Molecule FYI-1000261

A

Molecule Summary:

ID: FYI-1000261
SMILES: C=C(C)[NH+](C)C(=O)C1=NC(=C)CC=C1N1N=CC=N1

Received at FYIcenter.com on: 2021-02-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000261
FYIcenter.com

 35 36  0  0  0  0  0  0  0  0999 V2000
    3.3165    0.6173    1.1224 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5452    1.3320    0.3411 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.1253    2.0145   -0.8708 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1838    1.4616    0.6317 N   0  3  0  0  0  0  0  0  0  0  0  0
    0.9683    0.9444    1.4708 H   0  0  0  0  0  0  0  0  0  0  0  0
    0.8591    2.8799    0.8337 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.4302    0.9580   -0.4326 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9029    0.9265   -1.5488 O   0  0  0  0  0  0  0  0  0  0  0  0
   -0.9376    0.4658   -0.1982 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.9179    1.3303   -0.1930 N   0  0  0  0  0  0  0  0  0  0  0  0
   -3.1956    0.9726    0.0119 C   0  0  0  0  0  0  0  0  0  0  0  0
   -4.1683    1.8931    0.0083 C   0  0  0  0  0  0  0  0  0  0  0  0
   -3.5200   -0.4866    0.2464 C   0  0  0  0  0  0  0  0  0  0  0  0
   -2.3647   -1.4665    0.2350 C   0  0  0  0  0  0  0  0  0  0  0  0
   -1.1365   -0.9757    0.0128 C   0  0  0  0  0  0  0  0  0  0  0  0
   -0.0342   -1.8410   -0.0081 N   0  0  0  0  0  0  0  0  0  0  0  0
   -0.1097   -3.1221    0.0740 N   0  0  0  0  0  0  0  0  0  0  0  0
    1.1053   -3.6204    0.0227 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.9634   -2.5244   -0.1006 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1898   -1.4621   -0.1176 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.3682    0.5172    0.8979 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.9017    0.1319    1.9934 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0650    1.3448   -1.7286 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5623    2.9242   -1.0798 H   0  0  0  0  0  0  0  0  0  0  0  0
    4.1681    2.2683   -0.6805 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.4467    3.2726    1.6635 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.0919    3.4387   -0.0728 H   0  0  0  0  0  0  0  0  0  0  0  0
   -0.2023    2.9810    1.0602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -3.9275    2.9324   -0.1602 H   0  0  0  0  0  0  0  0  0  0  0  0
   -5.1934    1.5963    0.1740 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.0179   -0.5676    1.2127 H   0  0  0  0  0  0  0  0  0  0  0  0
   -4.2308   -0.7985   -0.5188 H   0  0  0  0  0  0  0  0  0  0  0  0
   -2.5248   -2.5225    0.3955 H   0  0  0  0  0  0  0  0  0  0  0  0
    1.3836   -4.6630    0.0674 H   0  0  0  0  0  0  0  0  0  0  0  0
    3.0409   -2.5461   -0.1709 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  2  0  0  0  0
  2  3  1  0  0  0  0
  2  4  1  0  0  0  0
  4  5  1  0  0  0  0
  4  6  1  0  0  0  0
  4  7  1  0  0  0  0
  7  8  2  0  0  0  0
  7  9  1  0  0  0  0
  9 10  2  0  0  0  0
 10 11  1  0  0  0  0
 11 12  2  0  0  0  0
 11 13  1  0  0  0  0
 13 14  1  0  0  0  0
 14 15  2  0  0  0  0
  9 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  1  0  0  0  0
 17 18  2  0  0  0  0
 18 19  1  0  0  0  0
 19 20  2  0  0  0  0
 16 20  1  0  0  0  0
  1 21  1  0  0  0  0
  1 22  1  0  0  0  0
  3 23  1  0  0  0  0
  3 24  1  0  0  0  0
  3 25  1  0  0  0  0
  6 26  1  0  0  0  0
  6 27  1  0  0  0  0
  6 28  1  0  0  0  0
 12 29  1  0  0  0  0
 12 30  1  0  0  0  0
 13 31  1  0  0  0  0
 13 32  1  0  0  0  0
 14 33  1  0  0  0  0
 18 34  1  0  0  0  0
 19 35  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="481" x2="461" y1="352" y2="370.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="461" x2="441" y1="370.5" y2="389" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="486" x2="466" y1="357" y2="375.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="466" x2="446" y1="375.5" y2="394" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="443.40246611446" x2="458.44553369729" y1="390.8308217244" y2="408.52931099398" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="458.44553369729" x2="473.48860128012" y1="408.52931099398" y2="426.22780026355" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="443.40246611446" x2="408.09884224398" y1="390.8308217244" y2="394.19158979669" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="408.09884224398" x2="372.79521837349" y1="394.19158979669" y2="397.55235786898" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="372.79521837349" x2="367.20690417922" y1="397.55235786898" y2="384.14040380271" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="367.20690417922" x2="361.61858998494" y1="384.14040380271" y2="370.72844973645" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #a4a4a4" />
<line x1="372.79521837349" x2="364.37514589608" y1="397.55235786898" y2="434.33150414157" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="364.37514589608" x2="355.95507341867" y1="434.33150414157" y2="471.11065041416" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="372.79521837349" x2="353.25297439759" y1="397.55235786898" y2="384.49307699548" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="353.25297439759" x2="333.71073042169" y1="384.49307699548" y2="371.43379612199" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="334" x2="346.5" y1="376" y2="375" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="346.5" x2="359" y1="375" y2="374" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #ff0000" />
<line x1="334" x2="346" y1="368" y2="367.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="346" x2="358" y1="367.5" y2="367" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #ff0000" />
<line x1="333.71073042169" x2="298.24114269578" y1="371.43379612199" y2="358.67013836596" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="298.24114269578" x2="262.77155496988" y1="358.67013836596" y2="345.90648060994" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="261" x2="235.5" y1="344" y2="366.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="235.5" x2="210" y1="366.5" y2="389" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="266" x2="240.5" y1="349" y2="371.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="240.5" x2="215" y1="371.5" y2="394" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="211.92956513554" x2="178.79643731175" y1="390.7426534262" y2="381.46682981928" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="178.79643731175" x2="145.66330948795" y1="381.46682981928" y2="372.19100621235" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="144" x2="118.5" y1="370" y2="394" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="118.5" x2="93" y1="394" y2="418" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="149" x2="123.5" y1="375" y2="399" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="123.5" x2="98" y1="399" y2="423" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="145.66330948795" x2="137.25101656627" y1="372.19100621235" y2="334.3512471762" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="137.25101656627" x2="128.83872364458" y1="334.3512471762" y2="296.51148814006" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="128.83872364458" x2="158.79779273343" y1="296.51148814006" y2="271.10086596386" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="158.79779273343" x2="188.75686182229" y1="271.10086596386" y2="245.69024378765" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="188" x2="220" y1="250" y2="262.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="220" x2="252" y1="262.5" y2="275" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="191" x2="222.5" y1="243" y2="255.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="222.5" x2="254" y1="255.5" y2="268" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="262.77155496988" x2="257.6137095256" y1="345.90648060994" y2="308.52571536145" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="257.6137095256" x2="252.45586408133" y1="308.52571536145" y2="271.14495011295" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="252.45586408133" x2="281.04054499247" y1="271.14495011295" y2="248.70611822289" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="281.04054499247" x2="309.62522590361" y1="248.70611822289" y2="226.26728633283" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="309.62522590361" x2="307.66737104669" y1="226.26728633283" y2="193.04599021084" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="307.66737104669" x2="305.70951618976" y1="193.04599021084" y2="159.82469408886" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="308" x2="339.5" y1="164" y2="151" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="339.5" x2="371" y1="151" y2="138" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="305" x2="336.5" y1="157" y2="144" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="336.5" x2="368" y1="144" y2="131" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="368.72391754518" x2="390.97604009789" y1="133.98100997741" y2="162.40232021837" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="390.97604009789" x2="413.2281626506" y1="162.40232021837" y2="190.82363045934" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="411" x2="391" y1="189" y2="216.5" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="391" x2="371" y1="216.5" y2="244" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="417" x2="397" y1="193" y2="221" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #000000" />
<line x1="397" x2="377" y1="221" y2="249" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="309.62522590361" x2="341.36581325301" y1="226.26728633283" y2="236.09286521084" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<line x1="341.36581325301" x2="373.10640060241" y1="236.09286521084" y2="245.91844408886" style="stroke-opacity:1; stroke-width: 2.8921359304256; stroke: #0000ff" />
<ellipse cx="372.79521837349" cy="397.55235786898" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="372.79521837349" y="413.45910548632"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">N<tspan baseline-shift='super' font-size='18.07584956516'>+</tspan></text>
<ellipse cx="361.61858998494" cy="370.72844973645" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="361.61858998494" y="386.63519735379"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">H</text>
<ellipse cx="358.22670368976" cy="369.80008942018" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="358.22670368976" y="385.70683703752"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">O</text>
<ellipse cx="211.92956513554" cy="390.7426534262" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="211.92956513554" y="406.64940104355"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">N</text>
<ellipse cx="309.62522590361" cy="226.26728633283" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="309.62522590361" y="242.17403395017"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">N</text>
<ellipse cx="305.70951618976" cy="159.82469408886" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="305.70951618976" y="175.7314417062"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">N</text>
<ellipse cx="373.10640060241" cy="245.91844408886" rx="18.798883547766" ry="18.798883547766" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="373.10640060241" y="261.8251917062"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:36.15169913032px">N</text>
</g></svg>

✍: FYIcenter.com

2021-03-07, 124👍, 0💬