Molecule FYI-1000357

A

Molecule Summary:

ID: FYI-1000357
SMILES: C1=CC=C(C2=CC=CC=C12)[C@H](N1CC[C@H](CC1)C(=O)NCCC1=CC=C(C=C1)Cl)C

Received at FYIcenter.com on: 2021-04-15

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000357
FYIcenter.com

 30 33  0  0  1  0  0  0  0  0999 V2000
   13.3368    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   16.9741    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7617    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 10  1  1  0  0  0  0
 10  5  1  0  0  0  0
 11  4  1  0  0  0  0
 11 12  1  1  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 17 12  1  0  0  0  0
 15 18  1  6  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 28 23  1  0  0  0  0
 29 26  1  0  0  0  0
 30 11  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="396" x2="413.5" y1="405" y2="415" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="413.5" x2="431" y1="415" y2="425" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="398" x2="415.5" y1="401" y2="411.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="415.5" x2="433" y1="411.5" y2="422" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="396.26553778993" x2="396.26553778993" y1="361.5769908272" y2="382.02755963497" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="396.26553778993" x2="396.26553778993" y1="382.02755963497" y2="402.47812844275" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="431" x2="413.5" y1="340" y2="350" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="413.5" x2="396" y1="350" y2="360" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="433" x2="415.5" y1="343" y2="353.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="415.5" x2="398" y1="353.5" y2="364" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467.10630814005" x2="449.39611555252" y1="361.5769908272" y2="351.35170642332" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="449.39611555252" x2="431.68592296499" y1="351.35170642332" y2="341.12642201943" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="502" x2="484.5" y1="340" y2="350" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="484.5" x2="467" y1="350" y2="360" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="504" x2="486.5" y1="343" y2="353.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="486.5" x2="469" y1="353.5" y2="364" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="537.95" x2="520.23980741247" y1="361.5769908272" y2="351.35170642332" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="520.23980741247" x2="502.52961482494" y1="351.35170642332" y2="341.12642201943" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="541" x2="541" y1="403" y2="382.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="541" x2="541" y1="382.5" y2="362" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="536" x2="536" y1="403" y2="382.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="536" x2="536" y1="382.5" y2="362" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="502.52961482494" x2="520.23980741247" y1="422.92869725052" y2="412.70341284663" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="520.23980741247" x2="537.95" y1="412.70341284663" y2="402.47812844275" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467" x2="484.5" y1="405" y2="415" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="484.5" x2="502" y1="415" y2="425" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="469" x2="486.5" y1="401" y2="411.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="486.5" x2="504" y1="411.5" y2="422" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467.10630814005" x2="449.39611555252" y1="402.47812844275" y2="412.70341284663" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="449.39611555252" x2="431.68592296499" y1="412.70341284663" y2="422.92869725052" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467.10630814005" x2="467.10630814005" y1="402.47812844275" y2="382.02755963497" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467.10630814005" x2="467.10630814005" y1="382.02755963497" y2="361.5769908272" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="431.68592296499" x2="431.68592296499" y1="300.22528440389" y2="320.67585321166" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="431.68592296499" x2="431.68592296499" y1="320.67585321166" y2="341.12642201943" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<polygon points=" 432,301 400,275 394,286" fill-opacity="1"  style="fill:#000000" />
<line x1="360.84515261487" x2="378.5553452024" y1="300.22528440389" y2="290" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="378.5553452024" x2="396.26553778993" y1="290" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #0000ff" />
<line x1="325.42184592998" x2="343.13349927242" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="343.13349927242" x2="360.84515261487" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="325.42184592998" x2="325.42184592998" y1="238.87357798057" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="325.42184592998" x2="325.42184592998" y1="259.32414678834" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="360.84515261487" x2="343.13349927242" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="343.13349927242" x2="325.42184592998" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="396.26553778993" x2="378.5553452024" y1="238.87357798057" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="378.5553452024" x2="360.84515261487" y1="228.64829357668" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="396.26553778993" x2="396.26553778993" y1="238.87357798057" y2="259.32414678834" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="396.26553778993" x2="396.26553778993" y1="259.32414678834" y2="279.77471559611" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #0000ff" />
<polygon points=" 326,239 294,214 287,224" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="288" x2="288" y1="178" y2="198.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #ff0000" />
<line x1="288" x2="288" y1="198.5" y2="219" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="293" x2="293" y1="178" y2="198.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #ff0000" />
<line x1="293" x2="293" y1="198.5" y2="219" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="254.58107557985" x2="272.29126816738" y1="238.87357798057" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #0000ff" />
<line x1="272.29126816738" x2="290.00146075491" y1="228.64829357668" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="219.16069040479" x2="236.87088299232" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="236.87088299232" x2="254.58107557985" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #0000ff" />
<line x1="183.73446221007" x2="201.44757630743" y1="238.87357798057" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="201.44757630743" x2="219.16069040479" y1="228.64829357668" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="148.31407703501" x2="166.02426962254" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="166.02426962254" x2="183.73446221007" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="114" x2="132" y1="241" y2="231" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="132" x2="150" y1="231" y2="221" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="112" x2="130" y1="238" y2="227.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="130" x2="148" y1="227.5" y2="217" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="77.470385175061" x2="95.182038517506" y1="218.4230091728" y2="228.64829357668" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="95.182038517506" x2="112.89369185995" y1="228.64829357668" y2="238.87357798057" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="76" x2="76" y1="178" y2="198.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="76" x2="76" y1="198.5" y2="219" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="80" x2="80" y1="178" y2="198.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="80" x2="80" y1="198.5" y2="219" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="112.89369185995" x2="95.182038517506" y1="157.07130274948" y2="167.29658715337" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="95.182038517506" x2="77.470385175061" y1="167.29658715337" y2="177.52187155725" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="150" x2="132" y1="176" y2="166" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="132" x2="114" y1="166" y2="156" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="148" x2="130" y1="180" y2="169.5" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="130" x2="112" y1="169.5" y2="159" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="148.31407703501" x2="148.31407703501" y1="177.52187155725" y2="197.97244036503" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="148.31407703501" x2="148.31407703501" y1="197.97244036503" y2="218.4230091728" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="42.05" x2="59.76019258753" y1="157.07130274948" y2="167.29658715337" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #00bc00" />
<line x1="59.76019258753" x2="77.470385175061" y1="167.29658715337" y2="177.52187155725" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="467.10630814005" x2="449.39611555252" y1="279.77471559611" y2="290" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<line x1="449.39611555252" x2="431.68592296499" y1="290" y2="300.22528440389" style="stroke-opacity:1; stroke-width: 1.7221582543592; stroke: #000000" />
<ellipse cx="396.26553778993" cy="279.77471559611" rx="11.194028653335" ry="11.194028653335" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="396.26553778993" y="289.24658599509"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52697817949px">N</text>
<ellipse cx="290.00146075491" cy="177.52187155725" rx="11.194028653335" ry="11.194028653335" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00146075491" y="186.99374195623"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52697817949px">O</text>
<ellipse cx="254.58107557985" cy="238.87357798057" rx="11.194028653335" ry="11.194028653335" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="254.58107557985" y="248.34544837955"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52697817949px">N</text>
<ellipse cx="42.05" cy="157.07130274948" rx="11.194028653335" ry="11.194028653335" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="166.54317314846"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:21.52697817949px">Cl</text>
</g></svg>

✍: FYIcenter.com

2021-05-16, 219👍, 0💬