Molecule FYI-1000460

A

Molecule Summary:

ID: FYI-1000460
SMILES: CN(C)CCC1=CNC2=C1C(=CC=C2)OP(=O)(O)O

Received at FYIcenter.com on: 2021-07-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000460
FYIcenter.com

 19 20  0  0  0  0  0  0  0  0999 V2000
    7.0656    4.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8532    4.9224    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.8532    6.3225    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6408    4.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4282    4.9224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.2158    4.2224    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.9369    4.7918    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    3.7515    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    0.7000    2.5391    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.0695    2.8301    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.0062    1.7896    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.5736    0.4582    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2042    0.1672    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    0.2674    1.2075    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.3756    2.0807    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3125    1.0403    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    6.3528    1.9771    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.2492    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2720    0.1036    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  2  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  7  6  2  0  0  0  0
  8  7  1  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 10  6  1  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 13 12  1  0  0  0  0
 14 13  2  0  0  0  0
 14  9  1  0  0  0  0
 15 11  1  0  0  0  0
 16 15  1  0  0  0  0
 17 16  2  0  0  0  0
 18 16  1  0  0  0  0
 19 16  1  0  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="452.85755774457" x2="495.40377887228" y1="413.60652810802" y2="389.0417353091" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #0000ff" />
<line x1="495.40377887228" x2="537.95" y1="389.0417353091" y2="364.47694251019" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="452.85755774457" x2="452.85755774457" y1="511.8727178159" y2="462.73962296196" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="452.85755774457" x2="452.85755774457" y1="462.73962296196" y2="413.60652810802" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #0000ff" />
<line x1="367.76511548913" x2="410.31133661685" y1="364.47694251019" y2="389.0417353091" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="410.31133661685" x2="452.85755774457" y1="389.0417353091" y2="413.60652810802" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #0000ff" />
<line x1="282.65863620924" x2="325.21187584918" y1="413.60652810802" y2="389.0417353091" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="325.21187584918" x2="367.76511548913" y1="389.0417353091" y2="364.47694251019" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="197.5661939538" x2="240.11241508152" y1="364.47694251019" y2="389.0417353091" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="240.11241508152" x2="282.65863620924" y1="389.0417353091" y2="413.60652810802" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="110" x2="155" y1="410" y2="390" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="155" x2="200" y1="390" y2="370" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="106" x2="151" y1="400" y2="380" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="151" x2="196" y1="380" y2="360" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="42.05" x2="74.928220533288" y1="331.42676842731" y2="367.93355978261" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #0000ff" />
<line x1="74.928220533288" x2="107.80644106658" y1="367.93355978261" y2="404.44035113791" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="91.179585597826" x2="66.614792798913" y1="246.33432617188" y2="288.88054729959" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="66.614792798913" x2="42.05" y1="288.88054729959" y2="331.42676842731" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #0000ff" />
<line x1="189" x2="141" y1="262" y2="252" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="141" x2="93" y1="252" y2="242" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="187" x2="139" y1="272" y2="262" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="139" x2="91" y1="262" y2="252" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="187.29811056386" x2="192.43215225883" y1="266.75819675611" y2="315.61756963315" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="192.43215225883" x2="197.5661939538" y1="315.61756963315" y2="364.47694251019" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="253.04051460598" x2="220.16931258492" y1="193.73057702106" y2="230.24438688859" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="220.16931258492" x2="187.29811056386" y1="230.24438688859" y2="266.75819675611" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="218" x2="233.5" y1="102" y2="149" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="233.5" x2="249" y1="149" y2="196" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="228" x2="243" y1="99" y2="146" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="243" x2="258" y1="146" y2="193" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="126.56692425272" x2="174.62267747962" y1="79.862234629755" y2="90.074169921875" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="174.62267747962" x2="222.67843070652" y1="90.074169921875" y2="100.28610521399" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="65" x2="98" y1="157" y2="120.5" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="98" x2="131" y1="120.5" y2="84" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="57" x2="90" y1="150" y2="113.5" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="90" x2="123" y1="113.5" y2="77" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="60.81750169837" x2="75.998543648098" y1="152.87581734035" y2="199.60507175611" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="75.998543648098" x2="91.179585597826" y1="199.60507175611" y2="246.33432617188" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="349.15202105978" x2="301.09626783288" y1="214.16146611753" y2="203.94602156929" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="301.09626783288" x2="253.04051460598" y1="203.94602156929" y2="193.73057702106" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #000000" />
<line x1="414.90846212636" x2="382.03024159307" y1="141.1408648947" y2="177.65116550611" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #c8aa1a" />
<line x1="382.03024159307" x2="349.15202105978" y1="177.65116550611" y2="214.16146611753" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="492" x2="455.5" y1="204" y2="171" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="455.5" x2="419" y1="171" y2="138" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #c8aa1a" />
<line x1="485" x2="448.5" y1="211" y2="178" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="448.5" x2="412" y1="178" y2="145" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #c8aa1a" />
<line x1="480.65086616848" x2="447.77966414742" y1="68.127282184103" y2="104.6340735394" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="447.77966414742" x2="414.90846212636" y1="104.6340735394" y2="141.1408648947" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #c8aa1a" />
<line x1="341.8808423913" x2="378.39465225883" y1="75.398460852582" y2="108.26966287364" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #ff0000" />
<line x1="378.39465225883" x2="414.90846212636" y1="108.26966287364" y2="141.1408648947" style="stroke-opacity:1; stroke-width: 4.1372389346504; stroke: #c8aa1a" />
<ellipse cx="452.85755774457" cy="413.60652810802" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="452.85755774457" y="436.36134224859"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">N</text>
<ellipse cx="42.05" cy="331.42676842731" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="354.18158256789"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">N</text>
<ellipse cx="349.15202105978" cy="214.16146611753" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="349.15202105978" y="236.9162802581"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">O</text>
<ellipse cx="414.90846212636" cy="141.1408648947" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="414.90846212636" y="163.89567903528"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">P</text>
<ellipse cx="487.92204483696" cy="206.89028744905" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="487.92204483696" y="229.64510158963"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">O</text>
<ellipse cx="480.65086616848" cy="68.127282184103" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="480.65086616848" y="90.88209632468"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">O</text>
<ellipse cx="341.8808423913" cy="75.398460852582" rx="26.892053075227" ry="26.892053075227" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="341.8808423913" y="98.153274993159"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:51.71548668313px">O</text>
</g></svg>

✍: FYIcenter.com

2021-10-02, 168👍, 0💬