Molecule FYI-1001179

A

Molecule Summary:

ID: FYI-1001179
SMILES: Oc1cc(O)c(C(=O)CCc2ccc(O)c(O)c2)c(O)c1

Received at FYIcenter.com on: 2022-02-21

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001179
FYIcenter.com

 21 22  0  0  0  0  0  0  0  0999 V2000
   12.1244    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    5.6000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0623    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    1.4000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    1.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  4  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 15 14  1  0  0  0  0
 16 14  1  0  0  0  0
 17 16  1  0  0  0  0
 18 16  2  0  0  0  0
 18 11  1  0  0  0  0
 19  6  1  0  0  0  0
 20 19  1  0  0  0  0
 21 19  2  0  0  0  0
 21  2  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="488.36163603972" x2="513.15581801986" y1="261.36930487282" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="513.15581801986" x2="537.95" y1="247.05395730923" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="492" x2="492" y1="319" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="492" x2="492" y1="290.5" y2="262" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="486" x2="486" y1="319" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="486" x2="486" y1="290.5" y2="262" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="438.76509188084" x2="463.56336396028" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="463.56336396028" x2="488.36163603972" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="438.76509188084" x2="438.76509188084" y1="404.52278050873" y2="375.89208538154" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="438.76509188084" x2="438.76509188084" y1="375.89208538154" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="388" x2="413" y1="322" y2="336" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="413" x2="438" y1="336" y2="350" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="391" x2="416" y1="317" y2="331" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="416" x2="441" y1="331" y2="345" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="339.58836396028" x2="364.38254594042" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="364.38254594042" x2="389.17672792056" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="343" x2="343" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="343" x2="343" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="337" x2="337" y1="405" y2="376.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="337" x2="337" y1="376.5" y2="348" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="290.0040900993" x2="314.79622702979" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="314.79622702979" x2="339.58836396028" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="240.40754594042" x2="265.20581801986" y1="347.26139025436" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="265.20581801986" x2="290.0040900993" y1="332.94604269077" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="190.81918198014" x2="215.61336396028" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="215.61336396028" x2="240.40754594042" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="143" x2="168" y1="350" y2="336" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="168" x2="193" y1="336" y2="322" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="140" x2="165" y1="345" y2="331" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="165" x2="190" y1="331" y2="317" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="91.638363960278" x2="116.43459099007" y1="318.63069512718" y2="332.94604269077" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="116.43459099007" x2="141.23081801986" y1="332.94604269077" y2="347.26139025436" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="89" x2="89" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="89" x2="89" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="95" x2="95" y1="262" y2="290.5" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="95" x2="95" y1="290.5" y2="319" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="42.05" x2="66.844181980139" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="66.844181980139" x2="91.638363960278" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="141.23081801986" x2="116.43459099007" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="116.43459099007" x2="91.638363960278" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="141.23081801986" x2="141.23081801986" y1="175.47721949127" y2="204.10791461846" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="141.23081801986" x2="141.23081801986" y1="204.10791461846" y2="232.73860974564" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="193" x2="168" y1="259" y2="245" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="168" x2="143" y1="245" y2="231" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="190" x2="165" y1="264" y2="250" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="165" x2="140" y1="250" y2="236" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="190.81918198014" x2="190.81918198014" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="389.17672792056" x2="389.17672792056" y1="261.36930487282" y2="290" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="389.17672792056" x2="389.17672792056" y1="290" y2="318.63069512718" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="339.58836396028" x2="364.38254594042" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #ff0000" />
<line x1="364.38254594042" x2="389.17672792056" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="438" x2="413" y1="231" y2="245" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="413" x2="388" y1="245" y2="259" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="441" x2="416" y1="236" y2="250" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="416" x2="391" y1="250" y2="264" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="438.76509188084" x2="463.56336396028" y1="232.73860974564" y2="247.05395730923" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<line x1="463.56336396028" x2="488.36163603972" y1="247.05395730923" y2="261.36930487282" style="stroke-opacity:1; stroke-width: 2.4110313741361; stroke: #000000" />
<ellipse cx="537.95" cy="232.73860974564" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="245.99928230339"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
<ellipse cx="438.76509188084" cy="404.52278050873" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="438.76509188084" y="417.78345306647"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
<ellipse cx="339.58836396028" cy="404.52278050873" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58836396028" y="417.78345306647"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
<ellipse cx="42.05" cy="232.73860974564" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="245.99928230339"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
<ellipse cx="141.23081801986" cy="175.47721949127" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="141.23081801986" y="188.73789204902"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
<ellipse cx="339.58836396028" cy="232.73860974564" rx="15.671703931885" ry="15.671703931885" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="339.58836396028" y="245.99928230339"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:30.137892176701px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 119👍, 0💬