Molecule FYI-1000293

A

Molecule Summary:

ID: FYI-1000293
SMILES: CCCCC(CC)C(=O)[O-].CCCCC(CC)C(=O)[O-].[Ca+2]

Received at FYIcenter.com on: 2021-03-15

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000293
FYIcenter.com

 21 18  0  0  0  0  0  0  0  0999 V2000
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.1000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
   18.7493    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.5368    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.3244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1120    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8996    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8996    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1120    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6871    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.4747    2.1000    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    9.3747    2.1000    0.0000 Ca  0  2  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  2  0  0  0  0
 10  8  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 15  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="74.119397257498" x2="58.084698628749" y1="271.4857087998" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="58.084698628749" x2="42.05" y1="280.7428543999" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="106.18614961625" x2="90.152773436875" y1="290" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="90.152773436875" x2="74.119397257498" y1="280.7428543999" y2="271.4857087998" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="138.25290197501" x2="122.21952579563" y1="271.4857087998" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="122.21952579563" x2="106.18614961625" y1="280.7428543999" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="170.31965433376" x2="154.28627815438" y1="290" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="154.28627815438" x2="138.25290197501" y1="280.7428543999" y2="271.4857087998" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="170.31965433376" x2="170.31965433376" y1="327.02858240041" y2="308.5142912002" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="170.31965433376" x2="170.31965433376" y1="308.5142912002" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="138.25290197501" x2="154.28627815438" y1="345.54287360061" y2="336.28572800051" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="154.28627815438" x2="170.31965433376" y1="336.28572800051" y2="327.02858240041" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="202.39169649" x2="186.35567541188" y1="271.4857087998" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="186.35567541188" x2="170.31965433376" y1="280.7428543999" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="201" x2="201" y1="235" y2="253.5" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="201" x2="201" y1="253.5" y2="272" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="205" x2="205" y1="235" y2="253.5" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="205" x2="205" y1="253.5" y2="272" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="234.45844884876" x2="218.42507266938" y1="290" y2="280.7428543999" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="218.42507266938" x2="202.39169649" y1="280.7428543999" y2="271.4857087998" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="505.8806027425" x2="521.91530137125" y1="308.5142912002" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="521.91530137125" x2="537.95" y1="299.2571456001" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="473.81385038375" x2="489.84722656312" y1="290" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="489.84722656312" x2="505.8806027425" y1="299.2571456001" y2="308.5142912002" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="441.74709802499" x2="457.78047420437" y1="308.5142912002" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="457.78047420437" x2="473.81385038375" y1="299.2571456001" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="409.68034566624" x2="425.71372184562" y1="290" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="425.71372184562" x2="441.74709802499" y1="299.2571456001" y2="308.5142912002" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="409.68034566624" x2="409.68034566624" y1="252.97141759959" y2="271.4857087998" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="409.68034566624" x2="409.68034566624" y1="271.4857087998" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="441.74709802499" x2="425.71372184562" y1="234.45712639939" y2="243.71427199949" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="425.71372184562" x2="409.68034566624" y1="243.71427199949" y2="252.97141759959" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="377.61094840874" x2="393.64564703749" y1="308.5142912002" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="393.64564703749" x2="409.68034566624" y1="299.2571456001" y2="290" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="380" x2="380" y1="346" y2="327.5" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="380" x2="380" y1="327.5" y2="309" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="376" x2="376" y1="346" y2="327.5" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="376" x2="376" y1="327.5" y2="309" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<line x1="345.54419604999" x2="361.57757222936" y1="290" y2="299.2571456001" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #ff0000" />
<line x1="361.57757222936" x2="377.61094840874" y1="299.2571456001" y2="308.5142912002" style="stroke-opacity:1; stroke-width: 1.55910325047; stroke: #000000" />
<ellipse cx="202.39169649" cy="234.45712639939" rx="10.134171128055" ry="10.134171128055" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="202.39169649" y="243.03219427697"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.488790630875px">O</text>
<ellipse cx="234.45844884876" cy="290" rx="10.134171128055" ry="10.134171128055" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="234.45844884876" y="298.57506787758"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.488790630875px">O<tspan baseline-shift='super' font-size='9.7443953154373'>-</tspan></text>
<ellipse cx="377.61094840874" cy="345.54287360061" rx="10.134171128055" ry="10.134171128055" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="377.61094840874" y="354.1179414782"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.488790630875px">O</text>
<ellipse cx="345.54419604999" cy="290" rx="10.134171128055" ry="10.134171128055" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="345.54419604999" y="298.57506787758"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:19.488790630875px">O<tspan baseline-shift='super' font-size='9.7443953154373'>-</tspan></text>
<ellipse cx="290.00132244937" cy="290" rx="10.134171128055" ry="10.134171128055" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00132244937" y="298.57506787758"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:19.488790630875px">Ca<tspan baseline-shift='super' font-size='9.7443953154373'>2+</tspan></text>
</g></svg>

✍: FYIcenter.com

2022-05-31, 140👍, 0💬