Molecule FYI-1000462

A

Molecule Summary:

ID: FYI-1000462
SMILES: C1[C@@H]([C@H](C2(O1)C3[C@@]45C[C@@](O2)([C@]6([C@@]([C@@H]4C7=C(O6)C(=C(C=C7C(=O)O[C@@H]8[C@@H]9[C@@H]([C@@H](COC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O9)O)O)O)O)O)O)O[C@H]8OC(=O)C1=CC(=C(C(=C1)O)O)O)OC5=O)O)O)(O3)O)O)O)O)O

Received at FYIcenter.com on: 2021-07-14

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:

FYI-1000462
FYIcenter.com

 77 88  0  0  1  0  0  0  0  0999 V2000
   11.5911    6.0611    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.7224    6.8806    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5092    8.0986    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.0899    8.4938    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.7115    7.0987    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.7365    8.2844    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.8608    9.0331    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8804   10.2614    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.6014   11.6275    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8868    9.4080    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.2793   11.8424    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1514   10.5040    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.5215   10.3047    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3632    9.7359    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.6655   10.8601    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.4593   12.0383    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.5953   11.4136    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7079   10.4103    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1332    9.1400    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5183    9.2839    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.9172    8.0867    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.5993    8.3264    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0587    6.7547    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8978    5.7107    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.1682    5.2859    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.4666    5.6156    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.2789    3.9327    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.9035    2.7738    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.1088    2.1893    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.0368    2.9022    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2924    2.3024    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.1211    4.2770    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.5160    2.9787    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.6669    2.4579    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.5317    3.1082    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.4351    4.4443    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.2298    5.0286    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.0990    6.2998    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.2421    7.1164    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.1455    8.4524    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.8136    9.1624    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8476    8.3525    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.8845    7.0091    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.8124    6.1668    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9157    4.8614    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.6139    6.7819    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   12.8436   10.3728    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.2543    9.2040    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.4474    6.5319    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.5439    5.1959    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   15.7370    2.5238    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.5194    1.0205    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.0949    3.3064    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.9604    4.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.8004    3.3488    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.6403    4.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.6403    5.3581    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4802    3.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3202    4.0186    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1600    3.3488    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.1600    2.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3202    1.3395    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.4802    2.0093    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.3202    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    1.3395    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    4.0186    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.3528    6.5934    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.5789    7.8861    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   11.9472    8.2258    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.3952   10.6770    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.3108   12.7226    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.7021    9.1235    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.2006   11.0461    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.4585   13.1698    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   11.3617   12.7305    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.4960    9.1526    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   13.9387    6.1673    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  1  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  5  1  1  0  0  0  0
  6  4  1  0  0  0  0
  7  6  1  0  0  0  0
  7  8  1  6  0  0  0
  9  8  1  0  0  0  0
 10  9  1  0  0  0  0
 10  4  1  0  0  0  0
 11  9  1  0  0  0  0
 12 11  1  0  0  0  0
 13 12  1  0  0  0  0
 13  7  1  0  0  0  0
 13 14  1  6  0  0  0
 15 14  2  0  0  0  0
 16 15  1  0  0  0  0
 11 16  1  1  0  0  0
 17 15  1  0  0  0  0
 18 17  2  0  0  0  0
 19 18  1  0  0  0  0
 20 19  2  0  0  0  0
 20 14  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  2  0  0  0  0
 23 21  1  0  0  0  0
 24 23  1  6  0  0  0
 25 24  1  0  0  0  0
 26 25  1  0  0  0  0
 27 26  1  0  0  0  0
 28 27  1  0  0  0  0
 29 28  1  0  0  0  0
 30 29  1  0  0  0  0
 31 30  2  0  0  0  0
 32 30  1  0  0  0  0
 33 32  2  0  0  0  0
 34 33  1  0  0  0  0
 35 34  2  0  0  0  0
 36 35  1  0  0  0  0
 37 36  2  0  0  0  0
 37 32  1  0  0  0  0
 38 37  1  0  0  0  0
 39 38  2  0  0  0  0
 40 39  1  0  0  0  0
 41 40  2  0  0  0  0
 42 41  1  0  0  0  0
 43 42  2  0  0  0  0
 43 38  1  0  0  0  0
 44 43  1  0  0  0  0
 45 44  2  0  0  0  0
 46 44  1  0  0  0  0
 25 46  1  6  0  0  0
 47 41  1  0  0  0  0
 48 40  1  0  0  0  0
 49 39  1  0  0  0  0
 50 36  1  0  0  0  0
 51 35  1  0  0  0  0
 52 34  1  0  0  0  0
 27 53  1  1  0  0  0
 54 53  1  0  0  0  0
 54 24  1  0  0  0  0
 54 55  1  1  0  0  0
 56 55  1  0  0  0  0
 57 56  2  0  0  0  0
 58 56  1  0  0  0  0
 59 58  2  0  0  0  0
 60 59  1  0  0  0  0
 61 60  2  0  0  0  0
 62 61  1  0  0  0  0
 63 62  2  0  0  0  0
 63 58  1  0  0  0  0
 64 62  1  0  0  0  0
 65 61  1  0  0  0  0
 66 60  1  0  0  0  0
 26 67  1  6  0  0  0
 68 67  1  0  0  0  0
 68  7  1  0  0  0  0
 69 68  2  0  0  0  0
 70 18  1  0  0  0  0
 71 17  1  0  0  0  0
 72 12  1  0  0  0  0
 72  6  1  0  0  0  0
 12 73  1  6  0  0  0
 74 11  1  0  0  0  0
  9 75  1  1  0  0  0
  3 76  1  6  0  0  0
  2 77  1  1  0  0  0
M  END
$$$$

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="442.95475694224" x2="425.13015028277" y1="299.31801677575" y2="286.40608788206" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="425.13015028277" x2="407.30554362331" y1="286.40608788206" y2="273.49415898837" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="436.2364573934" x2="439.59560716782" y1="337.69929656224" y2="318.508656669" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="439.59560716782" x2="442.95475694224" y1="318.508656669" y2="299.31801677575" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="391.51186757324" x2="413.87416248332" y1="350.15272987228" y2="343.92601321726" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="413.87416248332" x2="436.2364573934" y1="343.92601321726" y2="337.69929656224" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="379.58783122577" x2="385.5498493995" y1="306.190723772" y2="328.17172682214" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="385.5498493995" x2="391.51186757324" y1="328.17172682214" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="379.58783122577" x2="393.44668742454" y1="306.190723772" y2="289.84244138019" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="393.44668742454" x2="407.30554362331" y1="289.84244138019" y2="273.49415898837" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="317.35217639957" x2="354.4320219864" y1="343.5541748745" y2="346.85345237339" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="354.4320219864" x2="391.51186757324" y1="346.85345237339" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="352.78080765076" x2="335.06649202516" y1="367.14700260533" y2="355.35058873991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="335.06649202516" x2="317.35217639957" y1="355.35058873991" y2="343.5541748745" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 353,368 380,411 391,402" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="376.11839041749" x2="380.51427591028" y1="448.90101925399" y2="427.37693620131" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="380.51427591028" x2="384.91016140306" y1="427.37693620131" y2="405.85285314863" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="416.62356039906" x2="396.37097540827" y1="378.96074791892" y2="413.93088358645" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="396.37097540827" x2="376.11839041749" y1="413.93088358645" y2="448.90101925399" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="416.62356039906" x2="404.06771398615" y1="378.96074791892" y2="364.5567388956" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="404.06771398615" x2="391.51186757324" y1="364.5567388956" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="334.45674016649" x2="355.28756529199" y1="455.67288873356" y2="452.28695399377" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="355.28756529199" x2="376.11839041749" y1="452.28695399377" y2="448.90101925399" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="298.91466670903" x2="316.68570343776" y1="413.49759738197" y2="434.58524305776" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="316.68570343776" x2="334.45674016649" y1="434.58524305776" y2="455.67288873356" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="342.08887971024" x2="320.50177320963" y1="407.21731079621" y2="410.35745408909" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="320.50177320963" x2="298.91466670903" y1="410.35745408909" y2="413.49759738197" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="342.08887971024" x2="347.4348436805" y1="407.21731079621" y2="387.18215670077" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="347.4348436805" x2="352.78080765076" y1="387.18215670077" y2="367.14700260533" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 343,408 276,383 273,396" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="255" x2="266" y1="426" y2="408.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="266" x2="277" y1="408.5" y2="391" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="251" x2="262" y1="424" y2="406.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="262" x2="273" y1="406.5" y2="389" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="277.10540255449" x2="264.59839931372" y1="461.84603545784" y2="443.28247887145" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="264.59839931372" x2="252.09139607295" y1="443.28247887145" y2="424.71892228506" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 335,456 277,456 278,469" fill-opacity="1"  style="fill:#000000" />
<line x1="218.36754908814" x2="235.22947258054" y1="442.16066149838" y2="433.43979189172" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="235.22947258054" x2="252.09139607295" y1="433.43979189172" y2="424.71892228506" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="189" x2="203" y1="413" y2="428.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="203" x2="217" y1="428.5" y2="444" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="193" x2="207" y1="410" y2="425.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="207" x2="221" y1="425.5" y2="441" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="203.805981445" x2="197.10501334435" y1="370.51560589693" y2="390.5302773718" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="197.10501334435" x2="190.40404524369" y1="390.5302773718" y2="410.54494884667" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="248" x2="226.5" y1="373" y2="371" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="226.5" x2="205" y1="371" y2="369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="248" x2="226" y1="378" y2="375.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="226" x2="204" y1="375.5" y2="373" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="247.45287030565" x2="260.76499809366" y1="375.05014297515" y2="382.17179259071" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="260.76499809366" x2="274.07712588168" y1="382.17179259071" y2="389.29344220627" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="228.51117303171" x2="237.98202166868" y1="337.32430704709" y2="356.18722501112" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="237.98202166868" x2="247.45287030565" y1="356.18722501112" y2="375.05014297515" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="188" x2="208.5" y1="348" y2="344" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="208.5" x2="229" y1="344" y2="340" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="187" x2="208" y1="343" y2="339.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="208" x2="229" y1="339.5" y2="336" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="232.97008197242" x2="230.74062750207" y1="295.35069072886" y2="316.33749888797" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="230.74062750207" x2="228.51117303171" y1="316.33749888797" y2="337.32430704709" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 260,263 228,292 239,300" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="299.4440636716" x2="279.42781661054" y1="249.06627057254" y2="255.7593607422" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="279.42781661054" x2="259.41156954947" y1="255.7593607422" y2="262.45245091186" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="340.35888606469" x2="319.90147486815" y1="259.45568596302" y2="254.26097826778" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="319.90147486815" x2="299.4440636716" y1="254.26097826778" y2="249.06627057254" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="334.4441354769" x2="337.40151077079" y1="206.4246057063" y2="232.94014583466" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="337.40151077079" x2="340.35888606469" y1="232.94014583466" y2="259.45568596302" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="354.12635826396" x2="344.28524687043" y1="169.905668806" y2="188.16513725615" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="344.28524687043" x2="334.4441354769" y1="188.16513725615" y2="206.4246057063" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="392.10743915613" x2="373.11689871005" y1="151.48706614984" y2="160.69636747792" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="373.11689871005" x2="354.12635826396" y1="160.69636747792" y2="169.905668806" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="421.35031899345" x2="406.72887907479" y1="173.9517741628" y2="162.71942015632" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="406.72887907479" x2="392.10743915613" y1="162.71942015632" y2="151.48706614984" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="460" x2="440.5" y1="153" y2="162.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="440.5" x2="421" y1="162.5" y2="172" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="462" x2="442.5" y1="158" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="442.5" x2="423" y1="167.5" y2="177" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="424.00675732351" x2="422.67853815848" y1="217.27409226663" y2="195.61293321472" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="422.67853815848" x2="421.35031899345" y1="195.61293321472" y2="173.9517741628" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="435" x2="428.5" y1="176" y2="196.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="428.5" x2="422" y1="196.5" y2="217" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="439" x2="433" y1="178" y2="198" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="433" x2="427" y1="198" y2="218" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="472.71758022495" x2="454.58415867065" y1="159.9511152062" y2="168.15676812607" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="454.58415867065" x2="436.45073711635" y1="168.15676812607" y2="176.36242104594" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="502" x2="488.5" y1="179" y2="169" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="488.5" x2="475" y1="169" y2="159" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="499" x2="485.5" y1="183" y2="172.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="485.5" x2="472" y1="172.5" y2="162" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="496.92488657304" x2="498.44690284044" y1="222.54600368558" y2="201.49459649234" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="498.44690284044" x2="499.96891910784" y1="201.49459649234" y2="180.4431892991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="460" x2="479" y1="244" y2="234.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="479" x2="498" y1="234.5" y2="225" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="458" x2="477" y1="239" y2="230" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="477" x2="496" y1="230" y2="221" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="458.94380568088" x2="441.47528150219" y1="240.95830399695" y2="229.11619813179" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="441.47528150219" x2="424.00675732351" y1="229.11619813179" y2="217.27409226663" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="454.82207218657" x2="456.88293893372" y1="281.01600749825" y2="260.9871557476" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="456.88293893372" x2="458.94380568088" y1="260.9871557476" y2="240.95830399695" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="493" x2="475" y1="305" y2="292.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="475" x2="457" y1="292.5" y2="280" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="490" x2="472" y1="309" y2="296" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="472" x2="454" y1="296" y2="283" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="487.79909131347" x2="489.32110758086" y1="348.84814450022" y2="327.79831289318" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="489.32110758086" x2="490.84312384826" y1="327.79831289318" y2="306.74848128614" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="447" x2="468" y1="374" y2="362.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="468" x2="489" y1="362.5" y2="351" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="445" x2="466" y1="370" y2="358.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="466" x2="487" y1="358.5" y2="347" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="415.38830081972" x2="430.60846349368" y1="345.70012327636" y2="358.46079589502" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="430.60846349368" x2="445.82862616763" y1="358.46079589502" y2="371.22146851369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="415" x2="414.5" y1="304" y2="325" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="414.5" x2="414" y1="325" y2="346" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="419" x2="418.5" y1="304" y2="325" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="418.5" x2="418" y1="325" y2="346" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="416.55108343395" x2="435.68657781026" y1="303.36727330495" y2="292.1916404016" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="435.68657781026" x2="454.82207218657" y1="292.1916404016" y2="281.01600749825" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="382.7673641736" x2="399.65922380377" y1="276.82494821122" y2="290.09611075809" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="399.65922380377" x2="416.55108343395" y1="290.09611075809" y2="303.36727330495" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="384" x2="382.5" y1="236" y2="256.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="382.5" x2="381" y1="256.5" y2="277" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="389" x2="387.5" y1="236" y2="257" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="387.5" x2="386" y1="257" y2="278" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="345.00056300438" x2="363.88396358899" y1="296.20780962064" y2="286.51637891593" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="363.88396358899" x2="382.7673641736" y1="286.51637891593" y2="276.82494821122" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 300,250 341,301 350,292" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="446.77397788651" x2="446.30130202707" y1="409.36325919807" y2="390.29236385588" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="446.30130202707" x2="445.82862616763" y1="390.29236385588" y2="371.22146851369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="522.73929084324" x2="505.26919107835" y1="372.53235623054" y2="360.69025036538" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="505.26919107835" x2="487.79909131347" y1="360.69025036538" y2="348.84814450022" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="528.82420474042" x2="509.83366429434" y1="288.32987862998" y2="297.53917995806" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="509.83366429434" x2="490.84312384826" y1="297.53917995806" y2="306.74848128614" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="531.86508610281" x2="514.39498633793" y1="246.2302154159" y2="234.38810955074" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="514.39498633793" x2="496.92488657304" y1="234.38810955074" y2="222.54600368558" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="537.95" x2="518.95945955392" y1="162.02773781534" y2="171.23546355722" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="518.95945955392" x2="499.96891910784" y1="171.23546355722" y2="180.4431892991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="468.06960094046" x2="470.3935905827" y1="114.65616318231" y2="137.30363919426" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="470.3935905827" x2="472.71758022495" y1="137.30363919426" y2="159.9511152062" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 335,207 301,181 295,193" fill-opacity="1"  style="fill:#000000" />
<line x1="261.38420346953" x2="279.25922888734" y1="209.13146279469" y2="197.91013789159" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="279.25922888734" x2="297.13425430514" y1="197.91013789159" y2="186.6888129885" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="261.38420346953" x2="260.3978865095" y1="209.13146279469" y2="235.79195685328" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="260.3978865095" x2="259.41156954947" y1="235.79195685328" y2="262.45245091186" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 262,210 229,183 222,194" fill-opacity="1"  style="fill:#000000" />
<line x1="188.27385270382" x2="206.55222818835" y1="209.13146279469" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="206.55222818835" x2="224.83060367287" y1="198.5781864396" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="191" x2="191" y1="252" y2="231" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="191" x2="191" y1="231" y2="210" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="186" x2="186" y1="252" y2="231" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="186" x2="186" y1="231" y2="210" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="151.71710173477" x2="169.99547721929" y1="188.02491008451" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="169.99547721929" x2="188.27385270382" y1="198.5781864396" y2="209.13146279469" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="117" x2="135" y1="212" y2="201.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="135" x2="153" y1="201.5" y2="191" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="115" x2="133" y1="208" y2="197.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="133" x2="151" y1="197.5" y2="187" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="78.603599796658" x2="96.883550867383" y1="188.02491008451" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="96.883550867383" x2="115.16350193811" y1="198.5781864396" y2="209.13146279469" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="77" x2="77" y1="146" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="77" x2="77" y1="167.5" y2="189" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="81" x2="81" y1="146" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="81" x2="81" y1="167.5" y2="189" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="115.16350193811" x2="96.883550867383" y1="124.70840312639" y2="135.26167948148" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="96.883550867383" x2="78.603599796658" y1="135.26167948148" y2="145.81495583656" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="153" x2="135" y1="144" y2="133.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="135" x2="117" y1="133.5" y2="123" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="151" x2="133" y1="148" y2="137.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="133" x2="115" y1="137.5" y2="127" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="151.71710173477" x2="151.71710173477" y1="145.81495583656" y2="166.91993296054" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="151.71710173477" x2="151.71710173477" y1="166.91993296054" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="115.16350193811" x2="115.16350193811" y1="82.498448878439" y2="103.60342600241" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="115.16350193811" x2="115.16350193811" y1="103.60342600241" y2="124.70840312639" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="42.05" x2="60.326799898329" y1="124.70840312639" y2="135.26167948148" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="60.326799898329" x2="78.603599796658" y1="135.26167948148" y2="145.81495583656" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="42.05" x2="60.326799898329" y1="209.13146279469" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="60.326799898329" x2="78.603599796658" y1="198.5781864396" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 341,260 364,295 374,286" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="375.40937662833" x2="371.84697623435" y1="331.00305522018" y2="310.63545243693" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="371.84697623435" x2="368.28457584038" y1="310.63545243693" y2="290.26784965368" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="375.40937662833" x2="364.09509213954" y1="331.00305522018" y2="349.07502891275" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="364.09509213954" x2="352.78080765076" y1="349.07502891275" y2="367.14700260533" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="420" x2="398" y1="340" y2="334.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="398" x2="376" y1="334.5" y2="329" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="418" x2="396.5" y1="344" y2="339" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="396.5" x2="375" y1="339" y2="334" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="149.03860519794" x2="169.72132522082" y1="418.9491256275" y2="414.74703723708" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="169.72132522082" x2="190.40404524369" y1="414.74703723708" y2="410.54494884667" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="209.40246362077" x2="213.88500635445" y1="483.40950816547" y2="462.78508483192" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="213.88500635445" x2="218.36754908814" y1="462.78508483192" y2="442.16066149838" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="284.75644913262" x2="291.83555792082" y1="369.99566245155" y2="391.74662991676" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="291.83555792082" x2="298.91466670903" y1="391.74662991676" y2="413.49759738197" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<line x1="284.75644913262" x2="301.05431276609" y1="369.99566245155" y2="356.77491866302" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="301.05431276609" x2="317.35217639957" y1="356.77491866302" y2="343.5541748745" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 299,414 266,425 273,437" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="340.10364110059" x2="337.28019063354" y1="497.50155112156" y2="476.58721992756" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" />
<line x1="337.28019063354" x2="334.45674016649" y1="476.58721992756" y2="455.67288873356" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" />
<polygon points=" 377,449 395,488 406,480" fill-opacity="1"  style="fill:#000000" />
<polygon points=" 437,338 463,376 473,367" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 443,300 485,283 478,272" fill-opacity="1"  style="fill:#000000" />
<ellipse cx="379.58783122577" cy="306.190723772" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="379.58783122577" y="316.41445987631"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="416.62356039906" cy="378.96074791892" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.62356039906" y="389.18448402322"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="277.10540255449" cy="461.84603545784" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="277.10540255449" y="472.06977156214"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="186.98187202135" cy="344.87766728093" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="186.98187202135" y="355.10140338523"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="232.97008197242" cy="295.35069072886" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.97008197242" y="305.57442683316"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="392.10743915613" cy="151.48706614984" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="392.10743915613" y="161.71080225414"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="460.91643960094" cy="155.05104213001" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="460.91643960094" y="165.27477823431"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="386.02252525894" cy="235.6895437504" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="386.02252525894" y="245.9132798547"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="345.00056300438" cy="296.20780962064" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="345.00056300438" y="306.43154572494"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="446.77397788651" cy="409.36325919807" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="446.77397788651" y="419.58699530237"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="522.73929084324" cy="372.53235623054" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="522.73929084324" y="382.75609233484"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="528.82420474042" cy="288.32987862998" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="528.82420474042" y="298.55361473428"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="531.86508610281" cy="246.2302154159" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="531.86508610281" y="256.4539515202"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="537.95" cy="162.02773781534" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="172.25147391964"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="468.06960094046" cy="114.65616318231" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="468.06960094046" y="124.87989928661"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="297.13425430514" cy="186.6888129885" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.13425430514" y="196.9125490928"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="224.83060367287" cy="188.02491008451" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="224.83060367287" y="198.24864618882"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="188.27385270382" cy="251.34141704264" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="188.27385270382" y="261.56515314694"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="115.16350193811" cy="82.498448878439" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="115.16350193811" y="92.722184982742"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="42.05" cy="124.70840312639" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="134.93213923069"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="42.05" cy="209.13146279469" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="219.35519889899"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="368.28457584038" cy="290.26784965368" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="368.28457584038" y="300.49158575799"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="418.5268685264" cy="341.70758785029" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="418.5268685264" y="351.93132395459"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="149.03860519794" cy="418.9491256275" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="149.03860519794" y="429.1728617318"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="209.40246362077" cy="483.40950816547" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.40246362077" y="493.63324426977"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="284.75644913262" cy="369.99566245155" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="284.75644913262" y="380.21939855585"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="268.95331956536" cy="430.58010294211" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="268.95331956536" y="440.80383904641"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="340.10364110059" cy="497.50155112156" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.10364110059" y="507.72528722586"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="400.07675414628" cy="483.65845078477" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.07675414628" y="493.88218688908"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="467.33222659973" cy="370.91265361886" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.33222659973" y="381.13638972316"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
<ellipse cx="481.28246679799" cy="276.8407040732" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="481.28246679799" y="287.06444017751"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:23.235763873415px">O</text>
</g></svg>

✍: FYIcenter.com

2021-08-01, 208👍, 0💬