Molecule FYI-1001182

A

Molecule Summary:

ID: FYI-1001182
SMILES: C1=CC(=C[N+](=C1)C2C(C(C(O2)COP(=O)([O-])OP(=O)(O)OCC3C(C(C(O3)N4C=NC5=C4N=CN=C5N)O)O)O)O)C(=O)N

Received at FYIcenter.com on: 2022-02-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001182
FYIcenter.com

 44 48  0  0  0  0  0  0  0  0999 V2000
    7.1446   16.0603    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.7140   17.3394    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.1064   17.4856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9293   16.3530    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.3598   15.0741    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
    7.9675   14.9277    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.1827   13.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.5827   13.9415    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.0154   12.6100    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8827   11.7871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7501   12.6100    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.8827   10.3871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6703    9.6871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6703    8.2871    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
   11.0703    8.2871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3703    7.0747    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    8.4579    7.5871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2454    8.2871    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.9454    9.4995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.5454    9.4995    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0330    7.5871    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.8205    8.2871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6081    7.5871    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3291    8.1565    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.3923    7.1161    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0923    5.9036    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4617    6.1947    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.5229    4.6247    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.1535    4.3337    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0072    2.9413    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2861    2.3719    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2229    3.4123    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5923    3.1212    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.0249    1.7897    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0881    0.7493    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.7187    1.0404    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.7819    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    7.2625    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.0380    9.5259    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.3469   12.1774    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.4056   15.0741    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6758   18.7647    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.8529   19.8973    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.0681   18.9110    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  5  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 11  7  1  0  0  0  0
 12 10  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 14  1  0  0  0  0
 17 14  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 18  1  0  0  0  0
 21 18  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 27 23  1  0  0  0  0
 28 26  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  2  0  0  0  0
 31 30  1  0  0  0  0
 32 31  2  0  0  0  0
 32 28  1  0  0  0  0
 33 32  1  0  0  0  0
 34 33  2  0  0  0  0
 35 34  1  0  0  0  0
 36 35  2  0  0  0  0
 36 31  1  0  0  0  0
 37 36  1  0  0  0  0
 38 25  1  0  0  0  0
 39 24  1  0  0  0  0
 40  9  1  0  0  0  0
 41  8  1  0  0  0  0
 42  3  1  0  0  0  0
 43 42  2  0  0  0  0
 44 42  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="318" x2="311" y1="474" y2="458" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="311" x2="304" y1="458" y2="442" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="315" x2="308" y1="475" y2="459.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="308" x2="301" y1="459.5" y2="444" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="350.63636297387" x2="333.28498464616" y1="477.8432503405" y2="476.02138053907" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="333.28498464616" x2="315.93360631845" y1="476.02138053907" y2="474.19951073764" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="370" x2="360" y1="449" y2="463" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="360" x2="350" y1="463" y2="477" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="373" x2="363" y1="451" y2="465" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="363" x2="353" y1="465" y2="479" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="356.9518459791" x2="364.04866439165" y1="417.7414852769" y2="433.678484518" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="364.04866439165" x2="371.1454828042" y1="433.678484518" y2="449.6154837591" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="323" x2="340" y1="416" y2="418" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="340" x2="357" y1="418" y2="420" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="323" x2="340.5" y1="413" y2="414.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="340.5" x2="358" y1="414.5" y2="416" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="322.25158162163" x2="311.99702170646" y1="414.09276107814" y2="428.20664436883" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="311.99702170646" x2="301.7424617913" y1="428.20664436883" y2="442.32052765953" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="377.46096580943" x2="367.20640589427" y1="389.5137186955" y2="403.6276019862" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="367.20640589427" x2="356.9518459791" y1="403.6276019862" y2="417.7414852769" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="412.35313710905" x2="394.90705145924" y1="389.5137186955" y2="389.5137186955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="394.90705145924" x2="377.46096580943" y1="389.5137186955" y2="389.5137186955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="423.13731033859" x2="417.74522372382" y1="356.32877149161" y2="372.92124509356" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="417.74522372382" x2="412.35313710905" y1="372.92124509356" y2="389.5137186955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="394.90705145924" x2="409.02218089892" y1="335.81965166128" y2="346.07421157645" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="409.02218089892" x2="423.13731033859" y1="346.07421157645" y2="356.32877149161" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="366.67928487785" x2="380.79316816855" y1="356.32877149161" y2="346.07421157645" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="380.79316816855" x2="394.90705145924" y1="346.07421157645" y2="335.81965166128" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="366.67928487785" x2="372.07012534364" y1="356.32877149161" y2="372.92124509356" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="372.07012534364" x2="377.46096580943" y1="372.92124509356" y2="389.5137186955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="394.90705145924" x2="394.90705145924" y1="300.92748036166" y2="318.37356601147" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="394.90705145924" x2="394.90705145924" y1="318.37356601147" y2="335.81965166128" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="364.69043111377" x2="379.79874128651" y1="283.48139471185" y2="292.20443753675" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="379.79874128651" x2="394.90705145924" y1="292.20443753675" y2="300.92748036166" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="364.69043111377" x2="364.69043111377" y1="248.58922341222" y2="266.03530906203" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="364.69043111377" x2="364.69043111377" y1="266.03530906203" y2="283.48139471185" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="400" x2="382.5" y1="247" y2="247" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="382.5" x2="365" y1="247" y2="247" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="400" x2="382.5" y1="251" y2="251" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="382.5" x2="365" y1="251" y2="251" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="382.13651676358" x2="373.41347393868" y1="218.37260306675" y2="233.48091323948" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="373.41347393868" x2="364.69043111377" y1="233.48091323948" y2="248.58922341222" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="334.4738107683" x2="349.58212094103" y1="231.14313776241" y2="239.86618058732" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="349.58212094103" x2="364.69043111377" y1="239.86618058732" y2="248.58922341222" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="304.25469812487" x2="319.36425444658" y1="248.58922341222" y2="239.86618058732" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="319.36425444658" x2="334.4738107683" y1="239.86618058732" y2="231.14313776241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="324" x2="315" y1="278" y2="263" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="315" x2="306" y1="263" y2="248" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="321" x2="312" y1="280" y2="265" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="312" x2="303" y1="265" y2="250" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="286.80861247506" x2="295.53165529997" y1="278.8058437577" y2="263.69753358496" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="295.53165529997" x2="304.25469812487" y1="263.69753358496" y2="248.58922341222" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="274.0380777794" x2="289.14638795213" y1="231.14313776241" y2="239.86618058732" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="289.14638795213" x2="304.25469812487" y1="239.86618058732" y2="248.58922341222" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #c8aa1a" />
<line x1="243.81896513597" x2="258.92852145769" y1="248.58922341222" y2="239.86618058732" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="258.92852145769" x2="274.0380777794" y1="239.86618058732" y2="231.14313776241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="213.6023447905" x2="228.71065496324" y1="231.14313776241" y2="239.86618058732" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="228.71065496324" x2="243.81896513597" y1="239.86618058732" y2="248.58922341222" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="181.72585401034" x2="197.66409940042" y1="245.33428228956" y2="238.23871002598" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="197.66409940042" x2="213.6023447905" y1="238.23871002598" y2="231.14313776241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="158.378006815" x2="170.05193041267" y1="219.40441441804" y2="232.3693483538" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="170.05193041267" x2="181.72585401034" y1="232.3693483538" y2="245.33428228956" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="175.82409246481" x2="167.1010496399" y1="189.18530177461" y2="204.29485809632" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="167.1010496399" x2="158.378006815" y1="204.29485809632" y2="219.40441441804" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="209.95362059174" x2="192.88885652827" y1="196.44038110698" y2="192.8128414408" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="192.88885652827" x2="175.82409246481" y1="192.8128414408" y2="189.18530177461" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="209.95362059174" x2="211.77798269112" y1="196.44038110698" y2="213.7917594347" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="211.77798269112" x2="213.6023447905" y1="213.7917594347" y2="231.14313776241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="161.63294793766" x2="168.72852020123" y1="157.31130329241" y2="173.24830253351" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="168.72852020123" x2="175.82409246481" y1="173.24830253351" y2="189.18530177461" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="127.50341981073" x2="144.56818387419" y1="150.05871625798" y2="153.6850097752" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="144.56818387419" x2="161.63294793766" y1="153.6850097752" y2="157.31130329241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="123" x2="124.5" y1="116" y2="133.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="124.5" x2="126" y1="133.5" y2="151" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="126" x2="128" y1="116" y2="133" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="128" x2="130" y1="133" y2="150" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="155.73118639212" x2="139.79418715102" y1="101.16481507541" y2="108.26038733899" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="139.79418715102" x2="123.85718790992" y1="108.26038733899" y2="115.35595960256" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="181" x2="169.5" y1="126" y2="113" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="169.5" x2="158" y1="113" y2="100" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="178" x2="166.5" y1="129" y2="116" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="166.5" x2="155" y1="116" y2="103" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="179.07903358747" x2="170.35599076257" y1="127.09468294693" y2="142.20299311967" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="170.35599076257" x2="161.63294793766" y1="142.20299311967" y2="157.31130329241" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="213.2085617144" x2="196.14379765094" y1="119.83960361456" y2="123.46714328075" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="196.14379765094" x2="179.07903358747" y1="123.46714328075" y2="127.09468294693" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="223" x2="217.5" y1="87" y2="103.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="217.5" x2="212" y1="103.5" y2="120" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="226" x2="220.5" y1="88" y2="104.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="220.5" x2="215" y1="104.5" y2="121" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="200.64239545064" x2="212.31631904831" y1="60.724788539149" y2="73.689722474909" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="212.31631904831" x2="223.99024264599" y1="73.689722474909" y2="86.654656410669" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="167" x2="184.5" y1="70" y2="66.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="184.5" x2="202" y1="66.5" y2="63" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="167" x2="184" y1="67" y2="63" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="184" x2="201" y1="63" y2="59" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="166.51286732371" x2="161.12202685792" y1="67.97986787152" y2="84.572341473466" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="161.12202685792" x2="155.73118639212" y1="84.572341473466" y2="101.16481507541" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="143.16502012836" x2="154.83894372603" y1="42.05" y2="55.01493393576" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="154.83894372603" x2="166.51286732371" y1="55.01493393576" y2="67.97986787152" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="123.67774245752" x2="141.02787463626" y1="223.0531386168" y2="221.22877651742" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="141.02787463626" x2="158.378006815" y1="221.22877651742" y2="219.40441441804" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="174.47077467797" x2="178.09831434416" y1="279.46381041649" y2="262.39904635302" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="178.09831434416" x2="181.72585401034" y1="262.39904635302" y2="245.33428228956" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="456.32225754248" x2="439.72978394053" y1="345.54709056003" y2="350.93793102582" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="439.72978394053" x2="423.13731033859" y1="350.93793102582" y2="356.32877149161" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="432.86225693938" x2="422.60769702422" y1="417.7414852769" y2="403.6276019862" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="422.60769702422" x2="412.35313710905" y1="403.6276019862" y2="389.5137186955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="364.82750750102" x2="357.73193523744" y1="509.7222334186" y2="493.78274187955" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="357.73193523744" x2="350.63636297387" y1="493.78274187955" y2="477.8432503405" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="346" x2="356.5" y1="540" y2="525.5" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="356.5" x2="367" y1="525.5" y2="511" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="343" x2="353.5" y1="537" y2="523" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #ff0000" />
<line x1="353.5" x2="364" y1="523" y2="509" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<line x1="399.52777185849" x2="382.17763967976" y1="513.36846531942" y2="511.54534936901" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #0000ff" />
<line x1="382.17763967976" x2="364.82750750102" y1="511.54534936901" y2="509.7222334186" style="stroke-opacity:1; stroke-width: 1.4691736190156; stroke: #000000" />
<ellipse cx="356.9518459791" cy="417.7414852769" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="356.9518459791" y="425.82194018148"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N<tspan baseline-shift='super' font-size='9.1823351188474'>+</tspan></text>
<ellipse cx="366.67928487785" cy="356.32877149161" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="366.67928487785" y="364.4092263962"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="364.69043111377" cy="283.48139471185" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.69043111377" y="291.56184961643"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="364.69043111377" cy="248.58922341222" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.69043111377" y="256.66967831681"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">P</text>
<ellipse cx="399.58260241339" cy="248.58922341222" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="399.58260241339" y="256.66967831681"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="382.13651676358" cy="218.37260306675" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="382.13651676358" y="226.45305797133"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O<tspan baseline-shift='super' font-size='9.1823351188474'>-</tspan></text>
<ellipse cx="334.4738107683" cy="231.14313776241" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="334.4738107683" y="239.223592667"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="304.25469812487" cy="248.58922341222" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="304.25469812487" y="256.66967831681"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">P</text>
<ellipse cx="321.70078377468" cy="278.8058437577" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="321.70078377468" y="286.88629866228"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="286.80861247506" cy="278.8058437577" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="286.80861247506" y="286.88629866228"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="274.0380777794" cy="231.14313776241" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="274.0380777794" y="239.223592667"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="209.95362059174" cy="196.44038110698" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.95362059174" y="204.52083601157"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="161.63294793766" cy="157.31130329241" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="161.63294793766" y="165.39175819699"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
<ellipse cx="123.85718790992" cy="115.35595960256" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.85718790992" y="123.43641450714"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
<ellipse cx="213.2085617144" cy="119.83960361456" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="213.2085617144" y="127.92005851915"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
<ellipse cx="200.64239545064" cy="60.724788539149" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="200.64239545064" y="68.805243443734"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
<ellipse cx="143.16502012836" cy="42.05" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="143.16502012836" y="50.130454904586"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
<ellipse cx="123.67774245752" cy="223.0531386168" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="123.67774245752" y="231.13359352138"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="174.47077467797" cy="279.46381041649" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="174.47077467797" y="287.54426532107"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="456.32225754248" cy="345.54709056003" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="456.32225754248" y="353.62754546461"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="432.86225693938" cy="417.7414852769" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="432.86225693938" y="425.82194018148"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="344.31838767069" cy="537.95" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="344.31838767069" y="546.03045490459"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">O</text>
<ellipse cx="399.52777185849" cy="513.36846531942" rx="9.5496285236013" ry="9.5496285236013" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="399.52777185849" y="521.448920224"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.364670237695px">N</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 116👍, 0💬