Molecule FYI-1001187

A

Molecule Summary:

ID: FYI-1001187
SMILES: O=C(Nc1ccc(CO)cc1)c3cc(n2cccc2)ccc3N4CCOCC4

Received at FYIcenter.com on: 2022-02-26

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001187
FYIcenter.com

 28 31  0  0  0  0  0  0  0  0999 V2000
    7.2746    6.5833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    5.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    6.5833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    5.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    5.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.3833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    3.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    3.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    1.6834    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.3584    2.2527    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.4216    1.2124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.1215    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4910    0.2911    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    1.6834    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    2.3833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    3.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    4.4833    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    3.7833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.4833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    5.8833    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6994    6.5833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4870    5.8833    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  7  1  0  0  0  0
 11 10  2  0  0  0  0
 11  4  1  0  0  0  0
 12  2  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 15  1  0  0  0  0
 20 14  2  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 22 12  1  0  0  0  0
 23 22  1  0  0  0  0
 24 23  1  0  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 28 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="316" x2="343.5" y1="411" y2="427" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="343.5" x2="371" y1="427" y2="443" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #ff0000" />
<line x1="320" x2="347.5" y1="405" y2="421" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="347.5" x2="375" y1="421" y2="437" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #ff0000" />
<line x1="262.44646535924" x2="289.99772773094" y1="439.59028913123" y2="423.68440570015" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="289.99772773094" x2="317.54899010264" y1="423.68440570015" y2="407.77852226906" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="207.34848515396" x2="234.8974752566" y1="407.77852226906" y2="423.68440570015" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="234.8974752566" x2="262.44646535924" y1="423.68440570015" y2="439.59028913123" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="154" x2="182" y1="443" y2="427" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="182" x2="210" y1="427" y2="411" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="151" x2="178.5" y1="437" y2="421" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="178.5" x2="206" y1="421" y2="405" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="97.147980205279" x2="124.69924257698" y1="407.77852226906" y2="423.68440570015" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="124.69924257698" x2="152.25050494868" y1="423.68440570015" y2="439.59028913123" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="94" x2="94" y1="345" y2="376.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="94" x2="94" y1="376.5" y2="408" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="101" x2="101" y1="345" y2="376.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="101" x2="101" y1="376.5" y2="408" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="42.05" x2="69.598990102639" y1="312.34322168255" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="69.598990102639" x2="97.147980205279" y1="328.24910511364" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="42.05" x2="42.05" y1="248.71968795821" y2="280.53145482038" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #ff0000" />
<line x1="42.05" x2="42.05" y1="280.53145482038" y2="312.34322168255" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="152.25050494868" x2="124.69924257698" y1="312.34322168255" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="124.69924257698" x2="97.147980205279" y1="328.24910511364" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="210" x2="182" y1="342" y2="326" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="182" x2="154" y1="326" y2="310" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="206" x2="178.5" y1="348" y2="332" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="178.5" x2="151" y1="332" y2="316" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="207.34848515396" x2="207.34848515396" y1="344.15498854472" y2="375.96675540689" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="207.34848515396" x2="207.34848515396" y1="375.96675540689" y2="407.77852226906" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="317.54899010264" x2="317.54899010264" y1="344.15498854472" y2="375.96675540689" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="317.54899010264" x2="317.54899010264" y1="375.96675540689" y2="407.77852226906" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="261" x2="288.5" y1="316" y2="332" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="288.5" x2="316" y1="332" y2="348" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="265" x2="292.5" y1="310" y2="326" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="292.5" x2="320" y1="326" y2="342" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="262.44646535924" x2="262.44646535924" y1="248.71968795821" y2="280.53145482038" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="262.44646535924" x2="262.44646535924" y1="280.53145482038" y2="312.34322168255" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="207.34848515396" x2="234.8974752566" y1="216.91246563416" y2="232.81607679619" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="234.8974752566" x2="262.44646535924" y1="232.81607679619" y2="248.71968795821" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="149.22838709677" x2="178.28843612537" y1="242.78452116935" y2="229.84849340176" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="178.28843612537" x2="207.34848515396" y1="229.84849340176" y2="216.91246563416" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="105" x2="126" y1="198" y2="222" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="126" x2="147" y1="222" y2="246" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="110" x2="131" y1="194" y2="217.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="131" x2="152" y1="217.5" y2="241" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="138.46237628299" x2="122.55876512097" y1="140.40971086877" y2="167.95870097141" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="122.55876512097" x2="106.65515395894" y1="167.95870097141" y2="195.50769107405" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="202" x2="171" y1="151" y2="144.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="171" x2="140" y1="144.5" y2="138" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="201" x2="169.5" y1="157" y2="150.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="169.5" x2="138" y1="150.5" y2="144" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="200.69982587977" x2="204.02415551686" y1="153.63886134531" y2="185.27566348974" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="204.02415551686" x2="207.34848515396" y1="185.27566348974" y2="216.91246563416" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="316" x2="288.5" y1="215" y2="230.5" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="288.5" x2="261" y1="230.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="320" x2="292.5" y1="220" y2="236" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="292.5" x2="265" y1="236" y2="252" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="372.64697030792" x2="345.09798020528" y1="248.71968795821" y2="232.81607679619" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="345.09798020528" x2="317.54899010264" y1="232.81607679619" y2="216.91246563416" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="376" x2="376" y1="313" y2="281" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="376" x2="376" y1="281" y2="249" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="370" x2="370" y1="313" y2="281" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="370" x2="370" y1="281" y2="249" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="372.64697030792" x2="345.09798020528" y1="312.34322168255" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="345.09798020528" x2="317.54899010264" y1="328.24910511364" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="427.7449505132" x2="400.19596041056" y1="344.15498854472" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="400.19596041056" x2="372.64697030792" y1="328.24910511364" y2="312.34322168255" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="482.84293071848" x2="455.29394061584" y1="312.34322168255" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="455.29394061584" x2="427.7449505132" y1="328.24910511364" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<line x1="537.95" x2="510.39646535924" y1="344.15498854472" y2="328.24910511364" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="510.39646535924" x2="482.84293071848" y1="328.24910511364" y2="312.34322168255" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="407.77852226906" y2="375.96675540689" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #ff0000" />
<line x1="537.95" x2="537.95" y1="375.96675540689" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="482.84293071848" x2="510.39646535924" y1="439.59028913123" y2="423.68440570015" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="510.39646535924" x2="537.95" y1="423.68440570015" y2="407.77852226906" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #ff0000" />
<line x1="427.7449505132" x2="455.29394061584" y1="407.77852226906" y2="423.68440570015" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="455.29394061584" x2="482.84293071848" y1="423.68440570015" y2="439.59028913123" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="427.7449505132" x2="427.7449505132" y1="407.77852226906" y2="375.96675540689" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #000000" />
<line x1="427.7449505132" x2="427.7449505132" y1="375.96675540689" y2="344.15498854472" style="stroke-opacity:1; stroke-width: 2.6788887898814; stroke: #0000ff" />
<ellipse cx="372.64697030792" cy="439.59028913123" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.64697030792" y="454.32417747558"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">O</text>
<ellipse cx="262.44646535924" cy="439.59028913123" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="262.44646535924" y="454.32417747558"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">N</text>
<ellipse cx="42.05" cy="248.71968795821" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="263.45357630256"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">O</text>
<ellipse cx="207.34848515396" cy="216.91246563416" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="207.34848515396" y="231.64635397851"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">N</text>
<ellipse cx="427.7449505132" cy="344.15498854472" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="427.7449505132" y="358.88887688907"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">N</text>
<ellipse cx="537.95" cy="407.77852226906" rx="17.412777134229" ry="17.412777134229" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="422.51241061341"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486109873517px">O</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 116👍, 0💬