Collections:
Molecule FYI-1000189
Molecule Summary:
ID: FYI-1000189
SMILES: Cc1ccc(C(=O)OCC(=O)Nc2ccccc2)cc1C
Received at FYIcenter.com on: 2020-11-11
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000189 FYIcenter.com 21 22 0 0 0 0 0 0 0 0999 V2000 13.3368 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 5.6000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 3.5000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0622 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 4.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 3.5000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2125 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 1.4000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 2 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 6 1 0 0 0 0 9 8 1 0 0 0 0 10 9 1 0 0 0 0 11 10 2 0 0 0 0 12 10 1 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 14 1 0 0 0 0 16 15 2 0 0 0 0 17 16 1 0 0 0 0 18 17 2 0 0 0 0 18 13 1 0 0 0 0 19 5 1 0 0 0 0 20 19 2 0 0 0 0 20 2 1 0 0 0 0 21 20 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="492.86953392118" x2="515.40976696059" y1="263.97201727551" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="515.40976696059" x2="537.95" y1="250.95802591326" y2="237.94403455102" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="496" x2="496" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="496" x2="496" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="491" x2="491" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="491" x2="491" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="447.78906784236" x2="470.32930088177" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="470.32930088177" x2="492.86953392118" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="402" x2="424.5" y1="319" y2="332" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="424.5" x2="447" y1="332" y2="345" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="405" x2="427.5" y1="314" y2="327" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="427.5" x2="450" y1="327" y2="340" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="357.62441740148" x2="380.16465044089" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="380.16465044089" x2="402.7048834803" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="361" x2="361" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="361" x2="361" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="355" x2="355" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="355" x2="355" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="312.54395132266" x2="335.08418436207" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="335.08418436207" x2="357.62441740148" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="267.45976696059" x2="290.00185914162" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="290.00185914162" x2="312.54395132266" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="222.37930088177" x2="244.91953392118" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="244.91953392118" x2="267.45976696059" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="220" x2="220" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="220" x2="220" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="226" x2="226" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" /> <line x1="226" x2="226" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="177.2951165197" x2="199.83720870074" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #0000ff" /> <line x1="199.83720870074" x2="222.37930088177" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="132.21465044089" x2="154.7548834803" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="154.7548834803" x2="177.2951165197" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #0000ff" /> <line x1="89" x2="111.5" y1="345" y2="332" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="111.5" x2="134" y1="332" y2="319" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="86" x2="108.5" y1="340" y2="327" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="108.5" x2="131" y1="327" y2="314" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="42.05" x2="64.592092181033" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="64.592092181033" x2="87.134184362066" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="40" x2="40" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="40" x2="40" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="45" x2="45" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="45" x2="45" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="87.134184362066" x2="64.592092181033" y1="237.94403455102" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="64.592092181033" x2="42.05" y1="250.95802591326" y2="263.97201727551" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="134" x2="111.5" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="111.5" x2="89" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="131" x2="108.5" y1="267" y2="254" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="108.5" x2="86" y1="254" y2="241" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="132.21465044089" x2="132.21465044089" y1="263.97201727551" y2="290" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="132.21465044089" x2="132.21465044089" y1="290" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="402.7048834803" x2="402.7048834803" y1="263.97201727551" y2="290" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="402.7048834803" x2="402.7048834803" y1="290" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="447" x2="424.5" y1="236" y2="249" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="424.5" x2="402" y1="249" y2="262" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="450" x2="427.5" y1="241" y2="254" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="427.5" x2="405" y1="254" y2="267" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="447.78906784236" x2="470.32930088177" y1="237.94403455102" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="470.32930088177" x2="492.86953392118" y1="250.95802591326" y2="263.97201727551" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="447.78906784236" x2="447.78906784236" y1="185.88806910203" y2="211.91605182653" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <line x1="447.78906784236" x2="447.78906784236" y1="211.91605182653" y2="237.94403455102" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" /> <ellipse cx="357.62441740148" cy="394.11193089797" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.62441740148" y="406.16700067502" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:27.397885856936px">O</text> <ellipse cx="312.54395132266" cy="316.02798272449" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.54395132266" y="328.08305250154" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:27.397885856936px">O</text> <ellipse cx="222.37930088177" cy="263.97201727551" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.37930088177" y="276.02708705256" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:27.397885856936px">O</text> <ellipse cx="177.2951165197" cy="342.05596544898" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.2951165197" y="354.11103522604" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:27.397885856936px">N</text> </g></svg>
✍: FYIcenter.com
2020-12-15, 356👍, 0💬
Popular Posts:
What is JSME JavaScript API? I want to see an example on how to use it. JSME JavaScript API is progr...
What Is "obgen" command? How to use it to Generate Molecule 3D Structures? "obgen" command is a comm...
How to perform exact match in fastsearch index file using a "babel" command? If you want to perform ...
How to build my own JSME editor Web Page? If you want to build your Web page and offer JSME as a mol...
What is Isomer? An Isomer is molecule that has the same the same chemical formula as another molecul...