Molecule FYI-1000940

A

Molecule Summary:

ID: FYI-1000940
SMILES: CN(C)CCC=C1C2=CC=CC=C2CCC3=CC=CC=C31

Received at FYIcenter.com on: 2021-07-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000940
FYIcenter.com

 21 23  0  0  0  0  0  0  0  0999 V2000
    9.5830    4.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.3706    4.1259    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    8.3706    2.7259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1582    4.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9458    4.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7333    4.8259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5209    4.1259    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3642    4.9146    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6757    6.2794    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6493    7.2317    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.3116    6.8191    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.4541    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0263    4.5020    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.5148    3.1987    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2148    1.9863    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5992    1.7776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.9107    0.4127    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2486    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2748    0.9523    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9633    2.3171    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6254    2.7299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 13  8  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 21 16  1  0  0  0  0
 21  7  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="475.21086194302" x2="506.58043097151" y1="316.39400970469" y2="334.50577011374" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #0000ff" />
<line x1="506.58043097151" x2="537.95" y1="334.50577011374" y2="352.6175305228" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="475.21086194302" x2="475.21086194302" y1="243.94696806845" y2="280.17048888657" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="475.21086194302" x2="475.21086194302" y1="280.17048888657" y2="316.39400970469" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #0000ff" />
<line x1="412.47172388605" x2="443.84129291454" y1="352.6175305228" y2="334.50577011374" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="443.84129291454" x2="475.21086194302" y1="334.50577011374" y2="316.39400970469" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #0000ff" />
<line x1="349.73258582907" x2="381.10215485756" y1="316.39400970469" y2="334.50577011374" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="381.10215485756" x2="412.47172388605" y1="334.50577011374" y2="352.6175305228" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="286.98827298341" x2="318.36042940624" y1="352.6175305228" y2="334.50577011374" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="318.36042940624" x2="349.73258582907" y1="334.50577011374" y2="316.39400970469" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="223" x2="254.5" y1="320" y2="338" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="254.5" x2="286" y1="338" y2="356" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="227" x2="258" y1="314" y2="332" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="258" x2="289" y1="332" y2="350" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="164.39235416884" x2="194.32074454764" y1="357.20756808932" y2="336.80078889701" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="194.32074454764" x2="224.24913492643" y1="336.80078889701" y2="316.39400970469" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="185" x2="177" y1="427" y2="392" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="177" x2="169" y1="392" y2="357" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="177" x2="169" y1="429" y2="394" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="169" x2="161" y1="394" y2="359" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="127.39778983617" x2="153.95480538454" y1="477.11259678598" y2="452.47284044662" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="153.95480538454" x2="180.5118209329" y1="452.47284044662" y2="427.83308410727" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="58" x2="92.5" y1="460" y2="470.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="92.5" x2="127" y1="470.5" y2="481" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="60" x2="94.5" y1="453" y2="463.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="94.5" x2="129" y1="463.5" y2="474" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="42.05" x2="50.112320776375" y1="385.12555306272" y2="420.44348586038" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="50.112320776375" x2="58.17464155275" y1="420.44348586038" y2="455.76141865804" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="93" x2="66.5" y1="334" y2="358.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="66.5" x2="40" y1="358.5" y2="383" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="98" x2="71.5" y1="339" y2="363.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="71.5" x2="45" y1="363.5" y2="388" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="95.158856308046" x2="129.77560523844" y1="335.85638996139" y2="346.53197902536" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="129.77560523844" x2="164.39235416884" y1="346.53197902536" y2="357.20756808932" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="68.68981216738" x2="81.924334237713" y1="268.41336898675" y2="302.13487947407" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="81.924334237713" x2="95.158856308046" y1="302.13487947407" y2="335.85638996139" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="104.9133329855" x2="86.801572576437" y1="205.67423092977" y2="237.04379995826" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="86.801572576437" x2="68.68981216738" y1="237.04379995826" y2="268.41336898675" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="176.55310758635" x2="140.73322028592" y1="194.87444693728" y2="200.27433893353" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="140.73322028592" x2="104.9133329855" y1="200.27433893353" y2="205.67423092977" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="189" x2="181" y1="124" y2="159.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="181" x2="173" y1="159.5" y2="195" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="197" x2="189" y1="126" y2="161" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="189" x2="181" y1="161" y2="196" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="261.90607221121" x2="227.28932328081" y1="102.88740321402" y2="113.56557967234" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="227.28932328081" x2="192.67257435041" y1="113.56557967234" y2="124.24375613065" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="318" x2="291.5" y1="150" y2="125.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="291.5" x2="265" y1="125.5" y2="101" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="313" x2="286.5" y1="155" y2="130.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="286.5" x2="260" y1="130.5" y2="106" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="298.8902869665" x2="306.95002034853" y1="222.79243191068" y2="187.4796739017" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="306.95002034853" x2="315.00975373056" y1="187.4796739017" y2="152.16691589273" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="231" x2="266" y1="248" y2="237.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="266" x2="301" y1="237.5" y2="227" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="229" x2="263.5" y1="241" y2="230.5" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="263.5" x2="298" y1="230.5" y2="220" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="229.65678910571" x2="203.10494834603" y1="244.15395961599" y2="219.51420327664" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="203.10494834603" x2="176.55310758635" y1="219.51420327664" y2="194.87444693728" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="229.65678910571" x2="226.95296201607" y1="244.15395961599" y2="280.27398466034" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<line x1="226.95296201607" x2="224.24913492643" y1="280.27398466034" y2="316.39400970469" style="stroke-opacity:1; stroke-width: 3.0504157522734; stroke: #000000" />
<ellipse cx="475.21086194302" cy="316.39400970469" rx="19.827702389777" ry="19.827702389777" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.21086194302" y="333.17129634219"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:38.130196903417px">N</text>
</g></svg>

✍: FYIcenter.com

2021-08-13, 143👍, 0💬