Molecule FYI-1000180

A

Molecule Summary:

ID: FYI-1000180
SMILES: O=C1N[C@H](C)CNC2=C1SC(C=C3)=C2C4=C3N=C(OC5=NC(Cl)=NC=C5COCC)C=C4

Received at FYIcenter.com on: 2020-10-25

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000180
FYIcenter.com

 32 36  0  0  1  0  0  0  0  0999 V2000
    0.0000    9.5283    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.3901    9.6955    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.8425   11.0203    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1605   11.4927    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3068   12.8850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3515   10.7567    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5186    9.3666    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.5361    8.3693    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1437    8.5157    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5743    7.2367    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8272    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8272    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0395    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0395    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2519    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4645    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6769    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.6769    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8893    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.8893    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1016    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    8.6769    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.4645    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4645    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2519    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.0395    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.8272    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.6146    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4645    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2519    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  4  5  1  6  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
  9  2  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 11  2  0  0  0  0
 14  8  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 16 13  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 22  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 26 20  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 18  1  0  0  0  0
 32 31  2  0  0  0  0
 32 15  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="131" x2="104" y1="413" y2="409.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="104" x2="77" y1="409.5" y2="406" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="130" x2="103.5" y1="419" y2="415.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="103.5" x2="77" y1="415.5" y2="412" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="147.28009545984" x2="138.57442374854" y1="466.18401396973" y2="440.69048195576" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="138.57442374854" x2="129.86875203725" y1="440.69048195576" y2="415.19694994179" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="198.00545052386" x2="172.64277299185" y1="484.36508963912" y2="475.27455180442" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="172.64277299185" x2="147.28009545984" y1="475.27455180442" y2="466.18401396973" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<polygon points=" 199,485 196,539 212,538" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="243.84300582072" x2="220.92422817229" y1="456.03894295693" y2="470.20201629802" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="220.92422817229" x2="198.00545052386" y1="470.20201629802" y2="484.36508963912" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="250.27411874272" x2="247.05856228172" y1="402.53870314319" y2="429.28882305006" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="247.05856228172" x2="243.84300582072" y1="429.28882305006" y2="456.03894295693" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="212.46102211874" x2="231.36757043073" y1="364.15600465658" y2="383.34735389988" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="231.36757043073" x2="250.27411874272" y1="383.34735389988" y2="402.53870314319" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="160" x2="186.5" y1="373" y2="370" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="186.5" x2="213" y1="370" y2="367" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="159" x2="186" y1="367" y2="364.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="186" x2="213" y1="364.5" y2="362" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="158.87226309662" x2="144.37050756694" y1="369.79044470314" y2="392.49369732247" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="144.37050756694" x2="129.86875203725" y1="392.49369732247" y2="415.19694994179" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="136.95798603027" x2="147.91512456345" y1="320.56606752037" y2="345.17825611176" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #c8aa1a" />
<line x1="147.91512456345" x2="158.87226309662" y1="345.17825611176" y2="369.79044470314" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="176.9956088475" x2="156.97679743888" y1="284.51565774156" y2="302.54086263097" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="156.97679743888" x2="136.95798603027" y1="302.54086263097" y2="320.56606752037" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #c8aa1a" />
<line x1="176.9956088475" x2="176.9956088475" y1="230.63440046566" y2="257.57502910361" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="176.9956088475" x2="176.9956088475" y1="257.57502910361" y2="284.51565774156" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="223" x2="199.5" y1="202" y2="215.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="199.5" x2="176" y1="215.5" y2="229" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="226" x2="202.5" y1="207" y2="220.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="202.5" x2="179" y1="220.5" y2="234" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="226" x2="202.5" y1="310" y2="296.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="202.5" x2="179" y1="296.5" y2="283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="223" x2="199.5" y1="314" y2="300.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="199.5" x2="176" y1="300.5" y2="287" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="223.6644749709" x2="218.06274854482" y1="311.45628637951" y2="337.80614551804" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="218.06274854482" x2="212.46102211874" y1="337.80614551804" y2="364.15600465658" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="270.32179511059" x2="246.99313504075" y1="284.51565774156" y2="297.98597206054" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="246.99313504075" x2="223.6644749709" y1="297.98597206054" y2="311.45628637951" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="268" x2="268" y1="231" y2="258" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="268" x2="268" y1="258" y2="285" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="274" x2="274" y1="231" y2="258" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="274" x2="274" y1="258" y2="285" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="270.32179511059" x2="246.99313504075" y1="230.63440046566" y2="217.16408614668" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="246.99313504075" x2="223.6644749709" y1="217.16408614668" y2="203.69377182771" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="316.98296391153" x2="293.65237951106" y1="203.69377182771" y2="217.16408614668" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="293.65237951106" x2="270.32179511059" y1="217.16408614668" y2="230.63440046566" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="366" x2="342.5" y1="229" y2="215.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="342.5" x2="319" y1="215.5" y2="202" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="363" x2="339.5" y1="234" y2="220.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="339.5" x2="316" y1="220.5" y2="207" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="410.31299883586" x2="386.98241443539" y1="203.69377182771" y2="217.16408614668" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="386.98241443539" x2="363.65183003492" y1="217.16408614668" y2="230.63440046566" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="410.31299883586" x2="410.31299883586" y1="149.8125145518" y2="176.75314318976" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="410.31299883586" x2="410.31299883586" y1="176.75314318976" y2="203.69377182771" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="456" x2="432.5" y1="121" y2="134.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="432.5" x2="409" y1="134.5" y2="148" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="459" x2="435.5" y1="126" y2="139.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="435.5" x2="412" y1="139.5" y2="153" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="456.97416763679" x2="456.97416763679" y1="68.990628637951" y2="95.931257275902" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="456.97416763679" x2="456.97416763679" y1="95.931257275902" y2="122.87188591385" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="503.63148777648" x2="480.30282770664" y1="42.05" y2="55.520314318976" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #00bc00" />
<line x1="480.30282770664" x2="456.97416763679" y1="55.520314318976" y2="68.990628637951" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="409" x2="432.5" y1="45" y2="58.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="432.5" x2="456" y1="58.5" y2="72" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="412" x2="435.5" y1="40" y2="53.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="435.5" x2="459" y1="53.5" y2="67" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="363.65183003492" x2="386.98241443539" y1="68.990628637951" y2="55.520314318976" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="386.98241443539" x2="410.31299883586" y1="55.520314318976" y2="42.05" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #0000ff" />
<line x1="367" x2="367" y1="123" y2="96" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="367" x2="367" y1="96" y2="69" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="361" x2="361" y1="123" y2="96" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="361" x2="361" y1="96" y2="69" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="363.65183003492" x2="386.98241443539" y1="122.87188591385" y2="136.34220023283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="386.98241443539" x2="410.31299883586" y1="136.34220023283" y2="149.8125145518" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="316.98296391153" x2="340.31739697322" y1="149.8125145518" y2="136.34220023283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="340.31739697322" x2="363.65183003492" y1="136.34220023283" y2="122.87188591385" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="270.32179511059" x2="293.65237951106" y1="122.87188591385" y2="136.34220023283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="293.65237951106" x2="316.98296391153" y1="136.34220023283" y2="149.8125145518" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="223.6644749709" x2="246.99313504075" y1="149.8125145518" y2="136.34220023283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="246.99313504075" x2="270.32179511059" y1="136.34220023283" y2="122.87188591385" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #ff0000" />
<line x1="176.9956088475" x2="200.3300419092" y1="122.87188591385" y2="136.34220023283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="200.3300419092" x2="223.6644749709" y1="136.34220023283" y2="149.8125145518" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="363.65183003492" x2="363.65183003492" y1="284.51565774156" y2="257.57502910361" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="363.65183003492" x2="363.65183003492" y1="257.57502910361" y2="230.63440046566" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="319" x2="342.5" y1="314" y2="300.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="342.5" x2="366" y1="300.5" y2="287" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="316" x2="339.5" y1="310" y2="296.5" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="339.5" x2="363" y1="296.5" y2="283" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="316.98296391153" x2="293.65237951106" y1="311.45628637951" y2="297.98597206054" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<line x1="293.65237951106" x2="270.32179511059" y1="297.98597206054" y2="284.51565774156" style="stroke-opacity:1; stroke-width: 2.2687172206996; stroke: #000000" />
<ellipse cx="76.368512223516" cy="408.76198835856" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="76.368512223516" y="421.2399330724"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">O</text>
<ellipse cx="147.28009545984" cy="466.18401396973" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="147.28009545984" y="478.66195868358"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">N</text>
<ellipse cx="250.27411874272" cy="402.53870314319" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="250.27411874272" y="415.01664785704"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">N</text>
<ellipse cx="136.95798603027" cy="320.56606752037" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="136.95798603027" y="333.04401223422"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">S</text>
<ellipse cx="316.98296391153" cy="203.69377182771" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="316.98296391153" y="216.17171654155"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">N</text>
<ellipse cx="410.31299883586" cy="203.69377182771" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="410.31299883586" y="216.17171654155"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">O</text>
<ellipse cx="456.97416763679" cy="122.87188591385" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="456.97416763679" y="135.3498306277"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">N</text>
<ellipse cx="503.63148777648" cy="42.05" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="503.63148777648" y="54.527944713848"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">Cl</text>
<ellipse cx="410.31299883586" cy="42.05" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="410.31299883586" y="54.527944713848"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">N</text>
<ellipse cx="270.32179511059" cy="122.87188591385" rx="14.746661934548" ry="14.746661934548" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.32179511059" y="135.3498306277"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.358965258745px">O</text>
</g></svg>

✍: FYIcenter.com

2020-11-11, 114👍, 0💬