Collections:
Molecule FYI-1000211
Molecule Summary:
ID: FYI-1000211
SMILES: COC1=C(Cl)C=C(Cl)C(NC2=C(C=NC3=CC(OCCCN4CCN(C)CC4)=C(OC)C=C23)C#N)=C1
Received at FYIcenter.com on: 2020-12-22
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000211 FYIcenter.com 36 39 0 0 0 0 0 0 0 0999 V2000 15.7618 9.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9742 8.4000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 16.9742 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 18.1866 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 19.3990 7.0000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 18.1866 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9742 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 16.9742 2.8000 0.0000 Cl 0 0 0 0 0 0 0 0 0 0 0 0 15.7618 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5492 4.2000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3368 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 6.3000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 4.9000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6995 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4871 2.1000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2747 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.0623 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 0.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9120 0.7000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.1244 4.2000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5492 7.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 15.7618 7.7000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 15.7618 6.3000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 2 0 0 0 0 5 4 1 0 0 0 0 6 4 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 7 1 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 13 12 1 0 0 0 0 14 13 2 0 0 0 0 15 14 1 0 0 0 0 16 15 2 0 0 0 0 17 16 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 23 22 1 0 0 0 0 24 23 1 0 0 0 0 25 24 1 0 0 0 0 26 25 1 0 0 0 0 27 25 1 0 0 0 0 28 27 1 0 0 0 0 28 22 1 0 0 0 0 29 17 2 0 0 0 0 30 29 1 0 0 0 0 31 30 1 0 0 0 0 32 29 1 0 0 0 0 33 32 2 0 0 0 0 33 11 1 0 0 0 0 33 15 1 0 0 0 0 34 12 1 0 0 0 0 35 34 3 0 0 0 0 36 9 2 0 0 0 0 36 3 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="475.964417238" x2="460.4680215475" y1="388.41821743389" y2="397.3653281097" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="460.4680215475" x2="444.971625857" y1="397.3653281097" y2="406.3124387855" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="475.964417238" x2="475.964417238" y1="352.62977473066" y2="370.52399608227" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="475.964417238" x2="475.964417238" y1="370.52399608227" y2="388.41821743389" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="507" x2="491.5" y1="334" y2="342.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="491.5" x2="476" y1="342.5" y2="351" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="508" x2="492.5" y1="337" y2="346" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="492.5" x2="477" y1="346" y2="355" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="537.95" x2="522.4536043095" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #00bc00" /> <line x1="522.4536043095" x2="506.957208619" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="506.957208619" x2="506.957208619" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="506.957208619" x2="506.957208619" y1="316.84133202742" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="476" x2="491.5" y1="283" y2="292" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="491.5" x2="507" y1="292" y2="301" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="477" x2="492.5" y1="280" y2="289" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="492.5" x2="508" y1="289" y2="298" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="475.964417238" x2="475.964417238" y1="245.26444662096" y2="263.15866797258" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #00bc00" /> <line x1="475.964417238" x2="475.964417238" y1="263.15866797258" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444.971625857" x2="460.4680215475" y1="298.94711067581" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="460.4680215475" x2="475.964417238" y1="290" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="413.97372184133" x2="429.47267384917" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="429.47267384917" x2="444.971625857" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="382.98093046033" x2="398.47732615083" y1="298.94711067581" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="398.47732615083" x2="413.97372184133" y1="290" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="385" x2="385" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="385" x2="385" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="382" x2="382" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="382" x2="382" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351.98813907933" x2="367.48453476983" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="367.48453476983" x2="382.98093046033" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="321" x2="336.5" y1="337" y2="346" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="336.5" x2="352" y1="346" y2="355" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="322" x2="337.5" y1="334" y2="342.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="337.5" x2="353" y1="342.5" y2="351" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="320.99534769833" x2="320.99534769833" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="320.99534769833" x2="320.99534769833" y1="316.84133202742" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="290" x2="305.5" y1="283" y2="292" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="305.5" x2="321" y1="292" y2="301" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="291" x2="306.5" y1="280" y2="289" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="306.5" x2="322" y1="289" y2="298" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="290" x2="290" y1="245.26444662096" y2="263.15866797258" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="290" x2="290" y1="263.15866797258" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="259.007208619" x2="274.5036043095" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="274.5036043095" x2="290" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="228.014417238" x2="243.5108129285" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="243.5108129285" x2="259.007208619" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="197.021625857" x2="212.5180215475" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="212.5180215475" x2="228.014417238" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="166.02372184133" x2="181.52267384917" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="181.52267384917" x2="197.021625857" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="135.03093046033" x2="150.52732615083" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="150.52732615083" x2="166.02372184133" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="104.03813907933" x2="119.53453476983" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="119.53453476983" x2="135.03093046033" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="73.042791380999" x2="88.540465230166" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="88.540465230166" x2="104.03813907933" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="73.042791380999" x2="73.042791380999" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="73.042791380999" x2="73.042791380999" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="42.05" x2="57.546395690499" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="57.546395690499" x2="73.042791380999" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="104.03813907933" x2="88.540465230166" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="88.540465230166" x2="73.042791380999" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="135.03093046033" x2="119.53453476983" y1="191.58178256611" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="119.53453476983" x2="104.03813907933" y1="182.6346718903" y2="173.6875612145" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="135.03093046033" x2="135.03093046033" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="135.03093046033" x2="135.03093046033" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="321" x2="305.5" y1="226" y2="235" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="305.5" x2="290" y1="235" y2="244" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="322" x2="306.5" y1="230" y2="238.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="306.5" x2="291" y1="238.5" y2="247" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="320.99534769833" x2="320.99534769833" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="320.99534769833" x2="320.99534769833" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351.98813907933" x2="336.49174338883" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="336.49174338883" x2="320.99534769833" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" /> <line x1="351.98813907933" x2="336.49174338883" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="336.49174338883" x2="320.99534769833" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="354" x2="354" y1="282" y2="264" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="354" x2="354" y1="264" y2="246" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351" x2="351" y1="282" y2="264" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351" x2="351" y1="264" y2="246" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351.98813907933" x2="367.48453476983" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="367.48453476983" x2="382.98093046033" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="351.98813907933" x2="336.49174338883" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="336.49174338883" x2="320.99534769833" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="413.97372184133" x2="398.47732615083" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="398.47732615083" x2="382.98093046033" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="447" x2="431.5" y1="368" y2="359" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="431.5" x2="416" y1="359" y2="350" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444" x2="428.5" y1="374" y2="365" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="428.5" x2="413" y1="365" y2="356" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444.971625857" x2="429.47267384917" y1="370.52399608227" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" /> <line x1="429.47267384917" x2="413.97372184133" y1="361.57688540646" y2="352.62977473066" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="447" x2="447" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="447" x2="447" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444" x2="444" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444" x2="444" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="444.971625857" x2="460.4680215475" y1="334.73555337904" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <line x1="460.4680215475" x2="475.964417238" y1="343.68266405485" y2="352.62977473066" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" /> <ellipse cx="475.964417238" cy="388.41821743389" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="396.70605874238" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">O</text> <ellipse cx="537.95" cy="352.62977473066" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="360.91761603915" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">Cl</text> <ellipse cx="475.964417238" cy="245.26444662096" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="253.55228792945" fill="#00bc00" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">Cl</text> <ellipse cx="413.97372184133" cy="281.05288932419" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.97372184133" y="289.34073063268" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">N</text> <ellipse cx="320.99534769833" cy="334.73555337904" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.99534769833" y="343.02339468753" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">N</text> <ellipse cx="259.007208619" cy="227.37022526934" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.007208619" y="235.65806657783" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">O</text> <ellipse cx="135.03093046033" cy="227.37022526934" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.03093046033" y="235.65806657783" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">N</text> <ellipse cx="73.042791380999" cy="191.58178256611" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="73.042791380999" y="199.8696238746" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">N</text> <ellipse cx="320.99534769833" cy="191.58178256611" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.99534769833" y="199.8696238746" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">O</text> <ellipse cx="444.971625857" cy="370.52399608227" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="444.971625857" y="378.81183739076" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:18.836002973842px">N</text> </g></svg>
✍: FYIcenter.com
2021-08-01, 262👍, 0💬
Popular Posts:
How to view the molecule structure specified in a SDF/Mol file? To help you to view the molecule str...
How to display the InChi string and InChi Key of the molecule in JSME editor? JSME does not offer an...
Where to find FAQ (Frequently Asked Questions) on molecule online tools? I want to use them to creat...
How to convert Convert SDF to SVG (Scalable Vector Graphics) using "sdf2svg" PHP script? I want to s...
How to use "babel -o fpt ..." command to do similarity search? You can use the "fpt" output file for...