Molecule FYI-1001290

A

Molecule Summary:

ID: FYI-1001290
SMILES: COc1ccc2c(c1)cc(C1C(C#N)=C(N)N(c3cccnc3)C3=C1C(=O)CCC3)c1nnnn12

Received at FYIcenter.com on: 2022-05-02

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001290
FYIcenter.com

 35 40  0  0  0  0  0  0  0  0999 V2000
   10.9120    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.7000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9120    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    9.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498   10.5000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    8.4000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    9.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125   11.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000   10.5000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    9.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2125    8.4000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    4.2000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    6.3000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    7.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.7782    8.3694    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.1704    8.5157    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.7399    7.2368    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  7  6  1  0  0  0  0
  8  7  2  0  0  0  0
  8  3  1  0  0  0  0
  9  7  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 14 13  3  0  0  0  0
 15 12  2  0  0  0  0
 16 15  1  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 20 19  1  0  0  0  0
 21 20  2  0  0  0  0
 22 21  1  0  0  0  0
 23 22  2  0  0  0  0
 23 18  1  0  0  0  0
 24 17  1  0  0  0  0
 25 24  2  0  0  0  0
 25 11  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  2  0  0  0  0
 28 26  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 30 24  1  0  0  0  0
 31 10  1  0  0  0  0
 32 31  2  0  0  0  0
 33 32  1  0  0  0  0
 34 33  2  0  0  0  0
 35 34  1  0  0  0  0
 35 31  1  0  0  0  0
 35  6  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="477.88854017857" x2="504.73134151786" y1="73.04375" y2="57.546875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #ff0000" />
<line x1="504.73134151786" x2="531.57414285714" y1="57.546875" y2="42.05" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="477.88854017857" x2="477.88854017857" y1="135.03125" y2="104.0375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="477.88854017857" x2="477.88854017857" y1="104.0375" y2="73.04375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #ff0000" />
<line x1="534" x2="507" y1="164" y2="148.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="507" x2="480" y1="148.5" y2="133" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="530" x2="503.5" y1="169" y2="153.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="503.5" x2="477" y1="153.5" y2="138" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="531.57414285714" x2="531.57414285714" y1="228.0125" y2="197.01875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="531.57414285714" x2="531.57414285714" y1="197.01875" y2="166.025" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="480" x2="507" y1="262" y2="246.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="507" x2="534" y1="246.5" y2="231" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="477" x2="503.5" y1="257" y2="241.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="503.5" x2="530" y1="241.5" y2="226" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="424.20736517857" x2="451.04795267857" y1="228.0125" y2="243.509375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="451.04795267857" x2="477.88854017857" y1="243.509375" y2="259.00625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="421" x2="421" y1="167" y2="198" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="421" x2="421" y1="198" y2="229" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="428" x2="428" y1="167" y2="198" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="428" x2="428" y1="198" y2="229" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="424.20736517857" x2="451.04795267857" y1="166.025" y2="150.528125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="451.04795267857" x2="477.88854017857" y1="150.528125" y2="135.03125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="370.5217625" x2="397.36456383929" y1="259.00625" y2="243.509375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="397.36456383929" x2="424.20736517857" y1="243.509375" y2="228.0125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="374" x2="374" y1="321" y2="290.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="374" x2="374" y1="290.5" y2="260" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="368" x2="368" y1="321" y2="290.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="368" x2="368" y1="290.5" y2="260" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="316.8405875" x2="343.681175" y1="351.9875" y2="336.490625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="343.681175" x2="370.5217625" y1="336.490625" y2="320.99375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="316.8405875" x2="316.8405875" y1="413.975" y2="382.98125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="316.8405875" x2="316.8405875" y1="382.98125" y2="351.9875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="370.5217625" x2="343.681175" y1="444.96875" y2="429.471875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="343.681175" x2="316.8405875" y1="429.471875" y2="413.975" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="428" x2="401" y1="471" y2="455.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="401" x2="374" y1="455.5" y2="440" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="421" x2="394.5" y1="482" y2="466.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="394.5" x2="368" y1="466.5" y2="451" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="424.20736517857" x2="397.36456383929" y1="475.9625" y2="460.465625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="397.36456383929" x2="370.5217625" y1="460.465625" y2="444.96875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="265" x2="292" y1="448" y2="432.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="292" x2="319" y1="432.5" y2="417" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="262" x2="289" y1="443" y2="427.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="289" x2="316" y1="427.5" y2="412" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="263.1594125" x2="263.1594125" y1="506.95625" y2="475.9625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="263.1594125" x2="263.1594125" y1="475.9625" y2="444.96875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="209.47380982143" x2="236.31661116071" y1="413.975" y2="429.471875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="236.31661116071" x2="263.1594125" y1="429.471875" y2="444.96875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="155.79263482143" x2="182.63322232143" y1="444.96875" y2="429.471875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="182.63322232143" x2="209.47380982143" y1="429.471875" y2="413.975" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="160" x2="160" y1="507" y2="476" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="160" x2="160" y1="476" y2="445" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="153" x2="153" y1="507" y2="476" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="153" x2="153" y1="476" y2="445" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="102.11145982143" x2="128.95204732143" y1="537.95" y2="522.453125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="128.95204732143" x2="155.79263482143" y1="522.453125" y2="506.95625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="47" x2="74" y1="510" y2="525.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="74" x2="101" y1="525.5" y2="541" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="51" x2="77.5" y1="505" y2="520.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="77.5" x2="104" y1="520.5" y2="536" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="48.425857142857" x2="48.425857142857" y1="444.96875" y2="475.9625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="48.425857142857" x2="48.425857142857" y1="475.9625" y2="506.95625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="101" x2="74" y1="412" y2="427.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="74" x2="47" y1="427.5" y2="443" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="104" x2="77.5" y1="417" y2="432.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="77.5" x2="51" y1="432.5" y2="448" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="102.11145982143" x2="128.95204732143" y1="413.975" y2="429.471875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="128.95204732143" x2="155.79263482143" y1="429.471875" y2="444.96875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="209.47380982143" x2="209.47380982143" y1="351.9875" y2="382.98125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="209.47380982143" x2="209.47380982143" y1="382.98125" y2="413.975" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="262" x2="235" y1="319" y2="334.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="235" x2="208" y1="334.5" y2="350" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="265" x2="238.5" y1="324" y2="339.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="238.5" x2="212" y1="339.5" y2="355" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="263.1594125" x2="290" y1="320.99375" y2="336.490625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="290" x2="316.8405875" y1="336.490625" y2="351.9875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="263.1594125" x2="263.1594125" y1="259.00625" y2="290" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="263.1594125" x2="263.1594125" y1="290" y2="320.99375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="316" x2="289" y1="226" y2="241.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #ff0000" />
<line x1="289" x2="262" y1="241.5" y2="257" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="319" x2="292" y1="231" y2="246.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #ff0000" />
<line x1="292" x2="265" y1="246.5" y2="262" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="209.47380982143" x2="236.31661116071" y1="228.0125" y2="243.509375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="236.31661116071" x2="263.1594125" y1="243.509375" y2="259.00625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="155.79263482143" x2="182.63322232143" y1="259.00625" y2="243.509375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="182.63322232143" x2="209.47380982143" y1="243.509375" y2="228.0125" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="155.79263482143" x2="155.79263482143" y1="320.99375" y2="290" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="155.79263482143" x2="155.79263482143" y1="290" y2="259.00625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="155.79263482143" x2="182.63322232143" y1="320.99375" y2="336.490625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="182.63322232143" x2="209.47380982143" y1="336.490625" y2="351.9875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="424.20736517857" x2="397.36456383929" y1="351.9875" y2="336.490625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="397.36456383929" x2="370.5217625" y1="336.490625" y2="320.99375" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="441" x2="434.5" y1="412" y2="382" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="434.5" x2="428" y1="382" y2="352" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="434" x2="428" y1="414" y2="383.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="428" x2="422" y1="383.5" y2="353" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="498.73847857143" x2="467.91740803571" y1="419.09782410714" y2="415.85897723214" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="467.91740803571" x2="437.0963375" y1="415.85897723214" y2="412.62013035714" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="521" x2="508.5" y1="362" y2="390" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="508.5" x2="496" y1="390" y2="418" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="527" x2="514.5" y1="364" y2="392.5" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="514.5" x2="502" y1="392.5" y2="421" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="477.88854017857" x2="500.92132410714" y1="320.99375" y2="341.73299642857" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="500.92132410714" x2="523.95410803571" y1="341.73299642857" y2="362.47224285714" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="477.88854017857" x2="451.04795267857" y1="320.99375" y2="336.490625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="451.04795267857" x2="424.20736517857" y1="336.490625" y2="351.9875" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<line x1="477.88854017857" x2="477.88854017857" y1="320.99375" y2="290" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #0000ff" />
<line x1="477.88854017857" x2="477.88854017857" y1="290" y2="259.00625" style="stroke-opacity:1; stroke-width: 2.6100064173241; stroke: #000000" />
<ellipse cx="477.88854017857" cy="73.04375" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="477.88854017857" y="87.398785295282"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">O</text>
<ellipse cx="424.20736517857" cy="475.9625" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="424.20736517857" y="490.31753529528"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="263.1594125" cy="506.95625" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="263.1594125" y="521.31128529528"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="209.47380982143" cy="413.975" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.47380982143" y="428.33003529528"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="48.425857142857" cy="444.96875" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="48.425857142857" y="459.32378529528"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="316.8405875" cy="228.0125" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="316.8405875" y="242.36753529528"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">O</text>
<ellipse cx="437.0963375" cy="412.62013035714" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="437.0963375" y="426.97516565243"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="498.73847857143" cy="419.09782410714" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="498.73847857143" y="433.45285940243"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="523.95410803571" cy="362.47224285714" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="523.95410803571" y="376.82727815243"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
<ellipse cx="477.88854017857" cy="320.99375" rx="16.965041712606" ry="16.965041712606" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="477.88854017857" y="335.34878529528"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:32.625080216551px">N</text>
</g></svg>

✍: FYIcenter.com

2022-05-15, 143👍, 0💬