Molecule FYI-1002396

A

Molecule Summary:

ID: FYI-1002396
Names:
InChIKey: PMRVNBLFPMPZHZ-CIBUHMANSA-N
SMILES: CC(C)CCC[C@@H](C)C3CCC4[C@@H]2CC=C1C[C@@H](O)CC[C@]1(C)[C@H]2CC[C@]34C.CC(C)CCC[C@@H](C)[C@H]3CC[C@H]4[C@@H]2CC=C1C[C@@H](O)CC[C@]1(C)[C@H]2CC[C@]34C

Received at FYIcenter.com on: 2023-03-13

Molecule ID: FYI-1002396 Edit

Molecule Structure InChIKey: PMRVNBLFPMPZHZ-CIBUHMANSA-N

Molecule Structure SMILES String: CC(C)CCC[C@@H](C)C3CCC4[C@@H]2CC=C1C[C@@H](O)CC[C@]1(C)[C@H]2CC[C@]34C.CC(C)CCC[C@@H](C)[C@H]3CC[C@H]4[C@@H]2CC=C1C[C@@H](O)CC[C@]1(C)[C@H]2CC[C@]34C

Download SDF Download SVG Structure in 2D SDF:

FYI-1002396
FYIcenter.com

 56 62  0  0  1  0  0  0  0  0999 V2000
    7.4859    1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1948    2.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7622    4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6990    5.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0684    5.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0052    6.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4378    4.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5726    7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2032    7.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2664    6.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5094    8.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8788    8.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8156    9.1654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3114    6.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3746    5.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5010    3.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5642    2.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3622    4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9296    2.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4859    1.5535    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.1948    2.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7622    4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.6990    5.2948    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0684    5.0037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0052    6.0441    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4378    4.7126    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5726    7.3756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2032    7.6667    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2664    6.6263    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5094    8.4160    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8788    8.1250    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8156    9.1654    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.3114    6.7935    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.3746    5.7531    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5010    3.6722    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5642    2.6318    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3622    4.2544    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9296    2.9229    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  1  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  6  7  1  1  0  0  0
  8  6  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
  4 10  1  6  0  0  0
 11  8  1  0  0  0  0
 12 11  1  0  0  0  0
 12 13  1  1  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 15  6  1  0  0  0  0
  5 16  1  1  0  0  0
 17 16  1  0  0  0  0
 17  2  1  0  0  0  0
 23 18  1  6  0  0  0
 19 27  1  0  0  0  0
  3 20  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 22  2  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 30 29  1  1  0  0  0
 31 30  1  0  0  0  0
 32 31  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  1  0  0  0  0
 34 35  1  1  0  0  0
 36 34  1  0  0  0  0
 37 36  2  0  0  0  0
 38 37  1  0  0  0  0
 32 38  1  6  0  0  0
 39 36  1  0  0  0  0
 40 39  1  0  0  0  0
 40 41  1  1  0  0  0
 42 40  1  0  0  0  0
 43 42  1  0  0  0  0
 43 34  1  0  0  0  0
 33 44  1  1  0  0  0
 45 44  1  0  0  0  0
 45 30  1  0  0  0  0
 51 46  1  6  0  0  0
 47 55  1  0  0  0  0
 31 48  1  1  0  0  0
 49 48  1  0  0  0  0
 50 49  1  1  0  0  0
 50 30  1  0  0  0  0
 51 50  1  0  0  0  0
 52 51  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  1  0  0  0  0
 56 55  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1002396-3D
FYIcenter.com


<head>
<title>NCBI - WWW Error 803 Diagnostic</title>
<meta http-equiv="Content-Type" content="application/xhtml+xml; charset=utf-8" />
<meta http-equiv="pragma" content="no-cache" />
<meta http-equiv="cache-control" content="no-cache" />
<meta name="robots" content="noarchive,none" />

<style type="text/css">
body {
min-width: 950px;
_width: 950px;
}
h1.error {color: red; font-size: 40pt}

#mainContent {
padding: 1em 2em;
}

dl#diags {
padding: 0.5em 0.5em 1.5em 0.5em;
padding-left: 2em;
border: solid 1px #888;
border-left: none;
border-right: none;
margin-bottom:0;
background-color:#eeeeee;
color:#666;
font-size: 80%;
_font-size: 70%;
font-family: Verdana, sans-serif;
}

dl#diags dt {
float: left;
font-weight: bold;
width: auto;
}

dl#diags dd {
margin-left:1em;
float: left;
margin-right: 2em;
}

#footer span {
float: left;
color: #888;
font-size: 80%;
}

#footer {
text-align: right;
padding: 0 0.5em;
clear: left;
}

#footer img {
border: none;
}

.ncbi {
margin: 0;
padding:0;
font-size:240%;
font-weight: bold;
font-family: Times, serif;
color: #336699;
float: left;
display: inline;
}

.ncbi a {
text-decoration: none;
color: #336699;
}

.ncbi a:visited {
text-decoration: none;
color: #336699;
}

.ncbi a:hover {
text-decoration: underline;
}

.message {
font-family: Verdana, sans-serif;
background-color: #336699;
color: white;
padding: .35em;
margin-left: 7em;
margin-top: .67em;
_margin-top: 0.5em;
font-weight: bold;
font-size: 100%;
margin-bottom: 0;
}

h1 {
clear: left;
font-size: 110%;
font-family: Verdana, sans-serif;
}


body.denied {
background-color: black;
color: white;
}

body.denied h1 {
color: red;
}

body.denied a {
color: green;
}

body.denied #footer, body.denied #diags {
color: black;
}

#searchme:focus {
background-color: #ffa;
}

.errurl {
letter-spacing: 0;
margin: 0 1em;
padding: 0.25em;
background-color: #fff0f0;
color: #c00;
font-family: "Courier New", Courier, monospace;
font-size: 90%;
_font-size: 80%;
}

body.denied .errurl {
background-color: black;
color: yellow;
}

span.x {
display: none;
}

</style>

<!--[if IE]>
<script type="text/javascript">
/* <![CDATA[ */
_isIE=1;
/* ]]> */
</script>
<![endif]-->

<script type="text/javascript">
/* <![CDATA[ */
addEvent = function(obj, type, fn, b) {
    if (obj.attachEvent) {
        var name = "" + type + fn; 
        name = name.substring(0, name.indexOf("\n"));
        obj["e" + name] = fn;
        obj[name] = function(){ obj["e" + name](window.event);}
        obj.attachEvent("on" + type, obj[name]);
    } else {
        obj.addEventListener(type, fn, b);
        return true;
    }
}

fixlink = function() {
   var ie = typeof(_isIE) != 'undefined';
   var v = document.getElementById("mlink");

   if (v) {
      var ieHACK = v.innerHTML;
      var newText;

      newText = "%3E%20REQUEST_URI%3D" + document.REQUEST_URI + "%0D" +
                "%3E%20HTTP_HOST%3D" + document.HTTP_HOST + "%0D" +
                "%3E%20REMOTE_ADDR%3D" + document.REMOTE_ADDR + "%0D" +
                "%3E%20REQUEST_METHOD%3D" + document.REQUEST_METHOD + "%0D";

      var href = v.getAttribute("href");
      newText = newText.replace(/'/g, "%27");
      newText = newText.replace(/\?/g, "%3F");

      // IE bugfixes
      if (ie) {
          var m = /(.*)\?(.*)/.exec(href);
          if (m) {
             href = m[1] + "?" + escape(m[2]);
          }
          href = href.replace(/(.*)(%0D-----%0D.*)/m, "$1" + newText + "$2");
          href = href.replace(/subject%3D/, "subject=");
          href = href.replace(/%26body%3D/, "&body=");
          href=href.replace(/%0D/mg, "%0A");
      } else {
          href = href.replace(/(.*)(%0D-----%0D.*)/m, "$1" + newText + "$2");
      }
      v.setAttribute("href", href);
      v.innerHTML = ieHACK;  // I can't believe this...
   }  
   v = document.getElementById("searchme");
   if (v) { v.focus(); }
}


addEvent(window, "load", fixlink, false);
/* ]]> */
</script>


</head>

<body>

<div id='header'>
<a href="#mainContent" title="Skip to main content" />
<p class="ncbi"><a href="http://www.ncbi.nlm.nih.gov">NCBI</a></p>
<p class="message">Error</p>
</div>

<div id='mainContent'>
<h1>Temporarily Unavailable</h1>

<p class='errurl'>
<script type="text/javascript">
/* <![CDATA[ */
  document.REQUEST_URI = "/rest/pug/compound/inchikey/PMRVNBLFPMPZHZ-CIBUHMANSA-N/SDF%3frecord_type=3d";
  document.HTTP_HOST = "pubchem.ncbi.nlm.nih.gov";
  document.REMOTE_ADDR = "10.6.6.6";
  document.REQUEST_METHOD = "GET";

  var p = "http://" + document.HTTP_HOST + document.REQUEST_URI;
  p = p.replace(/(.)/g, "<span class=\"x\"> </span>$1");
  p = p.replace(/'/g, "'");
  document.write(p);
//  document.write(p.replace(/[^A-Za-z0-9\#\;\:\.\/\?&\=\_\- ]*/g, "<span class='x'> </span>"));
/* ]]> */
</script>
</p>

<p>The server is temporarily unable to service your request.
Please try again.  If you continue to receive this error, please contact
<a id='mlink'
href="mailto:info@ncbi.nlm.nih.gov?subject=NCBI%20Web%20site%20error%20803&body=%3E%20Error%3D803%0D%3E%20Server%3D10.6.6.6%0D%3E%20Client%3D10.6.6.6%0D%3E%20Time%3DThursday, 18-Jan-2024 07:05:35 EST%0D%0D-----%0DPlease%20enter%20comments%20below:%0D%0D">info@ncbi.nlm.nih.gov</a>. 
</p>


<form method="post" action="http://www.ncbi.nlm.nih.gov/gquery/gquery.fcgi"
     enctype="application/x-www-form-urlencoded">
<p>
<strong>Search NCBI</strong>
<input name="term" size="40" style="margin-left: 1em; border: solid 1px #336699;" id="searchme"/>
<input type="submit" value="Go" />
</p>
</form>


</div>

<dl id="diags">
   <dt>Error</dt><dd>803</dd>
   <dt>Server</dt><dd>10.6.6.6</dd>
   <dt>Client</dt><dd>10.6.6.6</dd>
   <dt>Time</dt><dd>Thursday, 18-Jan-2024 07:05:35 EST</dd>
</dl>

<p id='footer'>

<span id='rev'>Rev. 05 Apr 2022 15:26:50 EDT</span>
<!-- <a href="http://validator.w3.org/check?uri=referer"><img src="http://www.w3.org/Icons/valid-xhtml11" alt="Valid XHTML 1.1!" /></a> -->
</p>
<p><a href="https://www.hhs.gov/vulnerability-disclosure-policy/index.html">HHS Vulnerability Disclosure</a></p>

</body>
</html>

M  END
$$$$

✍: FYIcenter.com

2023-04-13, 464👍, 0💬