Collections:
Molecule FYI-1000462
Molecule Summary:
ID: FYI-1000462
SMILES: C1[C@@H]([C@H](C2(O1)C3[C@@]45C[C@@](O2)([C@]6([C@@]([C@@H]4C7=C(O6)C(=C(C=C7C(=O)O[C@@H]8[C@@H]9[C@@H]([C@@H](COC(=O)C1=CC(=C(C(=C1C1=C(C(=C(C=C1C(=O)O9)O)O)O)O)O)O)O[C@H]8OC(=O)C1=CC(=C(C(=C1)O)O)O)OC5=O)O)O)(O3)O)O)O)O)O
Received at FYIcenter.com on: 2021-07-14
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000462 FYIcenter.com 77 88 0 0 1 0 0 0 0 0999 V2000 11.5911 6.0611 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.7224 6.8806 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5092 8.0986 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.0899 8.4938 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7115 7.0987 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.7365 8.2844 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.8608 9.0331 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8804 10.2614 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.6014 11.6275 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8868 9.4080 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.2793 11.8424 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1514 10.5040 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.5215 10.3047 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3632 9.7359 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.6655 10.8601 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.4593 12.0383 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.5953 11.4136 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7079 10.4103 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.1332 9.1400 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.5183 9.2839 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.9172 8.0867 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.5993 8.3264 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.0587 6.7547 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.8978 5.7107 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1682 5.2859 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.4666 5.6156 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2789 3.9327 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.9035 2.7738 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.1088 2.1893 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.0368 2.9022 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2924 2.3024 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.1211 4.2770 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.5160 2.9787 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6669 2.4579 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.5317 3.1082 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.4351 4.4443 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.2298 5.0286 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0990 6.2998 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2421 7.1164 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.1455 8.4524 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.8136 9.1624 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8476 8.3525 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.8845 7.0091 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.8124 6.1668 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9157 4.8614 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.6139 6.7819 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8436 10.3728 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.2543 9.2040 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.4474 6.5319 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.5439 5.1959 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 15.7370 2.5238 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.5194 1.0205 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.0949 3.3064 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.9604 4.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 5.8004 3.3488 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 4.6403 4.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6403 5.3581 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.4802 3.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3202 4.0186 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1600 3.3488 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.1600 2.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3202 1.3395 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.4802 2.0093 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.3202 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 1.3395 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 4.0186 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.3528 6.5934 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.5789 7.8861 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 11.9472 8.2258 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.3952 10.6770 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.3108 12.7226 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.7021 9.1235 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 7.2006 11.0461 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.4585 13.1698 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 11.3617 12.7305 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.4960 9.1526 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 13.9387 6.1673 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 1 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 5 1 1 0 0 0 0 6 4 1 0 0 0 0 7 6 1 0 0 0 0 7 8 1 6 0 0 0 9 8 1 0 0 0 0 10 9 1 0 0 0 0 10 4 1 0 0 0 0 11 9 1 0 0 0 0 12 11 1 0 0 0 0 13 12 1 0 0 0 0 13 7 1 0 0 0 0 13 14 1 6 0 0 0 15 14 2 0 0 0 0 16 15 1 0 0 0 0 11 16 1 1 0 0 0 17 15 1 0 0 0 0 18 17 2 0 0 0 0 19 18 1 0 0 0 0 20 19 2 0 0 0 0 20 14 1 0 0 0 0 21 20 1 0 0 0 0 22 21 2 0 0 0 0 23 21 1 0 0 0 0 24 23 1 6 0 0 0 25 24 1 0 0 0 0 26 25 1 0 0 0 0 27 26 1 0 0 0 0 28 27 1 0 0 0 0 29 28 1 0 0 0 0 30 29 1 0 0 0 0 31 30 2 0 0 0 0 32 30 1 0 0 0 0 33 32 2 0 0 0 0 34 33 1 0 0 0 0 35 34 2 0 0 0 0 36 35 1 0 0 0 0 37 36 2 0 0 0 0 37 32 1 0 0 0 0 38 37 1 0 0 0 0 39 38 2 0 0 0 0 40 39 1 0 0 0 0 41 40 2 0 0 0 0 42 41 1 0 0 0 0 43 42 2 0 0 0 0 43 38 1 0 0 0 0 44 43 1 0 0 0 0 45 44 2 0 0 0 0 46 44 1 0 0 0 0 25 46 1 6 0 0 0 47 41 1 0 0 0 0 48 40 1 0 0 0 0 49 39 1 0 0 0 0 50 36 1 0 0 0 0 51 35 1 0 0 0 0 52 34 1 0 0 0 0 27 53 1 1 0 0 0 54 53 1 0 0 0 0 54 24 1 0 0 0 0 54 55 1 1 0 0 0 56 55 1 0 0 0 0 57 56 2 0 0 0 0 58 56 1 0 0 0 0 59 58 2 0 0 0 0 60 59 1 0 0 0 0 61 60 2 0 0 0 0 62 61 1 0 0 0 0 63 62 2 0 0 0 0 63 58 1 0 0 0 0 64 62 1 0 0 0 0 65 61 1 0 0 0 0 66 60 1 0 0 0 0 26 67 1 6 0 0 0 68 67 1 0 0 0 0 68 7 1 0 0 0 0 69 68 2 0 0 0 0 70 18 1 0 0 0 0 71 17 1 0 0 0 0 72 12 1 0 0 0 0 72 6 1 0 0 0 0 12 73 1 6 0 0 0 74 11 1 0 0 0 0 9 75 1 1 0 0 0 3 76 1 6 0 0 0 2 77 1 1 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="442.95475694224" x2="425.13015028277" y1="299.31801677575" y2="286.40608788206" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="425.13015028277" x2="407.30554362331" y1="286.40608788206" y2="273.49415898837" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="436.2364573934" x2="439.59560716782" y1="337.69929656224" y2="318.508656669" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="439.59560716782" x2="442.95475694224" y1="318.508656669" y2="299.31801677575" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="391.51186757324" x2="413.87416248332" y1="350.15272987228" y2="343.92601321726" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="413.87416248332" x2="436.2364573934" y1="343.92601321726" y2="337.69929656224" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="379.58783122577" x2="385.5498493995" y1="306.190723772" y2="328.17172682214" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="385.5498493995" x2="391.51186757324" y1="328.17172682214" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="379.58783122577" x2="393.44668742454" y1="306.190723772" y2="289.84244138019" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="393.44668742454" x2="407.30554362331" y1="289.84244138019" y2="273.49415898837" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="317.35217639957" x2="354.4320219864" y1="343.5541748745" y2="346.85345237339" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="354.4320219864" x2="391.51186757324" y1="346.85345237339" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="352.78080765076" x2="335.06649202516" y1="367.14700260533" y2="355.35058873991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="335.06649202516" x2="317.35217639957" y1="355.35058873991" y2="343.5541748745" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 353,368 380,411 391,402" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="376.11839041749" x2="380.51427591028" y1="448.90101925399" y2="427.37693620131" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="380.51427591028" x2="384.91016140306" y1="427.37693620131" y2="405.85285314863" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="416.62356039906" x2="396.37097540827" y1="378.96074791892" y2="413.93088358645" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="396.37097540827" x2="376.11839041749" y1="413.93088358645" y2="448.90101925399" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="416.62356039906" x2="404.06771398615" y1="378.96074791892" y2="364.5567388956" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="404.06771398615" x2="391.51186757324" y1="364.5567388956" y2="350.15272987228" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="334.45674016649" x2="355.28756529199" y1="455.67288873356" y2="452.28695399377" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="355.28756529199" x2="376.11839041749" y1="452.28695399377" y2="448.90101925399" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="298.91466670903" x2="316.68570343776" y1="413.49759738197" y2="434.58524305776" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="316.68570343776" x2="334.45674016649" y1="434.58524305776" y2="455.67288873356" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="342.08887971024" x2="320.50177320963" y1="407.21731079621" y2="410.35745408909" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="320.50177320963" x2="298.91466670903" y1="410.35745408909" y2="413.49759738197" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="342.08887971024" x2="347.4348436805" y1="407.21731079621" y2="387.18215670077" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="347.4348436805" x2="352.78080765076" y1="387.18215670077" y2="367.14700260533" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 343,408 276,383 273,396" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="255" x2="266" y1="426" y2="408.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="266" x2="277" y1="408.5" y2="391" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="251" x2="262" y1="424" y2="406.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="262" x2="273" y1="406.5" y2="389" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="277.10540255449" x2="264.59839931372" y1="461.84603545784" y2="443.28247887145" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="264.59839931372" x2="252.09139607295" y1="443.28247887145" y2="424.71892228506" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 335,456 277,456 278,469" fill-opacity="1" style="fill:#000000" /> <line x1="218.36754908814" x2="235.22947258054" y1="442.16066149838" y2="433.43979189172" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="235.22947258054" x2="252.09139607295" y1="433.43979189172" y2="424.71892228506" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="189" x2="203" y1="413" y2="428.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="203" x2="217" y1="428.5" y2="444" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="193" x2="207" y1="410" y2="425.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="207" x2="221" y1="425.5" y2="441" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="203.805981445" x2="197.10501334435" y1="370.51560589693" y2="390.5302773718" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="197.10501334435" x2="190.40404524369" y1="390.5302773718" y2="410.54494884667" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="248" x2="226.5" y1="373" y2="371" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="226.5" x2="205" y1="371" y2="369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="248" x2="226" y1="378" y2="375.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="226" x2="204" y1="375.5" y2="373" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="247.45287030565" x2="260.76499809366" y1="375.05014297515" y2="382.17179259071" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="260.76499809366" x2="274.07712588168" y1="382.17179259071" y2="389.29344220627" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="228.51117303171" x2="237.98202166868" y1="337.32430704709" y2="356.18722501112" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="237.98202166868" x2="247.45287030565" y1="356.18722501112" y2="375.05014297515" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="188" x2="208.5" y1="348" y2="344" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="208.5" x2="229" y1="344" y2="340" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="187" x2="208" y1="343" y2="339.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="208" x2="229" y1="339.5" y2="336" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="232.97008197242" x2="230.74062750207" y1="295.35069072886" y2="316.33749888797" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="230.74062750207" x2="228.51117303171" y1="316.33749888797" y2="337.32430704709" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 260,263 228,292 239,300" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="299.4440636716" x2="279.42781661054" y1="249.06627057254" y2="255.7593607422" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="279.42781661054" x2="259.41156954947" y1="255.7593607422" y2="262.45245091186" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="340.35888606469" x2="319.90147486815" y1="259.45568596302" y2="254.26097826778" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="319.90147486815" x2="299.4440636716" y1="254.26097826778" y2="249.06627057254" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="334.4441354769" x2="337.40151077079" y1="206.4246057063" y2="232.94014583466" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="337.40151077079" x2="340.35888606469" y1="232.94014583466" y2="259.45568596302" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="354.12635826396" x2="344.28524687043" y1="169.905668806" y2="188.16513725615" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="344.28524687043" x2="334.4441354769" y1="188.16513725615" y2="206.4246057063" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="392.10743915613" x2="373.11689871005" y1="151.48706614984" y2="160.69636747792" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="373.11689871005" x2="354.12635826396" y1="160.69636747792" y2="169.905668806" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="421.35031899345" x2="406.72887907479" y1="173.9517741628" y2="162.71942015632" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="406.72887907479" x2="392.10743915613" y1="162.71942015632" y2="151.48706614984" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="460" x2="440.5" y1="153" y2="162.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="440.5" x2="421" y1="162.5" y2="172" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="462" x2="442.5" y1="158" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="442.5" x2="423" y1="167.5" y2="177" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="424.00675732351" x2="422.67853815848" y1="217.27409226663" y2="195.61293321472" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="422.67853815848" x2="421.35031899345" y1="195.61293321472" y2="173.9517741628" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="435" x2="428.5" y1="176" y2="196.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="428.5" x2="422" y1="196.5" y2="217" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="439" x2="433" y1="178" y2="198" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="433" x2="427" y1="198" y2="218" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="472.71758022495" x2="454.58415867065" y1="159.9511152062" y2="168.15676812607" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="454.58415867065" x2="436.45073711635" y1="168.15676812607" y2="176.36242104594" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="502" x2="488.5" y1="179" y2="169" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="488.5" x2="475" y1="169" y2="159" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="499" x2="485.5" y1="183" y2="172.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="485.5" x2="472" y1="172.5" y2="162" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="496.92488657304" x2="498.44690284044" y1="222.54600368558" y2="201.49459649234" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="498.44690284044" x2="499.96891910784" y1="201.49459649234" y2="180.4431892991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="460" x2="479" y1="244" y2="234.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="479" x2="498" y1="234.5" y2="225" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="458" x2="477" y1="239" y2="230" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="477" x2="496" y1="230" y2="221" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="458.94380568088" x2="441.47528150219" y1="240.95830399695" y2="229.11619813179" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="441.47528150219" x2="424.00675732351" y1="229.11619813179" y2="217.27409226663" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="454.82207218657" x2="456.88293893372" y1="281.01600749825" y2="260.9871557476" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="456.88293893372" x2="458.94380568088" y1="260.9871557476" y2="240.95830399695" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="493" x2="475" y1="305" y2="292.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="475" x2="457" y1="292.5" y2="280" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="490" x2="472" y1="309" y2="296" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="472" x2="454" y1="296" y2="283" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="487.79909131347" x2="489.32110758086" y1="348.84814450022" y2="327.79831289318" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="489.32110758086" x2="490.84312384826" y1="327.79831289318" y2="306.74848128614" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="447" x2="468" y1="374" y2="362.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="468" x2="489" y1="362.5" y2="351" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="445" x2="466" y1="370" y2="358.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="466" x2="487" y1="358.5" y2="347" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="415.38830081972" x2="430.60846349368" y1="345.70012327636" y2="358.46079589502" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="430.60846349368" x2="445.82862616763" y1="358.46079589502" y2="371.22146851369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="415" x2="414.5" y1="304" y2="325" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="414.5" x2="414" y1="325" y2="346" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="419" x2="418.5" y1="304" y2="325" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="418.5" x2="418" y1="325" y2="346" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="416.55108343395" x2="435.68657781026" y1="303.36727330495" y2="292.1916404016" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="435.68657781026" x2="454.82207218657" y1="292.1916404016" y2="281.01600749825" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="382.7673641736" x2="399.65922380377" y1="276.82494821122" y2="290.09611075809" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="399.65922380377" x2="416.55108343395" y1="290.09611075809" y2="303.36727330495" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="384" x2="382.5" y1="236" y2="256.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="382.5" x2="381" y1="256.5" y2="277" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="389" x2="387.5" y1="236" y2="257" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="387.5" x2="386" y1="257" y2="278" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="345.00056300438" x2="363.88396358899" y1="296.20780962064" y2="286.51637891593" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="363.88396358899" x2="382.7673641736" y1="286.51637891593" y2="276.82494821122" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 300,250 341,301 350,292" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="446.77397788651" x2="446.30130202707" y1="409.36325919807" y2="390.29236385588" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="446.30130202707" x2="445.82862616763" y1="390.29236385588" y2="371.22146851369" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="522.73929084324" x2="505.26919107835" y1="372.53235623054" y2="360.69025036538" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="505.26919107835" x2="487.79909131347" y1="360.69025036538" y2="348.84814450022" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="528.82420474042" x2="509.83366429434" y1="288.32987862998" y2="297.53917995806" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="509.83366429434" x2="490.84312384826" y1="297.53917995806" y2="306.74848128614" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="531.86508610281" x2="514.39498633793" y1="246.2302154159" y2="234.38810955074" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="514.39498633793" x2="496.92488657304" y1="234.38810955074" y2="222.54600368558" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="537.95" x2="518.95945955392" y1="162.02773781534" y2="171.23546355722" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="518.95945955392" x2="499.96891910784" y1="171.23546355722" y2="180.4431892991" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="468.06960094046" x2="470.3935905827" y1="114.65616318231" y2="137.30363919426" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="470.3935905827" x2="472.71758022495" y1="137.30363919426" y2="159.9511152062" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 335,207 301,181 295,193" fill-opacity="1" style="fill:#000000" /> <line x1="261.38420346953" x2="279.25922888734" y1="209.13146279469" y2="197.91013789159" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="279.25922888734" x2="297.13425430514" y1="197.91013789159" y2="186.6888129885" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="261.38420346953" x2="260.3978865095" y1="209.13146279469" y2="235.79195685328" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="260.3978865095" x2="259.41156954947" y1="235.79195685328" y2="262.45245091186" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 262,210 229,183 222,194" fill-opacity="1" style="fill:#000000" /> <line x1="188.27385270382" x2="206.55222818835" y1="209.13146279469" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="206.55222818835" x2="224.83060367287" y1="198.5781864396" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="191" x2="191" y1="252" y2="231" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="191" x2="191" y1="231" y2="210" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="186" x2="186" y1="252" y2="231" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="186" x2="186" y1="231" y2="210" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="151.71710173477" x2="169.99547721929" y1="188.02491008451" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="169.99547721929" x2="188.27385270382" y1="198.5781864396" y2="209.13146279469" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="117" x2="135" y1="212" y2="201.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="135" x2="153" y1="201.5" y2="191" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="115" x2="133" y1="208" y2="197.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="133" x2="151" y1="197.5" y2="187" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="78.603599796658" x2="96.883550867383" y1="188.02491008451" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="96.883550867383" x2="115.16350193811" y1="198.5781864396" y2="209.13146279469" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="77" x2="77" y1="146" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="77" x2="77" y1="167.5" y2="189" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="81" x2="81" y1="146" y2="167.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="81" x2="81" y1="167.5" y2="189" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="115.16350193811" x2="96.883550867383" y1="124.70840312639" y2="135.26167948148" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="96.883550867383" x2="78.603599796658" y1="135.26167948148" y2="145.81495583656" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="153" x2="135" y1="144" y2="133.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="135" x2="117" y1="133.5" y2="123" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="151" x2="133" y1="148" y2="137.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="133" x2="115" y1="137.5" y2="127" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="151.71710173477" x2="151.71710173477" y1="145.81495583656" y2="166.91993296054" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="151.71710173477" x2="151.71710173477" y1="166.91993296054" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="115.16350193811" x2="115.16350193811" y1="82.498448878439" y2="103.60342600241" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="115.16350193811" x2="115.16350193811" y1="103.60342600241" y2="124.70840312639" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="42.05" x2="60.326799898329" y1="124.70840312639" y2="135.26167948148" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="60.326799898329" x2="78.603599796658" y1="135.26167948148" y2="145.81495583656" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="42.05" x2="60.326799898329" y1="209.13146279469" y2="198.5781864396" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="60.326799898329" x2="78.603599796658" y1="198.5781864396" y2="188.02491008451" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 341,260 364,295 374,286" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="375.40937662833" x2="371.84697623435" y1="331.00305522018" y2="310.63545243693" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="371.84697623435" x2="368.28457584038" y1="310.63545243693" y2="290.26784965368" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="375.40937662833" x2="364.09509213954" y1="331.00305522018" y2="349.07502891275" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="364.09509213954" x2="352.78080765076" y1="349.07502891275" y2="367.14700260533" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="420" x2="398" y1="340" y2="334.5" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="398" x2="376" y1="334.5" y2="329" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="418" x2="396.5" y1="344" y2="339" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="396.5" x2="375" y1="339" y2="334" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="149.03860519794" x2="169.72132522082" y1="418.9491256275" y2="414.74703723708" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="169.72132522082" x2="190.40404524369" y1="414.74703723708" y2="410.54494884667" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="209.40246362077" x2="213.88500635445" y1="483.40950816547" y2="462.78508483192" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="213.88500635445" x2="218.36754908814" y1="462.78508483192" y2="442.16066149838" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="284.75644913262" x2="291.83555792082" y1="369.99566245155" y2="391.74662991676" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="291.83555792082" x2="298.91466670903" y1="391.74662991676" y2="413.49759738197" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <line x1="284.75644913262" x2="301.05431276609" y1="369.99566245155" y2="356.77491866302" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="301.05431276609" x2="317.35217639957" y1="356.77491866302" y2="343.5541748745" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 299,414 266,425 273,437" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="340.10364110059" x2="337.28019063354" y1="497.50155112156" y2="476.58721992756" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #ff0000" /> <line x1="337.28019063354" x2="334.45674016649" y1="476.58721992756" y2="455.67288873356" style="stroke-opacity:1; stroke-width: 1.8588611098732; stroke: #000000" /> <polygon points=" 377,449 395,488 406,480" fill-opacity="1" style="fill:#000000" /> <polygon points=" 437,338 463,376 473,367" fill-opacity="1" style="fill:none;stroke:#000000;" /> <polygon points=" 443,300 485,283 478,272" fill-opacity="1" style="fill:#000000" /> <ellipse cx="379.58783122577" cy="306.190723772" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="379.58783122577" y="316.41445987631" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="416.62356039906" cy="378.96074791892" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="416.62356039906" y="389.18448402322" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="277.10540255449" cy="461.84603545784" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="277.10540255449" y="472.06977156214" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="186.98187202135" cy="344.87766728093" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="186.98187202135" y="355.10140338523" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="232.97008197242" cy="295.35069072886" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="232.97008197242" y="305.57442683316" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="392.10743915613" cy="151.48706614984" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="392.10743915613" y="161.71080225414" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="460.91643960094" cy="155.05104213001" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="460.91643960094" y="165.27477823431" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="386.02252525894" cy="235.6895437504" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="386.02252525894" y="245.9132798547" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="345.00056300438" cy="296.20780962064" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="345.00056300438" y="306.43154572494" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="446.77397788651" cy="409.36325919807" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="446.77397788651" y="419.58699530237" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="522.73929084324" cy="372.53235623054" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="522.73929084324" y="382.75609233484" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="528.82420474042" cy="288.32987862998" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="528.82420474042" y="298.55361473428" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="531.86508610281" cy="246.2302154159" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="531.86508610281" y="256.4539515202" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="537.95" cy="162.02773781534" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="537.95" y="172.25147391964" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="468.06960094046" cy="114.65616318231" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="468.06960094046" y="124.87989928661" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="297.13425430514" cy="186.6888129885" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="297.13425430514" y="196.9125490928" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="224.83060367287" cy="188.02491008451" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="224.83060367287" y="198.24864618882" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="188.27385270382" cy="251.34141704264" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="188.27385270382" y="261.56515314694" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="115.16350193811" cy="82.498448878439" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="115.16350193811" y="92.722184982742" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="42.05" cy="124.70840312639" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="134.93213923069" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="42.05" cy="209.13146279469" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="42.05" y="219.35519889899" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="368.28457584038" cy="290.26784965368" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="368.28457584038" y="300.49158575799" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="418.5268685264" cy="341.70758785029" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="418.5268685264" y="351.93132395459" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="149.03860519794" cy="418.9491256275" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="149.03860519794" y="429.1728617318" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="209.40246362077" cy="483.40950816547" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.40246362077" y="493.63324426977" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="284.75644913262" cy="369.99566245155" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="284.75644913262" y="380.21939855585" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="268.95331956536" cy="430.58010294211" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="268.95331956536" y="440.80383904641" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="340.10364110059" cy="497.50155112156" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="340.10364110059" y="507.72528722586" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="400.07675414628" cy="483.65845078477" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.07675414628" y="493.88218688908" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="467.33222659973" cy="370.91265361886" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="467.33222659973" y="381.13638972316" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> <ellipse cx="481.28246679799" cy="276.8407040732" rx="12.082597214176" ry="12.082597214176" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="481.28246679799" y="287.06444017751" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:23.235763873415px">O</text> </g></svg>
✍: FYIcenter.com
2021-08-01, 257👍, 0💬
Popular Posts:
biotech.FYIcenter.com is a Website for biotech professionals looking for biotech resources, software...
Where to find FAQ (Frequently Asked Questions) on molecule online tools? I want to use them to creat...
What Is Tanimoto coefficient? Tanimoto coefficient is a metric (or score) to measure the similarity ...
How many command line tools are provided in the Open Babel package? By default, Open Babel package p...
Right/Left Hand Stereo Centers? In chemstry study, a stereo center a labeled as R (Rectus, Right in ...