Collections:
Molecule FYI-1000353
Molecule Summary:
ID: FYI-1000353
SMILES: Cc1cn(c(=O)[nH]c1=O)[C@H]2C[C@H]([C@@H](O2)CO)O
Received at FYIcenter.com on: 2021-04-07
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000353 FYIcenter.com 17 18 0 0 1 0 0 0 0 0999 V2000 7.8642 2.2652 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4718 2.4115 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9025 3.6906 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5101 3.8369 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6872 2.7043 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.2949 2.8506 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2566 1.4254 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 5.6489 1.2789 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2184 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9406 5.1159 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6406 6.3283 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7039 7.3687 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4250 6.7993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.5713 5.4070 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 7.4993 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 6.7993 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.9949 8.7382 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 2 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 2 0 0 0 0 7 5 1 0 0 0 0 8 7 1 0 0 0 0 8 2 1 0 0 0 0 9 8 2 0 0 0 0 10 4 1 6 0 0 0 11 10 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 14 13 1 0 0 0 0 14 10 1 0 0 0 0 13 15 1 1 0 0 0 16 15 1 0 0 0 0 12 17 1 6 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="434.13005310018" x2="473.63997276327" y1="178.904598201" y2="174.75327584628" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="473.63997276327" x2="513.14989242636" y1="174.75327584628" y2="170.60195349157" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="406" x2="422" y1="254" y2="217.5" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="422" x2="438" y1="217.5" y2="181" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="399" x2="415" y1="250" y2="214" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="415" x2="431" y1="214" y2="178" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="322.80197294637" x2="362.31189260946" y1="259.79721452931" y2="255.64589217459" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" /> <line x1="362.31189260946" x2="401.82181227255" y1="255.64589217459" y2="251.49456981987" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="276.10172461148" x2="299.45184877892" y1="195.52123778353" y2="227.65922615642" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="299.45184877892" x2="322.80197294637" y1="227.65922615642" y2="259.79721452931" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" /> <line x1="198" x2="237.5" y1="208" y2="204" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="237.5" x2="277" y1="204" y2="200" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="197" x2="236.5" y1="200" y2="196" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="236.5" x2="276" y1="196" y2="192" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="308.41564052093" x2="292.2586825662" y1="122.94261632831" y2="159.23192705592" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" /> <line x1="292.2586825662" x2="276.10172461148" y1="159.23192705592" y2="195.52123778353" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="387.42980476528" x2="347.92272264311" y1="114.62862145522" y2="118.78561889176" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="347.92272264311" x2="308.41564052093" y1="118.78561889176" y2="122.94261632831" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #0000ff" /> <line x1="387.42980476528" x2="410.77992893273" y1="114.62862145522" y2="146.76660982811" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="410.77992893273" x2="434.13005310018" y1="146.76660982811" y2="178.904598201" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="416" x2="400" y1="41" y2="77" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="400" x2="384" y1="77" y2="113" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="424" x2="408" y1="44" y2="80.5" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="408" x2="392" y1="80.5" y2="117" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <polygon points=" 291,333 334,265 312,255" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="330.20795472752" x2="310.34516834131" y1="401.18620310819" y2="366.78385708727" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="310.34516834131" x2="290.48238195509" y1="366.78385708727" y2="332.38151106635" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="277.04946327619" x2="303.62870900185" y1="460.22975441166" y2="430.70797875993" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="303.62870900185" x2="330.20795472752" y1="430.70797875993" y2="401.18620310819" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="204.47084182097" x2="240.76015254858" y1="427.91583850221" y2="444.07279645694" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="240.76015254858" x2="277.04946327619" y1="444.07279645694" y2="460.22975441166" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="212.77348653041" x2="208.62216417569" y1="348.90167425786" y2="388.40875638003" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="208.62216417569" x2="204.47084182097" y1="388.40875638003" y2="427.91583850221" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <line x1="212.77348653041" x2="251.62793424275" y1="348.90167425786" y2="340.6415926621" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="251.62793424275" x2="290.48238195509" y1="340.6415926621" y2="332.38151106635" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <polygon points=" 205,428 130,458 142,478" fill-opacity="1" style="fill:#000000" /> <line x1="66.850107573642" x2="101.25245359456" y1="427.91583850221" y2="447.77862488842" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #ff0000" /> <line x1="101.25245359456" x2="135.65479961548" y1="447.77862488842" y2="467.64141127463" style="stroke-opacity:1; stroke-width: 3.3453456516449; stroke: #000000" /> <polygon points=" 278,461 282,541 306,536" fill-opacity="1" style="fill:none;stroke:#000000;" /> <ellipse cx="322.80197294637" cy="259.79721452931" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.80197294637" y="278.19661561336" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">N</text> <ellipse cx="197.08756036712" cy="203.82388249296" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="197.08756036712" y="222.22328357701" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">O</text> <ellipse cx="308.41564052093" cy="122.94261632831" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="308.41564052093" y="141.34201741235" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">N</text> <ellipse cx="419.74939575656" cy="42.05" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="419.74939575656" y="60.449401084047" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">O</text> <ellipse cx="212.77348653041" cy="348.90167425786" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="212.77348653041" y="367.3010753419" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">O</text> <ellipse cx="66.850107573642" cy="427.91583850221" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="66.850107573642" y="446.31523958626" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">O</text> <ellipse cx="293.56395138587" cy="537.95" rx="21.744746735692" ry="21.744746735692" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="293.56395138587" y="556.34940108405" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:41.816820645561px">O</text> </g></svg>
✍: FYIcenter.com
2021-10-10, 198👍, 0💬
Popular Posts:
What JSME Molecule Editor Options? JSME Molecule Editor Options are parameters that can be passed to...
Where to find FAQ (Frequently Asked Questions) on basic understanding of JSME, Molecule Editor in Ja...
Where to find molecule FAQ (Frequently Asked Questions)? I want to learn more about SDF/Mol file for...
What are examples of Constitutional Isomers? The picture below gives an example of Constitutional Is...
What are the options for installing Open Babel on macOS computers? There are a number of options for...