Molecule FYI-1000262

A

Molecule Summary:

ID: FYI-1000262
SMILES: [CH+]=C1CC=C(N2N=CC=N2)C=N1

Received at FYIcenter.com on: 2021-02-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000262
FYIcenter.com

 19 20  0  0  0  0  0  0  0  0999 V2000
    2.8660   -2.6144    0.0000 C   0  3  0  0  0  0  0  0  0  0  0  0
    2.3291   -2.9244    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -1.6144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -1.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.7321   -0.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    0.3856    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660    1.3856    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.6750    1.9734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.3660    2.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3660    2.9244    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0570    1.9734    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -0.1144    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -1.1144    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.9441   -1.6970    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.3426   -1.0068    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690    0.1956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.7305    3.4260    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0016    3.4260    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4631    0.1956    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  1  3  2  0  0  0  0
  3  4  1  0  0  0  0
  4  5  1  0  0  0  0
  5  6  2  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  8  9  2  0  0  0  0
  9 10  1  0  0  0  0
 10 11  2  0  0  0  0
  7 11  1  0  0  0  0
  6 12  1  0  0  0  0
 12 13  2  0  0  0  0
  3 13  1  0  0  0  0
  4 14  1  0  0  0  0
  4 15  1  0  0  0  0
  5 16  1  0  0  0  0
  9 17  1  0  0  0  0
 10 18  1  0  0  0  0
 12 19  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="284" x2="284" y1="67" y2="106" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="284" x2="284" y1="106" y2="145" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="292" x2="292" y1="67" y2="106" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="292" x2="292" y1="106" y2="145" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="287.12239937642" x2="320.93908730159" y1="144.34733560091" y2="163.86972789116" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="320.93908730159" x2="354.75577522676" y1="163.86972789116" y2="183.39212018141" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="354.75577522676" x2="354.75577522676" y1="183.39212018141" y2="222.4369047619" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="354.75577522676" x2="354.75577522676" y1="222.4369047619" y2="261.4816893424" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="353" x2="319.5" y1="258" y2="277.5" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="319.5" x2="286" y1="277.5" y2="297" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="357" x2="323.5" y1="266" y2="285.5" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="323.5" x2="290" y1="285.5" y2="305" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="287.12239937642" x2="287.12239937642" y1="300.5264739229" y2="339.5712585034" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="287.12239937642" x2="287.12239937642" y1="339.5712585034" y2="378.6160430839" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="287.12239937642" x2="318.70963010204" y1="378.6160430839" y2="401.56656746032" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="318.70963010204" x2="350.29686082766" y1="401.56656746032" y2="424.51709183673" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="347" x2="335" y1="424" y2="461" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="335" x2="323" y1="461" y2="498" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="355" x2="343" y1="426" y2="463.5" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="343" x2="331" y1="463.5" y2="501" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="326.16718395692" x2="287.12239937642" y1="498.78027210884" y2="498.78027210884" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="287.12239937642" x2="248.07761479592" y1="498.78027210884" y2="498.78027210884" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="252" x2="240" y1="498" y2="461" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="240" x2="228" y1="461" y2="424" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="245" x2="233" y1="501" y2="463.5" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="233" x2="221" y1="463.5" y2="426" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="287.12239937642" x2="255.53516865079" y1="378.6160430839" y2="401.56656746032" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="255.53516865079" x2="223.94793792517" y1="401.56656746032" y2="424.51709183673" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="287.12239937642" x2="253.30961592971" y1="300.5264739229" y2="281.00408163265" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="253.30961592971" x2="219.49683248299" y1="281.00408163265" y2="261.4816893424" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="224" x2="224" y1="262" y2="223" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="224" x2="224" y1="223" y2="184" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="216" x2="216" y1="262" y2="223" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="216" x2="216" y1="223" y2="184" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<line x1="287.12239937642" x2="253.30961592971" y1="144.34733560091" y2="163.86972789116" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #000000" />
<line x1="253.30961592971" x2="219.49683248299" y1="163.86972789116" y2="183.39212018141" style="stroke-opacity:1; stroke-width: 3.2880406077466; stroke: #0000ff" />
<ellipse cx="287.12239937642" cy="378.6160430839" rx="21.372263950353" ry="21.372263950353" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="287.12239937642" y="396.70026642651"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.100507596832px">N</text>
<ellipse cx="350.29686082766" cy="424.51709183673" rx="21.372263950353" ry="21.372263950353" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="350.29686082766" y="442.60131517934"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.100507596832px">N</text>
<ellipse cx="223.94793792517" cy="424.51709183673" rx="21.372263950353" ry="21.372263950353" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="223.94793792517" y="442.60131517934"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.100507596832px">N</text>
<ellipse cx="219.49683248299" cy="183.39212018141" rx="21.372263950353" ry="21.372263950353" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="219.49683248299" y="201.47634352401"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:41.100507596832px">N</text>
</g></svg>

✍: FYIcenter.com

2021-03-21, 129👍, 0💬