Molecule FYI-1000281

A

Molecule Summary:

ID: FYI-1000281
SMILES: COC(=O)OC1CN1[C@H](C(=O)OCc1ccccc1)C(C)C

Received at FYIcenter.com on: 2021-03-03

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000281
FYIcenter.com

 22 23  0  0  1  0  0  0  0  0999 V2000
    0.0000    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8499    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2499    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.5499    1.9124    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.5499    3.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7623    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7623    5.4124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.9747    3.3124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.1871    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3996    3.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.3996    1.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6120    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8244    1.9124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8244    3.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.6120    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3373    4.0124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3373    5.4124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1249    3.3124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  3  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  8  6  1  0  0  0  0
  9  8  1  1  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 14  1  0  0  0  0
 20  9  1  0  0  0  0
 21 20  1  0  0  0  0
 22 20  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="88.935526808272" x2="65.492763404136" y1="185.35537101151" y2="198.88933751287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="65.492763404136" x2="42.05" y1="198.88933751287" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="135.81718676897" x2="112.37635678862" y1="212.42330401422" y2="198.88933751287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="112.37635678862" x2="88.935526808272" y1="198.88933751287" y2="185.35537101151" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="139" x2="139" y1="267" y2="240" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="139" x2="139" y1="240" y2="213" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="133" x2="133" y1="267" y2="240" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="133" x2="133" y1="240" y2="213" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="182.69884672967" x2="159.25801674932" y1="185.35537101151" y2="198.88933751287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="159.25801674932" x2="135.81718676897" y1="198.88933751287" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="229.58824038552" x2="206.14354355759" y1="212.42330401422" y2="198.88933751287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="206.14354355759" x2="182.69884672967" y1="198.88933751287" y2="185.35537101151" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="283.72410639094" x2="256.65617338823" y1="212.42330401422" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="256.65617338823" x2="229.58824038552" y1="212.42330401422" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="256.65617338823" x2="270.19013988959" y1="259.30496397492" y2="235.86413399457" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #0000ff" />
<line x1="270.19013988959" x2="283.72410639094" y1="235.86413399457" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="256.65617338823" x2="243.12220688687" y1="259.30496397492" y2="235.86413399457" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #0000ff" />
<line x1="243.12220688687" x2="229.58824038552" y1="235.86413399457" y2="212.42330401422" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<polygon points=" 257,314 265,260 249,260" fill-opacity="1"  style="fill:#000000" />
<line x1="303.53783334893" x2="280.09700336858" y1="340.50876298306" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="280.09700336858" x2="256.65617338823" y1="326.97479648171" y2="313.44082998035" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="307" x2="307" y1="395" y2="368" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="307" x2="307" y1="368" y2="341" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="301" x2="301" y1="395" y2="368" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="301" x2="301" y1="368" y2="341" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="350.41949330963" x2="326.97866332928" y1="313.44082998035" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="326.97866332928" x2="303.53783334893" y1="326.97479648171" y2="340.50876298306" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="397.30115327033" x2="373.86032328998" y1="340.50876298306" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="373.86032328998" x2="350.41949330963" y1="326.97479648171" y2="313.44082998035" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #ff0000" />
<line x1="444.1866800786" x2="420.74391667446" y1="313.44082998035" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="420.74391667446" x2="397.30115327033" y1="326.97479648171" y2="340.50876298306" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="442" x2="442" y1="260" y2="287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="442" x2="442" y1="287" y2="314" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="448" x2="448" y1="260" y2="287" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="448" x2="448" y1="287" y2="314" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="491.0683400393" x2="467.62751005895" y1="232.23703097221" y2="245.77099747357" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="467.62751005895" x2="444.1866800786" y1="245.77099747357" y2="259.30496397492" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="540" x2="516.5" y1="257" y2="243.5" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="516.5" x2="493" y1="243.5" y2="230" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="537" x2="513.5" y1="262" y2="248.5" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="513.5" x2="490" y1="248.5" y2="235" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="313.44082998035" y2="286.37289697764" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="286.37289697764" y2="259.30496397492" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="493" x2="516.5" y1="343" y2="329.5" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="516.5" x2="540" y1="329.5" y2="316" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="490" x2="513.5" y1="339" y2="325" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="513.5" x2="537" y1="325" y2="311" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="491.0683400393" x2="467.62751005895" y1="340.50876298306" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="467.62751005895" x2="444.1866800786" y1="326.97479648171" y2="313.44082998035" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="209.76677973239" x2="233.21147656031" y1="340.50876298306" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="233.21147656031" x2="256.65617338823" y1="326.97479648171" y2="313.44082998035" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="209.76677973239" x2="209.76677973239" y1="394.64462898849" y2="367.57669598578" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="209.76677973239" x2="209.76677973239" y1="367.57669598578" y2="340.50876298306" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="162.88511977169" x2="186.32594975204" y1="313.44082998035" y2="326.97479648171" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<line x1="186.32594975204" x2="209.76677973239" y1="326.97479648171" y2="340.50876298306" style="stroke-opacity:1; stroke-width: 2.2794067035492; stroke: #000000" />
<ellipse cx="88.935526808272" cy="185.35537101151" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="88.935526808272" y="197.89210788103"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">O</text>
<ellipse cx="135.81718676897" cy="266.55917001965" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.81718676897" y="279.09590688917"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">O</text>
<ellipse cx="182.69884672967" cy="185.35537101151" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="182.69884672967" y="197.89210788103"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">O</text>
<ellipse cx="256.65617338823" cy="259.30496397492" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="256.65617338823" y="271.84170084444"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">N</text>
<ellipse cx="303.53783334893" cy="394.64462898849" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="303.53783334893" y="407.18136585801"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">O</text>
<ellipse cx="350.41949330963" cy="313.44082998035" rx="14.81614357307" ry="14.81614357307" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.41949330963" y="325.97756684987"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.492583794365px">O</text>
</g></svg>

✍: FYIcenter.com

2021-04-17, 225👍, 0💬