Molecule FYI-1000291

A

Molecule Summary:

ID: FYI-1000291
SMILES: CCN(CC)CCOC(=O)C1=CC=C(C=C1)N

Received at FYIcenter.com on: 2021-03-15

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000291
FYIcenter.com

 17 17  0  0  0  0  0  0  0  0999 V2000
   12.1244    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  3  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 16 11  1  0  0  0  0
 17 14  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36163603972" x2="513.15581801986" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="513.15581801986" x2="537.95" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="438.76509188084" x2="463.56336396028" y1="304.31534756359" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #0000ff" />
<line x1="463.56336396028" x2="488.36163603972" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="438.76509188084" x2="438.76509188084" y1="361.57673781795" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="438.76509188084" x2="438.76509188084" y1="332.94604269077" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #0000ff" />
<line x1="389.17672792056" x2="413.9709099007" y1="390.20743294514" y2="375.89208538154" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="413.9709099007" x2="438.76509188084" y1="375.89208538154" y2="361.57673781795" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="389.17672792056" x2="413.9709099007" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="413.9709099007" x2="438.76509188084" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #0000ff" />
<line x1="339.59245405958" x2="364.38459099007" y1="304.31534756359" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="364.38459099007" x2="389.17672792056" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="290.0040900993" x2="314.79827207944" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #ff0000" />
<line x1="314.79827207944" x2="339.59245405958" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="240.40754594042" x2="265.20581801986" y1="304.31534756359" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="265.20581801986" x2="290.0040900993" y1="290" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #ff0000" />
<line x1="244" x2="244" y1="362" y2="333.5" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #ff0000" />
<line x1="244" x2="244" y1="333.5" y2="305" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="238" x2="238" y1="362" y2="333.5" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #ff0000" />
<line x1="238" x2="238" y1="333.5" y2="305" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="190.81918198014" x2="215.61336396028" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="215.61336396028" x2="240.40754594042" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="143" x2="168" y1="307" y2="293" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="168" x2="193" y1="293" y2="279" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="140" x2="165" y1="302" y2="288" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="165" x2="190" y1="288" y2="274" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="91.638363960278" x2="116.43459099007" y1="275.68465243641" y2="290" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="116.43459099007" x2="141.23081801986" y1="290" y2="304.31534756359" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="89" x2="89" y1="219" y2="247.5" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="89" x2="89" y1="247.5" y2="276" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="95" x2="95" y1="219" y2="247.5" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="95" x2="95" y1="247.5" y2="276" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="141.23081801986" x2="116.43459099007" y1="189.79256705486" y2="204.10791461846" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="116.43459099007" x2="91.638363960278" y1="204.10791461846" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="193" x2="168" y1="216" y2="202" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="168" x2="143" y1="202" y2="188" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="190" x2="165" y1="222" y2="207.5" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="165" x2="140" y1="207.5" y2="193" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="218.42326218205" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="247.05395730923" y2="275.68465243641" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<line x1="42.05" x2="66.844181980139" y1="189.79256705486" y2="204.10791461846" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #0000ff" />
<line x1="66.844181980139" x2="91.638363960278" y1="204.10791461846" y2="218.42326218205" style="stroke-opacity:1; stroke-width: 2.4109783858592; stroke: #000000" />
<ellipse cx="438.76509188084" cy="304.31534756359" rx="15.671359508085" ry="15.671359508085" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="438.76509188084" y="317.57572868582"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137229823241px">N</text>
<ellipse cx="290.0040900993" cy="275.68465243641" rx="15.671359508085" ry="15.671359508085" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.0040900993" y="288.94503355864"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137229823241px">O</text>
<ellipse cx="240.40754594042" cy="361.57673781795" rx="15.671359508085" ry="15.671359508085" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="240.40754594042" y="374.83711894018"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137229823241px">O</text>
<ellipse cx="42.05" cy="189.79256705486" rx="15.671359508085" ry="15.671359508085" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="203.05294817709"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137229823241px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-31, 127👍, 0💬