Molecule FYI-1000943


Molecule Summary:

ID: FYI-1000943
SMILES: COc1ccc2c(c1)[NH]c1c2ccnc1C

Received at on: 2021-07-24

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 28 30  0  0  0  0  0  0  0  0999 V2000
    2.0000   -0.8013    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6720   -0.0608    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6493   -0.2724    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9712   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9917   -1.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6767   -0.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3677    0.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3523    0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1767    0.8518    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.1767    1.4718    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9857    0.2640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6767   -0.6871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3617   -1.4718    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3822   -1.2631    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7040   -0.2724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.0011    0.4963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2991    1.4508    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5409   -0.3847    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5834   -1.2605    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4591   -1.2179    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.5581   -1.7254    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1901   -2.0592    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1675    1.0881    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1633   -2.0592    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7952   -1.7254    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8909    1.2661    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4839    2.0427    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7073    1.6356    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  3  8  2  0  0  0  0
  7  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  1  0  0  0  0
 11 12  2  0  0  0  0
  6 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  2  0  0  0  0
 14 15  1  0  0  0  0
 15 16  2  0  0  0  0
 11 16  1  0  0  0  0
 16 17  1  0  0  0  0
  1 18  1  0  0  0  0
  1 19  1  0  0  0  0
  1 20  1  0  0  0  0
  4 21  1  0  0  0  0
  5 22  1  0  0  0  0
  8 23  1  0  0  0  0
 13 24  1  0  0  0  0
 14 25  1  0  0  0  0
 17 26  1  0  0  0  0
 17 27  1  0  0  0  0
 17 28  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="73.025195918367" x2="95.694910204082" y1="236.49340204082" y2="261.47394285714" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="95.694910204082" x2="118.3646244898" y1="261.47394285714" y2="286.45448367347" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #ff0000" />
<line x1="118.3646244898" x2="151.33354081633" y1="286.45448367347" y2="279.31622244898" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #ff0000" />
<line x1="151.33354081633" x2="184.30245714286" y1="279.31622244898" y2="272.17796122449" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="184.30245714286" x2="195.16165510204" y1="272.17796122449" y2="238.757" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="195.16165510204" x2="206.02085306122" y1="238.757" y2="205.33603877551" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="207" x2="241.5" y1="209" y2="202" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="241.5" x2="276" y1="202" y2="195" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="206" x2="240.5" y1="202" y2="195" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="240.5" x2="275" y1="195" y2="188" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="274.87336326531" x2="297.98162857143" y1="191.25517755102" y2="217.72679183673" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="297.98162857143" x2="321.08989387755" y1="217.72679183673" y2="244.19840612245" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="318" x2="307.5" y1="244" y2="276" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="307.5" x2="297" y1="276" y2="308" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="325" x2="314.5" y1="246" y2="278" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="314.5" x2="304" y1="278" y2="310" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="300.24185306122" x2="265.98764489796" y1="308.36854081633" y2="316.20511020408" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="265.98764489796" x2="231.73343673469" y1="316.20511020408" y2="324.04167959184" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="182" x2="206" y1="275" y2="301" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="206" x2="230" y1="301" y2="327" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="187" x2="211" y1="270" y2="296" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="211" x2="235" y1="296" y2="322" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="300.24185306122" x2="327.53322040816" y1="308.36854081633" y2="328.19779387755" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="327.53322040816" x2="354.8245877551" y1="328.19779387755" y2="348.02704693878" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="354.8245877551" x2="354.8245877551" y1="348.02704693878" y2="368.94255714286" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="354.8245877551" x2="354.8245877551" y1="368.94255714286" y2="389.85806734694" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #a4a4a4" />
<line x1="354.8245877551" x2="382.11595510204" y1="348.02704693878" y2="328.19779387755" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="382.11595510204" x2="409.40732244898" y1="328.19779387755" y2="308.36854081633" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="413" x2="403" y1="308" y2="276" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="403" x2="393" y1="276" y2="244" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="406" x2="396" y1="310" y2="278" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="396" x2="386" y1="278" y2="246" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="321.08989387755" x2="354.8245877551" y1="244.19840612245" y2="244.19840612245" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="354.8245877551" x2="388.55928163265" y1="244.19840612245" y2="244.19840612245" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="388.55928163265" x2="411.66754693878" y1="244.19840612245" y2="217.72679183673" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="411.66754693878" x2="434.7758122449" y1="217.72679183673" y2="191.25517755102" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="435" x2="469" y1="195" y2="202" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="469" x2="503" y1="202" y2="209" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="436" x2="470.5" y1="188" y2="195" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="470.5" x2="505" y1="195" y2="202" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="503.62832244898" x2="514.48414693878" y1="205.33603877551" y2="238.757" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="514.48414693878" x2="525.33997142857" y1="238.757" y2="272.17796122449" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="523" x2="499.5" y1="270" y2="296" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="499.5" x2="476" y1="296" y2="322" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="529" x2="505" y1="275" y2="301" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #0000ff" />
<line x1="505" x2="481" y1="301" y2="327" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="409.40732244898" x2="443.66153061224" y1="308.36854081633" y2="316.20511020408" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="443.66153061224" x2="477.91573877551" y1="316.20511020408" y2="324.04167959184" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="477.91573877551" x2="487.96867755102" y1="324.04167959184" y2="356.24144489796" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<line x1="487.96867755102" x2="498.02161632653" y1="356.24144489796" y2="388.44121020408" style="stroke-opacity:1; stroke-width: 2.9196812591426; stroke: #000000" />
<ellipse cx="118.3646244898" cy="286.45448367347" rx="18.977928184427" ry="18.977928184427" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="118.3646244898" y="302.51273059875"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:36.496015739283px">O</text>
<ellipse cx="354.8245877551" cy="348.02704693878" rx="18.977928184427" ry="18.977928184427" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="354.8245877551" y="364.08529386406"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.496015739283px">N</text>
<ellipse cx="354.8245877551" cy="389.85806734694" rx="18.977928184427" ry="18.977928184427" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="354.8245877551" y="405.91631427222"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:36.496015739283px">H</text>
<ellipse cx="525.33997142857" cy="272.17796122449" rx="18.977928184427" ry="18.977928184427" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="525.33997142857" y="288.23620814977"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.496015739283px">N</text>


2021-09-09, 238👍, 0💬