Molecule FYI-1001185

A

Molecule Summary:

ID: FYI-1001185
SMILES: CC(C)(CCCc1ccc(Br)cc1)C(=O)N(c2ccccc2)c3ccccc3

Received at FYIcenter.com on: 2022-02-22

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001185
FYIcenter.com

 28 30  0  0  0  0  0  0  0  0999 V2000
    5.5497    6.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.1497    6.1124    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 Br  0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 15 10  1  0  0  0  0
 16  9  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 21 16  1  0  0  0  0
 22  2  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 26 25  1  0  0  0  0
 27 25  1  0  0  0  0
 28 27  2  0  0  0  0
 28 22  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="207.34886385506" x2="219.27838575317" y1="337.71808759244" y2="358.38001951997" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="219.27838575317" x2="231.20790765128" y1="358.38001951997" y2="379.0419514475" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="183.48982005883" x2="195.41934195695" y1="379.0419514475" y2="358.38001951997" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="195.41934195695" x2="207.34886385506" y1="358.38001951997" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="248.67613614494" x2="228.0125" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="228.0125" x2="207.34886385506" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="290" x2="269.33806807247" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="269.33806807247" x2="248.67613614494" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="331.32727228989" x2="310.66363614494" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="310.66363614494" x2="290" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="372.65113614494" x2="351.98920421741" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="351.98920421741" x2="331.32727228989" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="376" x2="376" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #ff0000" />
<line x1="376" x2="376" y1="362" y2="338" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="371" x2="371" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #ff0000" />
<line x1="371" x2="371" y1="362" y2="338" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="413.975" x2="393.31306807247" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #0000ff" />
<line x1="393.31306807247" x2="372.65113614494" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455.30227228989" x2="434.63863614494" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="434.63863614494" x2="413.975" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #0000ff" />
<line x1="496" x2="475.5" y1="312" y2="324" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="475.5" x2="455" y1="324" y2="336" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="498" x2="477.5" y1="317" y2="328.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="477.5" x2="457" y1="328.5" y2="340" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="537.95" x2="517.28806807247" y1="337.71808759244" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="517.28806807247" x2="496.62613614494" y1="325.78856569433" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="541" x2="541" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="541" x2="541" y1="362" y2="338" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="536" x2="536" y1="386" y2="362" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="536" x2="536" y1="362" y2="338" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="496.62613614494" x2="517.28806807247" y1="409.29521898111" y2="397.365697083" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="517.28806807247" x2="537.95" y1="397.365697083" y2="385.43617518489" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455" x2="475.5" y1="388" y2="400" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="475.5" x2="496" y1="400" y2="412" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="457" x2="477.5" y1="384" y2="396" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="477.5" x2="498" y1="396" y2="408" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455.30227228989" x2="455.30227228989" y1="385.43617518489" y2="361.57713138867" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455.30227228989" x2="455.30227228989" y1="361.57713138867" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="413.975" x2="413.975" y1="266.14095620378" y2="290" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="413.975" x2="413.975" y1="290" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #0000ff" />
<line x1="372" x2="392.5" y1="245" y2="257" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="392.5" x2="413" y1="257" y2="269" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="374" x2="395" y1="241" y2="252.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="395" x2="416" y1="252.5" y2="264" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="372.65113614494" x2="372.65113614494" y1="194.56382481511" y2="218.42286861133" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="372.65113614494" x2="372.65113614494" y1="218.42286861133" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="413" x2="392.5" y1="169" y2="181" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="392.5" x2="372" y1="181" y2="193" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="416" x2="395" y1="173" y2="185" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="395" x2="374" y1="185" y2="197" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455.30227228989" x2="434.63863614494" y1="194.56382481511" y2="182.634302917" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="434.63863614494" x2="413.975" y1="182.634302917" y2="170.70478101889" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="458" x2="458" y1="243" y2="219" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="458" x2="458" y1="219" y2="195" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="453" x2="453" y1="243" y2="219" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="453" x2="453" y1="219" y2="195" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="455.30227228989" x2="434.63863614494" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="434.63863614494" x2="413.975" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="166.025" x2="186.68693192753" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="186.68693192753" x2="207.34886385506" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="126" x2="147" y1="340" y2="328.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="147" x2="168" y1="328.5" y2="317" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="124" x2="144.5" y1="336" y2="324" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="144.5" x2="165" y1="324" y2="312" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="83.373863855057" x2="104.0375" y1="313.85904379622" y2="325.78856569433" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="104.0375" x2="124.70113614494" y1="325.78856569433" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="81" x2="81" y1="267" y2="290.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="81" x2="81" y1="290.5" y2="314" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="86" x2="86" y1="267" y2="290.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="86" x2="86" y1="290.5" y2="314" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="42.05" x2="62.711931927529" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #db8802" />
<line x1="62.711931927529" x2="83.373863855057" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="124.70113614494" x2="104.0375" y1="242.28191240756" y2="254.21143430567" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="104.0375" x2="83.373863855057" y1="254.21143430567" y2="266.14095620378" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="168" x2="147" y1="264" y2="252.5" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="147" x2="126" y1="252.5" y2="241" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="165" x2="144.5" y1="269" y2="257" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="144.5" x2="124" y1="257" y2="245" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="166.025" x2="166.025" y1="266.14095620378" y2="290" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<line x1="166.025" x2="166.025" y1="290" y2="313.85904379622" style="stroke-opacity:1; stroke-width: 2.0091788702833; stroke: #000000" />
<ellipse cx="372.65113614494" cy="385.43617518489" rx="13.059662656841" ry="13.059662656841" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.65113614494" y="396.48665897145"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114735878541px">O</text>
<ellipse cx="413.975" cy="313.85904379622" rx="13.059662656841" ry="13.059662656841" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="413.975" y="324.90952758278"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114735878541px">N</text>
<ellipse cx="42.05" cy="242.28191240756" rx="13.059662656841" ry="13.059662656841" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="253.33239619411"  fill="#db8802" style="text-anchor:middle;  font-family:sans-serif;font-size:25.114735878541px">Br</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 119👍, 0💬