Molecule FYI-1000975

A

Molecule Summary:

ID: FYI-1000975
SMILES: S=C1S/C(=C/c2ccc(CC)cc2)C(=O)N1CCN(CC)CC

Received at FYIcenter.com on: 2021-08-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000975
FYIcenter.com

 23 24  0  0  0  0  0  0  0  0999 V2000
    7.6322    0.8611    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3412    2.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2779    3.2710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5779    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1473    5.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3245    6.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8939    8.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0710    9.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6787    9.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8558   10.2928    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4635   10.1465    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1092    7.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9321    6.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2086    4.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1681    5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12  9  1  0  0  0  0
 13 12  2  0  0  0  0
 13  6  1  0  0  0  0
 14  4  1  0  0  0  0
 15 14  2  0  0  0  0
 16 14  1  0  0  0  0
 16  2  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 19  1  0  0  0  0
 23 22  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="448" x2="455" y1="151" y2="118" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="455" x2="462" y1="118" y2="85" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" />
<line x1="441" x2="448" y1="149" y2="116" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="448" x2="455" y1="116" y2="83" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" />
<line x1="489.41175433313" x2="466.84697458418" y1="199.64452238458" y2="174.58164542204" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" />
<line x1="466.84697458418" x2="444.28219483522" y1="174.58164542204" y2="149.51876845951" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="455.68623746697" x2="472.54899590005" y1="258.05711759677" y2="228.85081999067" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="472.54899590005" x2="489.41175433313" y1="228.85081999067" y2="199.64452238458" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" />
<line x1="487" x2="473" y1="319" y2="288" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="473" x2="459" y1="288" y2="257" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="480" x2="466.5" y1="322" y2="291" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="466.5" x2="453" y1="291" y2="260" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="443.47760036142" x2="463.29856841676" y1="374.24634113166" y2="346.96239798694" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="463.29856841676" x2="483.1195364721" y1="346.96239798694" y2="319.67845484222" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="475" x2="461" y1="435" y2="404" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="461" x2="447" y1="404" y2="373" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="468" x2="454.5" y1="438" y2="407" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="454.5" x2="441" y1="407" y2="376" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="431.26414532489" x2="451.08752234572" y1="490.43556466656" y2="463.14921255635" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="451.08752234572" x2="470.91089936655" y1="463.14921255635" y2="435.86286044614" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="364" x2="397.5" y1="487" y2="490.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="397.5" x2="431" y1="490.5" y2="494" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="365" x2="398.5" y1="480" y2="483.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="398.5" x2="432" y1="483.5" y2="487" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="324.53733823644" x2="344.36071525727" y1="537.95" y2="510.66605685528" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="344.36071525727" x2="364.1840922781" y1="510.66605685528" y2="483.38211371055" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="257.45728518965" x2="290.99731171304" y1="530.90136697497" y2="534.42568348749" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="290.99731171304" x2="324.53733823644" y1="534.42568348749" y2="537.95" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="336.74597534199" x2="350.46503381004" y1="421.76559439608" y2="452.57385405332" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="350.46503381004" x2="364.1840922781" y1="452.57385405332" y2="483.38211371055" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="374" x2="354" y1="366" y2="393" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="354" x2="334" y1="393" y2="420" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="380" x2="360" y1="370" y2="397" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="360" x2="340" y1="397" y2="424" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="376.39272938365" x2="409.93516487253" y1="367.19770810664" y2="370.72202461915" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="409.93516487253" x2="443.47760036142" y1="370.72202461915" y2="374.24634113166" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="389.71430854578" x2="422.70027300637" y1="244.03212051143" y2="251.0446190541" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="422.70027300637" x2="455.68623746697" y1="251.0446190541" y2="258.05711759677" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="342" x2="367.5" y1="292" y2="269.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #ff0000" />
<line x1="367.5" x2="393" y1="269.5" y2="247" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="338" x2="363" y1="287" y2="264.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #ff0000" />
<line x1="363" x2="388" y1="264.5" y2="242" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="382.65603965879" x2="386.18517410229" y1="176.95206746464" y2="210.49209398803" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="386.18517410229" x2="389.71430854578" y1="210.49209398803" y2="244.03212051143" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="382.65603965879" x2="413.46911724701" y1="176.95206746464" y2="163.23541796207" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="413.46911724701" x2="444.28219483522" y1="163.23541796207" y2="149.51876845951" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="324.2434444466" x2="353.4497420527" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="353.4497420527" x2="382.65603965879" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="265.83084923442" x2="295.03714684051" y1="176.95206746464" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="295.03714684051" x2="324.2434444466" y1="160.08930903156" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="207.41825402223" x2="236.62455162832" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="236.62455162832" x2="265.83084923442" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="207.41825402223" x2="207.41825402223" y1="75.775516866159" y2="109.50103373232" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="207.41825402223" x2="207.41825402223" y1="109.50103373232" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="265.83084923442" x2="236.62455162832" y1="42.05" y2="58.912758433079" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="236.62455162832" x2="207.41825402223" y1="58.912758433079" y2="75.775516866159" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="149.00084087906" x2="178.20954745065" y1="176.95206746464" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="178.20954745065" x2="207.41825402223" y1="160.08930903156" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" />
<line x1="90.588245666874" x2="119.79454327297" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<line x1="119.79454327297" x2="149.00084087906" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" />
<ellipse cx="458.30237398958" cy="83.537203676356" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="458.30237398958" y="99.157188228925"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:35.499964892202px">S</text>
<ellipse cx="489.41175433313" cy="199.64452238458" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="489.41175433313" y="215.26450693715"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:35.499964892202px">S</text>
<ellipse cx="339.58373668972" cy="289.17131587129" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58373668972" y="304.79130042386"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:35.499964892202px">O</text>
<ellipse cx="382.65603965879" cy="176.95206746464" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="382.65603965879" y="192.5720520172"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:35.499964892202px">N</text>
<ellipse cx="207.41825402223" cy="143.22655059848" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.41825402223" y="158.84653515105"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:35.499964892202px">N</text>
</g></svg>

✍: FYIcenter.com

2021-12-28, 212👍, 0💬