Molecule FYI-1000971

A

Molecule Summary:

ID: FYI-1000971
SMILES: O=C1CSC(=S)N1CCCN1CCCCCC1

Received at FYIcenter.com on: 2021-08-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000971
FYIcenter.com

 37 38  0  0  0  0  0  0  0  0999 V2000
    2.4612   -0.3786    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.6691   -1.3568    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -2.0999    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5000   -2.9659    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.4781   -2.7580    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2213   -3.4271    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    3.5827   -1.7635    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4487   -1.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4487   -0.2635    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3147    0.2365    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.3147    1.2365    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.4138    1.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1912    2.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8147    3.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8147    3.4271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4382    2.6453    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2157    1.6704    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.5851   -1.6392    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4984   -2.4643    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6608   -1.8461    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.0593   -1.1558    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2366    0.3191    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8381   -0.3712    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5268   -0.3461    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9253    0.3442    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7938    1.6704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2758    1.0659    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.8047    3.1301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.6326    2.3763    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.9527    4.0316    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2561    3.6962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3733    3.6962    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.6768    4.0316    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9968    2.3763    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8248    3.1301    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.3537    1.0659    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.8357    1.6704    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  5  7  1  0  0  0  0
  2  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
 10 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 11 17  1  0  0  0  0
  3 18  1  0  0  0  0
  3 19  1  0  0  0  0
  8 20  1  0  0  0  0
  8 21  1  0  0  0  0
  9 22  1  0  0  0  0
  9 23  1  0  0  0  0
 10 24  1  0  0  0  0
 10 25  1  0  0  0  0
 12 26  1  0  0  0  0
 12 27  1  0  0  0  0
 13 28  1  0  0  0  0
 13 29  1  0  0  0  0
 14 30  1  0  0  0  0
 14 31  1  0  0  0  0
 15 32  1  0  0  0  0
 15 33  1  0  0  0  0
 16 34  1  0  0  0  0
 16 35  1  0  0  0  0
 17 36  1  0  0  0  0
 17 37  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="175" x2="182" y1="246" y2="213.5" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #ff0000" />
<line x1="182" x2="189" y1="213.5" y2="181" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="168" x2="175" y1="245" y2="212" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #ff0000" />
<line x1="175" x2="182" y1="212" y2="179" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="185.05166449918" x2="162.80873409575" y1="179.6962077842" y2="154.99329105608" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="162.80873409575" x2="140.56580369233" y1="154.99329105608" y2="130.29037432797" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="140.56580369233" x2="157.18733291324" y1="130.29037432797" y2="101.50188571735" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="157.18733291324" x2="173.80886213415" y1="101.50188571735" y2="72.713397106734" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #c8aa1a" />
<line x1="173.80886213415" x2="206.3238975961" y1="72.713397106734" y2="79.624628956789" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #c8aa1a" />
<line x1="206.3238975961" x2="238.83893305804" y1="79.624628956789" y2="86.535860806843" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="242" x2="266.5" y1="90" y2="67.5" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="266.5" x2="291" y1="67.5" y2="45" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #c8aa1a" />
<line x1="237" x2="261.5" y1="84" y2="62" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="261.5" x2="286" y1="62" y2="40" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #c8aa1a" />
<line x1="238.83893305804" x2="242.31615697105" y1="86.535860806843" y2="119.59608242723" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="242.31615697105" x2="245.79338088407" y1="119.59608242723" y2="152.65630404762" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="185.05166449918" x2="215.42252269162" y1="179.6962077842" y2="166.17625591591" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="215.42252269162" x2="245.79338088407" y1="166.17625591591" y2="152.65630404762" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="245.79338088407" x2="274.58186949468" y1="152.65630404762" y2="169.27783326853" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="274.58186949468" x2="303.3703581053" y1="169.27783326853" y2="185.89936248944" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="303.3703581053" x2="303.3703581053" y1="185.89936248944" y2="219.14242093126" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="303.3703581053" x2="303.3703581053" y1="219.14242093126" y2="252.38547937308" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="303.3703581053" x2="332.15884671592" y1="252.38547937308" y2="269.00700859399" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="332.15884671592" x2="360.94733532653" y1="269.00700859399" y2="285.6285378149" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="360.94733532653" x2="360.94733532653" y1="285.6285378149" y2="318.87159625672" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="360.94733532653" x2="360.94733532653" y1="318.87159625672" y2="352.11465469854" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="360.94733532653" x2="330.9986639763" y1="352.11465469854" y2="366.53881775645" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="330.9986639763" x2="301.04999262606" y1="366.53881775645" y2="380.96298081435" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="301.04999262606" x2="293.65008781691" y1="380.96298081435" y2="413.37163848928" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="293.65008781691" x2="286.25018300776" y1="413.37163848928" y2="445.78029616421" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="286.25018300776" x2="306.97722994624" y1="445.78029616421" y2="471.76971925403" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="306.97722994624" x2="327.70427688471" y1="471.76971925403" y2="497.75914234384" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="327.70427688471" x2="360.94733532653" y1="497.75914234384" y2="497.75914234384" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="360.94733532653" x2="394.19039376835" y1="497.75914234384" y2="497.75914234384" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="394.19039376835" x2="414.91744070683" y1="497.75914234384" y2="471.76971925403" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="414.91744070683" x2="435.6444876453" y1="471.76971925403" y2="445.78029616421" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="435.6444876453" x2="428.247907142" y1="445.78029616421" y2="413.37163848928" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="428.247907142" x2="420.85132663869" y1="413.37163848928" y2="380.96298081435" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<line x1="360.94733532653" x2="390.89933098261" y1="352.11465469854" y2="366.53881775645" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #0000ff" />
<line x1="390.89933098261" x2="420.85132663869" y1="366.53881775645" y2="380.96298081435" style="stroke-opacity:1; stroke-width: 2.7993616333177; stroke: #000000" />
<ellipse cx="171.22920079907" cy="244.73292731977" rx="18.195850616565" ry="18.195850616565" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="171.22920079907" y="260.12941630302"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:34.992020416471px">O</text>
<ellipse cx="173.80886213415" cy="72.713397106734" rx="18.195850616565" ry="18.195850616565" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="173.80886213415" y="88.109886089982"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:34.992020416471px">S</text>
<ellipse cx="288.25141512596" cy="42.05" rx="18.195850616565" ry="18.195850616565" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="288.25141512596" y="57.446488983247"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:34.992020416471px">S</text>
<ellipse cx="245.79338088407" cy="152.65630404762" rx="18.195850616565" ry="18.195850616565" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="245.79338088407" y="168.05279303087"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.992020416471px">N</text>
<ellipse cx="360.94733532653" cy="352.11465469854" rx="18.195850616565" ry="18.195850616565" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="360.94733532653" y="367.51114368179"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:34.992020416471px">N</text>
</g></svg>

✍: FYIcenter.com

2021-11-30, 214👍, 0💬