Molecule FYI-1000211

A

Molecule Summary:

ID: FYI-1000211
SMILES: COC1=C(Cl)C=C(Cl)C(NC2=C(C=NC3=CC(OCCCN4CCN(C)CC4)=C(OC)C=C23)C#N)=C1

Received at FYIcenter.com on: 2020-12-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000211
FYIcenter.com

 36 39  0  0  0  0  0  0  0  0999 V2000
   15.7618    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    8.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   19.3990    7.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   18.1866    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9742    2.8000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   15.7618    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7618    7.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   15.7618    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  4  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 28 22  1  0  0  0  0
 29 17  2  0  0  0  0
 30 29  1  0  0  0  0
 31 30  1  0  0  0  0
 32 29  1  0  0  0  0
 33 32  2  0  0  0  0
 33 11  1  0  0  0  0
 33 15  1  0  0  0  0
 34 12  1  0  0  0  0
 35 34  3  0  0  0  0
 36  9  2  0  0  0  0
 36  3  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="475.964417238" x2="460.4680215475" y1="388.41821743389" y2="397.3653281097" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="460.4680215475" x2="444.971625857" y1="397.3653281097" y2="406.3124387855" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="475.964417238" x2="475.964417238" y1="352.62977473066" y2="370.52399608227" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="475.964417238" x2="475.964417238" y1="370.52399608227" y2="388.41821743389" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="507" x2="491.5" y1="334" y2="342.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="491.5" x2="476" y1="342.5" y2="351" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="508" x2="492.5" y1="337" y2="346" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="492.5" x2="477" y1="346" y2="355" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="537.95" x2="522.4536043095" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #00bc00" />
<line x1="522.4536043095" x2="506.957208619" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="506.957208619" x2="506.957208619" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="506.957208619" x2="506.957208619" y1="316.84133202742" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="476" x2="491.5" y1="283" y2="292" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="491.5" x2="507" y1="292" y2="301" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="477" x2="492.5" y1="280" y2="289" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="492.5" x2="508" y1="289" y2="298" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="475.964417238" x2="475.964417238" y1="245.26444662096" y2="263.15866797258" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #00bc00" />
<line x1="475.964417238" x2="475.964417238" y1="263.15866797258" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444.971625857" x2="460.4680215475" y1="298.94711067581" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="460.4680215475" x2="475.964417238" y1="290" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="413.97372184133" x2="429.47267384917" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="429.47267384917" x2="444.971625857" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="382.98093046033" x2="398.47732615083" y1="298.94711067581" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="398.47732615083" x2="413.97372184133" y1="290" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="385" x2="385" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="385" x2="385" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="382" x2="382" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="382" x2="382" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351.98813907933" x2="367.48453476983" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="367.48453476983" x2="382.98093046033" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="321" x2="336.5" y1="337" y2="346" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="336.5" x2="352" y1="346" y2="355" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="322" x2="337.5" y1="334" y2="342.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="337.5" x2="353" y1="342.5" y2="351" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="320.99534769833" x2="320.99534769833" y1="298.94711067581" y2="316.84133202742" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="320.99534769833" x2="320.99534769833" y1="316.84133202742" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="290" x2="305.5" y1="283" y2="292" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="305.5" x2="321" y1="292" y2="301" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="291" x2="306.5" y1="280" y2="289" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="306.5" x2="322" y1="289" y2="298" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="290" x2="290" y1="245.26444662096" y2="263.15866797258" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="290" x2="290" y1="263.15866797258" y2="281.05288932419" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="259.007208619" x2="274.5036043095" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="274.5036043095" x2="290" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="228.014417238" x2="243.5108129285" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="243.5108129285" x2="259.007208619" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="197.021625857" x2="212.5180215475" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="212.5180215475" x2="228.014417238" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="166.02372184133" x2="181.52267384917" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="181.52267384917" x2="197.021625857" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="135.03093046033" x2="150.52732615083" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="150.52732615083" x2="166.02372184133" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="104.03813907933" x2="119.53453476983" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="119.53453476983" x2="135.03093046033" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="73.042791380999" x2="88.540465230166" y1="227.37022526934" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="88.540465230166" x2="104.03813907933" y1="236.31733594515" y2="245.26444662096" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="73.042791380999" x2="73.042791380999" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="73.042791380999" x2="73.042791380999" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="42.05" x2="57.546395690499" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="57.546395690499" x2="73.042791380999" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="104.03813907933" x2="88.540465230166" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="88.540465230166" x2="73.042791380999" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="135.03093046033" x2="119.53453476983" y1="191.58178256611" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="119.53453476983" x2="104.03813907933" y1="182.6346718903" y2="173.6875612145" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="135.03093046033" x2="135.03093046033" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="135.03093046033" x2="135.03093046033" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="321" x2="305.5" y1="226" y2="235" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="305.5" x2="290" y1="235" y2="244" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="322" x2="306.5" y1="230" y2="238.5" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="306.5" x2="291" y1="238.5" y2="247" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="320.99534769833" x2="320.99534769833" y1="191.58178256611" y2="209.47600391773" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="320.99534769833" x2="320.99534769833" y1="209.47600391773" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351.98813907933" x2="336.49174338883" y1="173.6875612145" y2="182.6346718903" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="336.49174338883" x2="320.99534769833" y1="182.6346718903" y2="191.58178256611" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #ff0000" />
<line x1="351.98813907933" x2="336.49174338883" y1="245.26444662096" y2="236.31733594515" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="336.49174338883" x2="320.99534769833" y1="236.31733594515" y2="227.37022526934" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="354" x2="354" y1="282" y2="264" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="354" x2="354" y1="264" y2="246" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351" x2="351" y1="282" y2="264" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351" x2="351" y1="264" y2="246" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351.98813907933" x2="367.48453476983" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="367.48453476983" x2="382.98093046033" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="351.98813907933" x2="336.49174338883" y1="281.05288932419" y2="290" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="336.49174338883" x2="320.99534769833" y1="290" y2="298.94711067581" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="413.97372184133" x2="398.47732615083" y1="352.62977473066" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="398.47732615083" x2="382.98093046033" y1="343.68266405485" y2="334.73555337904" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="447" x2="431.5" y1="368" y2="359" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="431.5" x2="416" y1="359" y2="350" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444" x2="428.5" y1="374" y2="365" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="428.5" x2="413" y1="365" y2="356" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444.971625857" x2="429.47267384917" y1="370.52399608227" y2="361.57688540646" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #0000ff" />
<line x1="429.47267384917" x2="413.97372184133" y1="361.57688540646" y2="352.62977473066" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="447" x2="447" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="447" x2="447" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444" x2="444" y1="335" y2="317" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444" x2="444" y1="317" y2="299" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="444.971625857" x2="460.4680215475" y1="334.73555337904" y2="343.68266405485" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<line x1="460.4680215475" x2="475.964417238" y1="343.68266405485" y2="352.62977473066" style="stroke-opacity:1; stroke-width: 1.5068802379073; stroke: #000000" />
<ellipse cx="475.964417238" cy="388.41821743389" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="396.70605874238"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">O</text>
<ellipse cx="537.95" cy="352.62977473066" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="360.91761603915"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">Cl</text>
<ellipse cx="475.964417238" cy="245.26444662096" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="475.964417238" y="253.55228792945"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">Cl</text>
<ellipse cx="413.97372184133" cy="281.05288932419" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.97372184133" y="289.34073063268"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">N</text>
<ellipse cx="320.99534769833" cy="334.73555337904" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.99534769833" y="343.02339468753"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">N</text>
<ellipse cx="259.007208619" cy="227.37022526934" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="259.007208619" y="235.65806657783"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">O</text>
<ellipse cx="135.03093046033" cy="227.37022526934" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.03093046033" y="235.65806657783"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">N</text>
<ellipse cx="73.042791380999" cy="191.58178256611" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="73.042791380999" y="199.8696238746"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">N</text>
<ellipse cx="320.99534769833" cy="191.58178256611" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="320.99534769833" y="199.8696238746"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">O</text>
<ellipse cx="444.971625857" cy="370.52399608227" rx="9.7947215463977" ry="9.7947215463977" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="444.971625857" y="378.81183739076"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.836002973842px">N</text>
</g></svg>

✍: FYIcenter.com

2021-08-01, 175👍, 0💬