Molecule FYI-1000215


Molecule Summary:

ID: FYI-1000215
SMILES: C(CC[C@@H](C(=O)O)NC(=O)C1=CC=C(NCC2=CN=C3N=C(N)NC(=O)C3=N2)C=C1)(=O)O

Received at on: 2020-12-29

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 32 34  0  0  1  0  0  0  0  0999 V2000
    1.2124   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   14.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   14.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124   16.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   14.7000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   14.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   14.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497   12.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    9.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    8.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    5.6000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    5.6000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622   11.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.8000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  5  1  0  0  0  0
  4  8  1  1  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11  9  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 22  1  0  0  0  0
 24 22  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 25  1  0  0  0  0
 27 20  1  0  0  0  0
 28 27  2  0  0  0  0
 28 17  1  0  0  0  0
 29 14  1  0  0  0  0
 30 29  2  0  0  0  0
 30 11  1  0  0  0  0
 31  1  2  0  0  0  0
 32  1  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="215.31006770186" x2="215.31006770186" y1="408.5847826087" y2="387.02391304348" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="215.31006770186" x2="215.31006770186" y1="387.02391304348" y2="365.46304347826" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252.65657391304" x2="233.98332080745" y1="430.14565217391" y2="419.3652173913" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="233.98332080745" x2="215.31006770186" y1="419.3652173913" y2="408.5847826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252.65657391304" x2="252.65657391304" y1="473.26739130435" y2="451.70652173913" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252.65657391304" x2="252.65657391304" y1="451.70652173913" y2="430.14565217391" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="215.31006770186" x2="233.98332080745" y1="494.82826086957" y2="484.04782608696" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="233.98332080745" x2="252.65657391304" y1="484.04782608696" y2="473.26739130435" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="177" x2="196" y1="476" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="196" x2="215" y1="486.5" y2="497" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="180" x2="198.5" y1="472" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="198.5" x2="217" y1="482.5" y2="493" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="215.31006770186" x2="215.31006770186" y1="537.95" y2="516.38913043478" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="215.31006770186" x2="215.31006770186" y1="516.38913043478" y2="494.82826086957" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<polygon points=" 253,474 287,501 294,490" fill-opacity="1"  style="fill:#000000" />
<line x1="327.34342608696" x2="308.67171304348" y1="473.26739130435" y2="484.04782608696" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308.67171304348" x2="290" y1="484.04782608696" y2="494.82826086957" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="366" x2="347.5" y1="493" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="347.5" x2="329" y1="482.5" y2="472" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364" x2="345.5" y1="497" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="345.5" x2="327" y1="486.5" y2="476" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="327.34342608696" y1="430.14565217391" y2="451.70652173913" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="327.34342608696" y1="451.70652173913" y2="473.26739130435" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="289" x2="308" y1="411" y2="422" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308" x2="327" y1="422" y2="433" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="292" x2="310.5" y1="407" y2="418" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="310.5" x2="329" y1="418" y2="429" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="290" x2="290" y1="365.46304347826" y2="387.02391304348" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="290" x2="290" y1="387.02391304348" y2="408.5847826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327" x2="308" y1="342" y2="353" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308" x2="289" y1="353" y2="364" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="329" x2="310.5" y1="346" y2="357" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="310.5" x2="292" y1="357" y2="368" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="327.34342608696" y1="300.78043478261" y2="322.34130434783" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="327.34342608696" x2="327.34342608696" y1="322.34130434783" y2="343.90217391304" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="290" x2="308.67171304348" y1="279.21956521739" y2="290" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308.67171304348" x2="327.34342608696" y1="290" y2="300.78043478261" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="290" x2="290" y1="236.09782608696" y2="257.65869565217" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="290" x2="290" y1="257.65869565217" y2="279.21956521739" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252" x2="270.5" y1="217" y2="228" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="270.5" x2="289" y1="228" y2="239" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="254" x2="273" y1="213" y2="224" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="273" x2="292" y1="224" y2="235" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252.65657391304" x2="252.65657391304" y1="171.4152173913" y2="192.97608695652" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="252.65657391304" x2="252.65657391304" y1="192.97608695652" y2="214.53695652174" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="289" x2="270.5" y1="148" y2="159" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="270.5" x2="252" y1="159" y2="170" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="292" x2="273" y1="152" y2="163" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="273" x2="254" y1="163" y2="174" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="290" x2="290" y1="106.73260869565" y2="128.29347826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="290" x2="290" y1="128.29347826087" y2="149.85434782609" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327" x2="308" y1="84" y2="94.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308" x2="289" y1="94.5" y2="105" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="329" x2="310.5" y1="88" y2="98.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="310.5" x2="292" y1="98.5" y2="109" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="327.34342608696" x2="327.34342608696" y1="42.05" y2="63.610869565217" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="327.34342608696" x2="327.34342608696" y1="63.610869565217" y2="85.171739130435" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364.68993229814" x2="346.01667919255" y1="106.73260869565" y2="95.952173913043" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="346.01667919255" x2="327.34342608696" y1="95.952173913043" y2="85.171739130435" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364.68993229814" x2="364.68993229814" y1="149.85434782609" y2="128.29347826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364.68993229814" x2="364.68993229814" y1="128.29347826087" y2="106.73260869565" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="404" x2="385" y1="170" y2="159" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="385" x2="366" y1="159" y2="148" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="401" x2="382.5" y1="174" y2="163" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="382.5" x2="364" y1="163" y2="152" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="346.01667919255" y1="171.4152173913" y2="160.6347826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="346.01667919255" x2="364.68993229814" y1="160.6347826087" y2="149.85434782609" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="308.67171304348" y1="171.4152173913" y2="160.6347826087" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="308.67171304348" x2="290" y1="160.6347826087" y2="149.85434782609" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="330" x2="330" y1="215" y2="193.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="330" x2="330" y1="193.5" y2="172" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="326" x2="326" y1="215" y2="193.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="326" x2="326" y1="193.5" y2="172" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="327.34342608696" x2="308.67171304348" y1="214.53695652174" y2="225.31739130435" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #0000ff" />
<line x1="308.67171304348" x2="290" y1="225.31739130435" y2="236.09782608696" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364.68993229814" x2="346.01667919255" y1="365.46304347826" y2="354.68260869565" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="346.01667919255" x2="327.34342608696" y1="354.68260869565" y2="343.90217391304" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="367" x2="367" y1="409" y2="387.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="367" x2="367" y1="387.5" y2="366" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="363" x2="363" y1="409" y2="387.5" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="363" x2="363" y1="387.5" y2="366" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="364.68993229814" x2="346.01667919255" y1="408.5847826087" y2="419.3652173913" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="346.01667919255" x2="327.34342608696" y1="419.3652173913" y2="430.14565217391" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="252" x2="233.5" y1="342" y2="353" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="233.5" x2="215" y1="353" y2="364" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="254" x2="235.5" y1="346" y2="357" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="235.5" x2="217" y1="357" y2="368" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<line x1="177.96664161491" x2="196.63835465839" y1="343.90217391304" y2="354.68260869565" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #ff0000" />
<line x1="196.63835465839" x2="215.31006770186" y1="354.68260869565" y2="365.46304347826" style="stroke-opacity:1; stroke-width: 1.815665645269; stroke: #000000" />
<ellipse cx="177.96664161491" cy="473.26739130435" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96664161491" y="483.25355235333"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>
<ellipse cx="215.31006770186" cy="537.95" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="215.31006770186" y="547.93616104898"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>
<ellipse cx="290" cy="494.82826086957" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="504.81442191854"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="364.68993229814" cy="494.82826086957" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.68993229814" y="504.81442191854"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>
<ellipse cx="327.34342608696" cy="300.78043478261" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.34342608696" y="310.76659583159"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="252.65657391304" cy="171.4152173913" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.65657391304" y="181.40137844028"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="290" cy="106.73260869565" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290" y="116.71876974463"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="327.34342608696" cy="42.05" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.34342608696" y="52.036161048979"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="364.68993229814" cy="106.73260869565" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.68993229814" y="116.71876974463"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="402.03335838509" cy="171.4152173913" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="402.03335838509" y="181.40137844028"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>
<ellipse cx="327.34342608696" cy="214.53695652174" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.34342608696" y="224.52311757072"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">N</text>
<ellipse cx="252.65657391304" cy="343.90217391304" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.65657391304" y="353.88833496202"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>
<ellipse cx="177.96664161491" cy="343.90217391304" rx="11.801826694248" ry="11.801826694248" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96664161491" y="353.88833496202"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695820565862px">O</text>


2021-08-01, 343👍, 0💬