Molecule FYI-1000379

A

Molecule Summary:

ID: FYI-1000379
SMILES: Oc1cc(O)c2c(c1)OC(c1ccc(O)c(O)c1)C(OC1(c3ccc(O)c(O)c3)Oc3cc(O)cc(O)c3C(O)C1O)C2

Received at FYIcenter.com on: 2021-04-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000379
FYIcenter.com

 43 48  0  0  0  0  0  0  0  0999 V2000
    6.0803   12.6377    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0803   11.2335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8643   10.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8643    9.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6482    8.4251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0803    8.4251    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2963    9.1272    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2963   10.5314    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124    8.4251    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124    7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7285    6.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9446    7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1606    6.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1606    4.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3767    4.2126    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9446    4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9446    2.8084    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7285    4.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2963    6.3189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2963    4.9147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0803    4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2963    3.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124    4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7285    3.5105    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7285    2.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9446    1.4042    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124    1.4042    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5124    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4205    2.2304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8643    4.9147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6482    4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4321    4.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2160    4.2126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9147    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2160    2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4321    2.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4321    0.7021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6482    2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8643    2.1063    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8643    0.7021    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0803    2.8084    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0482    1.8581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0803    7.0209    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  4  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  8  2  1  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 14  1  0  0  0  0
 17 16  1  0  0  0  0
 18 16  2  0  0  0  0
 18 11  1  0  0  0  0
 19 10  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 29 27  2  0  0  0  0
 29 22  1  0  0  0  0
 30 21  1  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 33  2  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 36  2  0  0  0  0
 38 31  1  0  0  0  0
 39 38  1  0  0  0  0
 40 39  1  0  0  0  0
 41 39  1  0  0  0  0
 41 21  1  0  0  0  0
 42 41  1  0  0  0  0
 43 19  1  0  0  0  0
 43  6  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="267.45841687412" x2="267.45841687412" y1="472.19552916639" y2="498.2237267039" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="267.45841687412" y1="498.2237267039" y2="524.2519242414" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="222" x2="244.5" y1="449" y2="462" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="244.5" x2="267" y1="462" y2="475" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="224" x2="246.5" y1="444" y2="457" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="246.5" x2="269" y1="457" y2="470" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="222.37895781471" x2="222.37895781471" y1="394.11093655386" y2="420.13913409137" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="222.37895781471" x2="222.37895781471" y1="420.13913409137" y2="446.16733162888" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="177.29579156294" x2="199.83737468882" y1="368.08273901635" y2="381.0968377851" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="199.83737468882" x2="222.37895781471" y1="381.0968377851" y2="394.11093655386" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267" x2="244.5" y1="366" y2="379" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="244.5" x2="222" y1="379" y2="392" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="269" x2="246.5" y1="371" y2="384" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="246.5" x2="224" y1="384" y2="397" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="312.53787593353" x2="289.99814640382" y1="394.11093655386" y2="381.0968377851" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="289.99814640382" x2="267.45841687412" y1="381.0968377851" y2="368.08273901635" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="316" x2="316" y1="447" y2="421" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="316" x2="316" y1="421" y2="395" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="310" x2="310" y1="447" y2="421" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="310" x2="310" y1="421" y2="395" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="312.53787593353" x2="289.99814640382" y1="446.16733162888" y2="459.18143039763" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="289.99814640382" x2="267.45841687412" y1="459.18143039763" y2="472.19552916639" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357.62104218529" x2="335.07945905941" y1="368.08273901635" y2="381.0968377851" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="335.07945905941" x2="312.53787593353" y1="381.0968377851" y2="394.11093655386" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357.62104218529" x2="357.62104218529" y1="316.02634394133" y2="342.05454147884" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357.62104218529" x2="357.62104218529" y1="342.05454147884" y2="368.08273901635" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="402.70420843706" x2="380.16262531118" y1="290.00185359618" y2="303.01409876875" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="380.16262531118" x2="357.62104218529" y1="303.01409876875" y2="316.02634394133" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="450" x2="427.5" y1="314" y2="301" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="427.5" x2="405" y1="301" y2="288" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="447" x2="424.5" y1="319" y2="306" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="424.5" x2="402" y1="306" y2="293" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="492.86683374823" x2="470.32710421853" y1="290.00185359618" y2="303.01409876875" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="470.32710421853" x2="447.78737468882" y1="303.01409876875" y2="316.02634394133" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="491" x2="491" y1="238" y2="264.5" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="491" x2="491" y1="264.5" y2="291" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="496" x2="496" y1="238" y2="264.5" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="496" x2="496" y1="264.5" y2="291" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="537.95" x2="515.40841687412" y1="211.91726098365" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="515.40841687412" x2="492.86683374823" y1="224.93135975241" y2="237.94545852116" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="447.78737468882" x2="470.32710421853" y1="211.91726098365" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="470.32710421853" x2="492.86683374823" y1="224.93135975241" y2="237.94545852116" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="447.78737468882" x2="447.78737468882" y1="159.86086590863" y2="185.88906344614" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="447.78737468882" x2="447.78737468882" y1="185.88906344614" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="405" x2="427.5" y1="241" y2="228" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="427.5" x2="450" y1="228" y2="215" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="402" x2="424.5" y1="236" y2="223" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="424.5" x2="447" y1="223" y2="210" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="402.70420843706" x2="402.70420843706" y1="237.94545852116" y2="263.97365605867" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="402.70420843706" x2="402.70420843706" y1="263.97365605867" y2="290.00185359618" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="312.53787593353" x2="335.07945905941" y1="290.00185359618" y2="303.01409876875" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="335.07945905941" x2="357.62104218529" y1="303.01409876875" y2="316.02634394133" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="312.53787593353" x2="312.53787593353" y1="237.94545852116" y2="263.97365605867" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="312.53787593353" x2="312.53787593353" y1="263.97365605867" y2="290.00185359618" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="289.99814640382" y1="211.91726098365" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="289.99814640382" x2="312.53787593353" y1="224.93135975241" y2="237.94545852116" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="312.53787593353" x2="289.99814640382" y1="185.88906344614" y2="198.9031622149" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="289.99814640382" x2="267.45841687412" y1="198.9031622149" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="359" x2="336.5" y1="210" y2="197" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="336.5" x2="314" y1="197" y2="184" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357" x2="334.5" y1="215" y2="202" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="334.5" x2="312" y1="202" y2="189" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="402.70420843706" x2="380.16262531118" y1="185.88906344614" y2="198.9031622149" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="380.16262531118" x2="357.62104218529" y1="198.9031622149" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="400" x2="400" y1="134" y2="160" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="400" x2="400" y1="160" y2="186" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="406" x2="406" y1="134" y2="160" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="406" x2="406" y1="160" y2="186" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="447.78737468882" x2="425.24579156294" y1="107.80447083361" y2="120.81856960237" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="425.24579156294" x2="402.70420843706" y1="120.81856960237" y2="133.83266837112" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357.62104218529" x2="380.16262531118" y1="107.80447083361" y2="120.81856960237" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="380.16262531118" x2="402.70420843706" y1="120.81856960237" y2="133.83266837112" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="357.62104218529" x2="357.62104218529" y1="55.748075758595" y2="81.776273296104" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="357.62104218529" x2="357.62104218529" y1="81.776273296104" y2="107.80447083361" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="319" x2="339.5" y1="141" y2="125.5" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="339.5" x2="360" y1="125.5" y2="110" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="316" x2="336" y1="137" y2="121.5" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="336" x2="356" y1="121.5" y2="106" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="317.14220884075" x2="314.84004238714" y1="138.43329408599" y2="162.16117876606" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="314.84004238714" x2="312.53787593353" y1="162.16117876606" y2="185.88906344614" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="222.37895781471" x2="244.91868734441" y1="237.94545852116" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="244.91868734441" x2="267.45841687412" y1="224.93135975241" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="177.29579156294" x2="199.83737468882" y1="211.91726098365" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="199.83737468882" x2="222.37895781471" y1="224.93135975241" y2="237.94545852116" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="134" x2="156.5" y1="241" y2="228" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="156.5" x2="179" y1="228" y2="215" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="131" x2="153.5" y1="236" y2="223" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="153.5" x2="176" y1="223" y2="210" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="87.129459059409" x2="109.67104218529" y1="211.91726098365" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="109.67104218529" x2="132.21262531118" y1="224.93135975241" y2="237.94545852116" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="42.05" x2="64.589729529705" y1="237.94545852116" y2="224.93135975241" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="64.589729529705" x2="87.129459059409" y1="224.93135975241" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="85" x2="85" y1="160" y2="186" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="85" x2="85" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="90" x2="90" y1="160" y2="186" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="90" x2="90" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="132.21262531118" x2="109.67104218529" y1="133.83266837112" y2="146.84676713988" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="109.67104218529" x2="87.129459059409" y1="146.84676713988" y2="159.86086590863" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="132.21262531118" x2="132.21262531118" y1="81.776273296104" y2="107.80447083361" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="132.21262531118" x2="132.21262531118" y1="107.80447083361" y2="133.83266837112" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="179" x2="156.5" y1="158" y2="145" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="156.5" x2="134" y1="145" y2="132" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="176" x2="153.5" y1="163" y2="150" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="153.5" x2="131" y1="150" y2="137" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="177.29579156294" x2="177.29579156294" y1="159.86086590863" y2="185.88906344614" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="177.29579156294" x2="177.29579156294" y1="185.88906344614" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="222.37895781471" x2="199.83737468882" y1="133.83266837112" y2="146.84676713988" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="199.83737468882" x2="177.29579156294" y1="146.84676713988" y2="159.86086590863" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="222.37895781471" x2="222.37895781471" y1="81.776273296104" y2="107.80447083361" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="222.37895781471" x2="222.37895781471" y1="107.80447083361" y2="133.83266837112" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="244.91868734441" y1="159.86086590863" y2="146.84676713988" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="244.91868734441" x2="222.37895781471" y1="146.84676713988" y2="133.83266837112" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="267.45841687412" y1="159.86086590863" y2="185.88906344614" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="267.45841687412" y1="185.88906344614" y2="211.91726098365" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="303.34033169616" x2="285.39937428514" y1="124.6314169414" y2="142.24614142502" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #ff0000" />
<line x1="285.39937428514" x2="267.45841687412" y1="142.24614142502" y2="159.86086590863" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="289.99814640382" y1="316.02634394133" y2="303.01409876875" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="289.99814640382" x2="312.53787593353" y1="303.01409876875" y2="290.00185359618" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="267.45841687412" y1="316.02634394133" y2="342.05454147884" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<line x1="267.45841687412" x2="267.45841687412" y1="342.05454147884" y2="368.08273901635" style="stroke-opacity:1; stroke-width: 2.1843571185551; stroke: #000000" />
<ellipse cx="267.45841687412" cy="524.2519242414" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="267.45841687412" y="536.26588839346"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="177.29579156294" cy="368.08273901635" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.29579156294" y="380.0967031684"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="357.62104218529" cy="368.08273901635" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.62104218529" y="380.0967031684"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="537.95" cy="211.91726098365" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="223.9312251357"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="447.78737468882" cy="159.86086590863" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="447.78737468882" y="171.87483006069"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="312.53787593353" cy="237.94545852116" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.53787593353" y="249.95942267321"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="447.78737468882" cy="107.80447083361" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="447.78737468882" y="119.81843498567"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="357.62104218529" cy="55.748075758595" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.62104218529" y="67.762039910648"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="222.37895781471" cy="237.94545852116" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.37895781471" y="249.95942267321"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="42.05" cy="237.94545852116" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="249.95942267321"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="132.21262531118" cy="81.776273296104" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="132.21262531118" y="93.790237448157"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="222.37895781471" cy="81.776273296104" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.37895781471" y="93.790237448157"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
<ellipse cx="303.34033169616" cy="124.6314169414" rx="14.198321270608" ry="14.198321270608" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.34033169616" y="136.64538109345"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.304463981938px">O</text>
</g></svg>

✍: FYIcenter.com

2021-05-04, 162👍, 0💬