Molecule FYI-1001163

A

Molecule Summary:

ID: FYI-1001163
SMILES: Oc1ccccc1C1=NNC(=S)N1CC=C

Received at FYIcenter.com on: 2022-02-11

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001163
FYIcenter.com

 16 17  0  0  0  0  0  0  0  0999 V2000
    2.8354    2.2347    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.1669    1.8021    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4580    0.4326    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.7895    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.8299    0.9369    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5388    2.3062    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.2073    2.7388    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9162    4.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8531    5.1486    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1531    6.3610    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.7836    6.0699    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.7433    7.0068    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.6777    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.6777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.9777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  7  2  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 11  1  0  0  0  0
 13  8  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="343.2185883713" x2="296.10072786436" y1="169.59201489981" y2="184.90045384484" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="296.10072786436" x2="248.98286735742" y1="184.90045384484" y2="200.20889278986" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #ff0000" />
<line x1="359" x2="349" y1="72" y2="120.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="349" x2="339" y1="120.5" y2="169" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="369" x2="359" y1="74" y2="122.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="359" x2="349" y1="122.5" y2="171" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="458.05665139579" x2="410.93879088885" y1="42.05" y2="57.358438945025" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="410.93879088885" x2="363.82093038191" y1="57.358438945025" y2="72.66687789005" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="536" x2="499" y1="105" y2="72" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="499" x2="462" y1="72" y2="39" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="529" x2="492" y1="113" y2="79.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="492" x2="455" y1="79.5" y2="46" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="511.08768838842" x2="521.38885939373" y1="205.26924130844" y2="156.81375021408" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="521.38885939373" x2="531.69003039904" y1="156.81375021408" y2="108.35825911971" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="419" x2="466" y1="241" y2="226" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="466" x2="513" y1="226" y2="211" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="416" x2="463" y1="231" y2="216" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="463" x2="510" y1="216" y2="201" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="416.85196737455" x2="380.03527787292" y1="235.88611919849" y2="202.73906704915" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="380.03527787292" x2="343.2185883713" y1="202.73906704915" y2="169.59201489981" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="396.24962536393" x2="406.55079636924" y1="332.81125620825" y2="284.34868770337" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="406.55079636924" x2="416.85196737455" y1="284.34868770337" y2="235.88611919849" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="467" x2="434" y1="403" y2="366.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="434" x2="401" y1="366.5" y2="330" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="459" x2="426" y1="410" y2="373.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="426" x2="393" y1="373.5" y2="337" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="413.01601087515" x2="437.7869476794" y1="492.24408289091" y2="449.34082034595" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="437.7869476794" x2="462.55788448364" y1="449.34082034595" y2="406.43755780099" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="316.09087386539" x2="364.55344237027" y1="471.64174088029" y2="481.9429118856" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="364.55344237027" x2="413.01601087515" y1="481.9429118856" y2="492.24408289091" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="246" x2="283" y1="542" y2="509" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #c8aa1a" />
<line x1="283" x2="320" y1="509" y2="476" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="239" x2="276" y1="535" y2="501.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #c8aa1a" />
<line x1="276" x2="313" y1="501.5" y2="468" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="305.73662228121" x2="310.9137480733" y1="373.11003168351" y2="422.3758862819" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="310.9137480733" x2="316.09087386539" y1="422.3758862819" y2="471.64174088029" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="305.73662228121" x2="350.99312382257" y1="373.11003168351" y2="352.96064394588" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="350.99312382257" x2="396.24962536393" y1="352.96064394588" y2="332.81125620825" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="219.9300971913" x2="262.83335973626" y1="323.56815807501" y2="348.33909487926" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="262.83335973626" x2="305.73662228121" y1="348.33909487926" y2="373.11003168351" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #0000ff" />
<line x1="134.11649469087" x2="177.02329594109" y1="373.11003168351" y2="348.33909487926" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="177.02329594109" x2="219.9300971913" y1="348.33909487926" y2="323.56815807501" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="46" x2="89" y1="329" y2="353.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="89" x2="132" y1="353.5" y2="378" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="51" x2="94" y1="320" y2="344.5" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<line x1="94" x2="137" y1="344.5" y2="369" style="stroke-opacity:1; stroke-width: 4.1720008702348; stroke: #000000" />
<ellipse cx="248.98286735742" cy="200.20889278986" rx="27.118005656526" ry="27.118005656526" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="248.98286735742" y="223.15489757615"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:52.150010877935px">O</text>
<ellipse cx="462.55788448364" cy="406.43755780099" rx="27.118005656526" ry="27.118005656526" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="462.55788448364" y="429.38356258728"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:52.150010877935px">N</text>
<ellipse cx="413.01601087515" cy="492.24408289091" rx="27.118005656526" ry="27.118005656526" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.01601087515" y="515.1900876772"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:52.150010877935px">N</text>
<ellipse cx="242.46457227265" cy="537.95" rx="27.118005656526" ry="27.118005656526" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="242.46457227265" y="560.89600478629"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:52.150010877935px">S</text>
<ellipse cx="305.73662228121" cy="373.11003168351" rx="27.118005656526" ry="27.118005656526" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.73662228121" y="396.0560364698"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:52.150010877935px">N</text>
</g></svg>

✍: FYIcenter.com

2022-07-01, 123👍, 0💬