Molecule FYI-1000260

A

Molecule Summary:

ID: FYI-1000260
SMILES: C=C(C=NC1=NC=C(C(F)(F)F)N=C1)[NH+](C)CC1=NC(=C)CC=C1N1N=CC=N1

Received at FYIcenter.com on: 2021-02-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000260
FYIcenter.com

 47 49  0  0  0  0  0  0  0  0999 V2000
    1.1796    3.3695   -2.4790 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9096    2.5500   -1.4618 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.4557    2.0648   -1.2555 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.7201    1.2623   -0.2593 N   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9940    0.8096   -0.0669 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.9692    1.1844   -0.8931 N   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1990    0.7433   -0.7017 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.4766   -0.1068    0.3543 C   0  0  0  0  0  0  0  0  0  0  0  0
   -5.8827   -0.6061    0.5655 C   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0642   -1.8007   -0.1396 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.0973   -0.8324    1.9293 F   0  0  0  0  0  0  0  0  0  0  0  0
   -6.7920    0.3512    0.1029 F   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5134   -0.4834    1.1791 N   0  0  0  0  0  0  0  0  0  0  0  0
   -2.2797   -0.0548    0.9959 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9307    2.1546   -0.5927 N   0  3  0  0  0  0  0  0  0  0  0  0
    2.7999    2.5790   -0.8798 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.6042    2.5838    0.7738 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0647    0.6922   -0.6278 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.2436    0.2754    0.2134 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.9558    1.1822    0.8285 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.0163    0.7977    1.5927 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0809    1.5868    1.7247 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.9587   -0.5432    2.2879 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.4029   -1.5587    1.3173 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.5815   -1.1459    0.3418 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0507   -2.0745   -0.5663 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.2922   -3.3374   -0.5446 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.6380   -3.9090   -1.5308 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9544   -2.8799   -2.1835 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2522   -1.7791   -1.5301 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.1871    3.7275   -2.6312 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.3916    3.6714   -3.1530 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.2445    2.3703   -1.9269 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.9903    1.0470   -1.3710 H   0  0  0  0  0  0  0  0  0  0  0  0
   -1.4938   -0.3630    1.6695 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.5048    3.6689    0.7999 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.6653    2.1253    1.0840 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.4004    2.2755    1.4514 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.1573    0.2346   -0.2337 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.2189    0.3661   -1.6564 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.1100    2.5429    1.2231 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.9153    1.2707    2.3332 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.9610   -0.8403    2.5964 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3098   -0.4765    3.1612 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.6608   -2.6032    1.4108 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.6303   -4.9587   -1.7846 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3099   -2.9710   -3.0454 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  3  4  2  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  2  0  0  0  0
  8  9  1  0  0  0  0
  9 10  1  0  0  0  0
  9 11  1  0  0  0  0
  9 12  1  0  0  0  0
  8 13  1  0  0  0  0
 13 14  2  0  0  0  0
  5 14  1  0  0  0  0
  2 15  1  0  0  0  0
 15 16  1  0  0  0  0
 15 17  1  0  0  0  0
 15 18  1  0  0  0  0
 18 19  1  0  0  0  0
 19 20  2  0  0  0  0
 20 21  1  0  0  0  0
 21 22  2  0  0  0  0
 21 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  2  0  0  0  0
 19 25  1  0  0  0  0
 25 26  1  0  0  0  0
 26 27  1  0  0  0  0
 27 28  2  0  0  0  0
 28 29  1  0  0  0  0
 29 30  2  0  0  0  0
 26 30  1  0  0  0  0
  1 31  1  0  0  0  0
  1 32  1  0  0  0  0
  3 33  1  0  0  0  0
  7 34  1  0  0  0  0
 14 35  1  0  0  0  0
 17 36  1  0  0  0  0
 17 37  1  0  0  0  0
 17 38  1  0  0  0  0
 18 39  1  0  0  0  0
 18 40  1  0  0  0  0
 22 41  1  0  0  0  0
 22 42  1  0  0  0  0
 23 43  1  0  0  0  0
 23 44  1  0  0  0  0
 24 45  1  0  0  0  0
 28 46  1  0  0  0  0
 29 47  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="333" x2="328" y1="434" y2="419" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="328" x2="323" y1="419" y2="404" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="329" x2="324" y1="435" y2="420.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="324" x2="319" y1="420.5" y2="406" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="320.67696811188" x2="295.98019084721" y1="404.52445339345" y2="395.74771836904" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="295.98019084721" x2="271.28341358254" y1="395.74771836904" y2="386.97098334464" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="274" x2="269" y1="387" y2="372.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="269" x2="264" y1="372.5" y2="358" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="270" x2="265" y1="388" y2="373.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="265" x2="260" y1="373.5" y2="359" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="261.71800245125" x2="238.67455078681" y1="357.93829638222" y2="349.74945065768" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="238.67455078681" x2="215.63109912237" y1="349.74945065768" y2="341.56060493314" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="215" x2="197.5" y1="340" y2="347" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="197.5" x2="180" y1="347" y2="354" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="217" x2="199.5" y1="344" y2="351" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="199.5" x2="182" y1="351" y2="358" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="180.35050557002" x2="158.10477446324" y1="355.12004552319" y2="347.14103105644" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="158.10477446324" x2="135.85904335646" y1="347.14103105644" y2="339.1620165897" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="139" x2="133.5" y1="339" y2="323.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="133.5" x2="128" y1="323.5" y2="308" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="134" x2="129" y1="340" y2="325" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="129" x2="124" y1="325" y2="310" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="125.81608522466" x2="100.3812807774" y1="308.40726620122" y2="299.37547766519" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="100.3812807774" x2="74.946476330131" y1="299.37547766519" y2="290.34368912915" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="74.946476330131" x2="71.66334070167" y1="290.34368912915" y2="268.73468735637" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="71.66334070167" x2="68.380205073209" y1="268.73468735637" y2="247.12568558359" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #00bc00" />
<line x1="74.946476330131" x2="71.064598060887" y1="290.34368912915" y2="286.25017071196" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="71.064598060887" x2="67.182719791644" y1="286.25017071196" y2="282.15665229476" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #00bc00" />
<line x1="74.946476330131" x2="58.498238165065" y1="290.34368912915" y2="307.66019456786" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="58.498238165065" x2="42.05" y1="307.66019456786" y2="324.97670000657" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #00bc00" />
<line x1="125.81608522466" x2="143.23931518242" y1="308.40726620122" y2="301.59498588343" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="143.23931518242" x2="160.66254514018" y1="301.59498588343" y2="294.78270556565" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="160" x2="182.5" y1="297" y2="305" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="182.5" x2="205" y1="305" y2="313" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="162" x2="184.5" y1="293" y2="301" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="184.5" x2="207" y1="301" y2="309" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="215.63109912237" x2="210.46309995404" y1="341.56060493314" y2="325.92455844696" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="210.46309995404" x2="205.29510078571" y1="325.92455844696" y2="310.28851196078" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="320.67696811188" x2="339.14754546847" y1="404.52445339345" y2="397.37210172682" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="339.14754546847" x2="357.61812282506" y1="397.37210172682" y2="390.21975006019" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="357.61812282506" x2="373.34099603861" y1="390.21975006019" y2="397.89667987131" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="373.34099603861" x2="389.06386925215" y1="397.89667987131" y2="405.57360968243" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #a4a4a4" />
<line x1="357.61812282506" x2="351.71209647414" y1="390.21975006019" y2="397.98350659867" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="351.71209647414" x2="345.80607012322" y1="397.98350659867" y2="405.74726313716" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="357.61812282506" x2="360.04203563065" y1="390.21975006019" y2="363.76654045655" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="360.04203563065" x2="362.46594843623" y1="363.76654045655" y2="337.3133308529" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="362.46594843623" x2="383.79095445493" y1="337.3133308529" y2="329.77387669344" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="383.79095445493" x2="405.11596047362" y1="329.77387669344" y2="322.23442253398" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="404" x2="417" y1="324" y2="340.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="417" x2="430" y1="340.5" y2="357" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="407" x2="420" y1="321" y2="337.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="420" x2="433" y1="337.5" y2="354" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="430.88179181896" x2="450.065071896" y1="355.04045435644" y2="348.08527171653" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="450.065071896" x2="469.24835197304" y1="348.08527171653" y2="341.13008907662" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="468" x2="487.5" y1="343" y2="357.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="487.5" x2="507" y1="357.5" y2="372" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="471" x2="490.5" y1="340" y2="354" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="490.5" x2="510" y1="354" y2="368" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="469.24835197304" x2="468.20643124467" y1="341.13008907662" y2="316.87468100939" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="468.20643124467" x2="467.16451051629" y1="316.87468100939" y2="292.61927294215" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="467.16451051629" x2="457.11069904358" y1="292.61927294215" y2="274.24999343416" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="457.11069904358" x2="447.05688757086" y1="274.24999343416" y2="255.88071392616" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="447" x2="432" y1="254" y2="261.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="432" x2="417" y1="261.5" y2="269" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="449" x2="434" y1="258" y2="265.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="434" x2="419" y1="265.5" y2="273" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="405.11596047362" x2="411.22820030203" y1="322.23442253398" y2="296.52466678339" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="411.22820030203" x2="417.34044013044" y1="296.52466678339" y2="270.81491103281" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="417.34044013044" x2="407.73885119608" y1="270.81491103281" y2="254.01755706813" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="407.73885119608" x2="398.13726226171" y1="254.01755706813" y2="237.22020310346" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="398.13726226171" x2="402.50573198223" y1="237.22020310346" y2="214.37572935589" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="402.50573198223" x2="406.87420170274" y1="214.37572935589" y2="191.53125560833" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="409" x2="397" y1="190" y2="180" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="397" x2="385" y1="180" y2="170" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="406" x2="394" y1="194" y2="183.5" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="394" x2="382" y1="183.5" y2="173" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="383.20668293537" x2="370.84110984658" y1="170.85202337441" y2="189.46731194327" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="370.84110984658" x2="358.47553675779" y1="189.46731194327" y2="208.08260051214" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="357" x2="362.5" y1="209" y2="229" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="362.5" x2="368" y1="229" y2="249" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="361" x2="366.5" y1="208" y2="228" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #000000" />
<line x1="366.5" x2="372" y1="228" y2="248" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="398.13726226171" x2="383.69327438664" y1="237.22020310346" y2="242.56366461666" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<line x1="383.69327438664" x2="369.24928651157" y1="242.56366461666" y2="247.90712612987" style="stroke-opacity:1; stroke-width: 1.8151859420347; stroke: #0000ff" />
<ellipse cx="261.71800245125" cy="357.93829638222" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="261.71800245125" y="367.92181906341"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="180.35050557002" cy="355.12004552319" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="180.35050557002" y="365.10356820438"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="68.380205073209" cy="247.12568558359" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="68.380205073209" y="257.10920826479"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">F</text>
<ellipse cx="67.182719791644" cy="282.15665229476" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="67.182719791644" y="292.14017497595"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">F</text>
<ellipse cx="42.05" cy="324.97670000657" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="334.96022268776"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">F</text>
<ellipse cx="160.66254514018" cy="294.78270556565" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="160.66254514018" y="304.76622824684"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="357.61812282506" cy="390.21975006019" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="357.61812282506" y="400.20327274138"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N<tspan baseline-shift='super' font-size='11.344912137717'>+</tspan></text>
<ellipse cx="389.06386925215" cy="405.57360968243" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="389.06386925215" y="415.55713236362"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">H</text>
<ellipse cx="430.88179181896" cy="355.04045435644" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="430.88179181896" y="365.02397703763"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="398.13726226171" cy="237.22020310346" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="398.13726226171" y="247.20372578465"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="406.87420170274" cy="191.53125560833" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="406.87420170274" y="201.51477828952"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
<ellipse cx="369.24928651157" cy="247.90712612987" rx="11.798708623226" ry="11.798708623226" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="369.24928651157" y="257.89064881106"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:22.689824275434px">N</text>
</g></svg>

✍: FYIcenter.com

2021-03-07, 130👍, 0💬