Molecule FYI-1000942

A

Molecule Summary:

ID: FYI-1000942
SMILES: O=C4N=C(NC23CC1CC(CC(C1)C2)C3)SC45CCC5

Received at FYIcenter.com on: 2021-07-23

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000942
FYIcenter.com

 20 24  0  0  0  0  0  0  0  0999 V2000
    8.0469    2.7435    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8410    2.6168    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0296    3.5178    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9219    3.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8717    3.6310    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8216    3.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.6090    3.0247    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0073    1.9928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0434    3.4182    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.8006    4.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.6429    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8216    0.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5712    0.7757    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4279    1.9746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0131    4.4249    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0486    1.8188    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    6.2347    1.5667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8002    0.4346    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.9321    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3667    1.1321    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 13  8  1  0  0  0  0
 14 12  1  0  0  0  0
 14  6  1  0  0  0  0
 15 10  1  0  0  0  0
 15  6  1  0  0  0  0
 16  4  1  0  0  0  0
 17 16  1  0  0  0  0
 17  2  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 20 17  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="464" x2="501" y1="320" y2="324" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="501" x2="538" y1="324" y2="328" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #ff0000" />
<line x1="465" x2="502" y1="311" y2="314.5" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="502" x2="539" y1="314.5" y2="318" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #ff0000" />
<line x1="413.63143384409" x2="438.6331897998" y1="370.44378145621" y2="342.68117100995" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #0000ff" />
<line x1="438.6331897998" x2="463.63494575551" y1="342.68117100995" y2="314.9185605637" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="344" x2="378" y1="345" y2="360" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="378" x2="412" y1="360" y2="375" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #0000ff" />
<line x1="348" x2="382" y1="336" y2="351.5" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="382" x2="416" y1="351.5" y2="367" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #0000ff" />
<line x1="280.64822167543" x2="313.00814785818" y1="377.41986914215" y2="358.73788166872" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #0000ff" />
<line x1="313.00814785818" x2="345.36807404094" y1="358.73788166872" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="215.93453193155" x2="248.29137680349" y1="340.05589419528" y2="358.73788166872" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="248.29137680349" x2="280.64822167543" y1="358.73788166872" y2="377.41986914215" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #0000ff" />
<line x1="141.2065820378" x2="178.57055698468" y1="340.05589419528" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="178.57055698468" x2="215.93453193155" y1="340.05589419528" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="104.12608768594" x2="122.66633486187" y1="276.46380158819" y2="308.25984789173" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="122.66633486187" x2="141.2065820378" y1="308.25984789173" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="44.724577787719" x2="74.42533273683" y1="364.30581031205" y2="320.38480595012" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="74.42533273683" x2="104.12608768594" y1="320.38480595012" y2="276.46380158819" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="91.387948775305" x2="68.056263281512" y1="426.3449222682" y2="395.32536629012" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="68.056263281512" x2="44.724577787719" y1="395.32536629012" y2="364.30581031205" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="42.05" x2="66.718974387652" y1="254.9007885024" y2="340.6228553853" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="66.718974387652" x2="91.387948775305" y1="340.6228553853" y2="426.3449222682" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="215.93453193155" x2="128.99226596578" y1="210.6223520859" y2="232.76157029415" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="128.99226596578" x2="42.05" y1="232.76157029415" y2="254.9007885024" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="138.8771110614" x2="177.40582149648" y1="201.45853372106" y2="206.04044290348" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="177.40582149648" x2="215.93453193155" y1="206.04044290348" y2="210.6223520859" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="138.8771110614" x2="121.50159937367" y1="201.45853372106" y2="238.96116765462" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="121.50159937367" x2="104.12608768594" y1="238.96116765462" y2="276.46380158819" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="253.29850687843" x2="234.61651940499" y1="275.3422044514" y2="242.98227826865" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="234.61651940499" x2="215.93453193155" y1="242.98227826865" y2="210.6223520859" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="253.29850687843" x2="234.61651940499" y1="275.3422044514" y2="307.69904932334" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="234.61651940499" x2="215.93453193155" y1="307.69904932334" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="166.10973604742" x2="128.74884241136" y1="426.3449222682" y2="426.3449222682" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="128.74884241136" x2="91.387948775305" y1="426.3449222682" y2="426.3449222682" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="166.10973604742" x2="191.02213398949" y1="426.3449222682" y2="383.20040823174" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="191.02213398949" x2="215.93453193155" y1="383.20040823174" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="353.17611564702" x2="349.27209484398" y1="265.74083995079" y2="302.89836707303" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #c8aa1a" />
<line x1="349.27209484398" x2="345.36807404094" y1="302.89836707303" y2="340.05589419528" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="426.27097080863" x2="389.72354322783" y1="250.20487081982" y2="257.9728553853" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="389.72354322783" x2="353.17611564702" y1="257.9728553853" y2="265.74083995079" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #c8aa1a" />
<line x1="426.27097080863" x2="444.95295828207" y1="250.20487081982" y2="282.56171569176" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="444.95295828207" x2="463.63494575551" y1="282.56171569176" y2="314.9185605637" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="399.49437982329" x2="412.88267531596" y1="180.43783133878" y2="215.3213510793" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="412.88267531596" x2="426.27097080863" y1="215.3213510793" y2="250.20487081982" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="469.24909406107" x2="434.37173694218" y1="153.6550777318" y2="167.04645453529" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="434.37173694218" x2="399.49437982329" y1="167.04645453529" y2="180.43783133878" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="496.03184766805" x2="482.64047086456" y1="223.42211721284" y2="188.53859747232" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="482.64047086456" x2="469.24909406107" y1="188.53859747232" y2="153.6550777318" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="496.03184766805" x2="461.15140923834" y1="223.42211721284" y2="236.81349401633" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<line x1="461.15140923834" x2="426.27097080863" y1="236.81349401633" y2="250.20487081982" style="stroke-opacity:1; stroke-width: 3.8329735692715; stroke: #000000" />
<ellipse cx="537.95" cy="322.72660216978" rx="24.914328200265" ry="24.914328200265" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="343.80795680077"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:47.912169615894px">O</text>
<ellipse cx="413.63143384409" cy="370.44378145621" rx="24.914328200265" ry="24.914328200265" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.63143384409" y="391.52513608721"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:47.912169615894px">N</text>
<ellipse cx="280.64822167543" cy="377.41986914215" rx="24.914328200265" ry="24.914328200265" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="280.64822167543" y="398.50122377315"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:47.912169615894px">N</text>
<ellipse cx="353.17611564702" cy="265.74083995079" rx="24.914328200265" ry="24.914328200265" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="353.17611564702" y="286.82219458178"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:47.912169615894px">S</text>
</g></svg>

✍: FYIcenter.com

2021-09-09, 119👍, 0💬