Molecule FYI-1000978

A

Molecule Summary:

ID: FYI-1000978
SMILES: S=C1S/C(=C/c2ccccc2)C(=O)N1CCN(CC)CC

Received at FYIcenter.com on: 2021-08-20

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000978
FYIcenter.com

 21 22  0  0  0  0  0  0  0  0999 V2000
    7.6322    0.8611    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.3412    2.2306    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.2779    3.2710    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    7.5779    4.4834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1473    5.7624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3245    6.8950    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8939    8.1739    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.0710    9.3066    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.6787    9.1602    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1092    7.8813    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9321    6.7487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.2086    4.1923    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1681    5.1292    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 11  6  1  0  0  0  0
 12  4  1  0  0  0  0
 13 12  2  0  0  0  0
 14 12  1  0  0  0  0
 14  2  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 17  1  0  0  0  0
 21 20  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="465" x2="472.5" y1="162" y2="125.5" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="472.5" x2="480" y1="125.5" y2="89" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #c8aa1a" />
<line x1="457" x2="465" y1="161" y2="124.5" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="465" x2="473" y1="124.5" y2="88" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #c8aa1a" />
<line x1="510.54298078783" x2="485.58706079556" y1="216.34446844175" y2="188.62573335053" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #c8aa1a" />
<line x1="485.58706079556" x2="460.6311408033" y1="188.62573335053" y2="160.9069982593" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="473.2436448327" x2="491.89331281026" y1="280.94691831603" y2="248.64569337889" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="491.89331281026" x2="510.54298078783" y1="248.64569337889" y2="216.34446844175" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #c8aa1a" />
<line x1="508" x2="492.5" y1="348" y2="314" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="492.5" x2="477" y1="314" y2="280" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="500" x2="485" y1="351" y2="317" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="485" x2="470" y1="317" y2="283" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="459.74128521694" x2="481.66263780543" y1="409.44845915802" y2="379.27329637032" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="481.66263780543" x2="503.58399039391" y1="379.27329637032" y2="349.09813358262" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="494" x2="479" y1="476" y2="442" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="479" x2="464" y1="442" y2="408" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="487" x2="472" y1="480" y2="446" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="472" x2="457" y1="446" y2="412" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="446.23359712462" x2="468.15761395139" y1="537.95" y2="507.77217297402" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="468.15761395139" x2="490.08163077816" y1="507.77217297402" y2="477.59434594804" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="372" x2="409" y1="535" y2="538.5" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="409" x2="446" y1="538.5" y2="542" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="373" x2="410" y1="527" y2="531" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="410" x2="447" y1="531" y2="535" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="341.69954387209" x2="356.87238089098" y1="462.00322351879" y2="496.0761669138" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="356.87238089098" x2="372.04521790987" y1="496.0761669138" y2="530.14911030881" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="383" x2="361" y1="400" y2="430" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="361" x2="339" y1="430" y2="460" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="389" x2="367" y1="404" y2="434.5" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="367" x2="345" y1="434.5" y2="465" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="385.54757752563" x2="422.64443137128" y1="401.6528979434" y2="405.55067855071" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="422.64443137128" x2="459.74128521694" y1="405.55067855071" y2="409.44845915802" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="400.2808152279" x2="436.7622300303" y1="265.43572303527" y2="273.19132067565" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="436.7622300303" x2="473.2436448327" y1="273.19132067565" y2="280.94691831603" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="348" x2="375.5" y1="319" y2="294" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #ff0000" />
<line x1="375.5" x2="403" y1="294" y2="269" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="343" x2="370.5" y1="313" y2="288" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #ff0000" />
<line x1="370.5" x2="398" y1="288" y2="263" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="392.47459706015" x2="396.37770614403" y1="191.24734382051" y2="228.34153342789" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="396.37770614403" x2="400.2808152279" y1="228.34153342789" y2="265.43572303527" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="392.47459706015" x2="426.55286893173" y1="191.24734382051" y2="176.07717103991" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="426.55286893173" x2="460.6311408033" y1="176.07717103991" y2="160.9069982593" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="327.87214718587" x2="360.17337212301" y1="153.94800786539" y2="172.59767584295" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="360.17337212301" x2="392.47459706015" y1="172.59767584295" y2="191.24734382051" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="263.26969731159" x2="295.57092224873" y1="191.24734382051" y2="172.59767584295" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="295.57092224873" x2="327.87214718587" y1="172.59767584295" y2="153.94800786539" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="198.6672474373" x2="230.96847237444" y1="153.94800786539" y2="172.59767584295" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="230.96847237444" x2="263.26969731159" y1="172.59767584295" y2="191.24734382051" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="198.6672474373" x2="198.6672474373" y1="79.349335955129" y2="116.64867191026" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="198.6672474373" x2="198.6672474373" y1="116.64867191026" y2="153.94800786539" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="263.26969731159" x2="230.96847237444" y1="42.05" y2="60.699667977564" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="230.96847237444" x2="198.6672474373" y1="60.699667977564" y2="79.349335955129" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="134.05946908645" x2="166.36335826188" y1="191.24734382051" y2="172.59767584295" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="166.36335826188" x2="198.6672474373" y1="172.59767584295" y2="153.94800786539" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #0000ff" />
<line x1="69.457019212172" x2="101.75824414931" y1="153.94800786539" y2="172.59767584295" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<line x1="101.75824414931" x2="134.05946908645" y1="172.59767584295" y2="191.24734382051" style="stroke-opacity:1; stroke-width: 3.140946933216; stroke: #000000" />
<ellipse cx="476.1370076075" cy="87.933511701373" rx="20.416155065904" ry="20.416155065904" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="476.1370076075" y="105.20871983406"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:39.2618366652px">S</text>
<ellipse cx="510.54298078783" cy="216.34446844175" rx="20.416155065904" ry="20.416155065904" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="510.54298078783" y="233.61967657444"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:39.2618366652px">S</text>
<ellipse cx="344.83801656889" cy="315.35821997292" rx="20.416155065904" ry="20.416155065904" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="344.83801656889" y="332.63342810561"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:39.2618366652px">O</text>
<ellipse cx="392.47459706015" cy="191.24734382051" rx="20.416155065904" ry="20.416155065904" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="392.47459706015" y="208.5225519532"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:39.2618366652px">N</text>
<ellipse cx="198.6672474373" cy="153.94800786539" rx="20.416155065904" ry="20.416155065904" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="198.6672474373" y="171.22321599807"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:39.2618366652px">N</text>
</g></svg>

✍: FYIcenter.com

2021-12-28, 187👍, 0💬