Collections:
Molecule FYI-1000975
Molecule Summary:
ID: FYI-1000975
SMILES: S=C1S/C(=C/c2ccc(CC)cc2)C(=O)N1CCN(CC)CC
Received at FYIcenter.com on: 2021-08-20
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000975 FYIcenter.com 23 24 0 0 0 0 0 0 0 0999 V2000 7.6322 0.8611 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 7.3412 2.2306 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2779 3.2710 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 7.5779 4.4834 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1473 5.7624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3245 6.8950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.8939 8.1739 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0710 9.3066 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.6787 9.1602 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8558 10.2928 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4635 10.1465 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1092 7.8813 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9321 6.7487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.2086 4.1923 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1681 5.1292 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0621 2.8000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 4.8497 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.1000 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 0.7000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 0.0000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 2.8000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.1000 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 2 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 9 1 0 0 0 0 11 10 1 0 0 0 0 12 9 1 0 0 0 0 13 12 2 0 0 0 0 13 6 1 0 0 0 0 14 4 1 0 0 0 0 15 14 2 0 0 0 0 16 14 1 0 0 0 0 16 2 1 0 0 0 0 17 16 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 19 1 0 0 0 0 23 22 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="448" x2="455" y1="151" y2="118" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="455" x2="462" y1="118" y2="85" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" /> <line x1="441" x2="448" y1="149" y2="116" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="448" x2="455" y1="116" y2="83" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" /> <line x1="489.41175433313" x2="466.84697458418" y1="199.64452238458" y2="174.58164542204" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" /> <line x1="466.84697458418" x2="444.28219483522" y1="174.58164542204" y2="149.51876845951" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="455.68623746697" x2="472.54899590005" y1="258.05711759677" y2="228.85081999067" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="472.54899590005" x2="489.41175433313" y1="228.85081999067" y2="199.64452238458" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #c8aa1a" /> <line x1="487" x2="473" y1="319" y2="288" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="473" x2="459" y1="288" y2="257" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="480" x2="466.5" y1="322" y2="291" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="466.5" x2="453" y1="291" y2="260" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="443.47760036142" x2="463.29856841676" y1="374.24634113166" y2="346.96239798694" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="463.29856841676" x2="483.1195364721" y1="346.96239798694" y2="319.67845484222" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="475" x2="461" y1="435" y2="404" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="461" x2="447" y1="404" y2="373" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="468" x2="454.5" y1="438" y2="407" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="454.5" x2="441" y1="407" y2="376" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="431.26414532489" x2="451.08752234572" y1="490.43556466656" y2="463.14921255635" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="451.08752234572" x2="470.91089936655" y1="463.14921255635" y2="435.86286044614" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="364" x2="397.5" y1="487" y2="490.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="397.5" x2="431" y1="490.5" y2="494" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="365" x2="398.5" y1="480" y2="483.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="398.5" x2="432" y1="483.5" y2="487" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="324.53733823644" x2="344.36071525727" y1="537.95" y2="510.66605685528" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="344.36071525727" x2="364.1840922781" y1="510.66605685528" y2="483.38211371055" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="257.45728518965" x2="290.99731171304" y1="530.90136697497" y2="534.42568348749" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="290.99731171304" x2="324.53733823644" y1="534.42568348749" y2="537.95" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="336.74597534199" x2="350.46503381004" y1="421.76559439608" y2="452.57385405332" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="350.46503381004" x2="364.1840922781" y1="452.57385405332" y2="483.38211371055" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="374" x2="354" y1="366" y2="393" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="354" x2="334" y1="393" y2="420" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="380" x2="360" y1="370" y2="397" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="360" x2="340" y1="397" y2="424" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="376.39272938365" x2="409.93516487253" y1="367.19770810664" y2="370.72202461915" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="409.93516487253" x2="443.47760036142" y1="370.72202461915" y2="374.24634113166" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="389.71430854578" x2="422.70027300637" y1="244.03212051143" y2="251.0446190541" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="422.70027300637" x2="455.68623746697" y1="251.0446190541" y2="258.05711759677" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="342" x2="367.5" y1="292" y2="269.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #ff0000" /> <line x1="367.5" x2="393" y1="269.5" y2="247" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="338" x2="363" y1="287" y2="264.5" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #ff0000" /> <line x1="363" x2="388" y1="264.5" y2="242" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="382.65603965879" x2="386.18517410229" y1="176.95206746464" y2="210.49209398803" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="386.18517410229" x2="389.71430854578" y1="210.49209398803" y2="244.03212051143" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="382.65603965879" x2="413.46911724701" y1="176.95206746464" y2="163.23541796207" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="413.46911724701" x2="444.28219483522" y1="163.23541796207" y2="149.51876845951" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="324.2434444466" x2="353.4497420527" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="353.4497420527" x2="382.65603965879" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="265.83084923442" x2="295.03714684051" y1="176.95206746464" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="295.03714684051" x2="324.2434444466" y1="160.08930903156" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="207.41825402223" x2="236.62455162832" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="236.62455162832" x2="265.83084923442" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="207.41825402223" x2="207.41825402223" y1="75.775516866159" y2="109.50103373232" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="207.41825402223" x2="207.41825402223" y1="109.50103373232" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="265.83084923442" x2="236.62455162832" y1="42.05" y2="58.912758433079" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="236.62455162832" x2="207.41825402223" y1="58.912758433079" y2="75.775516866159" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="149.00084087906" x2="178.20954745065" y1="176.95206746464" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="178.20954745065" x2="207.41825402223" y1="160.08930903156" y2="143.22655059848" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #0000ff" /> <line x1="90.588245666874" x2="119.79454327297" y1="143.22655059848" y2="160.08930903156" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <line x1="119.79454327297" x2="149.00084087906" y1="160.08930903156" y2="176.95206746464" style="stroke-opacity:1; stroke-width: 2.8399971913762; stroke: #000000" /> <ellipse cx="458.30237398958" cy="83.537203676356" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="458.30237398958" y="99.157188228925" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:35.499964892202px">S</text> <ellipse cx="489.41175433313" cy="199.64452238458" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="489.41175433313" y="215.26450693715" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:35.499964892202px">S</text> <ellipse cx="339.58373668972" cy="289.17131587129" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58373668972" y="304.79130042386" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:35.499964892202px">O</text> <ellipse cx="382.65603965879" cy="176.95206746464" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="382.65603965879" y="192.5720520172" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:35.499964892202px">N</text> <ellipse cx="207.41825402223" cy="143.22655059848" rx="18.459981743945" ry="18.459981743945" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.41825402223" y="158.84653515105" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:35.499964892202px">N</text> </g></svg>
✍: FYIcenter.com
2021-12-28, 212👍, 0💬
Popular Posts:
What is biomodel.uah.es? biomodel.uah.es is a Website that offers an online tool to draw and view an...
What is Radical Molecule? A Radical molecule, also called free radical, is molecule that has one or ...
How to run OpenBabelGUI on Windows computers? Open Babel GUI is the graphical user interface for Ope...
What Is Atomic Bond? Atomic Bond is a physical process that ties atoms together to form a molecule. ...
How to perform exact match in fastsearch index file using a "babel" command? If you want to perform ...