Molecule FYI-1000285


Molecule Summary:

ID: FYI-1000285
SMILES: CC(C)(O)c2ccc(C(=O)OCc1ccc(CCCBr)cc1)cc2

Received at on: 2021-03-04

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 28 30  0  0  0  0  0  0  0  0999 V2000
    2.4708    0.7133    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4708    2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.8190    2.5148    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417    2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1771    2.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4125    2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.6480    2.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8833    2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8833    0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1188    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.3542    0.7133    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.5896    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3542    2.1399    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1188    2.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2355    2.8531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1399    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.4708    3.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5758    4.8299    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7063    5.7062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417    4.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9417    3.5664    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6499    3.0223    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2355    4.2796    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.9930    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2355    7.1327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4708    6.4195    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3447    5.2973    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 11  1  0  0  0  0
 14 13  2  0  0  0  0
 14  8  1  0  0  0  0
 15  2  1  0  0  0  0
 16 15  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 22 17  1  0  0  0  0
 23 15  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 28 23  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="135" x2="135" y1="238" y2="212" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="135" x2="135" y1="212" y2="186" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #ff0000" />
<line x1="130" x2="130" y1="238" y2="212" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="130" x2="130" y1="212" y2="186" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #ff0000" />
<line x1="181.40966474363" x2="156.81098707835" y1="251.62774143463" y2="244.78747718844" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #ff0000" />
<line x1="156.81098707835" x2="132.21230941308" y1="244.78747718844" y2="237.94721294225" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="222.37826794019" x2="201.89396634191" y1="237.94721294225" y2="244.78747718844" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="201.89396634191" x2="181.40966474363" y1="244.78747718844" y2="251.62774143463" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #ff0000" />
<line x1="267.45942264673" x2="244.91884529346" y1="263.97269419262" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="244.91884529346" x2="222.37826794019" y1="250.95995356743" y2="237.94721294225" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="312.54057735327" x2="290" y1="237.94721294225" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="290" x2="267.45942264673" y1="250.95995356743" y2="263.97269419262" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="357.62538117384" x2="335.08297926355" y1="263.97269419262" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="335.08297926355" x2="312.54057735327" y1="250.95995356743" y2="237.94721294225" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="402.70288676635" x2="380.16413397009" y1="237.94721294225" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="380.16413397009" x2="357.62538117384" y1="250.95995356743" y2="263.97269419262" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="401" x2="401" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="401" x2="401" y1="212" y2="238" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="406" x2="406" y1="186" y2="212" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="406" x2="406" y1="212" y2="238" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="447.78769058692" x2="425.24528867664" y1="159.85982184906" y2="172.87438703126" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="425.24528867664" x2="402.70288676635" y1="172.87438703126" y2="185.88895221346" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="495" x2="472.5" y1="184" y2="171" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="472.5" x2="450" y1="171" y2="158" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="492" x2="469.5" y1="189" y2="176" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="469.5" x2="447" y1="176" y2="163" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="537.95" x2="515.40942264673" y1="159.85982184906" y2="172.87438703126" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #ff0000" />
<line x1="515.40942264673" x2="492.86884529346" y1="172.87438703126" y2="185.88895221346" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="492.86884529346" x2="492.86884529346" y1="237.94721294225" y2="211.91808257785" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="492.86884529346" x2="492.86884529346" y1="211.91808257785" y2="185.88895221346" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="450" x2="472.5" y1="267" y2="254" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="472.5" x2="495" y1="254" y2="241" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="447" x2="469.5" y1="262" y2="249" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="469.5" x2="492" y1="249" y2="236" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="447.78769058692" x2="425.24528867664" y1="263.97269419262" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="425.24528867664" x2="402.70288676635" y1="250.95995356743" y2="237.94721294225" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="87.134803820569" x2="109.67355661682" y1="263.97269419262" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="109.67355661682" x2="132.21230941308" y1="250.95995356743" y2="237.94721294225" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="42.05" x2="64.592401910284" y1="237.94721294225" y2="250.95995356743" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #db8802" />
<line x1="64.592401910284" x2="87.134803820569" y1="250.95995356743" y2="263.97269419262" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="132.21230941308" x2="109.67355661682" y1="290.00182455701" y2="276.98725937482" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="109.67355661682" x2="87.134803820569" y1="276.98725937482" y2="263.97269419262" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="139" x2="137" y1="336" y2="313" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="137" x2="135" y1="313" y2="290" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="134" x2="132" y1="337" y2="314" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="132" x2="130" y1="314" y2="291" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="177.29711323365" x2="156.67049618826" y1="368.08556653617" y2="352.09697342085" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="156.67049618826" x2="136.04387914287" y1="352.09697342085" y2="336.10838030553" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="222" x2="199" y1="340" y2="353" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="199" x2="176" y1="353" y2="366" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="224" x2="201.5" y1="345" y2="358" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="201.5" x2="179" y1="358" y2="371" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="222.37826794019" x2="222.37826794019" y1="290.00182455701" y2="316.03095492141" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="222.37826794019" x2="222.37826794019" y1="316.03095492141" y2="342.06008528581" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="175" x2="198.5" y1="273" y2="283" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="198.5" x2="222" y1="283" y2="293" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="177" x2="200.5" y1="268" y2="278" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="200.5" x2="224" y1="278" y2="288" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="175.23901292165" x2="153.72566116736" y1="270.14699512863" y2="280.07440984282" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="153.72566116736" x2="132.21230941308" y1="280.07440984282" y2="290.00182455701" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="87.134803820569" x2="87.134803820569" y1="316.02730580738" y2="290" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="87.134803820569" x2="87.134803820569" y1="290" y2="263.97269419262" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="44" x2="66.5" y1="345" y2="332" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="66.5" x2="89" y1="332" y2="319" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="41" x2="63.5" y1="340" y2="327" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="63.5" x2="86" y1="327" y2="314" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="394.11469690057" y2="368.08739109319" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="368.08739109319" y2="342.06008528581" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="89" x2="66.5" y1="418" y2="405" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="66.5" x2="44" y1="405" y2="392" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="86" x2="63.5" y1="423" y2="410" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="63.5" x2="41" y1="410" y2="397" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="132.21230941308" x2="109.67355661682" y1="394.11469690057" y2="407.12743752575" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="109.67355661682" x2="87.134803820569" y1="407.12743752575" y2="420.14017815094" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="125" x2="127.5" y1="354" y2="374.5" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="127.5" x2="130" y1="374.5" y2="395" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="131" x2="133" y1="353" y2="373.5" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="133" x2="135" y1="373.5" y2="394" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="127.6107766233" x2="107.37279022193" y1="353.16433927415" y2="334.59582254077" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<line x1="107.37279022193" x2="87.134803820569" y1="334.59582254077" y2="316.02730580738" style="stroke-opacity:1; stroke-width: 2.1594811938746; stroke: #000000" />
<ellipse cx="132.21230941308" cy="185.88895221346" rx="14.036627760185" ry="14.036627760185" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="132.21230941308" y="197.76609877977"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.993514923433px">O</text>
<ellipse cx="181.40966474363" cy="251.62774143463" rx="14.036627760185" ry="14.036627760185" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="181.40966474363" y="263.50488800094"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.993514923433px">O</text>
<ellipse cx="537.95" cy="159.85982184906" rx="14.036627760185" ry="14.036627760185" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="171.73696841537"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.993514923433px">O</text>
<ellipse cx="42.05" cy="237.94721294225" rx="14.036627760185" ry="14.036627760185" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="249.82435950856"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:26.993514923433px">Br</text>


2021-08-13, 198👍, 0💬