Molecule FYI-1000380

A

Molecule Summary:

ID: FYI-1000380
SMILES: Cc1n[nH]c(C)c1c2cn(C)c3c(C(=O)O)cccc23.Cl

Received at FYIcenter.com on: 2021-04-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000380
FYIcenter.com

 21 22  0  0  0  0  0  0  0  0999 V2000
    0.2544    2.3835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4668    1.6835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6132    0.2912    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.9826    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6826    1.2125    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0749    1.3588    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7458    2.2529    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0369    3.6224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3158    4.1917    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1695    5.5840    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.2098    6.5208    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    5.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    7.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8000    8.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2000    8.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    9.5125    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    7.0876    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.8751    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    4.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1000    4.6627    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7298    4.5233    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  5  2  0  0  0  0
  7  2  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 10  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 14  1  0  0  0  0
 17 13  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20  8  1  0  0  0  0
 20 12  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="164.98367516426" x2="133.38161681997" y1="129.81322207622" y2="148.05921419185" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="133.38161681997" x2="101.77955847569" y1="148.05921419185" y2="166.30520630749" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="169" x2="165.5" y1="57" y2="93.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="165.5" x2="162" y1="93.5" y2="130" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="177" x2="173" y1="58" y2="94.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="173" x2="169" y1="94.5" y2="131" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="244.00446044678" x2="208.31008672799" y1="42.05" y2="49.640332720105" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="208.31008672799" x2="172.6157130092" y1="49.640332720105" y2="57.23066544021" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="280.49644467806" x2="262.25045256242" y1="105.25932982917" y2="73.654664914586" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="262.25045256242" x2="244.00446044678" y1="73.654664914586" y2="42.05" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="353.07900131406" x2="316.78772299606" y1="112.88615453351" y2="109.07274218134" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="316.78772299606" x2="280.49644467806" y1="109.07274218134" y2="105.25932982917" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="235" x2="259.5" y1="163" y2="135.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="259.5" x2="284" y1="135.5" y2="108" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="229" x2="253.5" y1="157" y2="130" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="253.5" x2="278" y1="130" y2="103" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="231.6597434954" x2="198.32170932983" y1="159.49684467806" y2="144.65503337714" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="198.32170932983" x2="164.98367516426" y1="144.65503337714" y2="129.81322207622" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="246.83519579501" x2="239.2474696452" y1="230.89080525624" y2="195.19382496715" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="239.2474696452" x2="231.6597434954" y1="195.19382496715" y2="159.49684467806" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="316" x2="282.5" y1="258" y2="243" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="282.5" x2="249" y1="243" y2="228" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="312" x2="279" y1="265" y2="250" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="279" x2="246" y1="250" y2="235" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="305.87922628121" x2="309.69263863338" y1="333.15177135348" y2="296.86049303548" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="309.69263863338" x2="313.50605098555" y1="296.86049303548" y2="260.56921471748" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="360.11152798949" x2="332.99537713535" y1="381.98847253614" y2="357.57012194481" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="332.99537713535" x2="305.87922628121" y1="357.57012194481" y2="333.15177135348" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="234.48526570302" x2="270.18224599212" y1="348.32722365309" y2="340.73949750329" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="270.18224599212" x2="305.87922628121" y1="340.73949750329" y2="333.15177135348" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #0000ff" />
<line x1="202" x2="220" y1="414" y2="382.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="220" x2="238" y1="382.5" y2="351" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="195" x2="213.5" y1="410" y2="378.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="213.5" x2="232" y1="378.5" y2="347" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="234.48526570302" x2="216.23927358739" y1="474.74067017083" y2="443.13861182654" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="216.23927358739" x2="197.99328147175" y1="443.13861182654" y2="411.53655348226" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="308" x2="271.5" y1="471" y2="471" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #ff0000" />
<line x1="271.5" x2="235" y1="471" y2="471" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="308" x2="271.5" y1="479" y2="479" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #ff0000" />
<line x1="271.5" x2="235" y1="479" y2="479" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="197.99328147175" x2="216.23927358739" y1="537.95" y2="506.34533508541" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #ff0000" />
<line x1="216.23927358739" x2="234.48526570302" y1="506.34533508541" y2="474.74067017083" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="125.0093130092" x2="161.50129724047" y1="411.53655348226" y2="411.53655348226" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="161.50129724047" x2="197.99328147175" y1="411.53655348226" y2="411.53655348226" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="86" x2="104" y1="351" y2="382.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="104" x2="122" y1="382.5" y2="414" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="92" x2="110.5" y1="347" y2="378.5" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="110.5" x2="129" y1="378.5" y2="410" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="125.0093130092" x2="106.76332089356" y1="285.12310696452" y2="316.7251653088" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="106.76332089356" x2="88.517328777924" y1="316.7251653088" y2="348.32722365309" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="198" x2="162" y1="282" y2="282" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="162" x2="126" y1="282" y2="282" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="198" x2="162" y1="289" y2="289" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="162" x2="126" y1="289" y2="289" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="197.99328147175" x2="222.41423863338" y1="285.12310696452" y2="258.00695611038" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="222.41423863338" x2="246.83519579501" y1="258.00695611038" y2="230.89080525624" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="197.99328147175" x2="216.23927358739" y1="285.12310696452" y2="316.7251653088" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<line x1="216.23927358739" x2="234.48526570302" y1="316.7251653088" y2="348.32722365309" style="stroke-opacity:1; stroke-width: 3.0730045567996; stroke: #000000" />
<ellipse cx="172.6157130092" cy="57.23066544021" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="172.6157130092" y="74.132190502608"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">N</text>
<ellipse cx="244.00446044678" cy="42.05" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="244.00446044678" y="58.951525062398"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">N</text>
<ellipse cx="305.87922628121" cy="333.15177135348" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.87922628121" y="350.05329641588"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">N</text>
<ellipse cx="307.46923416557" cy="474.74067017083" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="307.46923416557" y="491.64219523323"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">O</text>
<ellipse cx="197.99328147175" cy="537.95" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="197.99328147175" y="554.8515250624"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">O</text>
<ellipse cx="491.48267122208" cy="277.85598896189" rx="19.974529619198" ry="19.974529619198" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="491.48267122208" y="294.75751402429"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:38.412556959996px">Cl</text>
</g></svg>

✍: FYIcenter.com

2021-06-20, 133👍, 0💬