Molecule FYI-1000259


Molecule Summary:

ID: FYI-1000259
SMILES: CC1=CC2=C(C=C1C3=CC=CC(=C3)C[N+]#[C-])N=C(N=C2N)N

Received at on: 2021-02-07

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 22 24  0  0  0  0  0  0  0  0999 V2000
    7.2745    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6372    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8497    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0621    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2745    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 N   0  3  0  0  0  0  0  0  0  0  0  0
   10.9119    5.6000    0.0000 C   0  5  0  0  0  0  0  0  0  0  0  0
    2.4248    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4248    6.3000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  2  0  0  0  0
  4  3  1  0  0  0  0
  5  4  2  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  7  2  1  0  0  0  0
  8  7  1  0  0  0  0
  9  8  2  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 13  8  1  0  0  0  0
 14 12  1  0  0  0  0
 15 14  1  0  0  0  0
 16 15  3  0  0  0  0
 17  5  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20  4  1  0  0  0  0
 21 20  1  0  0  0  0
 22 18  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="317.54697028015" x2="345.09621285019" y1="337.71808759244" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="345.09621285019" x2="372.64545542023" y1="353.62411678993" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="265" x2="292.5" y1="373" y2="357" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="292.5" x2="320" y1="357" y2="341" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="261" x2="288.5" y1="367" y2="351" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="288.5" x2="316" y1="351" y2="335" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="207.34545542023" x2="234.89697028015" y1="337.71808759244" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="234.89697028015" x2="262.44848514008" y1="353.62411678993" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="204" x2="204" y1="275" y2="306.5" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="204" x2="204" y1="306.5" y2="338" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="211" x2="211" y1="275" y2="306.5" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="211" x2="211" y1="306.5" y2="338" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="262.44848514008" x2="234.89697028015" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="234.89697028015" x2="207.34545542023" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="320" x2="292.5" y1="272" y2="256" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="292.5" x2="265" y1="256" y2="240" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="316" x2="288.5" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="288.5" x2="261" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="317.54697028015" x2="317.54697028015" y1="274.09397080252" y2="305.90602919748" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="317.54697028015" x2="317.54697028015" y1="305.90602919748" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="372.64545542023" x2="345.09621285019" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="345.09621285019" x2="317.54697028015" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="370" x2="370" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="370" x2="370" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="376" x2="376" y1="179" y2="211" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="376" x2="376" y1="211" y2="243" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="427.75302971985" x2="400.19924257004" y1="146.84573722267" y2="162.75176642015" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="400.19924257004" x2="372.64545542023" y1="162.75176642015" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="485" x2="457.5" y1="176" y2="160" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="457.5" x2="430" y1="160" y2="144" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="482" x2="454.5" y1="182" y2="166" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="454.5" x2="427" y1="166" y2="150" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="482.85151485992" x2="482.85151485992" y1="242.28191240756" y2="210.46985401259" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="482.85151485992" x2="482.85151485992" y1="210.46985401259" y2="178.65779561763" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="430" x2="457.5" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="457.5" x2="485" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="427" x2="454.5" y1="272" y2="256" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="454.5" x2="482" y1="256" y2="240" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="427.75302971985" x2="400.19924257004" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="400.19924257004" x2="372.64545542023" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="537.95" x2="510.40075742996" y1="274.09397080252" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="510.40075742996" x2="482.85151485992" y1="258.18794160504" y2="242.28191240756" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="337.71808759244" y2="305.90602919748" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="537.95" x2="537.95" y1="305.90602919748" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="545" x2="545" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="545" x2="545" y1="370" y2="338" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="532" x2="532" y1="402" y2="370" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="532" x2="532" y1="370" y2="338" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="537.95" x2="537.95" y1="401.34220438237" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="537.95" x2="537.95" y1="369.53014598741" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="152.24697028015" x2="179.79621285019" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="179.79621285019" x2="207.34545542023" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="99" x2="126.5" y1="277" y2="261.5" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="126.5" x2="154" y1="261.5" y2="246" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="96" x2="123.5" y1="272" y2="256" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="123.5" x2="151" y1="256" y2="240" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="97.148485140076" x2="97.148485140076" y1="337.71808759244" y2="305.90602919748" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="97.148485140076" x2="97.148485140076" y1="305.90602919748" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="154" x2="126.5" y1="367" y2="351" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="126.5" x2="99" y1="351" y2="335" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="151" x2="123.5" y1="373" y2="357" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="123.5" x2="96" y1="357" y2="341" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="152.24697028015" x2="179.79621285019" y1="369.53014598741" y2="353.62411678993" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="179.79621285019" x2="207.34545542023" y1="353.62411678993" y2="337.71808759244" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="152.24697028015" x2="152.24697028015" y1="433.15426277733" y2="401.34220438237" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="152.24697028015" x2="152.24697028015" y1="401.34220438237" y2="369.53014598741" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<line x1="42.05" x2="69.599242570038" y1="242.28191240756" y2="258.18794160504" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #0000ff" />
<line x1="69.599242570038" x2="97.148485140076" y1="258.18794160504" y2="274.09397080252" style="stroke-opacity:1; stroke-width: 2.6789281217078; stroke: #000000" />
<ellipse cx="537.95" cy="337.71808759244" rx="17.413032791101" ry="17.413032791101" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="352.45219226184"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486601521348px">N<tspan baseline-shift='super' font-size='16.743300760674'>+</tspan></text>
<ellipse cx="152.24697028015" cy="242.28191240756" rx="17.413032791101" ry="17.413032791101" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="152.24697028015" y="257.01601707695"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486601521348px">N</text>
<ellipse cx="97.148485140076" cy="337.71808759244" rx="17.413032791101" ry="17.413032791101" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="97.148485140076" y="352.45219226184"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486601521348px">N</text>
<ellipse cx="152.24697028015" cy="433.15426277733" rx="17.413032791101" ry="17.413032791101" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="152.24697028015" y="447.88836744673"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486601521348px">N</text>
<ellipse cx="42.05" cy="242.28191240756" rx="17.413032791101" ry="17.413032791101" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="257.01601707695"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:33.486601521348px">N</text>


2021-03-07, 252👍, 0💬