Molecule FYI-1000957


Molecule Summary:

ID: FYI-1000957
SMILES: CC(C)Cc1ccc(C[NH2+]C(C)CC(N)=O)cc1

Received at on: 2021-08-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 18 18  0  0  0  0  0  0  0  0999 V2000
   12.1244    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 11  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 14  2  0  0  0  0
 17  8  1  0  0  0  0
 18 17  2  0  0  0  0
 18  5  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.35754594042" x2="513.15377297021" y1="189.79256705486" y2="175.47721949127" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="513.15377297021" x2="537.95" y1="175.47721949127" y2="161.16187192768" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="438.76918198014" x2="463.56336396028" y1="161.16187192768" y2="175.47721949127" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="463.56336396028" x2="488.35754594042" y1="175.47721949127" y2="189.79256705486" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="488.35754594042" x2="488.35754594042" y1="247.05395730923" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="488.35754594042" x2="488.35754594042" y1="218.42326218205" y2="189.79256705486" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="438.76918198014" x2="463.56336396028" y1="275.68465243641" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="463.56336396028" x2="488.35754594042" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="442" x2="442" y1="333" y2="304.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="442" x2="442" y1="304.5" y2="276" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="436" x2="436" y1="333" y2="304.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="436" x2="436" y1="304.5" y2="276" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="389.18081801986" x2="413.975" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="413.975" x2="438.76918198014" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="339" x2="363.5" y1="336" y2="350.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="363.5" x2="388" y1="350.5" y2="365" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="342" x2="366.5" y1="331" y2="345" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="366.5" x2="391" y1="345" y2="359" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="289.9959099007" x2="314.79418198014" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="314.79418198014" x2="339.59245405958" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="240.40754594042" x2="265.20172792056" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #0000ff" />
<line x1="265.20172792056" x2="289.9959099007" y1="347.26139025436" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="190.81918198014" x2="215.61336396028" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="215.61336396028" x2="240.40754594042" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #0000ff" />
<line x1="190.81918198014" x2="190.81918198014" y1="418.83812807232" y2="390.20743294514" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="390.20743294514" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="141.23081801986" x2="166.025" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="166.025" x2="190.81918198014" y1="347.26139025436" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="91.638363960278" x2="116.43459099007" y1="361.57673781795" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="116.43459099007" x2="141.23081801986" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="91.638363960278" x2="91.638363960278" y1="418.83812807232" y2="390.20743294514" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #0000ff" />
<line x1="91.638363960278" x2="91.638363960278" y1="390.20743294514" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="41" x2="66" y1="336" y2="350.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #ff0000" />
<line x1="66" x2="91" y1="350.5" y2="365" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="44" x2="69" y1="331" y2="345" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #ff0000" />
<line x1="69" x2="94" y1="345" y2="359" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="339.59245405958" x2="339.59245405958" y1="275.68465243641" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="339.59245405958" x2="339.59245405958" y1="304.31534756359" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="388" x2="363.5" y1="245" y2="259.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="363.5" x2="339" y1="259.5" y2="274" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="391" x2="366.5" y1="250" y2="264.5" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="366.5" x2="342" y1="264.5" y2="279" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="389.18081801986" x2="413.975" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<line x1="413.975" x2="438.76918198014" y1="261.36930487282" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4110106302299; stroke: #000000" />
<ellipse cx="240.40754594042" cy="332.94604269077" rx="15.671569096495" ry="15.671569096495" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.40754594042" y="346.20660115704"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137632877874px">N<tspan baseline-shift='super' font-size='15.068816438937'>+</tspan></text>
<ellipse cx="91.638363960278" cy="418.83812807232" rx="15.671569096495" ry="15.671569096495" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="91.638363960278" y="432.09868653858"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137632877874px">N</text>
<ellipse cx="42.05" cy="332.94604269077" rx="15.671569096495" ry="15.671569096495" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="346.20660115704"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137632877874px">O</text>


2021-08-13, 296👍, 0💬