Molecule FYI-1000353

A

Molecule Summary:

ID: FYI-1000353
SMILES: Cc1cn(c(=O)[nH]c1=O)[C@H]2C[C@H]([C@@H](O2)CO)O

Received at FYIcenter.com on: 2021-04-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000353
FYIcenter.com

 17 18  0  0  1  0  0  0  0  0999 V2000
    7.8642    2.2652    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4718    2.4115    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9025    3.6906    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5101    3.8369    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6872    2.7043    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2949    2.8506    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2566    1.4254    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.6489    1.2789    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2184    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9406    5.1159    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6406    6.3283    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7039    7.3687    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4250    6.7993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5713    5.4070    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    7.4993    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.7993    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.9949    8.7382    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  5  1  0  0  0  0
  8  7  1  0  0  0  0
  8  2  1  0  0  0  0
  9  8  2  0  0  0  0
 10  4  1  6  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 14 10  1  0  0  0  0
 13 15  1  1  0  0  0
 16 15  1  0  0  0  0
 12 17  1  6  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="434.13005310018" x2="473.63997276327" y1="178.904598201" y2="174.75327584628" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="473.63997276327" x2="513.14989242636" y1="174.75327584628" y2="170.60195349157" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="406" x2="422" y1="254" y2="217.5" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="422" x2="438" y1="217.5" y2="181" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="399" x2="415" y1="250" y2="214" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="415" x2="431" y1="214" y2="178" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="322.80197294637" x2="362.31189260946" y1="259.79721452931" y2="255.64589217459" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" />
<line x1="362.31189260946" x2="401.82181227255" y1="255.64589217459" y2="251.49456981987" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="276.10172461148" x2="299.45184877892" y1="195.52123778353" y2="227.65922615642" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="299.45184877892" x2="322.80197294637" y1="227.65922615642" y2="259.79721452931" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" />
<line x1="198" x2="237.5" y1="208" y2="204" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="237.5" x2="277" y1="204" y2="200" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="197" x2="236.5" y1="200" y2="196" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="236.5" x2="276" y1="196" y2="192" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="308.41564052093" x2="292.2586825662" y1="122.94261632831" y2="159.23192705592" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" />
<line x1="292.2586825662" x2="276.10172461148" y1="159.23192705592" y2="195.52123778353" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="387.42980476528" x2="347.92272264311" y1="114.62862145522" y2="118.78561889176" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="347.92272264311" x2="308.41564052093" y1="118.78561889176" y2="122.94261632831" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" />
<line x1="387.42980476528" x2="410.77992893273" y1="114.62862145522" y2="146.76660982811" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="410.77992893273" x2="434.13005310018" y1="146.76660982811" y2="178.904598201" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="416" x2="400" y1="41" y2="77" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="400" x2="384" y1="77" y2="113" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="424" x2="408" y1="44" y2="80.5" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="408" x2="392" y1="80.5" y2="117" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<polygon points=" 291,333 334,265 312,255" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="330.20795472752" x2="310.34516834131" y1="401.18620310819" y2="366.78385708727" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="310.34516834131" x2="290.48238195509" y1="366.78385708727" y2="332.38151106635" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="277.04946327619" x2="303.62870900185" y1="460.22975441166" y2="430.70797875993" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="303.62870900185" x2="330.20795472752" y1="430.70797875993" y2="401.18620310819" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="204.47084182097" x2="240.76015254858" y1="427.91583850221" y2="444.07279645694" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="240.76015254858" x2="277.04946327619" y1="444.07279645694" y2="460.22975441166" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="212.77348653041" x2="208.62216417569" y1="348.90167425786" y2="388.40875638003" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="208.62216417569" x2="204.47084182097" y1="388.40875638003" y2="427.91583850221" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<line x1="212.77348653041" x2="251.62793424275" y1="348.90167425786" y2="340.6415926621" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="251.62793424275" x2="290.48238195509" y1="340.6415926621" y2="332.38151106635" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<polygon points=" 205,428 130,458 142,478" fill-opacity="1"  style="fill:#000000" />
<line x1="66.850107573642" x2="101.25245359456" y1="427.91583850221" y2="447.77862488842" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" />
<line x1="101.25245359456" x2="135.65479961548" y1="447.77862488842" y2="467.64141127463" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" />
<polygon points=" 278,461 282,541 306,536" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<ellipse cx="322.80197294637" cy="259.79721452931" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.80197294637" y="278.19661561336"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">N</text>
<ellipse cx="197.08756036712" cy="203.82388249296" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="197.08756036712" y="222.22328357701"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">O</text>
<ellipse cx="308.41564052093" cy="122.94261632831" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="308.41564052093" y="141.34201741235"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">N</text>
<ellipse cx="419.74939575656" cy="42.05" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="419.74939575656" y="60.449401084047"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">O</text>
<ellipse cx="212.77348653041" cy="348.90167425786" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="212.77348653041" y="367.3010753419"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">O</text>
<ellipse cx="66.850107573642" cy="427.91583850221" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.850107573642" y="446.31523958626"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">O</text>
<ellipse cx="293.56395138587" cy="537.95" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="293.56395138587" y="556.34940108405"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:41.816820645561px">O</text>
</g></svg>

✍: FYIcenter.com

2021-10-10, 145👍, 0💬