Molecule FYI-1001288

A

Molecule Summary:

ID: FYI-1001288
SMILES: C1=C(C=C(C(=C1Cl)N2C(=C(C(=N2)C#N)[S@@](=O)C(F)(F)F)N)Cl)C(F)(F)F

Received at FYIcenter.com on: 2022-04-30

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1001288
FYIcenter.com

 26 27  0  0  1  0  0  0  0  0999 V2000
    9.4607    1.9550    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.0301    3.2340    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2072    4.3666    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8149    4.2203    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2453    2.9413    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.0683    1.8087    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4989    0.5298    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    5.8530    2.7950    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.9163    3.8353    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6374    3.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7837    1.8736    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1530    1.5826    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.7432    0.9367    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.7028    0.0000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    3.9659    0.0000 S   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    5.3660    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    3.2659    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9124    2.0535    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.5659    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    0.5124    4.4784    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
    5.2073    5.2048    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.9919    5.3529    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
   11.4224    3.3803    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.2761    4.7726    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   12.8147    3.5266    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
   11.5687    1.9880    0.0000 F   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  2  0  0  0  0
  5  4  1  0  0  0  0
  6  5  2  0  0  0  0
  6  1  1  0  0  0  0
  7  6  1  0  0  0  0
  8  5  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 12  8  1  0  0  0  0
 13 11  1  0  0  0  0
 14 13  3  0  0  0  0
 15 10  1  1  0  0  0
 16 15  2  0  0  0  0
 17 15  1  0  0  0  0
 18 17  1  0  0  0  0
 19 17  1  0  0  0  0
 20 17  1  0  0  0  0
 21  9  1  0  0  0  0
 22  4  1  0  0  0  0
 23  2  1  0  0  0  0
 24 23  1  0  0  0  0
 25 23  1  0  0  0  0
 26 23  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="433" x2="422" y1="311" y2="286" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="422" x2="411" y1="286" y2="261" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="428" x2="417" y1="313" y2="288" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="417" x2="406" y1="288" y2="263" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="398.34788290011" x2="414.27007030988" y1="355.15152442117" y2="333.23699111177" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="414.27007030988" x2="430.19225771965" y1="333.23699111177" y2="311.32245780237" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="345" x2="372" y1="353" y2="355.5" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="372" x2="399" y1="355.5" y2="358" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="345" x2="372" y1="347" y2="350" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="372" x2="399" y1="350" y2="353" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="322.42677589019" x2="333.44789382506" y1="299.99562767759" y2="324.74283596183" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="333.44789382506" x2="344.46901175993" y1="324.74283596183" y2="349.49004424606" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="352" x2="336.5" y1="255" y2="277" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="336.5" x2="321" y1="277" y2="299" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="357" x2="341" y1="258" y2="280" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="341" x2="325" y1="280" y2="302" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="354.27502048429" x2="381.21639094165" y1="256.16656105878" y2="258.99730114634" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="381.21639094165" x2="408.15776139902" y1="258.99730114634" y2="261.8280412339" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="332.24052416366" x2="343.25777232397" y1="206.67601426487" y2="231.42128766183" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="343.25777232397" x2="354.27502048429" y1="231.42128766183" y2="256.16656105878" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="268.54790475001" x2="295.4873403201" y1="294.33414750248" y2="297.16488759003" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="295.4873403201" x2="322.42677589019" y1="297.16488759003" y2="299.99562767759" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="232.29972648599" x2="250.423815618" y1="334.59141220629" y2="314.46277985439" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="250.423815618" x2="268.54790475001" y1="314.46277985439" y2="294.33414750248" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="182" x2="207" y1="316" y2="327" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="207" x2="232" y1="327" y2="338" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="184" x2="209" y1="310" y2="321" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="209" x2="234" y1="321" y2="332" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="188.47065986718" x2="185.63991977963" y1="258.67804474549" y2="285.61748031558" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="185.63991977963" x2="182.80917969207" y1="285.61748031558" y2="312.55691588566" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="241" x2="214.5" y1="245" y2="250.5" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="214.5" x2="188" y1="250.5" y2="256" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="243" x2="216.5" y1="251" y2="256.5" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="216.5" x2="190" y1="256.5" y2="262" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="241.45948285953" x2="255.00369380477" y1="247.41700078816" y2="270.87557414532" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="255.00369380477" x2="268.54790475001" y1="270.87557414532" y2="294.33414750248" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="148.20565561426" x2="168.33815774072" y1="222.42212693235" y2="240.55008583892" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="168.33815774072" x2="188.47065986718" y1="240.55008583892" y2="258.67804474549" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="105" x2="125" y1="191" y2="209" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="125" x2="145" y1="209" y2="227" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="112" x2="132.5" y1="182" y2="200.5" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="132.5" x2="153" y1="200.5" y2="219" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="107.94452113588" x2="128.07508837507" y1="186.17394866833" y2="204.29803780034" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="128.07508837507" x2="148.20565561426" y1="204.29803780034" y2="222.42212693235" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<polygon points=" 136,340 187,320 179,306" fill-opacity="1"  style="fill:#c8aa1a" />
<line x1="139" x2="139" y1="394" y2="367" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #ff0000" />
<line x1="139" x2="139" y1="367" y2="340" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #c8aa1a" />
<line x1="134" x2="134" y1="394" y2="367" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #ff0000" />
<line x1="134" x2="134" y1="367" y2="340" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #c8aa1a" />
<line x1="88.96714671432" x2="112.42572007148" y1="312.55691588566" y2="326.10112683091" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="112.42572007148" x2="135.88429342864" y1="326.10112683091" y2="339.64533777615" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #c8aa1a" />
<line x1="116.05556860481" x2="102.51135765956" y1="265.63976917134" y2="289.0983425285" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="102.51135765956" x2="88.96714671432" y1="289.0983425285" y2="312.55691588566" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="42.05" x2="65.50857335716" y1="285.46849399518" y2="299.01270494042" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="65.50857335716" x2="88.96714671432" y1="299.01270494042" y2="312.55691588566" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="61.878724823835" x2="75.422935769078" y1="359.47793237454" y2="336.0174241301" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="75.422935769078" x2="88.96714671432" y1="336.0174241301" y2="312.55691588566" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="243.56077044332" x2="237.93024846465" y1="387.58797474775" y2="361.08969347702" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #0000ff" />
<line x1="237.93024846465" x2="232.29972648599" y1="361.08969347702" y2="334.59141220629" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="312.62076716583" x2="328.54488946288" y1="393.31911086487" y2="371.40457755546" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="328.54488946288" x2="344.46901175993" y1="371.40457755546" y2="349.49004424606" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="484.07112885983" x2="457.13169328974" y1="316.98393797748" y2="314.15319788992" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="457.13169328974" x2="430.19225771965" y1="314.15319788992" y2="311.32245780237" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="478.40964868471" x2="481.24038877227" y1="370.86280911765" y2="343.92337354757" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="481.24038877227" x2="484.07112885983" y1="343.92337354757" y2="316.98393797748" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="537.95" x2="511.01056442991" y1="322.64541815259" y2="319.81467806503" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="511.01056442991" x2="484.07112885983" y1="319.81467806503" y2="316.98393797748" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<line x1="489.73260903494" x2="486.90186894738" y1="263.1050668373" y2="290.04450240739" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #00bc00" />
<line x1="486.90186894738" x2="484.07112885983" y1="290.04450240739" y2="316.98393797748" style="stroke-opacity:1; stroke-width: 2.2811602462961; stroke: #000000" />
<ellipse cx="332.24052416366" cy="206.67601426487" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.24052416366" y="219.2223956195"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">Cl</text>
<ellipse cx="268.54790475001" cy="294.33414750248" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="268.54790475001" y="306.88052885711"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">N</text>
<ellipse cx="241.45948285953" cy="247.41700078816" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="241.45948285953" y="259.96338214279"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">N</text>
<ellipse cx="107.94452113588" cy="186.17394866833" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="107.94452113588" y="198.72033002295"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">N</text>
<ellipse cx="135.88429342864" cy="339.64533777615" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.88429342864" y="352.19171913078"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">S</text>
<ellipse cx="135.88429342864" cy="393.82605133167" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="135.88429342864" y="406.3724326863"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">O</text>
<ellipse cx="116.05556860481" cy="265.63976917134" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="116.05556860481" y="278.18615052597"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
<ellipse cx="42.05" cy="285.46849399518" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="298.01487534981"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
<ellipse cx="61.878724823835" cy="359.47793237454" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="61.878724823835" y="372.02431372917"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
<ellipse cx="243.56077044332" cy="387.58797474775" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="243.56077044332" y="400.13435610238"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">N</text>
<ellipse cx="312.62076716583" cy="393.31911086487" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="312.62076716583" y="405.86549221949"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">Cl</text>
<ellipse cx="478.40964868471" cy="370.86280911765" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="478.40964868471" y="383.40919047228"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
<ellipse cx="537.95" cy="322.64541815259" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="335.19179950722"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
<ellipse cx="489.73260903494" cy="263.1050668373" rx="14.827541600925" ry="14.827541600925" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="489.73260903494" y="275.65144819193"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:28.514503078702px">F</text>
</g></svg>

✍: FYIcenter.com

2022-05-01, 140👍, 0💬