Molecule FYI-1000951

A

Molecule Summary:

ID: FYI-1000951
SMILES: CCCCCC1=CC(=C(C(=C1)O)C2C=C(CCC2C(=C)C)C)O

Received at FYIcenter.com on: 2021-07-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000951
FYIcenter.com

 23 24  0  0  0  0  0  0  0  0999 V2000
   13.1271    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9338    5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7404    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5471    5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3536    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1603    5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9669    6.2009    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7735    5.5119    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7735    4.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9669    3.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1603    4.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1264    1.8491    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.5801    3.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3868    4.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1935    3.4450    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1935    2.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3868    1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5801    2.0670    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7735    1.3780    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7735    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1296    2.3707    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.1340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5801    6.2009    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  6  1  0  0  0  0
 12 10  1  0  0  0  0
 13  9  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 18 13  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 19  1  0  0  0  0
 22 15  1  0  0  0  0
 23  8  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="492.87092922275" x2="515.41046461138" y1="381.09689535389" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="515.41046461138" x2="537.95" y1="394.11100738168" y2="407.12511940947" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="447.78808076422" x2="470.32950499349" y1="407.12511940947" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="470.32950499349" x2="492.87092922275" y1="394.11100738168" y2="381.09689535389" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="402.70900998697" x2="425.2485453756" y1="381.09689535389" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="425.2485453756" x2="447.78808076422" y1="394.11100738168" y2="407.12511940947" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="357.62238384716" x2="380.16569691706" y1="407.12511940947" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="380.16569691706" x2="402.70900998697" y1="394.11100738168" y2="381.09689535389" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="312.54331306991" x2="335.08284845853" y1="381.09689535389" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="335.08284845853" x2="357.62238384716" y1="394.11100738168" y2="407.12511940947" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="269" x2="291.5" y1="410" y2="397" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="291.5" x2="314" y1="397" y2="384" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="267" x2="289.5" y1="405" y2="392" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="289.5" x2="312" y1="392" y2="379" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="222.37761615284" x2="244.91904038211" y1="381.09689535389" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="244.91904038211" x2="267.46046461138" y1="394.11100738168" y2="407.12511940947" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="220" x2="220" y1="330" y2="356" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="220" x2="220" y1="356" y2="382" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="226" x2="226" y1="330" y2="356" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="226" x2="226" y1="356" y2="382" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="267.46046461138" x2="244.91904038211" y1="303.01600086843" y2="316.03011289622" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="244.91904038211" x2="222.37761615284" y1="316.03011289622" y2="329.04422492401" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="314" x2="291.5" y1="327" y2="314" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="291.5" x2="269" y1="314" y2="301" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="312" x2="289.5" y1="332" y2="319" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="289.5" x2="267" y1="319" y2="306" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="312.54331306991" x2="312.54331306991" y1="329.04422492401" y2="355.07056013895" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="312.54331306991" x2="312.54331306991" y1="355.07056013895" y2="381.09689535389" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="273.4858662614" x2="270.47316543639" y1="242.72798523665" y2="272.87199305254" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #ff0000" />
<line x1="270.47316543639" x2="267.46046461138" y1="272.87199305254" y2="303.01600086843" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="177.29476769431" x2="199.83619192358" y1="303.01600086843" y2="316.03011289622" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="199.83619192358" x2="222.37761615284" y1="316.03011289622" y2="329.04422492401" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="132.21569691706" x2="154.75523230569" y1="329.04422492401" y2="316.03011289622" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="154.75523230569" x2="177.29476769431" y1="316.03011289622" y2="303.01600086843" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="86" x2="108.5" y1="306" y2="319" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="108.5" x2="131" y1="319" y2="332" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="89" x2="111.5" y1="301" y2="314" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="111.5" x2="134" y1="314" y2="327" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="87.136626139818" x2="87.136626139818" y1="250.95955275727" y2="276.98777681285" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="87.136626139818" x2="87.136626139818" y1="276.98777681285" y2="303.01600086843" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="132.21569691706" x2="109.67616152844" y1="224.93132870169" y2="237.94544072948" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="109.67616152844" x2="87.136626139818" y1="237.94544072948" y2="250.95955275727" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="177.29476769431" x2="154.75523230569" y1="250.95955275727" y2="237.94544072948" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="154.75523230569" x2="132.21569691706" y1="237.94544072948" y2="224.93132870169" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="177.29476769431" x2="177.29476769431" y1="250.95955275727" y2="276.98777681285" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="177.29476769431" x2="177.29476769431" y1="276.98777681285" y2="303.01600086843" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="222.37761615284" x2="199.83619192358" y1="224.93132870169" y2="237.94544072948" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="199.83619192358" x2="177.29476769431" y1="237.94544072948" y2="250.95955275727" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="220" x2="220" y1="173" y2="199" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="220" x2="220" y1="199" y2="225" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="226" x2="226" y1="173" y2="199" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="226" x2="226" y1="199" y2="225" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="273.60675206253" x2="247.99218410769" y1="262.43237082067" y2="243.68184976118" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="247.99218410769" x2="222.37761615284" y1="243.68184976118" y2="224.93132870169" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="42.05" x2="64.593313069909" y1="329.04422492401" y2="316.03011289622" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="64.593313069909" x2="87.136626139818" y1="316.03011289622" y2="303.01600086843" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<line x1="177.29476769431" x2="199.83619192358" y1="407.12511940947" y2="394.11100738168" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #ff0000" />
<line x1="199.83619192358" x2="222.37761615284" y1="394.11100738168" y2="381.09689535389" style="stroke-opacity:1; stroke-width: 2.2137006707686; stroke: #000000" />
<ellipse cx="273.4858662614" cy="242.72798523665" rx="14.389054359996" ry="14.389054359996" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="273.4858662614" y="254.90333892588"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.671258384608px">O</text>
<ellipse cx="177.29476769431" cy="407.12511940947" rx="14.389054359996" ry="14.389054359996" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.29476769431" y="419.30047309869"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.671258384608px">O</text>
</g></svg>

✍: FYIcenter.com

2021-11-01, 163👍, 1💬