Molecule FYI-1000289

A

Molecule Summary:

ID: FYI-1000289
SMILES: C1[C@@H]([C@H](OC2=CC(=CC(=C21)O)OC(=O)C3=CC(=C(C(=C3)O)O)O)C4=CC(=C(C=C4)O)O)O

Received at FYIcenter.com on: 2021-03-09

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000289
FYIcenter.com

 32 35  0  0  1  0  0  0  0  0999 V2000
   10.9120    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    7.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    9.7999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120   10.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120   11.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994   12.5999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870   11.8999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870   10.4999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994   13.9999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244   12.5999    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 10  5  1  0  0  0  0
 10  1  1  0  0  0  0
 11  9  1  0  0  0  0
 12  7  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20 15  1  0  0  0  0
 21 19  1  0  0  0  0
 22 18  1  0  0  0  0
 23 17  1  0  0  0  0
  3 24  1  6  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 27  1  0  0  0  0
 29 28  2  0  0  0  0
 29 24  1  0  0  0  0
 30 27  1  0  0  0  0
 31 26  1  0  0  0  0
  2 32  1  1  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="461.78807134337" x2="461.78807134337" y1="314.79694819249" y2="290.00177108408" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="461.78807134337" x2="461.78807134337" y1="290.00177108408" y2="265.20659397567" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418.83574025529" x2="440.31190579933" y1="339.5921253009" y2="327.19453674669" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="440.31190579933" x2="461.78807134337" y1="327.19453674669" y2="314.79694819249" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375.89049350353" x2="397.36311687941" y1="314.79694819249" y2="327.19453674669" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="397.36311687941" x2="418.83574025529" y1="327.19453674669" y2="339.5921253009" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375.89049350353" x2="375.89049350353" y1="265.20659397567" y2="290.00177108408" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375.89049350353" x2="375.89049350353" y1="290.00177108408" y2="314.79694819249" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="332" x2="353.5" y1="243" y2="255.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="353.5" x2="375" y1="255.5" y2="268" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="335" x2="356.5" y1="239" y2="251" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="356.5" x2="378" y1="251" y2="263" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="332.94524675176" x2="332.94524675176" y1="190.82106265045" y2="215.61623975886" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="332.94524675176" x2="332.94524675176" y1="215.61623975886" y2="240.41141686726" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375" x2="353.5" y1="164" y2="176.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="353.5" x2="332" y1="176.5" y2="189" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="378" x2="356.5" y1="169" y2="181.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="356.5" x2="335" y1="181.5" y2="194" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418.83574025529" x2="397.36311687941" y1="190.82106265045" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="397.36311687941" x2="375.89049350353" y1="178.42347409624" y2="166.02588554204" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="422" x2="422" y1="241" y2="216" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="422" x2="422" y1="216" y2="191" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="417" x2="417" y1="241" y2="216" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="417" x2="417" y1="216" y2="191" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418.83574025529" x2="397.36311687941" y1="240.41141686726" y2="252.80900542147" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="397.36311687941" x2="375.89049350353" y1="252.80900542147" y2="265.20659397567" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418.83574025529" x2="440.31190579933" y1="240.41141686726" y2="252.80900542147" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="440.31190579933" x2="461.78807134337" y1="252.80900542147" y2="265.20659397567" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="461.78807134337" x2="440.31190579933" y1="166.02588554204" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="440.31190579933" x2="418.83574025529" y1="178.42347409624" y2="190.82106265045" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="290" x2="311.47262337588" y1="166.02588554204" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="311.47262337588" x2="332.94524675176" y1="178.42347409624" y2="190.82106265045" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="247.05121108008" x2="268.52560554004" y1="190.82106265045" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="268.52560554004" x2="290" y1="178.42347409624" y2="166.02588554204" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="250" x2="250" y1="241" y2="216" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="250" x2="250" y1="216" y2="191" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="245" x2="245" y1="241" y2="216" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="245" x2="245" y1="216" y2="191" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="204.10596432832" x2="225.5785877042" y1="166.02588554204" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="225.5785877042" x2="247.05121108008" y1="178.42347409624" y2="190.82106265045" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="163" x2="184.5" y1="194" y2="181.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="184.5" x2="206" y1="181.5" y2="169" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="160" x2="181.5" y1="189" y2="176.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="181.5" x2="203" y1="176.5" y2="164" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="118.21192865663" x2="139.68632311659" y1="166.02588554204" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="139.68632311659" x2="161.16071757655" y1="178.42347409624" y2="190.82106265045" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="116" x2="116" y1="117" y2="142" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="116" x2="116" y1="142" y2="167" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="121" x2="121" y1="117" y2="142" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="121" x2="121" y1="142" y2="167" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="161.16071757655" x2="139.68632311659" y1="91.640354216816" y2="104.03794277102" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="139.68632311659" x2="118.21192865663" y1="104.03794277102" y2="116.43553132522" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="206" x2="184.5" y1="115" y2="102.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="184.5" x2="163" y1="102.5" y2="90" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="203" x2="181.5" y1="119" y2="106.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="181.5" x2="160" y1="106.5" y2="94" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="204.10596432832" x2="204.10596432832" y1="116.43553132522" y2="141.23070843363" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="204.10596432832" x2="204.10596432832" y1="141.23070843363" y2="166.02588554204" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="161.16071757655" x2="161.16071757655" y1="42.05" y2="66.845177108408" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="161.16071757655" x2="161.16071757655" y1="66.845177108408" y2="91.640354216816" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="75.266681904871" x2="96.739305280752" y1="91.640354216816" y2="104.03794277102" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="96.739305280752" x2="118.21192865663" y1="104.03794277102" y2="116.43553132522" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="75.266681904871" x2="96.739305280752" y1="190.82106265045" y2="178.42347409624" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="96.739305280752" x2="118.21192865663" y1="178.42347409624" y2="166.02588554204" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<polygon points=" 419,340 412,390 427,390" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="464" x2="442.5" y1="412" y2="399.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="442.5" x2="421" y1="399.5" y2="387" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="461" x2="439.5" y1="417" y2="404.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="439.5" x2="418" y1="404.5" y2="392" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="461.78807134337" x2="461.78807134337" y1="463.56446867478" y2="438.76929156637" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="461.78807134337" x2="461.78807134337" y1="438.76929156637" y2="413.97411445796" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="421" x2="442.5" y1="491" y2="478.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="442.5" x2="464" y1="478.5" y2="466" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418" x2="439.5" y1="487" y2="474.5" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="439.5" x2="461" y1="474.5" y2="462" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375.89049350353" x2="397.36311687941" y1="463.56446867478" y2="475.96205722898" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="397.36311687941" x2="418.83574025529" y1="475.96205722898" y2="488.35964578318" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="374" x2="374" y1="414" y2="439" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="374" x2="374" y1="439" y2="464" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="379" x2="379" y1="414" y2="439" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="379" x2="379" y1="439" y2="464" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="375.89049350353" x2="397.36311687941" y1="413.97411445796" y2="401.57652590376" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="397.36311687941" x2="418.83574025529" y1="401.57652590376" y2="389.17893734955" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="418.83574025529" x2="418.83574025529" y1="537.95" y2="513.15482289159" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="418.83574025529" x2="418.83574025529" y1="513.15482289159" y2="488.35964578318" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<line x1="504.73331809513" x2="483.26069471925" y1="488.35964578318" y2="475.96205722898" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #ff0000" />
<line x1="483.26069471925" x2="461.78807134337" y1="475.96205722898" y2="463.56446867478" style="stroke-opacity:1; stroke-width: 2.0880346292761; stroke: #000000" />
<polygon points=" 462,315 502,347 509,334" fill-opacity="1"  style="fill:#000000" />
<ellipse cx="375.89049350353" cy="314.79694819249" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="375.89049350353" y="326.28113865351"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="461.78807134337" cy="166.02588554204" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="461.78807134337" y="177.51007600306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="290" cy="166.02588554204" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="177.51007600306"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="247.05121108008" cy="240.41141686726" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="247.05121108008" y="251.89560732828"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="161.16071757655" cy="42.05" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="161.16071757655" y="53.534190461019"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="75.266681904871" cy="91.640354216816" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.266681904871" y="103.12454467783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="75.266681904871" cy="190.82106265045" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="75.266681904871" y="202.30525311147"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="418.83574025529" cy="537.95" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="418.83574025529" y="549.43419046102"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="504.73331809513" cy="488.35964578318" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="504.73331809513" y="499.8438362442"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
<ellipse cx="504.73331809513" cy="339.5921253009" rx="13.572225090295" ry="13.572225090295" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="504.73331809513" y="351.07631576191"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:26.100432865951px">O</text>
</g></svg>

✍: FYIcenter.com

2022-05-31, 140👍, 0💬