Molecule FYI-1000959


Molecule Summary:

ID: FYI-1000959
SMILES: ZINC13377938 (Gingerenone B) COc1cc(CCC(=O)/C=C/CCc2cc(OC)c(O)c(OC)c2)ccc1O

Received at on: 2021-08-15

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 28 29  0  0  0  0  0  0  0  0999 V2000
   19.3990    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.9000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 16  2  0  0  0  0
 20 19  1  0  0  0  0
 21 19  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 21  2  0  0  0  0
 24 14  1  0  0  0  0
 25  5  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 27  3  1  0  0  0  0
 28 27  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="506.957208619" x2="522.4536043095" y1="334.73555337904" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="522.4536043095" x2="537.95" y1="325.78844270323" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="475.964417238" x2="491.4608129285" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="491.4608129285" x2="506.957208619" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="446" x2="461.5" y1="337" y2="328" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="461.5" x2="477" y1="328" y2="319" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="445" x2="460.5" y1="334" y2="325" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="460.5" x2="476" y1="325" y2="316" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="413.97372184133" x2="429.47011753183" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="429.47011753183" x2="444.96651322233" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="382.98093046033" x2="398.47732615083" y1="334.73555337904" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="398.47732615083" x2="413.97372184133" y1="325.78844270323" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="351.98813907933" x2="367.48453476983" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="367.48453476983" x2="382.98093046033" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="320.992791381" x2="336.49046523017" y1="334.73555337904" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="336.49046523017" x2="351.98813907933" y1="325.78844270323" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="323" x2="323" y1="371" y2="353" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="323" x2="323" y1="353" y2="335" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="320" x2="320" y1="371" y2="353" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="320" x2="320" y1="353" y2="335" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="290" x2="305.4963956905" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="305.4963956905" x2="320.992791381" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="260" x2="275.5" y1="337" y2="328" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="275.5" x2="291" y1="328" y2="319" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="259" x2="274.5" y1="334" y2="325" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="274.5" x2="290" y1="325" y2="316" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="228.014417238" x2="243.5108129285" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="243.5108129285" x2="259.007208619" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="197.01651322233" x2="212.51546523017" y1="334.73555337904" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="212.51546523017" x2="228.014417238" y1="325.78844270323" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="166.02372184133" x2="181.52011753183" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="181.52011753183" x2="197.01651322233" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="136" x2="151.5" y1="337" y2="328" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="151.5" x2="167" y1="328" y2="319" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="135" x2="150.5" y1="334" y2="325" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="150.5" x2="166" y1="325" y2="316" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="104.035582762" x2="119.53325661117" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="119.53325661117" x2="135.03093046033" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="73.042791380999" x2="88.539187071499" y1="334.73555337904" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="88.539187071499" x2="104.035582762" y1="325.78844270323" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="42.05" x2="57.546395690499" y1="316.84133202742" y2="325.78844270323" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="57.546395690499" x2="73.042791380999" y1="325.78844270323" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="103" x2="103" y1="282" y2="299.5" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="103" x2="103" y1="299.5" y2="317" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="106" x2="106" y1="282" y2="299.5" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="106" x2="106" y1="299.5" y2="317" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="73.042791380999" x2="88.539187071499" y1="263.15866797258" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="88.539187071499" x2="104.035582762" y1="272.10577864838" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="135.03093046033" x2="119.53325661117" y1="263.15866797258" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="119.53325661117" x2="104.035582762" y1="272.10577864838" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="135.03093046033" x2="135.03093046033" y1="227.37022526934" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="135.03093046033" x2="135.03093046033" y1="245.26444662096" y2="263.15866797258" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="166.02372184133" x2="150.52732615083" y1="209.47600391773" y2="218.42311459354" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="150.52732615083" x2="135.03093046033" y1="218.42311459354" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="167" x2="151.5" y1="280" y2="271" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="151.5" x2="136" y1="271" y2="262" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="166" x2="150.5" y1="283" y2="274" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="150.5" x2="135" y1="274" y2="265" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="166.02372184133" x2="166.02372184133" y1="281.05288932419" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="166.02372184133" x2="166.02372184133" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="413" x2="413" y1="282" y2="299.5" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="413" x2="413" y1="299.5" y2="317" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="416" x2="416" y1="282" y2="299.5" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="416" x2="416" y1="299.5" y2="317" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="444.96651322233" x2="429.47011753183" y1="263.15866797258" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="429.47011753183" x2="413.97372184133" y1="272.10577864838" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="477" x2="461.5" y1="280" y2="271" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="461.5" x2="446" y1="271" y2="262" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="476" x2="460.5" y1="283" y2="274" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="460.5" x2="445" y1="274" y2="265" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="475.964417238" x2="475.964417238" y1="281.05288932419" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="475.964417238" x2="475.964417238" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<line x1="506.957208619" x2="491.4608129285" y1="263.15866797258" y2="272.10577864838" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #ff0000" />
<line x1="491.4608129285" x2="475.964417238" y1="272.10577864838" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068972233942; stroke: #000000" />
<ellipse cx="506.957208619" cy="334.73555337904" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="506.957208619" y="343.02348810771"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>
<ellipse cx="320.992791381" cy="370.52399608227" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.992791381" y="378.81193081094"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>
<ellipse cx="73.042791380999" cy="334.73555337904" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="73.042791380999" y="343.02348810771"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>
<ellipse cx="73.042791380999" cy="263.15866797258" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="73.042791380999" y="271.44660270124"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>
<ellipse cx="135.03093046033" cy="227.37022526934" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.03093046033" y="235.65815999801"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>
<ellipse cx="506.957208619" cy="263.15866797258" rx="9.7948319520622" ry="9.7948319520622" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="506.957208619" y="271.44660270124"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836215292427px">O</text>


2021-10-02, 297👍, 0💬