Molecule FYI-1000939


Molecule Summary:

ID: FYI-1000939
SMILES: N#CN1CCC(C(=O)Nc2ncc(-c3ccccc3)s2)C1

Received at on: 2021-07-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 21 23  0  0  0  0  0  0  0  0999 V2000
   12.6847    6.3987    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.2924    6.5450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9001    6.6913    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.2001    7.9037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8306    7.6127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6843    6.2204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4719    5.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4719    4.1204    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2594    6.2204    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0470    5.5204    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7681    6.0897    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.8312    5.0494    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5312    3.8370    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9618    2.5579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5695    2.4116    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.1326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8229    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2152    0.1464    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7847    1.4253    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9007    4.1281    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.9632    5.6510    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  3  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 14  1  0  0  0  0
 20 13  1  0  0  0  0
 20 10  1  0  0  0  0
 21  6  1  0  0  0  0
 21  3  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="485" x2="512" y1="398" y2="395" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="512" x2="539" y1="395" y2="392" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="483" x2="510.5" y1="386" y2="383" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="510.5" x2="538" y1="383" y2="380" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="483.51894762982" x2="510.73447381491" y1="391.37749296396" y2="388.51774184648" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="510.73447381491" x2="537.95" y1="388.51774184648" y2="385.65799072899" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="429.08789525964" x2="456.30342144473" y1="397.09699519894" y2="394.23724408145" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="456.30342144473" x2="483.51894762982" y1="394.23724408145" y2="391.37749296396" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="401.72185585784" x2="415.40487555874" y1="444.49497544286" y2="420.7959853209" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="415.40487555874" x2="429.08789525964" y1="420.7959853209" y2="397.09699519894" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="348.18215448532" x2="374.95200517158" y1="433.11852192011" y2="438.80674868148" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="374.95200517158" x2="401.72185585784" y1="438.80674868148" y2="444.49497544286" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="342.46265225035" x2="345.32240336784" y1="378.68746954993" y2="405.90299573502" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="345.32240336784" x2="348.18215448532" y1="405.90299573502" y2="433.11852192011" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="295.06467200643" x2="318.76366212839" y1="351.32143014813" y2="365.00444984903" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="318.76366212839" x2="342.46265225035" y1="365.00444984903" y2="378.68746954993" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="293" x2="293" y1="297" y2="324.5" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #ff0000" />
<line x1="293" x2="293" y1="324.5" y2="352" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="298" x2="298" y1="297" y2="324.5" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #ff0000" />
<line x1="298" x2="298" y1="324.5" y2="352" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="247.66278232832" x2="271.36372716737" y1="378.68746954993" y2="365.00444984903" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="271.36372716737" x2="295.06467200643" y1="365.00444984903" y2="351.32143014813" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="200.2648020844" x2="223.96379220636" y1="351.32143014813" y2="365.00444984903" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="223.96379220636" x2="247.66278232832" y1="365.00444984903" y2="378.68746954993" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="152" x2="177" y1="377" y2="365.5" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="177" x2="202" y1="365.5" y2="354" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="150" x2="175" y1="371" y2="360" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="175" x2="200" y1="360" y2="349" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="113.63955907511" x2="131.95330358621" y1="332.90799506492" y2="353.24291705756" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="131.95330358621" x2="150.26704809731" y1="353.24291705756" y2="373.57783905019" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<line x1="139" x2="125.5" y1="285" y2="308.5" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="125.5" x2="112" y1="308.5" y2="332" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="144" x2="130.5" y1="287" y2="311" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="130.5" x2="117" y1="311" y2="335" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="118.74528014064" x2="129.87543930877" y1="235.50444196552" y2="260.50722839326" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="129.87543930877" x2="141.00559847691" y1="260.50722839326" y2="285.510014821" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="65" x2="92" y1="233" y2="236" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="92" x2="119" y1="236" y2="239" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="65" x2="92.5" y1="227" y2="230" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="92.5" x2="120" y1="230" y2="233" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="42.05" x2="53.182113885232" y1="179.78327630925" y2="204.7841080199" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="53.182113885232" x2="64.314227770464" y1="204.7841080199" y2="229.78493973054" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="72" x2="56" y1="134" y2="156.5" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="56" x2="40" y1="156.5" y2="179" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="77" x2="61" y1="138" y2="160" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="61" x2="45" y1="160" y2="182" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="128.65178640409" x2="101.436260219" y1="141.22843622632" y2="138.36673039173" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="101.436260219" x2="74.220734033915" y1="138.36673039173" y2="135.50502455714" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="154" x2="143" y1="191" y2="166" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="143" x2="132" y1="166" y2="141" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="149" x2="138" y1="193" y2="168" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="138" x2="127" y1="168" y2="143" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="150.91601417456" x2="134.8306471576" y1="191.22619021341" y2="213.36531608946" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="134.8306471576" x2="118.74528014064" y1="213.36531608946" y2="235.50444196552" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="194.54529984942" x2="167.77544916317" y1="296.89037777795" y2="291.20019629948" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #c8aa1a" />
<line x1="167.77544916317" x2="141.00559847691" y1="291.20019629948" y2="285.510014821" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="194.54529984942" x2="197.40505096691" y1="296.89037777795" y2="324.10590396304" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #c8aa1a" />
<line x1="197.40505096691" x2="200.2648020844" y1="324.10590396304" y2="351.32143014813" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="392.46040623744" x2="367.46152924389" y1="356.42715121367" y2="367.5573103818" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="367.46152924389" x2="342.46265225035" y1="367.5573103818" y2="378.68746954993" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="392.46040623744" x2="410.77415074854" y1="356.42715121367" y2="376.7620732063" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #000000" />
<line x1="410.77415074854" x2="429.08789525964" y1="376.7620732063" y2="397.09699519894" style="stroke-opacity:1; stroke-width: 2.3045023465153; stroke: #0000ff" />
<ellipse cx="537.95" cy="385.65799072899" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="398.33275363482"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">N</text>
<ellipse cx="429.08789525964" cy="397.09699519894" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="429.08789525964" y="409.77175810477"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">N</text>
<ellipse cx="295.06467200643" cy="296.58935134453" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="295.06467200643" y="309.26411425037"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">O</text>
<ellipse cx="247.66278232832" cy="378.68746954993" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="247.66278232832" y="391.36223245576"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">N</text>
<ellipse cx="150.26704809731" cy="373.57783905019" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="150.26704809731" y="386.25260195603"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">N</text>
<ellipse cx="194.54529984942" cy="296.89037777795" rx="14.97926525235" ry="14.97926525235" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.54529984942" y="309.56514068379"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:28.806279331442px">S</text>


2021-08-13, 314👍, 0💬