Molecule FYI-1000456

A

Molecule Summary:

ID: FYI-1000456
SMILES: CCN(CCCC(C)NC1=C2C=CC(=CC2=NC=C1)Cl)CCO

Received at FYIcenter.com on: 2021-07-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000456
FYIcenter.com

 23 24  0  0  0  0  0  0  0  0999 V2000
    4.8498    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6373    2.8000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    4.8498    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0622    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.2746    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.4871    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6995    2.1000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3367    0.0000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    0.7000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5492    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3367    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.3367    4.2000    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
   12.1243    4.9000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9119    4.2000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   15.7616    0.0000    0.0000 Cl  0  0  0  0  0  0  0  0  0  0  0  0
    2.4249    2.1000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2124    2.8000    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    2.1000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  1  0  0  0  0
  8  7  1  0  0  0  0
  9  7  1  0  0  0  0
 10  9  1  0  0  0  0
 11 10  2  0  0  0  0
 12 11  1  0  0  0  0
 13 12  2  0  0  0  0
 14 13  1  0  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 16 11  1  0  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  2  0  0  0  0
 19 10  1  0  0  0  0
 20 14  1  0  0  0  0
 21  3  1  0  0  0  0
 22 21  1  0  0  0  0
 23 22  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="156.48870355801" x2="175.56286956908" y1="345.05944827936" y2="356.07133793524" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="175.56286956908" x2="194.63703558014" y1="356.07133793524" y2="367.08322759111" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="156.48870355801" x2="156.48870355801" y1="301.01188965587" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="156.48870355801" x2="156.48870355801" y1="323.03566896762" y2="345.05944827936" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="194.63703558014" x2="175.56286956908" y1="278.98811034413" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="175.56286956908" x2="156.48870355801" y1="290" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="232.78222134809" x2="213.70962846412" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="213.70962846412" x2="194.63703558014" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="270.92740711603" x2="251.85481423206" y1="278.98811034413" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="251.85481423206" x2="232.78222134809" y1="290" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="309.07573913816" x2="290.00157312709" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="290.00157312709" x2="270.92740711603" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="309.07573913816" x2="309.07573913816" y1="345.05944827936" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="309.07573913816" x2="309.07573913816" y1="323.03566896762" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="347.2209249061" x2="328.14833202213" y1="278.98811034413" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="328.14833202213" x2="309.07573913816" y1="290" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="385.36611067404" x2="366.29351779007" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="366.29351779007" x2="347.2209249061" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="423" x2="404" y1="277" y2="288.5" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="404" x2="385" y1="288.5" y2="300" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="425" x2="406" y1="281" y2="292.5" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="406" x2="387" y1="292.5" y2="304" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="423.51129644199" x2="423.51129644199" y1="234.94055172064" y2="256.96433103238" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="423.51129644199" x2="423.51129644199" y1="256.96433103238" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="461" x2="442" y1="211" y2="222" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="442" x2="423" y1="222" y2="233" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="463" x2="444" y1="215" y2="226" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="444" x2="425" y1="226" y2="237" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="499.80481423206" x2="480.73064822099" y1="234.94055172064" y2="223.92866206476" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="480.73064822099" x2="461.65648220993" y1="223.92866206476" y2="212.91677240889" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="503" x2="503" y1="279" y2="257" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="503" x2="503" y1="257" y2="235" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="498" x2="498" y1="279" y2="257" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="498" x2="498" y1="257" y2="235" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="461.65648220993" x2="480.73064822099" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="480.73064822099" x2="499.80481423206" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="461.65648220993" x2="442.58388932596" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="442.58388932596" x2="423.51129644199" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="464" x2="464" y1="346" y2="324" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="464" x2="464" y1="324" y2="302" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="460" x2="460" y1="346" y2="324" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="460" x2="460" y1="324" y2="302" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="423.51129644199" x2="442.58388932596" y1="367.08322759111" y2="356.07133793524" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="442.58388932596" x2="461.65648220993" y1="356.07133793524" y2="345.05944827936" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="385" x2="404" y1="348" y2="359" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="404" x2="423" y1="359" y2="370" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="387" x2="406" y1="344" y2="355" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="406" x2="425" y1="355" y2="366" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="385.36611067404" x2="385.36611067404" y1="345.05944827936" y2="323.03566896762" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="385.36611067404" x2="385.36611067404" y1="323.03566896762" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="537.95" x2="518.87740711603" y1="212.91677240889" y2="223.92866206476" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #00bc00" />
<line x1="518.87740711603" x2="499.80481423206" y1="223.92866206476" y2="234.94055172064" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="118.34351779007" x2="137.41611067404" y1="278.98811034413" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="137.41611067404" x2="156.48870355801" y1="290" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #0000ff" />
<line x1="80.195185767942" x2="99.269351779007" y1="301.01188965587" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="99.269351779007" x2="118.34351779007" y1="290" y2="278.98811034413" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<line x1="42.05" x2="61.122592883971" y1="278.98811034413" y2="290" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #ff0000" />
<line x1="61.122592883971" x2="80.195185767942" y1="290" y2="301.01188965587" style="stroke-opacity:1; stroke-width: 1.8546423675697; stroke: #000000" />
<ellipse cx="156.48870355801" cy="301.01188965587" rx="12.055175389203" ry="12.055175389203" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="156.48870355801" y="311.21242267751"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.183029594622px">N</text>
<ellipse cx="347.2209249061" cy="278.98811034413" rx="12.055175389203" ry="12.055175389203" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="347.2209249061" y="289.18864336576"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.183029594622px">N</text>
<ellipse cx="461.65648220993" cy="345.05944827936" rx="12.055175389203" ry="12.055175389203" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="461.65648220993" y="355.259981301"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:23.183029594622px">N</text>
<ellipse cx="537.95" cy="212.91677240889" rx="12.055175389203" ry="12.055175389203" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="223.11730543053"  fill="#00bc00" style="text-anchor:middle;  font-family:sans-serif;font-size:23.183029594622px">Cl</text>
<ellipse cx="42.05" cy="278.98811034413" rx="12.055175389203" ry="12.055175389203" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="289.18864336576"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.183029594622px">O</text>
</g></svg>

✍: FYIcenter.com

2021-10-02, 175👍, 0💬