Molecule FYI-1010253

A

Molecule Summary:

ID: FYI-1010253
Names:
InChIKey: HHDQRNAQGXUIRL-YGJDNBSYSA-N
SMILES: C/C=C\\3NC(=O)C(C)NC(=O)C(CO)NC(=O)C(NC(=O)/C(=C\\C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(NC(=O)C(C)NC(=O)C(C)NC(=O)C(NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C1CCCN1C(=O)/C(=C\\C)NC(=O)CC(O)CCCCCCCCC)C(C)C)C(C)C)C(C)C)C(C)OC(=O)C(Cc2ccc(O)cc2)NC(=O)C(CCN)NC(=O)C(CCN)NC(=O)C(C)NC3=O

Received at FYIcenter.com on: 2024-06-03

Molecule ID: FYI-1010253 Edit

Molecule Structure InChIKey: HHDQRNAQGXUIRL-YGJDNBSYSA-N

Molecule Structure SMILES String: C/C=C\3NC(=O)C(C)NC(=O)C(CO)NC(=O)C(NC(=O)/C(=C\C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(NC(=O)C(C)NC(=O)C(C)NC(=O)C(NC(=O)C(CC(C)C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(NC(=O)C1CCCN1C(=O)/C(=C\C)NC(=O)CC(O)CCCCCCCCC)C(C)C)C(C)C)C(C)C)C(C)OC(=O)C(Cc2ccc(O)cc2)NC

Download SDF Download SVG Structure in 2D SDF:

Image not available

FYI-1010253
FYIcenter.com

155157  0  0  0  0  0  0  0  0999 V2000
   73.9921    4.3533    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   72.6602    3.9205    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   71.6194    4.8575    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   70.2874    4.4248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   69.2466    5.3619    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   67.9146    4.9291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   66.8739    5.8663    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   65.5419    5.4335    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   64.5011    6.3706    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   63.1692    5.9379    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.1284    6.8749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.7964    6.4422    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   60.5052    5.0723    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   59.7556    7.3793    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   58.4236    6.9465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   58.1325    5.5766    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.8006    5.1438    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.3829    7.8836    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   57.6741    9.2536    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   56.0509    7.4509    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   55.6181    6.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.2176    6.1189    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.7849    7.4509    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.9179    8.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.9179    9.6746    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.1308   10.3749    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   53.7050   10.3749    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   53.7050   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.9179   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   54.9179   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   56.1308   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.4921   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.2792   11.7753    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   52.4921   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   51.2792   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   51.2792   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.4921   16.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   53.7050   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   52.4921   18.0777    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   50.0664   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   50.0664   12.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   48.8535   14.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   47.6406   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   47.6406   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4277   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   46.4277   15.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   45.2149   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   44.0020   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   44.0020   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7891   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   42.7891   12.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   41.5762   14.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   40.3633   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   40.3633   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1504   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9376   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1504   10.3749    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1504   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   39.1504   15.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   37.9376   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   36.7247   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   36.7247   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   37.9376   16.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5118   16.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5118   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   35.5118   12.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   34.2990   14.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   33.0861   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   33.0861   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8732   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   31.8732   15.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   30.6603   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   29.4474   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   29.4474   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2345   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   28.2345   12.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   27.0216   14.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   25.8088   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   25.8088   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5959   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   27.0216   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5959   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   24.5959   15.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   23.3830   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   22.1702   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   22.1702   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9573   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   20.9573   12.4756    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   19.7444   14.5764    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   18.5316   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   18.5316   12.4756    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3186   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   17.3186   15.9768    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   16.1057   13.8761    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   14.8929   14.5764    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.8929   15.9768    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6800   16.6771    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6800   13.8761    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.4671   14.5764    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.6800   12.4756    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.4671   11.7753    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0099   10.4843    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2144    9.0988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.0680    7.7059    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4315    7.3861    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.5799    6.3933    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.7806    5.2432    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7204    4.3282    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.4954    3.1616    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4660    3.7054    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0960    3.4142    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6968    3.4728    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4632    2.0920    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3560    3.8776    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1581    4.6031    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.1782    5.6037    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0627    4.7570    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4779    6.8166    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1013    8.1656    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0720    9.5658    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.6791    9.7122    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.3918   10.9293    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.0791   11.4175    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.5248    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0406   12.1704    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9778   13.2112    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0626   14.2714    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.1443   13.9862    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4669   14.4468    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    7.8625   14.5640    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.9211   15.9633    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2434   14.3304    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.5228   13.7608    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   11.6204   12.8909    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5795   13.7988    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6482   15.6712    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0117   15.9910    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.5215   15.2407    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1868    6.2740    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7863    2.5982    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.3935    2.4519    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8239    1.1724    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.9265    2.3828    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0114    1.3226    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4720    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   13.8210    5.7444    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.8796    4.3451    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1208    3.6963    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.1794    2.2970    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.9970    1.5465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7558    2.1954    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.6972    3.5947    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.0556    0.1473    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   14.3588   10.8609    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   62.8780    4.5679    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  2  0  0  0  0
 17 16  1  0  0  0  0
 18 15  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 24 20  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 25  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 29  1  0  0  0  0
 32 28  1  0  0  0  0
 33 32  2  0  0  0  0
 34 32  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  1  0  0  0  0
 39 37  1  0  0  0  0
 40 35  1  0  0  0  0
 41 40  2  0  0  0  0
 42 40  1  0  0  0  0
 43 42  1  0  0  0  0
 44 43  1  0  0  0  0
 45 43  1  0  0  0  0
 46 45  2  0  0  0  0
 47 45  1  0  0  0  0
 48 47  1  0  0  0  0
 49 48  1  0  0  0  0
 50 48  1  0  0  0  0
 51 50  2  0  0  0  0
 52 50  1  0  0  0  0
 53 52  1  0  0  0  0
 54 53  1  0  0  0  0
 55 54  1  0  0  0  0
 56 55  1  0  0  0  0
 57 55  1  0  0  0  0
 58 53  1  0  0  0  0
 59 58  2  0  0  0  0
 60 58  1  0  0  0  0
 61 60  1  0  0  0  0
 62 61  1  0  0  0  0
 63 62  1  0  0  0  0
 64 62  1  0  0  0  0
 65 61  1  0  0  0  0
 66 65  2  0  0  0  0
 67 65  1  0  0  0  0
 68 67  1  0  0  0  0
 69 68  1  0  0  0  0
 70 68  1  0  0  0  0
 71 70  2  0  0  0  0
 72 70  1  0  0  0  0
 73 72  1  0  0  0  0
 74 73  1  0  0  0  0
 75 73  1  0  0  0  0
 76 75  2  0  0  0  0
 77 75  1  0  0  0  0
 78 77  1  0  0  0  0
 79 78  1  0  0  0  0
 80 79  1  0  0  0  0
 81 79  1  0  0  0  0
 82 78  1  0  0  0  0
 83 82  2  0  0  0  0
 84 82  1  0  0  0  0
 85 84  1  0  0  0  0
 86 85  1  0  0  0  0
 87 85  1  0  0  0  0
 88 87  2  0  0  0  0
 89 87  1  0  0  0  0
 90 89  1  0  0  0  0
 91 90  1  0  0  0  0
 92 90  1  0  0  0  0
 93 92  2  0  0  0  0
 94 92  1  0  0  0  0
 95 94  1  0  0  0  0
 96 95  2  0  0  0  0
 97 96  1  0  0  0  0
 98 95  1  0  0  0  0
 99 98  2  0  0  0  0
100 98  1  0  0  0  0
101100  1  0  0  0  0
102101  1  0  0  0  0
103102  1  0  0  0  0
104103  1  0  0  0  0
105104  2  0  0  0  0
106104  1  0  0  0  0
107106  1  0  0  0  0
108107  1  0  0  0  0
109108  2  0  0  0  0
110108  1  0  0  0  0
111110  1  0  0  0  0
112111  1  0  0  0  0
113112  2  0  0  0  0
114112  1  0  0  0  0
115114  1  0  0  0  0
116115  1  0  0  0  0
117116  2  0  0  0  0
118116  1  0  0  0  0
119118  1  0  0  0  0
120119  1  0  0  0  0
121120  2  0  0  0  0
122120  1  0  0  0  0
123122  2  0  0  0  0
124123  1  0  0  0  0
125122  1  0  0  0  0
126125  1  0  0  0  0
127126  2  0  0  0  0
128126  1  0  0  0  0
129128  1  0  0  0  0
130129  1  0  0  0  0
131130  2  0  0  0  0
132130  1  0  0  0  0
133132  1  0  0  0  0
134133  1  0  0  0  0
134101  1  0  0  0  0
135134  2  0  0  0  0
136132  1  0  0  0  0
137136  1  0  0  0  0
138128  1  0  0  0  0
139118  1  0  0  0  0
140114  1  0  0  0  0
141140  1  0  0  0  0
142141  1  0  0  0  0
143110  1  0  0  0  0
144143  1  0  0  0  0
145144  1  0  0  0  0
146106  1  0  0  0  0
147146  1  0  0  0  0
148147  2  0  0  0  0
149148  1  0  0  0  0
150149  2  0  0  0  0
151150  1  0  0  0  0
152151  2  0  0  0  0
152147  1  0  0  0  0
153150  1  0  0  0  0
154102  1  0  0  0  0
155 10  1  0  0  0  0
M  END
$$$$

Download SDF Structure in 3D SDF:

FYI-1010253-3D
FYIcenter.com

        <meta http-equiv="Content-Type" content="text/html; charset=UTF-8"/>
        <meta name="maintenance" content="true"/>
        <meta name="robots" content="noindex"/>
        <link rel="stylesheet" href="./SP_down/nwds.2b297fc25828.css"/>
        <link rel="stylesheet" href="./SP_down/uswds.053a2e840adc.css"/>
        <link rel="stylesheet" href="./SP_down/header.0a45ab6073a4.css"/>
        <link rel="stylesheet" href="./SP_down/footer.dce7b046ef03.css"/>
        <title>NCBI | NLM | NIH</title>
       	<style type="text/css">
			body {
				display: flex; 
				flex-direction: column;
				height: 100%;
			}
			header {
				flex-shrink: 0;
			}
			main {
				flex-grow: 1;
				flex-shrink: 0;
			}
		</style>
    </head>
    <body>
        <div class="usa-overlay"></div>
        <header class="ncbi-header" role="banner" data-section="Header">
        <div class="usa-grid">
            <div class="usa-width-one-whole">
                
                <div class="ncbi-header__logo">
                    <a href="https://www.ncbi.nlm.nih.gov/" class="logo" aria-label="NCBI Logo">
                        <img src="https://cdn.ncbi.nlm.nih.gov/coreutils/nwds/img/logos/AgencyLogo.svg" alt="NIH NLM Logo"/>
                    </a>
                </div>
            </div>
        </div>
    </header>
    <main id="main_content">
     <section class="usa-section usa-grid">
        <h3><strong>Maintenance in progress</strong></h3>
        <p>
The page you are trying to reach is currently unavailable due to planned
maintenance. Most services will be unavailable for 24+ hours starting 9 PM EDT
on Friday, July 25, 2025.<br><br>
For more information, please visit
<a href="https://ncbiinsights.ncbi.nlm.nih.gov/2025/07/08/ncbi-website-maintenance-july-26th/">
NCBI Insights</a>
        </p>
     </section>
    </main>
    <footer>
       <section class="icon-selection">
          <div id="icon-section-header" class="icon-section_header">Follow NCBI</div>
            <div class="grid-container container">
              <div class="icon-section_container">
                <a class="footer-icon" id="footer_twitter" href="https://twitter.com/ncbi" aria-label="Twitter">
                    <svg width="40" height="40" viewBox="0 0 40 37" fill="none" xmlns="http://www.w3.org/2000/svg">
                        <title>Twitter</title>
                        <g id="twitterx1008">
                        <path id="path1008" d="M6.06736 7L16.8778 20.8991L6.00001 32.2H10.2L18.6 23.1L25.668 32.2H34L22.8 17.5L31.9 7H28.4L20.7 15.4L14.401 7H6.06898H6.06736ZM9.66753 8.73423H12.9327L29.7327 30.4658H26.5697L9.66753 8.73423Z" fill="#5B616B"></path> </g>
                    </svg>
                </a>
                <a class="footer-icon" id="footer_facebook" href="https://www.facebook.com/ncbi.nlm" aria-label="Facebook"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>Facebook</title>
                    <path class="cls-11" d="M210.5,115.12H171.74V97.82c0-8.14,5.39-10,9.19-10h27.14V52l-39.32-.12c-35.66,0-42.42,26.68-42.42,43.77v19.48H99.09v36.32h27.24v109h45.41v-109h35Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_linkedin" href="https://www.linkedin.com/company/ncbinlm" aria-label="LinkedIn"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <title>LinkedIn</title>
                    <path class="cls-11" d="M101.64,243.37H57.79v-114h43.85Zm-22-131.54h-.26c-13.25,0-21.82-10.36-21.82-21.76,0-11.65,8.84-21.15,22.33-21.15S101.7,78.72,102,90.38C102,101.77,93.4,111.83,79.63,111.83Zm100.93,52.61A17.54,17.54,0,0,0,163,182v61.39H119.18s.51-105.23,0-114H163v13a54.33,54.33,0,0,1,34.54-12.66c26,0,44.39,18.8,44.39,55.29v58.35H198.1V182A17.54,17.54,0,0,0,180.56,164.44Z">
                    </path>
                  </svg></a>
                <a class="footer-icon" id="footer_github" href="https://github.com/ncbi" aria-label="GitHub"><svg data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 300 300">
                    <defs>
                      <style>
                        .cls-11,
                        .cls-12 {
                          fill: #737373;
                        }

                        .cls-11 {
                          fill-rule: evenodd;
                        }
                      </style>
                    </defs>
                    <title>GitHub</title>
                    <path class="cls-11" d="M151.36,47.28a105.76,105.76,0,0,0-33.43,206.1c5.28,1,7.22-2.3,7.22-5.09,0-2.52-.09-10.85-.14-19.69-29.42,6.4-35.63-12.48-35.63-12.48-4.81-12.22-11.74-15.47-11.74-15.47-9.59-6.56.73-6.43.73-6.43,10.61.75,16.21,10.9,16.21,10.9,9.43,16.17,24.73,11.49,30.77,8.79,1-6.83,3.69-11.5,6.71-14.14C108.57,197.1,83.88,188,83.88,147.51a40.92,40.92,0,0,1,10.9-28.39c-1.1-2.66-4.72-13.42,1-28,0,0,8.88-2.84,29.09,10.84a100.26,100.26,0,0,1,53,0C198,88.3,206.9,91.14,206.9,91.14c5.76,14.56,2.14,25.32,1,28a40.87,40.87,0,0,1,10.89,28.39c0,40.62-24.74,49.56-48.29,52.18,3.79,3.28,7.17,9.71,7.17,19.58,0,14.15-.12,25.54-.12,29,0,2.82,1.9,6.11,7.26,5.07A105.76,105.76,0,0,0,151.36,47.28Z">
                    </path>
                    <path class="cls-12" d="M85.66,199.12c-.23.52-1.06.68-1.81.32s-1.2-1.06-.95-1.59,1.06-.69,1.82-.33,1.21,1.07.94,1.6Zm-1.3-1">
                    </path>
                    <path class="cls-12" d="M90,203.89c-.51.47-1.49.25-2.16-.49a1.61,1.61,0,0,1-.31-2.19c.52-.47,1.47-.25,2.17.49s.82,1.72.3,2.19Zm-1-1.08">
                    </path>
                    <path class="cls-12" d="M94.12,210c-.65.46-1.71,0-2.37-.91s-.64-2.07,0-2.52,1.7,0,2.36.89.65,2.08,0,2.54Zm0,0"></path>
                    <path class="cls-12" d="M99.83,215.87c-.58.64-1.82.47-2.72-.41s-1.18-2.06-.6-2.7,1.83-.46,2.74.41,1.2,2.07.58,2.7Zm0,0">
                    </path>
                    <path class="cls-12" d="M107.71,219.29c-.26.82-1.45,1.2-2.64.85s-2-1.34-1.74-2.17,1.44-1.23,2.65-.85,2,1.32,1.73,2.17Zm0,0">
                    </path>
                    <path class="cls-12" d="M116.36,219.92c0,.87-1,1.59-2.24,1.61s-2.29-.68-2.3-1.54,1-1.59,2.26-1.61,2.28.67,2.28,1.54Zm0,0">
                    </path>
                    <path class="cls-12" d="M124.42,218.55c.15.85-.73,1.72-2,1.95s-2.37-.3-2.52-1.14.73-1.75,2-2,2.37.29,2.53,1.16Zm0,0"></path>
                  </svg></a>
                <a class="footer-icon" id="footer_blog" href="https://ncbiinsights.ncbi.nlm.nih.gov/" aria-label="Blog">
                  <svg id="Layer_1" data-name="Layer 1" xmlns="http://www.w3.org/2000/svg" viewBox="0 0 40 40"><defs><style>.cls-1{fill:#737373;}</style></defs><path class="cls-1" d="M14,30a4,4,0,1,1-4-4,4,4,0,0,1,4,4Zm11,3A19,19,0,0,0,7.05,15a1,1,0,0,0-1,1v3a1,1,0,0,0,.93,1A14,14,0,0,1,20,33.07,1,1,0,0,0,21,34h3a1,1,0,0,0,1-1Zm9,0A28,28,0,0,0,7,6,1,1,0,0,0,6,7v3a1,1,0,0,0,1,1A23,23,0,0,1,29,33a1,1,0,0,0,1,1h3A1,1,0,0,0,34,33Z"></path></svg>
                </a>
              </div>
            </div>
        </section>
      <section class="container-fluid bg-primary">
        <div class="container pt-5">
          <div class="row mt-3">
            <div class="col-lg-3 col-12">
              <p><a class="text-white" href="https://www.nlm.nih.gov/socialmedia/index.html">Follow NLM</a></p>
              <ul class="list-inline social_media">
                  <li class="list-inline-item">
                      <a href="https://twitter.com/NLM_NIH" aria-label="Twitter" target="_blank" rel="noopener noreferrer">
                          <svg width="35" height="35" viewBox="0 0 38 35" fill="none" xmlns="http://www.w3.org/2000/svg">
                              <title>Twitter</title>
                              <g id="twitterx1009" clip-path="url(#clip0_65276_3946)">
                                 <path id="Vector" d="M17.5006 34.6565C26.9761 34.6565 34.6575 26.9751 34.6575 17.4996C34.6575 8.02416 26.9761 0.342773 17.5006 0.342773C8.02514 0.342773 0.34375 8.02416 0.34375 17.4996C0.34375 26.9751 8.02514 34.6565 17.5006 34.6565Z" fill="#205493" stroke="white" stroke-width="1.2" stroke-miterlimit="10"></path>
                                 <path id="path1009" d="M8.54811 8.5L16.2698 18.4279L8.50001 26.5H11.5L17.5 20L22.5486 26.5H28.5L20.5 16L27 8.5H24.5L19 14.5L14.5007 8.5H8.54927H8.54811ZM11.1197 9.73873H13.4519L25.4519 25.2613H23.1926L11.1197 9.73873Z" fill="white"></path>
                              </g>
                              <defs>
                              <clipPath id="clip0_65276_3946"> <rect width="38" height="38" fill="white"></rect> </clipPath>
                              </defs>
                          </svg>
                      </a>
                  </li>
                <li class="list-inline-item"><a href="https://www.facebook.com/nationallibraryofmedicine" aria-label="Facebook" rel="noopener noreferrer" target="_blank">
                  <svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <style type="text/css">
                        .st10 {
                          fill: #FFFFFF;
                        }

                        .st110 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }
                      </style>
                      <title>SM-Facebook</title>
                      <g>
                        <g>
                          <path class="st10" d="M159,99.1h-24V88.4c0-5,3.3-6.2,5.7-6.2h16.8V60l-24.4-0.1c-22.1,0-26.2,16.5-26.2,27.1v12.1H90v22.5h16.9
                                                      v67.5H135v-67.5h21.7L159,99.1z"></path>
                        </g>
                      </g>
                      <circle class="st110" cx="123.6" cy="123.2" r="108.2"></circle>
                    </svg>
                </a>
                </li>
                <li class="list-inline-item"><a href="https://www.youtube.com/user/NLMNIH" aria-label="Youtube" target="_blank" rel="noopener noreferrer"><svg version="1.1" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink" x="0px" y="0px" viewBox="0 0 249 249" style="enable-background:new 0 0 249 249;" xml:space="preserve">
                      <title>SM-Youtube</title>
                      <style type="text/css">
                        .st4 {
                          fill: none;
                          stroke: #FFFFFF;
                          stroke-width: 8;
                          stroke-miterlimit: 10;
                        }

                        .st5 {
                          fill: #FFFFFF;
                        }
                      </style>
                      <circle class="st4" cx="124.2" cy="123.4" r="108.2"></circle>
                      <g transform="translate(0,-952.36218)">
                        <path class="st5" d="M88.4,1037.4c-10.4,0-18.7,8.3-18.7,18.7v40.1c0,10.4,8.3,18.7,18.7,18.7h72.1c10.4,0,18.7-8.3,18.7-18.7
                                            v-40.1c0-10.4-8.3-18.7-18.7-18.7H88.4z M115.2,1058.8l29.4,17.4l-29.4,17.4V1058.8z"></path>
                      </g>
                    </svg></a></li>
              </ul>
            </div>
            <div class="col-lg-3 col-12">
              <p class="address_footer text-white">National Library of Medicine<br>
                <a href="https://www.google.com/maps/place/8600+Rockville+Pike,+Bethesda,+MD+20894/@38.9959508,-77.101021,17z/data=!3m1!4b1!4m5!3m4!1s0x89b7c95e25765ddb:0x19156f88b27635b8!8m2!3d38.9959508!4d-77.0988323" class="text-white" target="_blank" rel="noopener noreferrer">8600 Rockville Pike<br>
                  Bethesda, MD 20894</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a href="https://www.nlm.nih.gov/web_policies.html" class="text-white">Web Policies</a><br>
                <a href="https://www.nih.gov/institutes-nih/nih-office-director/office-communications-public-liaison/freedom-information-act-office" class="text-white">FOIA</a><br>
                <a href="https://www.hhs.gov/vulnerability-disclosure-policy/index.html" class="text-white" id="vdp">HHS Vulnerability Disclosure</a></p>
            </div>
            <div class="col-lg-3 col-12 centered-lg">
              <p><a class="supportLink text-white" href="https://support.nlm.nih.gov/">Help</a><br>
                <a href="https://www.nlm.nih.gov/accessibility.html" class="text-white">Accessibility</a><br>
                <a href="https://www.nlm.nih.gov/careers/careers.html" class="text-white">Careers</a></p>
            </div>
          </div>
          <div class="row">
            <div class="col-lg-12 centered-lg">
              <nav class="bottom-links">
                <ul class="mt-3">
                  <li>
                    <a class="text-white" href="https://www.nlm.nih.gov/">NLM</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.nih.gov/">NIH</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.hhs.gov/">HHS</a>
                  </li>
                  <li>
                    <a class="text-white" href="https://www.usa.gov/">USA.gov</a>
                  </li>
                </ul>
              </nav>
            </div>
          </div>
        </div>
      </section>
    </footer>
    </body>
</html>
M  END
$$$$

✍: FYIcenter.com

2024-07-11, 586👍, 0💬