Molecule FYI-1000976

A

Molecule Summary:

ID: FYI-1000976
SMILES: S=C1S/C(=C/c2ccccc2C)C(=O)N1CCN(C)C

Received at FYIcenter.com on: 2021-08-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000976
FYIcenter.com

 20 21  0  0  0  0  0  0  0  0999 V2000
    3.9557    0.0000    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    4.9961    0.9368    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.3655    0.6457    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.0655    1.8582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4578    2.0045    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.0273    3.2835    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2044    4.4161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7738    5.6950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1662    5.8414    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9890    4.7088    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.4196    3.4298    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2425    2.2972    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1288    2.8986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.4198    4.2680    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.3291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.0291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.0291    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.4292    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.3291    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  6  1  0  0  0  0
 12 11  1  0  0  0  0
 13  4  1  0  0  0  0
 14 13  2  0  0  0  0
 15 13  1  0  0  0  0
 15  2  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 18  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="265" x2="242" y1="201" y2="180" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="242" x2="219" y1="180" y2="159" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" />
<line x1="261" x2="238" y1="205" y2="184.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="238" x2="215" y1="184.5" y2="164" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" />
<line x1="322.82842561708" x2="292.62671514343" y1="189.65110073382" y2="196.07122481654" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" />
<line x1="292.62671514343" x2="262.42500466978" y1="196.07122481654" y2="202.49134889927" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="353.70501000667" x2="338.26671781187" y1="243.13375583722" y2="216.39242828552" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="338.26671781187" x2="322.82842561708" y1="216.39242828552" y2="189.65110073382" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #c8aa1a" />
<line x1="416" x2="385.5" y1="247" y2="243.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="385.5" x2="355" y1="243.5" y2="240" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="415" x2="384.5" y1="253" y2="250" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="384.5" x2="354" y1="250" y2="247" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="440.23884322882" x2="427.6786897932" y1="306.00289259506" y2="277.79492728486" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="427.6786897932" x2="415.11853635757" y1="277.79492728486" y2="249.58696197465" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="407" x2="425" y1="358" y2="333" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="425" x2="443" y1="333" y2="308" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="402" x2="420" y1="355" y2="330" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="420" x2="438" y1="330" y2="305" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="429.05710873916" x2="416.49916077385" y1="412.37272581721" y2="384.16696597732" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="416.49916077385" x2="403.94121280854" y1="384.16696597732" y2="355.96120613742" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="491" x2="460.5" y1="416" y2="413" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="460.5" x2="430" y1="413" y2="410" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="491" x2="460" y1="423" y2="419.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="460" x2="429" y1="419.5" y2="416" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="526.76826551034" x2="508.62165577051" y1="368.8720293529" y2="393.85118612408" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="508.62165577051" x2="490.47504603069" y1="393.85118612408" y2="418.83034289526" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="499" x2="511.5" y1="314" y2="342.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="511.5" x2="524" y1="342.5" y2="371" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="505" x2="517.5" y1="312" y2="340" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="517.5" x2="530" y1="340" y2="368" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="501.65236957972" x2="470.94560640427" y1="312.45609873249" y2="309.22949566378" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="470.94560640427" x2="440.23884322882" y1="309.22949566378" y2="306.00289259506" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="537.95" x2="519.80118478986" y1="262.49778519013" y2="287.47694196131" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="519.80118478986" x2="501.65236957972" y1="287.47694196131" y2="312.45609873249" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="312.38772915277" x2="333.04636957972" y1="289.02518212141" y2="266.07946897932" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="333.04636957972" x2="353.70501000667" y1="266.07946897932" y2="243.13375583722" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="329" x2="322.5" y1="349" y2="319" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #ff0000" />
<line x1="322.5" x2="316" y1="319" y2="289" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="323" x2="316.5" y1="351" y2="320.5" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #ff0000" />
<line x1="316.5" x2="310" y1="320.5" y2="290" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="255.97179853235" x2="284.17976384256" y1="263.90487525017" y2="276.46502868579" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<line x1="284.17976384256" x2="312.38772915277" y1="276.46502868579" y2="289.02518212141" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="255.97179853235" x2="259.19840160107" y1="263.90487525017" y2="233.19811207472" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<line x1="259.19840160107" x2="262.42500466978" y1="233.19811207472" y2="202.49134889927" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="202.48914342895" x2="229.23047098065" y1="294.78145963976" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="229.23047098065" x2="255.97179853235" y1="279.34316744496" y2="263.90487525017" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<line x1="149.01089926618" x2="175.75002134757" y1="263.90487525017" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="175.75002134757" x2="202.48914342895" y1="279.34316744496" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="95.528244162775" x2="122.26957171448" y1="294.78145963976" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<line x1="122.26957171448" x2="149.01089926618" y1="279.34316744496" y2="263.90487525017" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="95.528244162775" x2="95.528244162775" y1="356.53903935957" y2="325.66024949967" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="95.528244162775" x2="95.528244162775" y1="325.66024949967" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<line x1="42.05" x2="68.789122081388" y1="263.90487525017" y2="279.34316744496" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #000000" />
<line x1="68.789122081388" x2="95.528244162775" y1="279.34316744496" y2="294.78145963976" style="stroke-opacity:1; stroke-width: 2.6001018601929; stroke: #0000ff" />
<ellipse cx="216.53357838559" cy="161.16965710474" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="216.53357838559" y="175.4702173358"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:32.501273252411px">S</text>
<ellipse cx="322.82842561708" cy="189.65110073382" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="322.82842561708" y="203.95166096488"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:32.501273252411px">S</text>
<ellipse cx="325.22356637759" cy="349.42860306871" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="325.22356637759" y="363.72916329977"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.501273252411px">O</text>
<ellipse cx="255.97179853235" cy="263.90487525017" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="255.97179853235" y="278.20543548123"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.501273252411px">N</text>
<ellipse cx="95.528244162775" cy="294.78145963976" rx="16.900662091254" ry="16.900662091254" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="95.528244162775" y="309.08201987082"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.501273252411px">N</text>
</g></svg>

✍: FYIcenter.com

2021-12-28, 185👍, 0💬