Molecule FYI-1000217


Molecule Summary:

ID: FYI-1000217
SMILES: C1[C@@H]2CC[C@@H]3[C@]([C@H]1O)(C2)CC[C@H]1[C@@]3(C)CCC[C@@]1(C)C(=O)O;OC[C@H]1OC([C@H]2Oc3ccccc3NC2=O)[C@@H]([C@H]([C@@H]1O)O)O

Received at on: 2021-01-05

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 22 25  0  0  1  0  0  0  0  0999 V2000
    7.0157    4.7968    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1432    5.8514    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6103    6.9163    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3975    6.2822    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3403    4.9147    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9567    3.9815    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2824    3.6412    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7863    2.3687    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8707    5.3474    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7411    2.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5559    2.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3706    2.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3706    4.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2533    5.4695    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1853    4.7903    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.1059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.7373    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1853    2.0530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.3686    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1853    0.6843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3706    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  6  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  7  1  1  0  0  0  0
  7  8  1  6  0  0  0
  6  9  1  6  0  0  0
  9  2  1  0  0  0  0
 10  6  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  6  0  0  0
 13 12  1  0  0  0  0
 13  5  1  0  0  0  0
 13 14  1  6  0  0  0
 15 13  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 18 12  1  0  0  0  0
 18 19  1  1  0  0  0
 20 18  1  0  0  0  0
 21 20  2  0  0  0  0
 22 20  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><polygon points=" 477,460 550,395 527,376" fill-opacity="1"  style="fill:#000000" />
<line x1="367.9259311259" x2="422.1019299571" y1="534.43698918141" y2="496.80112176975" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="422.1019299571" x2="476.27792878829" y1="496.80112176975" y2="459.16525435808" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="282.19998503357" x2="325.06295807974" y1="489.61606040737" y2="512.02652479439" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="325.06295807974" x2="367.9259311259" y1="512.02652479439" y2="534.43698918141" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<polygon points=" 279,393 268,491 298,489" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="392.41098037259" x2="335.28391108514" y1="326.99264007868" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="335.28391108514" x2="278.15684179768" y1="359.97394486651" y2="392.95524965435" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="486.11718645324" x2="439.26408341292" y1="302.93876519806" y2="314.96570263837" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="439.26408341292" x2="392.41098037259" y1="314.96570263837" y2="326.99264007868" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="486.11718645324" x2="512.03359322662" y1="302.93876519806" y2="343.78016662628" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="512.03359322662" x2="537.95" y1="343.78016662628" y2="384.62156805451" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<polygon points=" 487,303 536,219 508,208" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 393,327 372,423 402,425" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="386.3321286543" x2="431.3050287213" y1="423.54035591602" y2="441.35280513705" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="431.3050287213" x2="476.27792878829" y1="441.35280513705" y2="459.16525435808" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="377.17144048349" x2="384.79121042804" y1="239.04720626595" y2="283.01992317231" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="384.79121042804" x2="392.41098037259" y1="283.01992317231" y2="326.99264007868" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="293.39638168679" x2="335.28391108514" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="335.28391108514" x2="377.17144048349" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<polygon points=" 210,240 301,204 286,178" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="209.61425445786" x2="209.61425445786" y1="335.78576977351" y2="287.41648801973" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="209.61425445786" x2="209.61425445786" y1="287.41648801973" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="209.61425445786" x2="243.88554812777" y1="335.78576977351" y2="364.37050971393" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="243.88554812777" x2="278.15684179768" y1="364.37050971393" y2="392.95524965435" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<polygon points=" 210,336 187,431 217,434" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="125.83212722893" x2="167.72319084339" y1="384.16211995952" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="167.72319084339" x2="209.61425445786" y1="359.97394486651" y2="335.78576977351" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="42.05" x2="83.941063614465" y1="335.78576977351" y2="359.97394486651" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="83.941063614465" x2="125.83212722893" y1="359.97394486651" y2="384.16211995952" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="239.04720626595" y2="287.41648801973" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="287.41648801973" y2="335.78576977351" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="125.83212722893" x2="83.941063614465" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="83.941063614465" x2="42.05" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="125.83212722893" x2="167.72319084339" y1="190.67792451217" y2="214.86256538906" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="167.72319084339" x2="209.61425445786" y1="214.86256538906" y2="239.04720626595" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<polygon points=" 126,191 50,130 35,156" fill-opacity="1"  style="fill:#000000" />
<line x1="125.83212722893" x2="125.83212722893" y1="93.932292572373" y2="142.30510854227" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="125.83212722893" x2="125.83212722893" y1="142.30510854227" y2="190.67792451217" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="208" x2="166" y1="42" y2="66" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" />
<line x1="166" x2="124" y1="66" y2="90" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="213" x2="171" y1="51" y2="75" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" />
<line x1="171" x2="129" y1="75" y2="99" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<line x1="42.05" x2="83.941063614465" y1="45.563010818593" y2="69.747651695483" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #ff0000" />
<line x1="83.941063614465" x2="125.83212722893" y1="69.747651695483" y2="93.932292572373" style="stroke-opacity:1; stroke-width: 4.1793893620156; stroke: #000000" />
<ellipse cx="521.73501646308" cy="212.99296506407" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="521.73501646308" y="235.97960655516"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:52.242367025196px">O</text>
<ellipse cx="209.61425445786" cy="45.563010818593" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.61425445786" y="68.549652309679"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:52.242367025196px">O</text>
<ellipse cx="42.05" cy="45.563010818593" rx="27.166030853102" ry="27.166030853102" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="68.549652309679"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:52.242367025196px">O</text>


2021-08-04, 373👍, 1💬