Molecule FYI-1000189

A

Molecule Summary:

ID: FYI-1000189
SMILES: Cc1ccc(C(=O)OCC(=O)Nc2ccccc2)cc1C

Received at FYIcenter.com on: 2020-11-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000189
FYIcenter.com

 21 22  0  0  0  0  0  0  0  0999 V2000
   13.3368    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  6  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 18 13  1  0  0  0  0
 19  5  1  0  0  0  0
 20 19  2  0  0  0  0
 20  2  1  0  0  0  0
 21 20  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="492.86953392118" x2="515.40976696059" y1="263.97201727551" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="515.40976696059" x2="537.95" y1="250.95802591326" y2="237.94403455102" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="496" x2="496" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="496" x2="496" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="491" x2="491" y1="317" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="491" x2="491" y1="290.5" y2="264" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="447.78906784236" x2="470.32930088177" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="470.32930088177" x2="492.86953392118" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="402" x2="424.5" y1="319" y2="332" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="424.5" x2="447" y1="332" y2="345" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="405" x2="427.5" y1="314" y2="327" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="427.5" x2="450" y1="327" y2="340" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="357.62441740148" x2="380.16465044089" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="380.16465044089" x2="402.7048834803" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="361" x2="361" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="361" x2="361" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="355" x2="355" y1="395" y2="369" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="355" x2="355" y1="369" y2="343" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="312.54395132266" x2="335.08418436207" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="335.08418436207" x2="357.62441740148" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="267.45976696059" x2="290.00185914162" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="290.00185914162" x2="312.54395132266" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="222.37930088177" x2="244.91953392118" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="244.91953392118" x2="267.45976696059" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="220" x2="220" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="220" x2="220" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="226" x2="226" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #ff0000" />
<line x1="226" x2="226" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="177.2951165197" x2="199.83720870074" y1="342.05596544898" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #0000ff" />
<line x1="199.83720870074" x2="222.37930088177" y1="329.04197408674" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="132.21465044089" x2="154.7548834803" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="154.7548834803" x2="177.2951165197" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #0000ff" />
<line x1="89" x2="111.5" y1="345" y2="332" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="111.5" x2="134" y1="332" y2="319" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="86" x2="108.5" y1="340" y2="327" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="108.5" x2="131" y1="327" y2="314" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="42.05" x2="64.592092181033" y1="316.02798272449" y2="329.04197408674" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="64.592092181033" x2="87.134184362066" y1="329.04197408674" y2="342.05596544898" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="40" x2="40" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="40" x2="40" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="45" x2="45" y1="264" y2="290.5" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="45" x2="45" y1="290.5" y2="317" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="87.134184362066" x2="64.592092181033" y1="237.94403455102" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="64.592092181033" x2="42.05" y1="250.95802591326" y2="263.97201727551" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="134" x2="111.5" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="111.5" x2="89" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="131" x2="108.5" y1="267" y2="254" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="108.5" x2="86" y1="254" y2="241" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="132.21465044089" x2="132.21465044089" y1="263.97201727551" y2="290" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="132.21465044089" x2="132.21465044089" y1="290" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="402.7048834803" x2="402.7048834803" y1="263.97201727551" y2="290" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="402.7048834803" x2="402.7048834803" y1="290" y2="316.02798272449" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="447" x2="424.5" y1="236" y2="249" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="424.5" x2="402" y1="249" y2="262" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="450" x2="427.5" y1="241" y2="254" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="427.5" x2="405" y1="254" y2="267" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="447.78906784236" x2="470.32930088177" y1="237.94403455102" y2="250.95802591326" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="470.32930088177" x2="492.86953392118" y1="250.95802591326" y2="263.97201727551" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="447.78906784236" x2="447.78906784236" y1="185.88806910203" y2="211.91605182653" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<line x1="447.78906784236" x2="447.78906784236" y1="211.91605182653" y2="237.94403455102" style="stroke-opacity:1; stroke-width: 2.1918308685549; stroke: #000000" />
<ellipse cx="357.62441740148" cy="394.11193089797" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.62441740148" y="406.16700067502"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.397885856936px">O</text>
<ellipse cx="312.54395132266" cy="316.02798272449" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.54395132266" y="328.08305250154"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.397885856936px">O</text>
<ellipse cx="222.37930088177" cy="263.97201727551" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="222.37930088177" y="276.02708705256"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:27.397885856936px">O</text>
<ellipse cx="177.2951165197" cy="342.05596544898" rx="14.246900645607" ry="14.246900645607" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.2951165197" y="354.11103522604"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:27.397885856936px">N</text>
</g></svg>

✍: FYIcenter.com

2020-12-15, 120👍, 0💬