Molecule FYI-1000948

A

Molecule Summary:

ID: FYI-1000948
SMILES: COC(=O)C1=CC=C(OCC2=CN(N=N2)C2=CC=C(Br)C=C2)C=C1

Received at FYIcenter.com on: 2021-07-27

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000948
FYIcenter.com

 24 26  0  0  0  0  0  0  0  0999 V2000
   17.4846    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.2722    3.7834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.0598    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.0598    5.8834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.8473    3.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6349    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4225    3.7834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4225    2.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.2101    1.6834    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.9975    2.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7851    1.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5062    2.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5693    1.2124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.2693    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.6388    0.2911    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.1770    1.3587    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6077    2.6377    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    2.7840    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3924    1.6514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.7977    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    0.3724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3541    0.2261    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6349    1.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8473    2.3834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 15 11  1  0  0  0  0
 16 13  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 19  1  0  0  0  0
 22 21  2  0  0  0  0
 22 16  1  0  0  0  0
 23  8  1  0  0  0  0
 24 23  2  0  0  0  0
 24  5  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="503.56378813356" x2="520.75689406678" y1="313.87238083799" y2="323.79911636526" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="520.75689406678" x2="537.95" y1="323.79911636526" y2="333.72585189252" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="469.17757626712" x2="486.37068220034" y1="333.72585189252" y2="323.79911636526" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="486.37068220034" x2="503.56378813356" y1="323.79911636526" y2="313.87238083799" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="472" x2="472" y1="374" y2="354" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="472" x2="472" y1="354" y2="334" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="468" x2="468" y1="374" y2="354" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="468" x2="468" y1="354" y2="334" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="434.78852819052" x2="451.98305222882" y1="313.87238083799" y2="323.79911636526" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="451.98305222882" x2="469.17757626712" y1="323.79911636526" y2="333.72585189252" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="402" x2="419" y1="336" y2="326" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="419" x2="436" y1="326" y2="316" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="400" x2="417" y1="332" y2="322.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="417" x2="434" y1="322.5" y2="313" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="366.01610445764" x2="383.20921039086" y1="313.87238083799" y2="323.79911636526" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="383.20921039086" x2="400.40231632408" y1="323.79911636526" y2="333.72585189252" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="364" x2="364" y1="275" y2="294.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="364" x2="364" y1="294.5" y2="314" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="369" x2="369" y1="275" y2="294.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="369" x2="369" y1="294.5" y2="314" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="331.62989259119" x2="348.82299852442" y1="254.31196767441" y2="264.23870320167" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="348.82299852442" x2="366.01610445764" y1="264.23870320167" y2="274.16543872894" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="297.23800830445" x2="314.43395044782" y1="274.16543872894" y2="264.23870320167" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="314.43395044782" x2="331.62989259119" y1="264.23870320167" y2="254.31196767441" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #ff0000" />
<line x1="262.85179643801" x2="280.04490237123" y1="254.31196767441" y2="264.23870320167" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="280.04490237123" x2="297.23800830445" y1="264.23870320167" y2="274.16543872894" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="228" x2="246" y1="273" y2="265" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="246" x2="264" y1="265" y2="257" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="226" x2="244.5" y1="269" y2="261" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="244.5" x2="263" y1="261" y2="253" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="200.00705191998" x2="213.29327837068" y1="240.95341786486" y2="255.70596496345" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="213.29327837068" x2="226.57950482139" y1="255.70596496345" y2="270.45851206204" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="219.8605229745" x2="209.93378744724" y1="206.56720599842" y2="223.76031193164" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="209.93378744724" x2="200.00705191998" y1="223.76031193164" y2="240.95341786486" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="260" x2="240.5" y1="213" y2="209" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="240.5" x2="221" y1="209" y2="205" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="259" x2="239.5" y1="217" y2="213" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="239.5" x2="220" y1="213" y2="209" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="258.70242098761" x2="260.77710871281" y1="214.82341374695" y2="234.56769071068" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="260.77710871281" x2="262.85179643801" y1="234.56769071068" y2="254.31196767441" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="160.51849799252" x2="180.26277495625" y1="245.10279331526" y2="243.02810559006" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="180.26277495625" x2="200.00705191998" y1="243.02810559006" y2="240.95341786486" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #0000ff" />
<line x1="147" x2="155" y1="283" y2="264.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="155" x2="163" y1="264.5" y2="246" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="143" x2="151" y1="281" y2="263" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="151" x2="159" y1="263" y2="245" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="104.87772725713" x2="124.62484043101" y1="285.52729659243" y2="283.45260886723" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="124.62484043101" x2="144.37195360489" y1="283.45260886723" y2="281.37792114203" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="80" x2="92" y1="255" y2="271" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="92" x2="104" y1="271" y2="287" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="84" x2="95.5" y1="253" y2="269" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="95.5" x2="107" y1="269" y2="285" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="42.05" x2="61.795695068803" y1="257.5537558766" y2="255.4790681514" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #db8802" />
<line x1="61.795695068803" x2="81.541390137607" y1="255.4790681514" y2="253.4043804262" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="97.69077073539" x2="89.616080436498" y1="217.12925259943" y2="235.26681651282" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="89.616080436498" x2="81.541390137607" y1="235.26681651282" y2="253.4043804262" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="137" x2="117.5" y1="211" y2="213.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="117.5" x2="98" y1="213.5" y2="216" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="138" x2="118" y1="216" y2="218" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="118" x2="98" y1="218" y2="220" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="137.17932466285" x2="148.84891132768" y1="212.97987714903" y2="229.04133523215" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="148.84891132768" x2="160.51849799252" y1="229.04133523215" y2="245.10279331526" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="400.40231632408" x2="383.20921039086" y1="254.31196767441" y2="264.23870320167" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="383.20921039086" x2="366.01610445764" y1="264.23870320167" y2="274.16543872894" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="436" x2="419" y1="273" y2="263" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="419" x2="402" y1="263" y2="253" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="434" x2="417" y1="276" y2="266.5" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="417" x2="400" y1="266.5" y2="257" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="434.78852819052" x2="434.78852819052" y1="274.16543872894" y2="294.01890978347" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<line x1="434.78852819052" x2="434.78852819052" y1="294.01890978347" y2="313.87238083799" style="stroke-opacity:1; stroke-width: 1.6718572073661; stroke: #000000" />
<ellipse cx="503.56378813356" cy="313.87238083799" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.56378813356" y="323.06759547851"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">O</text>
<ellipse cx="469.17757626712" cy="373.43279400158" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="469.17757626712" y="382.62800864209"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">O</text>
<ellipse cx="331.62989259119" cy="254.31196767441" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="331.62989259119" y="263.50718231492"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">O</text>
<ellipse cx="200.00705191998" cy="240.95341786486" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="200.00705191998" y="250.14863250538"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">N</text>
<ellipse cx="219.8605229745" cy="206.56720599842" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.8605229745" y="215.76242063894"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">N</text>
<ellipse cx="258.70242098761" cy="214.82341374695" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="258.70242098761" y="224.01862838747"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">N</text>
<ellipse cx="42.05" cy="257.5537558766" rx="10.86707184788" ry="10.86707184788" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="266.74897051711"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:20.898215092077px">Br</text>
</g></svg>

✍: FYIcenter.com

2021-09-09, 118👍, 0💬