Collections:
Molecule FYI-1000976
Molecule Summary:
ID: FYI-1000976
SMILES: S=C1S/C(=C/c2ccccc2C)C(=O)N1CCN(C)C
Received at FYIcenter.com on: 2021-08-20
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000976 FYIcenter.com 20 21 0 0 0 0 0 0 0 0999 V2000 3.9557 0.0000 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 4.9961 0.9368 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3655 0.6457 0.0000 S 0 0 0 0 0 0 0 0 0 0 0 0 7.0655 1.8582 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.4578 2.0045 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.0273 3.2835 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.2044 4.4161 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.7738 5.6950 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.1662 5.8414 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9890 4.7088 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.4196 3.4298 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.2425 2.2972 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1288 2.8986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4198 4.2680 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.8498 2.3291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 3.6373 3.0291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4249 2.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 3.0291 0.0000 N 0 0 0 0 0 0 0 0 0 0 0 0 1.2124 4.4292 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 2.3291 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2 1 2 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 2 0 0 0 0 6 5 1 0 0 0 0 7 6 2 0 0 0 0 8 7 1 0 0 0 0 9 8 2 0 0 0 0 10 9 1 0 0 0 0 11 10 2 0 0 0 0 11 6 1 0 0 0 0 12 11 1 0 0 0 0 13 4 1 0 0 0 0 14 13 2 0 0 0 0 15 13 1 0 0 0 0 15 2 1 0 0 0 0 16 15 1 0 0 0 0 17 16 1 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 18 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="265" x2="242" y1="201" y2="180" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="242" x2="219" y1="180" y2="159" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" /> <line x1="261" x2="238" y1="205" y2="184.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="238" x2="215" y1="184.5" y2="164" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" /> <line x1="322.82842561708" x2="292.62671514343" y1="189.65110073382" y2="196.07122481654" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" /> <line x1="292.62671514343" x2="262.42500466978" y1="196.07122481654" y2="202.49134889927" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="353.70501000667" x2="338.26671781187" y1="243.13375583722" y2="216.39242828552" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="338.26671781187" x2="322.82842561708" y1="216.39242828552" y2="189.65110073382" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" /> <line x1="416" x2="385.5" y1="247" y2="243.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="385.5" x2="355" y1="243.5" y2="240" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="415" x2="384.5" y1="253" y2="250" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="384.5" x2="354" y1="250" y2="247" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="440.23884322882" x2="427.6786897932" y1="306.00289259506" y2="277.79492728486" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="427.6786897932" x2="415.11853635757" y1="277.79492728486" y2="249.58696197465" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="407" x2="425" y1="358" y2="333" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="425" x2="443" y1="333" y2="308" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="402" x2="420" y1="355" y2="330" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="420" x2="438" y1="330" y2="305" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="429.05710873916" x2="416.49916077385" y1="412.37272581721" y2="384.16696597732" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="416.49916077385" x2="403.94121280854" y1="384.16696597732" y2="355.96120613742" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="491" x2="460.5" y1="416" y2="413" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="460.5" x2="430" y1="413" y2="410" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="491" x2="460" y1="423" y2="419.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="460" x2="429" y1="419.5" y2="416" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="526.76826551034" x2="508.62165577051" y1="368.8720293529" y2="393.85118612408" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="508.62165577051" x2="490.47504603069" y1="393.85118612408" y2="418.83034289526" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="499" x2="511.5" y1="314" y2="342.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="511.5" x2="524" y1="342.5" y2="371" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="505" x2="517.5" y1="312" y2="340" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="517.5" x2="530" y1="340" y2="368" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="501.65236957972" x2="470.94560640427" y1="312.45609873249" y2="309.22949566378" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="470.94560640427" x2="440.23884322882" y1="309.22949566378" y2="306.00289259506" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="537.95" x2="519.80118478986" y1="262.49778519013" y2="287.47694196131" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="519.80118478986" x2="501.65236957972" y1="287.47694196131" y2="312.45609873249" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="312.38772915277" x2="333.04636957972" y1="289.02518212141" y2="266.07946897932" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="333.04636957972" x2="353.70501000667" y1="266.07946897932" y2="243.13375583722" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="329" x2="322.5" y1="349" y2="319" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #ff0000" /> <line x1="322.5" x2="316" y1="319" y2="289" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="323" x2="316.5" y1="351" y2="320.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #ff0000" /> <line x1="316.5" x2="310" y1="320.5" y2="290" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="255.97179853235" x2="284.17976384256" y1="263.90487525017" y2="276.46502868579" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <line x1="284.17976384256" x2="312.38772915277" y1="276.46502868579" y2="289.02518212141" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="255.97179853235" x2="259.19840160107" y1="263.90487525017" y2="233.19811207472" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <line x1="259.19840160107" x2="262.42500466978" y1="233.19811207472" y2="202.49134889927" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="202.48914342895" x2="229.23047098065" y1="294.78145963976" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="229.23047098065" x2="255.97179853235" y1="279.34316744496" y2="263.90487525017" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <line x1="149.01089926618" x2="175.75002134757" y1="263.90487525017" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="175.75002134757" x2="202.48914342895" y1="279.34316744496" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="95.528244162775" x2="122.26957171448" y1="294.78145963976" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <line x1="122.26957171448" x2="149.01089926618" y1="279.34316744496" y2="263.90487525017" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="95.528244162775" x2="95.528244162775" y1="356.53903935957" y2="325.66024949967" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="95.528244162775" x2="95.528244162775" y1="325.66024949967" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <line x1="42.05" x2="68.789122081388" y1="263.90487525017" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" /> <line x1="68.789122081388" x2="95.528244162775" y1="279.34316744496" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" /> <ellipse cx="216.53357838559" cy="161.16965710474" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="216.53357838559" y="175.4702173358" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:32.501273252411px">S</text> <ellipse cx="322.82842561708" cy="189.65110073382" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.82842561708" y="203.95166096488" fill="#c8aa1a" style="text-anchor:middle; font-family:sans-serif;font-size:32.501273252411px">S</text> <ellipse cx="325.22356637759" cy="349.42860306871" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.22356637759" y="363.72916329977" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:32.501273252411px">O</text> <ellipse cx="255.97179853235" cy="263.90487525017" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.97179853235" y="278.20543548123" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:32.501273252411px">N</text> <ellipse cx="95.528244162775" cy="294.78145963976" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.528244162775" y="309.08201987082" fill="#0000ff" style="text-anchor:middle; font-family:sans-serif;font-size:32.501273252411px">N</text> </g></svg>
✍: FYIcenter.com
2021-12-28, 185👍, 0💬
Popular Posts:
What is pubchem.ncbi.nlm.nih.gov Molecule Database? pubchem.ncbi.nlm.nih.gov Molecule Database is th...
Where to find FAQ (Frequently Asked Questions) on online tools for SDF/Mol files? I want to use them...
What Is Tanimoto coefficient? Tanimoto coefficient is a metric (or score) to measure the similarity ...
Where to find molecule FAQ (Frequently Asked Questions)? I want to learn more about SDF/Mol file for...
What is pubchem.ncbi.nlm.nih.gov Molecule Database? pubchem.ncbi.nlm.nih.gov Molecule Database is th...