Collections:
Molecule FYI-1000962
Molecule Summary:
ID: FYI-1000962
SMILES: CCCc1ccccc1NCC(C)c1ccc(N[SH](C)(=O)Nc2cccnc2C(N)=O)cn1
Received at FYIcenter.com on: 2021-08-19
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000962 FYIcenter.com 33 35 0 0 0 0 0 0 0 0999 V2000 9.6995 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3369 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5493 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7617 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7617 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5493 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3369 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 9.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 10.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 8.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 4.9000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 5.5497 3.6876 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2497 4.9000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 4.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 0.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 4.2000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 7.0000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 9 4 1 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 14 12 1 0 0 0 0 15 14 2 0 0 0 0 16 15 1 0 0 0 0 17 16 2 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 19 2 0 0 0 0 22 19 1 0 0 0 0 23 22 1 0 0 0 0 24 23 2 0 0 0 0 25 24 1 0 0 0 0 26 25 2 0 0 0 0 27 26 1 0 0 0 0 28 27 2 0 0 0 0 28 23 1 0 0 0 0 29 28 1 0 0 0 0 30 29 1 0 0 0 0 31 29 2 0 0 0 0 32 17 1 0 0 0 0 33 32 2 0 0 0 0 33 14 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="385.36707874151" x2="366.29303374636" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="366.29303374636" x2="347.21898875121" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="423.51202249757" x2="404.43955061954" y1="323.03545937304" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="404.43955061954" x2="385.36707874151" y1="334.04727916405" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="461.66011248787" x2="442.58606749272" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="442.58606749272" x2="423.51202249757" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="499" x2="480" y1="322" y2="333" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="480" x2="461" y1="333" y2="344" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="501" x2="482" y1="326" y2="337" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="482" x2="463" y1="337" y2="348" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="537.95" x2="518.87752812197" y1="345.05909895506" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="518.87752812197" x2="499.80505624393" y1="334.04727916405" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="541" x2="541" y1="390" y2="368" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="541" x2="541" y1="368" y2="346" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="536" x2="536" y1="390" y2="368" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="536" x2="536" y1="368" y2="346" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="499.80505624393" x2="518.87752812197" y1="411.13001770114" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="518.87752812197" x2="537.95" y1="400.11819791012" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="461" x2="480" y1="392" y2="403" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="480" x2="499" y1="403" y2="414" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="463" x2="482" y1="388" y2="399" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="482" x2="501" y1="399" y2="410" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="461.66011248787" x2="461.66011248787" y1="389.10637811911" y2="367.08273853709" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="461.66011248787" x2="461.66011248787" y1="367.08273853709" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="423.51202249757" x2="442.58606749272" y1="411.13001770114" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="442.58606749272" x2="461.66011248787" y1="400.11819791012" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="385.36707874151" x2="404.43955061954" y1="389.10637811911" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="404.43955061954" x2="423.51202249757" y1="400.11819791012" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="347.21898875121" x2="366.29303374636" y1="411.13001770114" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="366.29303374636" x2="385.36707874151" y1="400.11819791012" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="347.21898875121" x2="347.21898875121" y1="455.17729686519" y2="433.15365728316" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="347.21898875121" x2="347.21898875121" y1="433.15365728316" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="309.07404499515" x2="328.14651687318" y1="389.10637811911" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="328.14651687318" x2="347.21898875121" y1="400.11819791012" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="273" x2="292" y1="414" y2="403" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="292" x2="311" y1="403" y2="392" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="270" x2="289" y1="410" y2="399" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="289" x2="308" y1="399" y2="388" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="232.78101124879" x2="251.85505624393" y1="389.10637811911" y2="400.11819791012" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="251.85505624393" x2="270.92910123908" y1="400.11819791012" y2="411.13001770114" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="231" x2="231" y1="346" y2="368" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="231" x2="231" y1="368" y2="390" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="236" x2="236" y1="346" y2="368" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="236" x2="236" y1="368" y2="390" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="194.63606749272" x2="213.70853937075" y1="323.03545937304" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="213.70853937075" x2="232.78101124879" y1="334.04727916405" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="194.63606749272" x2="194.63606749272" y1="278.98818020899" y2="301.01181979101" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #c8aa1a" /> <line x1="194.63606749272" x2="194.63606749272" y1="301.01181979101" y2="323.03545937304" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="216.65656084052" x2="205.64631416662" y1="240.84323645292" y2="259.91570833095" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="205.64631416662" x2="194.63606749272" y1="259.91570833095" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #c8aa1a" /> <line x1="239" x2="217" y1="277" y2="277" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #ff0000" /> <line x1="217" x2="195" y1="277" y2="277" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #c8aa1a" /> <line x1="239" x2="217" y1="282" y2="282" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #ff0000" /> <line x1="217" x2="195" y1="282" y2="282" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #c8aa1a" /> <line x1="156.48797750243" x2="175.56202249757" y1="256.96454062696" y2="267.97636041798" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="175.56202249757" x2="194.63606749272" y1="267.97636041798" y2="278.98818020899" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #c8aa1a" /> <line x1="156.48797750243" x2="156.48797750243" y1="212.91726146291" y2="234.94090104494" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="156.48797750243" x2="156.48797750243" y1="234.94090104494" y2="256.96454062696" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="194" x2="175" y1="189" y2="200" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="175" x2="156" y1="200" y2="211" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="196" x2="177" y1="193" y2="204" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="177" x2="158" y1="204" y2="215" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="194.63606749272" x2="194.63606749272" y1="146.84634271684" y2="168.86998229886" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="194.63606749272" x2="194.63606749272" y1="168.86998229886" y2="190.89362188089" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="156" x2="175" y1="127" y2="138" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="175" x2="194" y1="138" y2="149" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="158" x2="177" y1="123" y2="134" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="177" x2="196" y1="134" y2="145" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="118.34303374636" x2="137.41550562439" y1="146.84634271684" y2="135.83452292583" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="137.41550562439" x2="156.48797750243" y1="135.83452292583" y2="124.82270313481" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="121" x2="121" y1="191" y2="169" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="121" x2="121" y1="169" y2="147" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="117" x2="117" y1="191" y2="169" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="117" x2="117" y1="169" y2="147" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="118.34303374636" x2="137.41550562439" y1="190.89362188089" y2="201.9054416719" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="137.41550562439" x2="156.48797750243" y1="201.9054416719" y2="212.91726146291" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="80.198089990293" x2="99.270561868326" y1="212.91726146291" y2="201.9054416719" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="99.270561868326" x2="118.34303374636" y1="201.9054416719" y2="190.89362188089" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="42.05" x2="61.124044995146" y1="190.89362188089" y2="201.9054416719" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="61.124044995146" x2="80.198089990293" y1="201.9054416719" y2="212.91726146291" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="83" x2="83" y1="257" y2="235" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #ff0000" /> <line x1="83" x2="83" y1="235" y2="213" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="78" x2="78" y1="257" y2="235" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #ff0000" /> <line x1="78" x2="78" y1="235" y2="213" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="270.92910123908" x2="251.85505624393" y1="323.03545937304" y2="334.04727916405" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="251.85505624393" x2="232.78101124879" y1="334.04727916405" y2="345.05909895506" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="311" x2="292" y1="344" y2="333" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="292" x2="273" y1="333" y2="322" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="308" x2="289" y1="348" y2="337" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="289" x2="270" y1="337" y2="326" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <line x1="309.07404499515" x2="309.07404499515" y1="345.05909895506" y2="367.08273853709" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #0000ff" /> <line x1="309.07404499515" x2="309.07404499515" y1="367.08273853709" y2="389.10637811911" style="stroke-opacity:1; stroke-width: 1.8546294350283; stroke: #000000" /> <ellipse cx="423.51202249757" cy="411.13001770114" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="423.51202249757" y="421.33047959379" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> <ellipse cx="194.63606749272" cy="323.03545937304" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.63606749272" y="333.23592126569" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> <ellipse cx="194.63606749272" cy="278.98818020899" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="194.63606749272" y="289.18864210164" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">S</text> <ellipse cx="238.68020042254" cy="278.98818020899" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="238.68020042254" y="289.18864210164" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">O</text> <ellipse cx="156.48797750243" cy="256.96454062696" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.48797750243" y="267.16500251962" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> <ellipse cx="118.34303374636" cy="146.84634271684" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="118.34303374636" y="157.04680460949" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> <ellipse cx="42.05" cy="190.89362188089" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="201.09408377354" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> <ellipse cx="80.198089990293" cy="256.96454062696" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="80.198089990293" y="267.16500251962" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">O</text> <ellipse cx="309.07404499515" cy="345.05909895506" rx="12.055091327684" ry="12.055091327684" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="309.07404499515" y="355.25956084772" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:23.182867937853px">N</text> </g></svg>
✍: FYIcenter.com
2021-11-13, 183👍, 0💬
Popular Posts:
How to display the InChi string and InChi Key of the molecule in JSME editor? JSME does not offer an...
What is pubchem.ncbi.nlm.nih.gov Molecule Database? pubchem.ncbi.nlm.nih.gov Molecule Database is th...
What is JSME JavaScript API? I want to see an example on how to use it. JSME JavaScript API is progr...
Where to find FAQ (Frequently Asked Questions) on JSME, Molecule Editor in JavaScript? I want to lea...
What is chem.nlm.nih.gov ChemIDplus Database? chem.nlm.nih.gov ChemIDplus Database contains over 108...