Collections:
Molecule FYI-1000950
Molecule Summary:
ID: FYI-1000950
SMILES: CCCCCc3cc(O)c2C1C=C(C)CCC1C(C)(C)Oc2c3
Received at FYIcenter.com on: 2021-07-28
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000950 FYIcenter.com 23 25 0 0 0 0 0 0 0 0999 V2000 13.3368 6.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 5.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9119 6.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 5.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4870 6.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 5.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 6.1124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 5.4124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 6.1124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 3.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4248 4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 3.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 1.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4248 1.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 1.9124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 1.2124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1497 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5497 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 1.9124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 3.3124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2746 4.0124 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 1 0 0 0 0 10 8 2 0 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 2 0 0 0 0 14 13 1 0 0 0 0 15 13 1 0 0 0 0 16 15 1 0 0 0 0 17 16 1 0 0 0 0 17 11 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 18 1 0 0 0 0 21 18 1 0 0 0 0 22 21 1 0 0 0 0 22 10 1 0 0 0 0 23 22 2 0 0 0 0 23 6 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="492.86953392118" x2="515.40976696059" y1="377.61018985064" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="515.40976696059" x2="537.95" y1="390.62418121288" y2="403.63817257513" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="447.78534955911" x2="470.32744174015" y1="403.63817257513" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="470.32744174015" x2="492.86953392118" y1="390.62418121288" y2="377.61018985064" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="402.7048834803" x2="425.2451165197" y1="377.61018985064" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="425.2451165197" x2="447.78534955911" y1="390.62418121288" y2="403.63817257513" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="357.62069911823" x2="380.16279129926" y1="403.63817257513" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="380.16279129926" x2="402.7048834803" y1="390.62418121288" y2="377.61018985064" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="312.54023303941" x2="335.08046607882" y1="377.61018985064" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="335.08046607882" x2="357.62069911823" y1="390.62418121288" y2="403.63817257513" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="269" x2="291.5" y1="407" y2="393.5" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="291.5" x2="314" y1="393.5" y2="380" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="267" x2="289.5" y1="402" y2="389" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="289.5" x2="312" y1="389" y2="376" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="222.37558259852" x2="244.91767477956" y1="377.61018985064" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="244.91767477956" x2="267.45976696059" y1="390.62418121288" y2="403.63817257513" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="177.2951165197" x2="199.83534955911" y1="403.63817257513" y2="390.62418121288" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #ff0000" /> <line x1="199.83534955911" x2="222.37558259852" y1="390.62418121288" y2="377.61018985064" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="220" x2="220" y1="326" y2="352" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="220" x2="220" y1="352" y2="378" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="226" x2="226" y1="326" y2="352" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="226" x2="226" y1="352" y2="378" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="177.2951165197" x2="199.83534955911" y1="299.52624167716" y2="312.54023303941" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="199.83534955911" x2="222.37558259852" y1="312.54023303941" y2="325.55422440166" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="132.21093215764" x2="154.75302433867" y1="325.55422440166" y2="312.54023303941" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="154.75302433867" x2="177.2951165197" y1="312.54023303941" y2="299.52624167716" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="86" x2="108.5" y1="302" y2="315" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="108.5" x2="131" y1="315" y2="328" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="89" x2="111.5" y1="298" y2="311" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="111.5" x2="134" y1="311" y2="324" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="42.05" x2="64.59023303941" y1="325.55422440166" y2="312.54023303941" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="64.59023303941" x2="87.130466078819" y1="312.54023303941" y2="299.52624167716" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="87.130466078819" x2="87.130466078819" y1="247.47027622818" y2="273.49825895267" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="87.130466078819" x2="87.130466078819" y1="273.49825895267" y2="299.52624167716" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="132.21093215764" x2="109.67069911823" y1="221.44229350369" y2="234.45628486593" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="109.67069911823" x2="87.130466078819" y1="234.45628486593" y2="247.47027622818" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="177.2951165197" x2="154.75302433867" y1="247.47027622818" y2="234.45628486593" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="154.75302433867" x2="132.21093215764" y1="234.45628486593" y2="221.44229350369" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="177.2951165197" x2="177.2951165197" y1="247.47027622818" y2="273.49825895267" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="177.2951165197" x2="177.2951165197" y1="273.49825895267" y2="299.52624167716" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="222.37558259852" x2="199.83534955911" y1="221.44229350369" y2="234.45628486593" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="199.83534955911" x2="177.2951165197" y1="234.45628486593" y2="247.47027622818" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="196.34759987403" x2="209.36159123628" y1="176.36182742487" y2="198.90206046428" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="209.36159123628" x2="222.37558259852" y1="198.90206046428" y2="221.44229350369" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="248.40356532302" x2="235.38957396077" y1="176.36182742487" y2="198.90206046428" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="235.38957396077" x2="222.37558259852" y1="198.90206046428" y2="221.44229350369" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="267.45976696059" x2="244.91767477956" y1="247.47027622818" y2="234.45628486593" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #ff0000" /> <line x1="244.91767477956" x2="222.37558259852" y1="234.45628486593" y2="221.44229350369" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="267.45976696059" x2="267.45976696059" y1="299.52624167716" y2="273.49825895267" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="267.45976696059" x2="267.45976696059" y1="273.49825895267" y2="247.47027622818" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #ff0000" /> <line x1="267.45976696059" x2="244.91767477956" y1="299.52624167716" y2="312.54023303941" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="244.91767477956" x2="222.37558259852" y1="312.54023303941" y2="325.55422440166" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="314" x2="291.5" y1="324" y2="311" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="291.5" x2="269" y1="311" y2="298" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="312" x2="289.5" y1="328" y2="315" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="289.5" x2="267" y1="315" y2="302" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="312.54023303941" x2="312.54023303941" y1="325.55422440166" y2="351.58220712615" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <line x1="312.54023303941" x2="312.54023303941" y1="351.58220712615" y2="377.61018985064" style="stroke-opacity:1; stroke-width: 2.1918276484451; stroke: #000000" /> <ellipse cx="177.2951165197" cy="403.63817257513" rx="14.246879714893" ry="14.246879714893" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.2951165197" y="415.69322464158" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:27.397845605564px">O</text> <ellipse cx="267.45976696059" cy="247.47027622818" rx="14.246879714893" ry="14.246879714893" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="267.45976696059" y="259.52532829463" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:27.397845605564px">O</text> </g></svg>
✍: FYIcenter.com
2021-11-01, 241👍, 1💬
Popular Posts:
How to create a molecule structure with custom atom positions? You can create a molecule structure w...
What are examples of Enantiomers Isomers? The picture below gives an example of Enantiomers Isomers:...
How to run OpenBabelGUI on Windows computers? Open Babel GUI is the graphical user interface for Ope...
What information is displayed in each area on PyMol Screen? Once PyMol is started, you should see tw...
biotech.FYIcenter.com is a Website for biotech professionals looking for biotech resources, software...