Molecule FYI-1000941

A

Molecule Summary:

ID: FYI-1000941
SMILES: CC3=C(C2=CC6=NC(=CC1=C(C(=C4[N-]1[Fe](=N)[N-]2C3=CC5=NC(=C4)C(=C5C(C)S)C)C(C)S)C)C(=C6CCC(=O)O)C)CCC(=O)O

Received at FYIcenter.com on: 2021-07-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000941
FYIcenter.com

 83 88  0  0  0  0  0  0  0  0999 V2000
    6.1000   -2.8317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6886   -2.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6658   -2.0232    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9598   -1.0788    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9369   -0.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2294    0.1271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6428    0.8444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.1967    1.6270    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.9042    2.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9598    2.8329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6331    3.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6560    3.7446    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3618    2.8001    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1445    2.1809    0.0000 N   0  4  0  0  0  0  0  0  0  0  0  0
    7.1394    0.8174    0.0000 Fe  0  0  0  0  0  0  0  0  0  0  0  0
    8.0035    0.3141    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.1772   -0.4922    0.0000 N   0  4  0  0  0  0  0  0  0  0  0  0
    6.3945   -1.1115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4501   -0.8174    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1561    0.0944    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7099    0.8444    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1561    1.5943    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.4175    2.5387    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2116    1.3329    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2116    0.3559    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4157   -0.2496    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5421   -1.2416    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4934    0.1369    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4158    1.9384    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0632    4.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0694    4.4394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4644    5.4660    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    8.2087    4.5623    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1427    1.3655    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1427    0.3885    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9412   -0.2135    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8618    0.1770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6602   -0.4250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5381   -1.4175    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5808   -0.0345    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9384    1.9711    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2585   -2.8286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8575   -3.7447    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4502   -4.5500    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4441   -4.4393    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0492   -5.4661    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5988   -2.4667    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7350   -3.3329    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6012   -3.1966    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3667   -1.2642    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.3407    2.9790    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.0011   -0.3059    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0139   -1.2580    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9791    2.9771    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9223   -0.6250    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9271   -1.3199    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6205   -1.8566    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1572   -1.1632    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.2385    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7912    2.4318    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9224    2.3138    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0403    1.4450    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6958    5.0494    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0008    5.0556    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.4532    4.3709    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.1380    3.8232    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0969    5.9654    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7157    4.2054    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.5655    5.0693    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.7017    4.9192    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.4876   -0.6362    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.2787   -0.7336    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   12.3153    0.5997    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.5242    0.6971    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   14.0759   -0.4077    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.3139    1.4778    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   11.4318    2.3466    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
   10.5629    2.4645    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7747   -3.1721    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.6865   -2.3800    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.3413   -3.4011    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.4295   -4.1933    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.4167   -5.9654    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  3  0  0  0
  5  6  1  0  0  0  0
  6  7  2  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  3  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
 11 12  1  0  0  0  0
 12 13  2  0  0  0  0
 13 14  1  0  0  0  0
 10 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  2  0  0  0  0
 15 17  1  0  0  0  0
  4 17  1  0  0  0  0
 17 18  1  0  0  0  0
  2 18  1  0  0  0  0
 18 19  2  3  0  0  0
 19 20  1  0  0  0  0
 20 21  2  0  0  0  0
 21 22  1  0  0  0  0
 22 23  2  3  0  0  0
 13 23  1  0  0  0  0
 22 24  1  0  0  0  0
 24 25  2  0  0  0  0
 20 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 26 28  1  0  0  0  0
 24 29  1  0  0  0  0
 12 30  1  0  0  0  0
 30 31  1  0  0  0  0
 30 32  1  0  0  0  0
 11 33  1  0  0  0  0
  8 34  1  0  0  0  0
 34 35  2  0  0  0  0
  6 35  1  0  0  0  0
 35 36  1  0  0  0  0
 36 37  1  0  0  0  0
 37 38  1  0  0  0  0
 38 39  2  0  0  0  0
 38 40  1  0  0  0  0
 34 41  1  0  0  0  0
  3 42  1  0  0  0  0
 42 43  1  0  0  0  0
 43 44  1  0  0  0  0
 44 45  2  0  0  0  0
 44 46  1  0  0  0  0
  1 47  1  0  0  0  0
  1 48  1  0  0  0  0
  1 49  1  0  0  0  0
  5 50  1  0  0  0  0
  9 51  1  0  0  0  0
 16 52  1  0  0  0  0
 19 53  1  0  0  0  0
 23 54  1  0  0  0  0
 26 55  1  0  0  0  0
 27 56  1  0  0  0  0
 27 57  1  0  0  0  0
 27 58  1  0  0  0  0
 28 59  1  0  0  0  0
 29 60  1  0  0  0  0
 29 61  1  0  0  0  0
 29 62  1  0  0  0  0
 30 63  1  0  0  0  0
 31 64  1  0  0  0  0
 31 65  1  0  0  0  0
 31 66  1  0  0  0  0
 32 67  1  0  0  0  0
 33 68  1  0  0  0  0
 33 69  1  0  0  0  0
 33 70  1  0  0  0  0
 36 71  1  0  0  0  0
 36 72  1  0  0  0  0
 37 73  1  0  0  0  0
 37 74  1  0  0  0  0
 40 75  1  0  0  0  0
 41 76  1  0  0  0  0
 41 77  1  0  0  0  0
 41 78  1  0  0  0  0
 42 79  1  0  0  0  0
 42 80  1  0  0  0  0
 43 81  1  0  0  0  0
 43 82  1  0  0  0  0
 46 83  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="210.41757508757" x2="222.50308175788" y1="173.71549698159" y2="190.3161292326" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="222.50308175788" x2="234.58858842819" y1="190.3161292326" y2="206.91676148362" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="235" x2="255" y1="210" y2="210" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="255" x2="275" y1="210" y2="210" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="235" x2="255" y1="205" y2="205" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="255" x2="275" y1="205" y2="205" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="274.71756266614" x2="280.75415621196" y1="206.91676148362" y2="226.30777830224" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="280.75415621196" x2="286.79074975778" y1="226.30777830224" y2="245.69879512086" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<polygon points=" 307,252 289,240 286,252" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 307,252 326,263 329,251" fill-opacity="1"  style="fill:#000000" />
<line x1="326.91561746951" x2="332.92141206867" y1="256.43325466425" y2="275.82632474598" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="332.92141206867" x2="338.92720666783" y1="275.82632474598" y2="295.21939482771" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="338" x2="326" y1="294" y2="309" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="326" x2="314" y1="309" y2="324" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="341" x2="329" y1="297" y2="312" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="329" x2="317" y1="312" y2="327" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="314.83832385164" x2="326.21134822249" y1="324.6755074156" y2="340.74434452091" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="326.21134822249" x2="337.58437259335" y1="340.74434452091" y2="356.81318162621" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<polygon points=" 332,376 344,359 332,355" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 332,376 320,393 332,397" fill-opacity="1"  style="fill:#000000" />
<line x1="325.57278339503" x2="306.1817665764" y1="394.25238118898" y2="400.29308126102" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="306.1817665764" x2="286.79074975778" y1="400.29308126102" y2="406.33378133307" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="285" x2="278.5" y1="406" y2="425" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="278.5" x2="272" y1="425" y2="444" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="289" x2="282.5" y1="408" y2="426.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="282.5" x2="276" y1="426.5" y2="445" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="273.37472859166" x2="253.3122947358" y1="443.77298089583" y2="443.77298089583" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="253.3122947358" x2="233.24986087993" y1="443.77298089583" y2="443.77298089583" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="236" x2="230" y1="444" y2="424.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="230" x2="224" y1="424.5" y2="405" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="232" x2="226" y1="445" y2="425.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="226" x2="220" y1="425.5" y2="406" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="221.16846073585" x2="237.23935110427" y1="404.98684073237" y2="392.27303555015" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="237.23935110427" x2="253.31024147269" y1="392.27303555015" y2="379.55923036792" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="286.79074975778" x2="270.05049561523" y1="406.33378133307" y2="392.9465058505" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="270.05049561523" x2="253.31024147269" y1="392.9465058505" y2="379.55923036792" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="253.31024147269" x2="253.20552505403" y1="379.55923036792" y2="351.56298785184" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="253.20552505403" x2="253.10080863538" y1="351.56298785184" y2="323.56674533575" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="255" x2="272.5" y1="326" y2="315.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="272.5" x2="290" y1="315.5" y2="305" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="253" x2="270.5" y1="322" y2="312" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="270.5" x2="288" y1="312" y2="302" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="253.10080863538" x2="253.87694209127" y1="323.56674533575" y2="296.6772116364" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="253.87694209127" x2="254.65307554716" y1="296.6772116364" y2="269.78767793705" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="286.79074975778" x2="270.72191265247" y1="245.69879512086" y2="257.74323652895" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="270.72191265247" x2="254.65307554716" y1="257.74323652895" y2="269.78767793705" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="254.65307554716" x2="238.58218517874" y1="269.78767793705" y2="257.07181949171" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="238.58218517874" x2="222.51129481032" y1="257.07181949171" y2="244.35596104638" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="234.58858842819" x2="228.54994161926" y1="206.91676148362" y2="225.636361265" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="228.54994161926" x2="222.51129481032" y1="225.636361265" y2="244.35596104638" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<polygon points=" 204,251 225,251 221,239" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 204,251 182,251 186,263" fill-opacity="1"  style="fill:#000000" />
<line x1="183.72926117308" x2="177.69266762726" y1="256.43325466425" y2="275.15490770874" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="177.69266762726" x2="171.65607408143" y1="275.15490770874" y2="293.87656075324" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="170" x2="181.5" y1="296" y2="311" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="181.5" x2="193" y1="311" y2="326" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="174" x2="185.5" y1="293" y2="308.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="185.5" x2="197" y1="308.5" y2="324" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="194.39801629692" x2="183.02704518918" y1="324.6755074156" y2="340.07292748367" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="183.02704518918" x2="171.65607408143" y1="340.07292748367" y2="355.47034755174" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<polygon points=" 178,375 178,354 166,358" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 178,375 177,396 189,393" fill-opacity="1"  style="fill:#000000" />
<line x1="221.16846073585" x2="201.77949718033" y1="404.98684073237" y2="399.61961096067" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="201.77949718033" x2="182.39053362482" y1="399.61961096067" y2="394.25238118898" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="171.65607408143" x2="152.2630039997" y1="355.47034755174" y2="350.10311778004" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="152.2630039997" x2="132.86993391797" y1="350.10311778004" y2="344.73588800835" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="136" x2="136" y1="345" y2="325" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="136" x2="136" y1="325" y2="305" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="131" x2="131" y1="345" y2="325" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="131" x2="131" y1="325" y2="305" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="171.65607408143" x2="152.2630039997" y1="293.87656075324" y2="299.24584378804" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="152.2630039997" x2="132.86993391797" y1="299.24584378804" y2="304.61512682285" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="132.86993391797" x2="116.52801281892" y1="304.61512682285" y2="292.18261868681" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="116.52801281892" x2="100.18609171987" y1="292.18261868681" y2="279.75011055077" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="100.18609171987" x2="102.78141629195" y1="279.75011055077" y2="259.38174049139" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="102.78141629195" x2="105.37674086404" y1="259.38174049139" y2="239.01337043202" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="100.18609171987" x2="81.248846048742" y1="279.75011055077" y2="287.6859724741" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="81.248846048742" x2="62.311600377612" y1="287.6859724741" y2="295.62183439744" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #c8aa1a" />
<line x1="132.86993391797" x2="116.53006608203" y1="344.73588800835" y2="357.16839614439" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="116.53006608203" x2="100.19019824609" y1="357.16839614439" y2="369.60090428043" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="233.24986087993" x2="221.07811715897" y1="443.77298089583" y2="460.30996199041" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="221.07811715897" x2="208.906373438" y1="460.30996199041" y2="476.84694308499" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="208.906373438" x2="188.50104464264" y1="476.84694308499" y2="474.57603408442" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="188.50104464264" x2="168.09571584727" y1="474.57603408442" y2="472.30512508384" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="208.906373438" x2="217.14406503863" y1="476.84694308499" y2="495.65483318014" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="217.14406503863" x2="225.38175663926" y1="495.65483318014" y2="514.46272327528" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #c8aa1a" />
<line x1="273.37472859166" x2="285.19331105756" y1="443.77298089583" y2="460.56251335304" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="285.19331105756" x2="297.01189352346" y1="460.56251335304" y2="477.35204581025" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="337.58437259335" x2="357.00824162174" y1="356.81318162621" y2="351.44389859141" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="357.00824162174" x2="376.43211065014" y1="351.44389859141" y2="346.0746155566" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="379" x2="379" y1="347" y2="326.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="379" x2="379" y1="326.5" y2="306" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="375" x2="375" y1="347" y2="326.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="375" x2="375" y1="326.5" y2="306" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="338.92720666783" x2="357.67965865898" y1="295.21939482771" y2="300.58662459941" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="357.67965865898" x2="376.43211065014" y1="300.58662459941" y2="305.9538543711" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="376.43211065014" x2="392.82741659007" y1="305.9538543711" y2="293.59321044394" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="392.82741659007" x2="409.22272253" y1="293.59321044394" y2="281.23256651678" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="409.22272253" x2="428.12506272824" y1="281.23256651678" y2="289.25055896455" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="428.12506272824" x2="447.02740292649" y1="289.25055896455" y2="297.26855141232" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="447.02740292649" x2="463.42065560331" y1="297.26855141232" y2="284.90790748516" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="463.42065560331" x2="479.81390828013" y1="284.90790748516" y2="272.547263558" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="482" x2="479.5" y1="273" y2="252.5" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="479.5" x2="477" y1="252.5" y2="232" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="478" x2="475.5" y1="273" y2="253" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="475.5" x2="473" y1="253" y2="233" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="479.81390828013" x2="498.71624847837" y1="272.547263558" y2="280.56525600576" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="498.71624847837" x2="517.61858867662" y1="280.56525600576" y2="288.58324845353" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="376.43211065014" x2="392.76992522296" y1="346.0746155566" y2="358.50917695575" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="392.76992522296" x2="409.10773979579" y1="358.50917695575" y2="370.94373835491" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="274.71756266614" x2="286.88725312399" y1="206.91676148362" y2="190.37978038904" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="286.88725312399" x2="299.05694358184" y1="190.37978038904" y2="173.84279929446" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="299.05694358184" x2="290.82335850744" y1="173.84279929446" y2="155.0328559362" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="290.82335850744" x2="282.58977343304" y1="155.0328559362" y2="136.22291257794" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="282.58977343304" x2="294.75946389089" y1="136.22291257794" y2="119.68798474648" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="294.75946389089" x2="306.92915434874" y1="119.68798474648" y2="103.15305691501" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="307" x2="327.5" y1="106" y2="108" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="327.5" x2="348" y1="108" y2="110" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="308" x2="328" y1="102" y2="104" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="328" x2="348" y1="104" y2="106" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="306.92915434874" x2="298.69556927434" y1="103.15305691501" y2="84.343113556754" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #000000" />
<line x1="298.69556927434" x2="290.46198419994" y1="84.343113556754" y2="65.533170198495" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="288.58530171664" x2="288.53602340198" y1="302.8985988622" y2="290.16836757509" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #0000ff" />
<line x1="288.53602340198" x2="288.48674508732" y1="290.16836757509" y2="277.43813628798" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #a4a4a4" />
<line x1="62.311600377612" x2="52.180800188806" y1="295.62183439744" y2="287.9138846794" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #c8aa1a" />
<line x1="52.180800188806" x2="42.05" y1="287.9138846794" y2="280.20593496137" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #a4a4a4" />
<line x1="225.38175663926" x2="217.83601470698" y1="514.46272327528" y2="524.71671925074" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #c8aa1a" />
<line x1="217.83601470698" x2="210.2902727747" y1="524.71671925074" y2="534.97071522619" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #a4a4a4" />
<line x1="517.61858867662" x2="527.78429433831" y1="288.58324845353" y2="280.92047052394" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="527.78429433831" x2="537.95" y1="280.92047052394" y2="273.25769259434" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #a4a4a4" />
<line x1="290.46198419994" x2="298.00772613221" y1="65.533170198495" y2="55.28122748615" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #ff0000" />
<line x1="298.00772613221" x2="305.55346806449" y1="55.28122748615" y2="45.029284773806" style="stroke-opacity:1; stroke-width: 1.7065921959395; stroke: #a4a4a4" />
<ellipse cx="314.83832385164" cy="324.6755074156" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="314.83832385164" y="334.06176449326"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">N</text>
<ellipse cx="253.31024147269" cy="379.55923036792" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="253.31024147269" y="388.94548744559"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">N<tspan baseline-shift='super' font-size='10.666201224622'>**</tspan></text>
<ellipse cx="253.10080863538" cy="323.56674533575" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="253.10080863538" y="332.95300241342"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">Fe</text>
<ellipse cx="288.58530171664" cy="302.8985988622" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="288.58530171664" y="312.28485593986"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">N</text>
<ellipse cx="254.65307554716" cy="269.78767793705" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.65307554716" y="279.17393501472"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">N<tspan baseline-shift='super' font-size='10.666201224622'>**</tspan></text>
<ellipse cx="194.39801629692" cy="324.6755074156" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.39801629692" y="334.06176449326"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">N</text>
<ellipse cx="62.311600377612" cy="295.62183439744" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="62.311600377612" y="305.0080914751"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">S</text>
<ellipse cx="225.38175663926" cy="514.46272327528" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.38175663926" y="523.84898035295"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">S</text>
<ellipse cx="474.7998397635" cy="231.78999080814" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="474.7998397635" y="241.17624788581"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">O</text>
<ellipse cx="517.61858867662" cy="288.58324845353" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="517.61858867662" y="297.9695055312"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">O</text>
<ellipse cx="347.7439184657" cy="107.69898144238" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="347.7439184657" y="117.08523852004"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">O</text>
<ellipse cx="290.46198419994" cy="65.533170198495" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.46198419994" y="74.919427276162"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">O</text>
<ellipse cx="288.48674508732" cy="277.43813628798" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="288.48674508732" y="286.82439336565"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">H</text>
<ellipse cx="42.05" cy="280.20593496137" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="289.59219203904"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">H</text>
<ellipse cx="210.2902727747" cy="534.97071522619" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="210.2902727747" y="544.35697230386"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">H</text>
<ellipse cx="537.95" cy="273.25769259434" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="282.64394967201"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">H</text>
<ellipse cx="305.55346806449" cy="45.029284773806" rx="11.092849273607" ry="11.092849273607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.55346806449" y="54.415541851473"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:21.332402449244px">H</text>
</g></svg>

✍: FYIcenter.com

2021-09-09, 120👍, 0💬