Molecule FYI-1000938

A

Molecule Summary:

ID: FYI-1000938
SMILES: O=S(NC(NC1=C(CCC2)C2=CC=C1C3=CC=NC(OC)=C3)=O)(N(C4=CN(C)N=C4)C5CCOCC5)=O

Received at FYIcenter.com on: 2021-07-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000938
FYIcenter.com

 37 41  0  0  0  0  0  0  0  0999 V2000
    4.1498    2.4033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    3.6157    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.3157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.3157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6591    1.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2285    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6209    0.1463    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    1.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    5.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    7.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    8.5157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    7.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    8.5157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    7.8157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    6.4157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.2157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.3157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.7157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7700    6.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3373    7.8701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1602    9.0027    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9373    7.8701    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.5047    6.5386    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.3157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.6157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.2157    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    1.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.2157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5498    2.4033    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11  7  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 14  6  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 19  2  0  0  0  0
 22 15  1  0  0  0  0
 23  4  2  0  0  0  0
 24  2  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 27  1  0  0  0  0
 30 29  2  0  0  0  0
 30 25  1  0  0  0  0
 31 24  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  1  0  0  0  0
 36 31  1  0  0  0  0
 37  2  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="244" x2="229.5" y1="253" y2="228" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<line x1="229.5" x2="215" y1="228" y2="203" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="238" x2="224" y1="256" y2="231" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<line x1="224" x2="210" y1="231" y2="206" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="290" x2="265.20581801986" y1="282.40673064234" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="265.20581801986" x2="240.41163603972" y1="268.09138307875" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<line x1="339.59245405958" x2="314.79622702979" y1="253.77603551516" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="314.79622702979" x2="290" y1="268.09138307875" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="389.18081801986" x2="364.38663603972" y1="282.40673064234" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="364.38663603972" x2="339.59245405958" y1="268.09138307875" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="438.76918198014" x2="413.975" y1="253.77603551516" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="413.975" x2="389.18081801986" y1="268.09138307875" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="436" x2="436" y1="197" y2="225.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="436" x2="436" y1="225.5" y2="254" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="442" x2="442" y1="197" y2="225.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="442" x2="442" y1="225.5" y2="254" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="396.21578882254" x2="417.49248540134" y1="158.19859498202" y2="177.35662012141" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="417.49248540134" x2="438.76918198014" y1="177.35662012141" y2="196.5146452608" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="419.50481425885" x2="407.86030154069" y1="105.89031498466" y2="132.04445498334" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="407.86030154069" x2="396.21578882254" y1="132.04445498334" y2="158.19859498202" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="476.45535696612" x2="447.98008561248" y1="111.87413026624" y2="108.88222262545" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="447.98008561248" x2="419.50481425885" y1="108.88222262545" y2="105.89031498466" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="488.36163603972" x2="463.56540900993" y1="167.88395013361" y2="182.19929769721" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="463.56540900993" x2="438.76918198014" y1="182.19929769721" y2="196.5146452608" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="488.36163603972" x2="482.40849650292" y1="167.88395013361" y2="139.87904019993" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="482.40849650292" x2="476.45535696612" y1="139.87904019993" y2="111.87413026624" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="540" x2="515" y1="194" y2="180" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="515" x2="490" y1="180" y2="166" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537" x2="512" y1="200" y2="185.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="512" x2="487" y1="185.5" y2="171" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="253.77603551516" y2="225.14534038798" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="225.14534038798" y2="196.5146452608" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="490" x2="515" y1="286" y2="271.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="515" x2="540" y1="271.5" y2="257" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="487" x2="512" y1="280" y2="266" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="512" x2="537" y1="266" y2="252" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="488.36163603972" x2="463.56540900993" y1="282.40673064234" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="463.56540900993" x2="438.76918198014" y1="268.09138307875" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="488.36163603972" x2="488.36163603972" y1="339.6681208967" y2="311.03742576952" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="488.36163603972" x2="488.36163603972" y1="311.03742576952" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="540" x2="515" y1="366" y2="352" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="515" x2="490" y1="352" y2="338" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537" x2="512" y1="371" y2="357" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="512" x2="487" y1="357" y2="343" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="425.56020627825" y2="396.92951115107" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="396.92951115107" y2="368.29881602389" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="490" x2="515" y1="457" y2="443" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="515" x2="540" y1="443" y2="429" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="487" x2="512" y1="452" y2="437.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="512" x2="537" y1="437.5" y2="423" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="438.76918198014" x2="463.56540900993" y1="425.56020627825" y2="439.87555384184" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="463.56540900993" x2="488.36163603972" y1="439.87555384184" y2="454.19090140543" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="389.18081801986" x2="413.975" y1="454.19090140543" y2="439.87555384184" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="413.975" x2="438.76918198014" y1="439.87555384184" y2="425.56020627825" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="339.59245405958" x2="364.38663603972" y1="425.56020627825" y2="439.87555384184" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="364.38663603972" x2="389.18081801986" y1="439.87555384184" y2="454.19090140543" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="436" x2="436" y1="369" y2="397.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="436" x2="436" y1="397.5" y2="426" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="442" x2="442" y1="369" y2="397.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="442" x2="442" y1="397.5" y2="426" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="438.76918198014" x2="463.56540900993" y1="368.29881602389" y2="353.98346846029" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="463.56540900993" x2="488.36163603972" y1="353.98346846029" y2="339.6681208967" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="337" x2="337" y1="197" y2="225.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="337" x2="337" y1="225.5" y2="254" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="343" x2="343" y1="197" y2="225.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="343" x2="343" y1="225.5" y2="254" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="190.81918198014" x2="215.61540900993" y1="282.40673064234" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="215.61540900993" x2="240.41163603972" y1="268.09138307875" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<line x1="190.81918198014" x2="190.81918198014" y1="339.6681208967" y2="311.03742576952" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="311.03742576952" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="239" x2="216" y1="371" y2="354.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="216" x2="193" y1="354.5" y2="338" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="236" x2="213" y1="376" y2="359.5" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="213" x2="190" y1="359.5" y2="343" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="219.44987710732" x2="228.29880695127" y1="427.78522029956" y2="400.55538418396" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="228.29880695127" x2="237.14773679522" y1="400.55538418396" y2="373.32554806836" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="253.10730427897" x2="236.27859069315" y1="474.10968501534" y2="450.94745265745" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="236.27859069315" x2="219.44987710732" y1="450.94745265745" y2="427.78522029956" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="162.18848685296" x2="190.81918198014" y1="427.78522029956" y2="427.78522029956" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="190.81918198014" x2="219.44987710732" y1="427.78522029956" y2="427.78522029956" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="142" x2="151" y1="375" y2="402" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="151" x2="160" y1="402" y2="429" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="148" x2="157" y1="373" y2="400" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="157" x2="166" y1="400" y2="427" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="144.49471726436" x2="167.65694962225" y1="373.32554806836" y2="356.49683448253" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="167.65694962225" x2="190.81918198014" y1="356.49683448253" y2="339.6681208967" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="141.23081801986" x2="166.025" y1="253.77603551516" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="166.025" x2="190.81918198014" y1="268.09138307875" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #0000ff" />
<line x1="91.642454059582" x2="116.43663603972" y1="282.40673064234" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="116.43663603972" x2="141.23081801986" y1="268.09138307875" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="42.05" x2="66.846227029791" y1="253.77603551516" y2="268.09138307875" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="66.846227029791" x2="91.642454059582" y1="268.09138307875" y2="282.40673064234" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="196.5146452608" y2="225.14534038798" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="42.05" x2="42.05" y1="225.14534038798" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="91.642454059582" x2="66.846227029791" y1="167.88395013361" y2="182.19929769721" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="66.846227029791" x2="42.05" y1="182.19929769721" y2="196.5146452608" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="141.23081801986" x2="116.43663603972" y1="196.5146452608" y2="182.19929769721" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="116.43663603972" x2="91.642454059582" y1="182.19929769721" y2="167.88395013361" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="196.5146452608" y2="225.14534038798" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="225.14534038798" y2="253.77603551516" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #000000" />
<line x1="267" x2="252.5" y1="203" y2="228" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="252.5" x2="238" y1="228" y2="253" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<line x1="272" x2="258" y1="206" y2="231" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #ff0000" />
<line x1="258" x2="244" y1="231" y2="256" style="stroke-opacity:1; stroke-width: 2.4110152668182; stroke: #c8aa1a" />
<ellipse cx="211.78094091254" cy="204.18767155488" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="211.78094091254" y="217.44825552238"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">O</text>
<ellipse cx="240.41163603972" cy="253.77603551516" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.41163603972" y="267.03661948266"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">S</text>
<ellipse cx="290" cy="282.40673064234" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="295.66731460984"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="389.18081801986" cy="282.40673064234" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="389.18081801986" y="295.66731460984"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="488.36163603972" cy="454.19090140543" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="488.36163603972" y="467.45148537293"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="389.18081801986" cy="454.19090140543" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="389.18081801986" y="467.45148537293"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">O</text>
<ellipse cx="339.59245405958" cy="196.5146452608" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.59245405958" y="209.7752292283"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">O</text>
<ellipse cx="190.81918198014" cy="282.40673064234" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="190.81918198014" y="295.66731460984"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="219.44987710732" cy="427.78522029956" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.44987710732" y="441.04580426706"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="162.18848685296" cy="427.78522029956" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="162.18848685296" y="441.04580426706"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">N</text>
<ellipse cx="42.05" cy="196.5146452608" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="209.7752292283"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">O</text>
<ellipse cx="269.0423311669" cy="204.18767155488" rx="15.671599234318" ry="15.671599234318" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="269.0423311669" y="217.44825552238"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137690835228px">O</text>
</g></svg>

✍: FYIcenter.com

2021-08-13, 145👍, 0💬