Molecule FYI-1001188

A

Molecule Summary:

ID: FYI-1001188
SMILES: C1CN(CCN1CCOCCO)C(C2=CC=CC=C2)C3=CC=C(C=C3)Cl

Received at FYIcenter.com on: 2022-02-28

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001188
FYIcenter.com

 26 28  0  0  0  0  0  0  0  0999 V2000
    7.2747    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2747    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    6.3000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3368    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1244    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    7.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13  3  1  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 14  1  0  0  0  0
 20 13  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 24 23  1  0  0  0  0
 25 24  2  0  0  0  0
 25 20  1  0  0  0  0
 26 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="309.07573913816" x2="290.00314625419" y1="312.02377931174" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="290.00314625419" x2="270.93055337022" y1="323.03566896762" y2="334.04755862349" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347.2209249061" x2="328.14833202213" y1="334.04755862349" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="328.14833202213" x2="309.07573913816" y1="323.03566896762" y2="312.02377931174" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347.2209249061" x2="347.2209249061" y1="378.09511724698" y2="356.07133793523" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347.2209249061" x2="347.2209249061" y1="356.07133793523" y2="334.04755862349" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="309.07573913816" x2="328.14833202213" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="328.14833202213" x2="347.2209249061" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="270.93055337022" x2="290.00314625419" y1="378.09511724698" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="290.00314625419" x2="309.07573913816" y1="389.10700690285" y2="400.11889655872" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="270.93055337022" x2="270.93055337022" y1="378.09511724698" y2="356.07133793523" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="270.93055337022" x2="270.93055337022" y1="356.07133793523" y2="334.04755862349" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="232.7790750939" x2="251.85481423206" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="251.85481423206" x2="270.93055337022" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="194.63388932596" x2="213.70648220993" y1="378.09511724698" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="213.70648220993" x2="232.7790750939" y1="389.10700690285" y2="400.11889655872" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="156.48870355801" x2="175.56129644199" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #ff0000" />
<line x1="175.56129644199" x2="194.63388932596" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="118.34351779007" x2="137.41611067404" y1="378.09511724698" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="137.41611067404" x2="156.48870355801" y1="389.10700690285" y2="400.11889655872" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #ff0000" />
<line x1="80.195185767942" x2="99.269351779007" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="99.269351779007" x2="118.34351779007" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="42.05" x2="61.122592883971" y1="378.09511724698" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #ff0000" />
<line x1="61.122592883971" x2="80.195185767942" y1="389.10700690285" y2="400.11889655872" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="385.36611067404" x2="366.29351779007" y1="312.02377931174" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="366.29351779007" x2="347.2209249061" y1="323.03566896762" y2="334.04755862349" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #0000ff" />
<line x1="385.36611067404" x2="385.36611067404" y1="267.97622068826" y2="290" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="385.36611067404" x2="385.36611067404" y1="290" y2="312.02377931174" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347" x2="366" y1="248" y2="259" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="366" x2="385" y1="259" y2="270" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="349" x2="368" y1="244" y2="255" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="368" x2="387" y1="255" y2="266" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347.2209249061" x2="347.2209249061" y1="201.90488275302" y2="223.92866206477" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="347.2209249061" x2="347.2209249061" y1="223.92866206477" y2="245.95244137651" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="385" x2="366" y1="178" y2="189" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="366" x2="347" y1="189" y2="200" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="387" x2="368" y1="182" y2="193" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="368" x2="349" y1="193" y2="204" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423.51444269617" x2="404.44027668511" y1="201.90488275302" y2="190.89299309715" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="404.44027668511" x2="385.36611067404" y1="190.89299309715" y2="179.88110344128" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="426" x2="426" y1="246" y2="224" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="426" x2="426" y1="224" y2="202" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="422" x2="422" y1="246" y2="224" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="422" x2="422" y1="224" y2="202" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423.51444269617" x2="404.44027668511" y1="245.95244137651" y2="256.96433103238" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="404.44027668511" x2="385.36611067404" y1="256.96433103238" y2="267.97622068826" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423.51444269617" x2="404.44027668511" y1="334.04755862349" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="404.44027668511" x2="385.36611067404" y1="323.03566896762" y2="312.02377931174" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="461" x2="442" y1="311" y2="322" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="442" x2="423" y1="322" y2="333" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="463" x2="444" y1="315" y2="326" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="444" x2="425" y1="326" y2="337" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="499.80481423206" x2="480.73222134809" y1="334.04755862349" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="480.73222134809" x2="461.65962846412" y1="323.03566896762" y2="312.02377931174" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="503" x2="503" y1="379" y2="357" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="503" x2="503" y1="357" y2="335" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="498" x2="498" y1="379" y2="357" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="498" x2="498" y1="357" y2="335" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="461.65962846412" x2="480.73222134809" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="480.73222134809" x2="499.80481423206" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423" x2="442" y1="381" y2="392" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="442" x2="461" y1="392" y2="403" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="425" x2="444" y1="377" y2="388" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="444" x2="463" y1="388" y2="399" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423.51444269617" x2="423.51444269617" y1="378.09511724698" y2="356.07133793523" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="423.51444269617" x2="423.51444269617" y1="356.07133793523" y2="334.04755862349" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<line x1="537.95" x2="518.87740711603" y1="400.11889655872" y2="389.10700690285" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #00bc00" />
<line x1="518.87740711603" x2="499.80481423206" y1="389.10700690285" y2="378.09511724698" style="stroke-opacity:1; stroke-width: 1.8546300735886; stroke: #000000" />
<ellipse cx="347.2209249061" cy="334.04755862349" rx="12.055095478326" ry="12.055095478326" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="347.2209249061" y="344.24802402823"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182875919857px">N</text>
<ellipse cx="270.93055337022" cy="378.09511724698" rx="12.055095478326" ry="12.055095478326" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="270.93055337022" y="388.29558265172"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182875919857px">N</text>
<ellipse cx="156.48870355801" cy="400.11889655872" rx="12.055095478326" ry="12.055095478326" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.48870355801" y="410.31936196346"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182875919857px">O</text>
<ellipse cx="42.05" cy="378.09511724698" rx="12.055095478326" ry="12.055095478326" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="388.29558265172"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182875919857px">O</text>
<ellipse cx="537.95" cy="400.11889655872" rx="12.055095478326" ry="12.055095478326" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="410.31936196346"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.182875919857px">Cl</text>
</g></svg>

✍: FYIcenter.com

2022-04-21, 118👍, 0💬