Molecule FYI-1000954

A

Molecule Summary:

ID: FYI-1000954
SMILES: CC(C(C(=O)OC)C(=O)OC)C(C(=O)O)NC(=O)C(CC1=CC(=CC=C1)F)NC(=O)C

Received at FYIcenter.com on: 2021-07-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000954
FYIcenter.com

 31 31  0  0  0  0  0  0  0  0999 V2000
   10.9119    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  3  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  1  0  0  0  0
 12  2  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 12  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 17  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26 21  1  0  0  0  0
 27 23  1  0  0  0  0
 28 19  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 29  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="438.77245407982" x2="463.56684055987" y1="261.36906872974" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="463.56684055987" x2="488.36122703991" y1="247.05360309461" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="438.77245407982" x2="438.77245407982" y1="318.63093127026" y2="290" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="438.77245407982" x2="438.77245407982" y1="290" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="488.36122703991" x2="463.56684055987" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="463.56684055987" x2="438.77245407982" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="537" x2="512" y1="317" y2="331" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="512" x2="487" y1="331" y2="345" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="540" x2="515" y1="322" y2="336" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="515" x2="490" y1="336" y2="350" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="488.36122703991" x2="488.36122703991" y1="404.52372508104" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="488.36122703991" x2="488.36122703991" y1="375.89279381078" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="537.95" x2="513.15561351996" y1="433.15465635129" y2="418.83919071617" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="513.15561351996" x2="488.36122703991" y1="418.83919071617" y2="404.52372508104" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="389.18368111973" x2="413.97806759978" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="413.97806759978" x2="438.77245407982" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="393" x2="393" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="393" x2="393" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="387" x2="387" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="387" x2="387" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="339.58672789357" x2="364.38520450665" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="364.38520450665" x2="389.18368111973" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="289.99795493348" x2="314.79234141352" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="314.79234141352" x2="339.58672789357" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="389.18368111973" x2="413.97806759978" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="413.97806759978" x2="438.77245407982" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="389.18368111973" x2="389.18368111973" y1="175.47627491896" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="389.18368111973" x2="389.18368111973" y1="204.10720618922" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="339" x2="363.5" y1="150" y2="164.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="363.5" x2="388" y1="164.5" y2="179" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="342" x2="366.5" y1="145" y2="159" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="366.5" x2="391" y1="159" y2="173" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="438.77245407982" x2="413.97806759978" y1="146.84534364871" y2="161.16080928383" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="413.97806759978" x2="389.18368111973" y1="161.16080928383" y2="175.47627491896" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="339.58672789357" x2="364.38520450665" y1="261.36906872974" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #0000ff" />
<line x1="364.38520450665" x2="389.18368111973" y1="247.05360309461" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="289.99795493348" x2="314.79234141352" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="314.79234141352" x2="339.58672789357" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #0000ff" />
<line x1="287" x2="287" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="287" x2="287" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="294" x2="294" y1="176" y2="204.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="294" x2="294" y1="204.5" y2="233" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="240.40918197339" x2="265.20356845344" y1="261.36906872974" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="265.20356845344" x2="289.99795493348" y1="247.05360309461" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="240.40918197339" x2="240.40918197339" y1="318.63093127026" y2="290" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="240.40918197339" x2="240.40918197339" y1="290" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="215.61479549335" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="215.61479549335" x2="240.40918197339" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="140" x2="165" y1="322" y2="336" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="165" x2="190" y1="336" y2="350" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="143" x2="168" y1="317" y2="331" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="168" x2="193" y1="331" y2="345" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="91.638772960088" x2="116.43315944013" y1="347.26186254052" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="116.43315944013" x2="141.22754592018" y1="332.94639690539" y2="318.63093127026" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="95" x2="95" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="95" x2="95" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="89" x2="89" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="89" x2="89" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="141.22754592018" x2="116.43315944013" y1="433.15465635129" y2="418.83919071617" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="116.43315944013" x2="91.638772960088" y1="418.83919071617" y2="404.52372508104" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190" x2="165" y1="402" y2="416.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="165" x2="140" y1="416.5" y2="431" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="193" x2="168" y1="408" y2="422" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="168" x2="143" y1="422" y2="436" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="404.52372508104" y2="375.89279381078" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="375.89279381078" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="42.05" x2="66.844386480044" y1="318.63093127026" y2="332.94639690539" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #00bc00" />
<line x1="66.844386480044" x2="91.638772960088" y1="332.94639690539" y2="347.26186254052" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="215.61479549335" y1="232.73813745948" y2="247.05360309461" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #0000ff" />
<line x1="215.61479549335" x2="240.40918197339" y1="247.05360309461" y2="261.36906872974" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="175.47627491896" y2="204.10720618922" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="190.8204090133" x2="190.8204090133" y1="204.10720618922" y2="232.73813745948" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #0000ff" />
<line x1="239" x2="214.5" y1="145" y2="159" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="214.5" x2="190" y1="159" y2="173" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="242" x2="217.5" y1="150" y2="164.5" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #ff0000" />
<line x1="217.5" x2="193" y1="164.5" y2="179" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="141.22754592018" x2="166.02397746674" y1="146.84534364871" y2="161.16080928383" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<line x1="166.02397746674" x2="190.8204090133" y1="161.16080928383" y2="175.47627491896" style="stroke-opacity:1; stroke-width: 2.4110172885108; stroke: #000000" />
<ellipse cx="537.95" cy="318.63093127026" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="331.89152635707"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="488.36122703991" cy="404.52372508104" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.36122703991" y="417.78432016784"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="389.18368111973" cy="404.52372508104" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="389.18368111973" y="417.78432016784"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="339.58672789357" cy="318.63093127026" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58672789357" y="331.89152635707"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="339.58672789357" cy="146.84534364871" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58672789357" y="160.10593873551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="438.77245407982" cy="146.84534364871" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="438.77245407982" y="160.10593873551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="339.58672789357" cy="261.36906872974" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58672789357" y="274.62966381655"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">N</text>
<ellipse cx="289.99795493348" cy="175.47627491896" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="289.99795493348" y="188.73687000577"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
<ellipse cx="42.05" cy="318.63093127026" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="331.89152635707"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">F</text>
<ellipse cx="190.8204090133" cy="232.73813745948" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.8204090133" y="245.99873254629"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">N</text>
<ellipse cx="240.40918197339" cy="146.84534364871" rx="15.67161237532" ry="15.67161237532" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.40918197339" y="160.10593873551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137716106385px">O</text>
</g></svg>

✍: FYIcenter.com

2021-11-13, 283👍, 0💬