Molecule FYI-1000463


Molecule Summary:

ID: FYI-1000463
SMILES: c12c([C@H]([C@@H]([C@H](O1)c1ccc(c(c1)O)O)O)c1c3c([C@@H]([C@@H]([C@H](O3)c3ccc(c(c3)O)O)O)c3c4c(C[C@H]([C@H](O4)c4ccc(c(c4)O)O)O)c(cc3O)O)c(cc1O)O)c(cc(c2)O)O

Received at on: 2021-07-16

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 63 71  0  0  1  0  0  0  0  0999 V2000
   12.2181    8.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7745    8.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7745    9.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964   10.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2181    9.8758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964   11.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7745   12.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.7745   14.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964   14.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2181   14.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2181   12.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4399   14.8137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964   16.2245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5527   10.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.5527    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    8.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8873    8.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8873    9.8758    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090   10.5812    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    9.8758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090   11.9920    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309   12.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309   14.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090   14.8137    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8873   14.1083    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8873   12.6974    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655   14.8137    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090   16.2245    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655   10.5812    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    5.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    4.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655    3.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.8873    4.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.7019    5.6523    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090    3.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    4.2325    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5527    3.5271    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5527    2.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    1.4108    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090    2.1162    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    0.0000    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    9.7745    1.4108    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.6655    2.1162    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    1.2218    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    1.2218    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    8.4650    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    2.4437    9.8758    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    0.0000    5.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.1090    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.3309    5.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    8.5527    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    9.6107    5.7088    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    5.2210    5.6273    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.9964    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   12.2181    5.6433    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4399    6.3487    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   13.4399    7.7596    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
   14.6617    5.6433    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
   10.1020    5.5124    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
  2  1  2  0  0  0  0
  3  2  1  0  0  0  0
  4  3  1  0  0  0  0
  5  4  1  0  0  0  0
  6  5  1  0  0  0  0
  6  1  1  0  0  0  0
  5  7  1  1  0  0  0
  8  7  2  0  0  0  0
  9  8  1  0  0  0  0
 10  9  2  0  0  0  0
 11 10  1  0  0  0  0
 12 11  2  0  0  0  0
 12  7  1  0  0  0  0
 13 11  1  0  0  0  0
 14 10  1  0  0  0  0
  4 15  1  6  0  0  0
  3 16  1  1  0  0  0
 17 16  2  0  0  0  0
 18 17  1  0  0  0  0
 19 18  1  0  0  0  0
 20 19  1  0  0  0  0
 21 20  1  0  0  0  0
 22 21  1  0  0  0  0
 22 17  1  0  0  0  0
 21 23  1  1  0  0  0
 24 23  2  0  0  0  0
 25 24  1  0  0  0  0
 26 25  2  0  0  0  0
 27 26  1  0  0  0  0
 28 27  2  0  0  0  0
 28 23  1  0  0  0  0
 29 27  1  0  0  0  0
 30 26  1  0  0  0  0
 20 31  1  6  0  0  0
 19 32  1  6  0  0  0
 33 32  2  0  0  0  0
 34 33  1  0  0  0  0
 35 34  1  0  0  0  0
 36 35  1  0  0  0  0
 37 36  1  0  0  0  0
 38 37  1  0  0  0  0
 38 33  1  0  0  0  0
 37 39  1  6  0  0  0
 40 39  2  0  0  0  0
 41 40  1  0  0  0  0
 42 41  2  0  0  0  0
 43 42  1  0  0  0  0
 44 43  2  0  0  0  0
 44 39  1  0  0  0  0
 45 43  1  0  0  0  0
 46 42  1  0  0  0  0
 36 47  1  6  0  0  0
 48 34  2  0  0  0  0
 49 48  1  0  0  0  0
 50 49  2  0  0  0  0
 50 32  1  0  0  0  0
 51 50  1  0  0  0  0
 52 48  1  0  0  0  0
 53 18  2  0  0  0  0
 54 53  1  0  0  0  0
 55 54  2  0  0  0  0
 55 16  1  0  0  0  0
 56 55  1  0  0  0  0
 57 53  1  0  0  0  0
 58  2  1  0  0  0  0
 59 58  2  0  0  0  0
 60 59  1  0  0  0  0
 61 60  2  0  0  0  0
 61  1  1  0  0  0  0
 62 60  1  0  0  0  0
 63 58  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="401" x2="420" y1="282" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="420" x2="439" y1="292.5" y2="303" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="404" x2="422.5" y1="278" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="422.5" x2="441" y1="288.5" y2="299" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="383.36350211101" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="383.36350211101" x2="402.0371194798" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="364.68988474221" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="364.68988474221" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="402.0371194798" x2="383.36350211101" y1="365.46317636907" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="383.36350211101" x2="364.68988474221" y1="354.68294092268" y2="343.90270547629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="439.3782412401" x2="420.70768035995" y1="343.90270547629" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="420.70768035995" x2="402.0371194798" y1="354.68294092268" y2="365.46317636907" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="439.3782412401" x2="439.3782412401" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="439.3782412401" x2="439.3782412401" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 403,366 396,409 409,409" fill-opacity="1"  style="fill:#000000" />
<line x1="366" x2="385" y1="433" y2="422" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="385" x2="404" y1="422" y2="411" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364" x2="382.5" y1="429" y2="418" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="382.5" x2="401" y1="418" y2="407" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="364.68988474221" y1="473.26858732164" y2="451.70658818454" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="364.68988474221" y1="451.70658818454" y2="430.14458904743" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="404" x2="385" y1="493" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="385" x2="366" y1="482.5" y2="472" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="401" x2="382.5" y1="497" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="382.5" x2="364" y1="486.5" y2="476" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="439.3782412401" x2="420.70768035995" y1="473.26858732164" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="420.70768035995" x2="402.0371194798" y1="484.04882276804" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="438" x2="438" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="438" x2="438" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="442" x2="442" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="442" x2="442" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="439.3782412401" x2="420.70768035995" y1="430.14458904743" y2="419.36435360104" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="420.70768035995" x2="402.0371194798" y1="419.36435360104" y2="408.58411815464" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="476.72241948904" x2="458.05033036457" y1="494.82905821443" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="458.05033036457" x2="439.3782412401" y1="484.04882276804" y2="473.26858732164" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="402.0371194798" x2="402.0371194798" y1="537.95" y2="516.38952910721" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="402.0371194798" x2="402.0371194798" y1="516.38952910721" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 365,344 325,360 331,372" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 365,301 331,274 325,285" fill-opacity="1"  style="fill:#000000" />
<line x1="292" x2="310.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="310.5" x2="329" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="289" x2="308" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="308" x2="327" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252.65429350673" x2="271.32791087553" y1="279.22129279793" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="271.32791087553" x2="290.00152824432" y1="290.00152824432" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="233.98373262658" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="233.98373262658" x2="252.65429350673" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="215.31317174643" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="215.31317174643" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252.65429350673" x2="233.98373262658" y1="365.46317636907" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="233.98373262658" x2="215.31317174643" y1="354.68294092268" y2="343.90270547629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="271.32791087553" y1="343.90270547629" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="271.32791087553" x2="252.65429350673" y1="354.68294092268" y2="365.46317636907" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="290.00152824432" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="290.00152824432" x2="290.00152824432" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 253,366 247,409 260,409" fill-opacity="1"  style="fill:#000000" />
<line x1="292" x2="273" y1="429" y2="418" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="273" x2="254" y1="418" y2="407" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="289" x2="270.5" y1="433" y2="422" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="270.5" x2="252" y1="422" y2="411" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="290.00152824432" y1="473.26858732164" y2="451.70658818454" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="290.00152824432" y1="451.70658818454" y2="430.14458904743" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="254" x2="273" y1="497" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="273" x2="292" y1="486.5" y2="476" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252" x2="270.5" y1="493" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="270.5" x2="289" y1="482.5" y2="472" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="233.98373262658" y1="473.26858732164" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="233.98373262658" x2="252.65429350673" y1="484.04882276804" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="214" x2="214" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="214" x2="214" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="218" x2="218" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="218" x2="218" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="233.98373262658" y1="430.14458904743" y2="419.36435360104" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="233.98373262658" x2="252.65429350673" y1="419.36435360104" y2="408.58411815464" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="177.96899349749" x2="196.64108262196" y1="494.82905821443" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="196.64108262196" x2="215.31317174643" y1="484.04882276804" y2="473.26858732164" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252.65429350673" x2="252.65429350673" y1="537.95" y2="516.38952910721" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="252.65429350673" x2="252.65429350673" y1="516.38952910721" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 216,344 175,360 182,372" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<polygon points=" 216,301 182,274 175,285" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="176" x2="176" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="176" x2="176" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="181" x2="181" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="181" x2="181" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140.62481524854" x2="159.29690437302" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="159.29690437302" x2="177.96899349749" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140.62481524854" x2="140.62481524854" y1="171.41588184536" y2="192.97635273814" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140.62481524854" x2="140.62481524854" y1="192.97635273814" y2="214.53682363093" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="177.96899349749" x2="159.29690437302" y1="149.85541095257" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="159.29690437302" x2="140.62481524854" y1="160.63564639896" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="215.31317174643" x2="196.64108262196" y1="171.41588184536" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="196.64108262196" x2="177.96899349749" y1="160.63564639896" y2="149.85541095257" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="209.64644180098" x2="212.47980677371" y1="214.81190760886" y2="193.11389472711" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="212.47980677371" x2="215.31317174643" y1="193.11389472711" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="209.64644180098" x2="193.80771764923" y1="214.81190760886" y2="225.45460106629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="193.80771764923" x2="177.96899349749" y1="225.45460106629" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 216,172 256,156 250,145" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="292" x2="273" y1="170" y2="159" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="273" x2="254" y1="159" y2="148" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="289" x2="270.5" y1="174" y2="163" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="270.5" x2="252" y1="163" y2="152" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="327.34570649327" x2="308.67361736879" y1="149.85541095257" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="308.67361736879" x2="290.00152824432" y1="160.63564639896" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="326" x2="326" y1="107" y2="128.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="326" x2="326" y1="128.5" y2="150" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="330" x2="330" y1="107" y2="128.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="330" x2="330" y1="128.5" y2="150" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="308.67361736879" y1="85.170941785571" y2="95.951177231964" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="308.67361736879" x2="327.34570649327" y1="95.951177231964" y2="106.73141267836" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="254" x2="273" y1="109" y2="98.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="273" x2="292" y1="98.5" y2="88" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252" x2="270.5" y1="105" y2="94.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="270.5" x2="289" y1="94.5" y2="84" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252.65429350673" x2="252.65429350673" y1="106.73141267836" y2="128.29341181546" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="252.65429350673" x2="252.65429350673" y1="128.29341181546" y2="149.85541095257" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="290.00152824432" y1="42.05" y2="63.610470892786" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="290.00152824432" x2="290.00152824432" y1="63.610470892786" y2="85.170941785571" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="364.68988474221" x2="346.01779561774" y1="85.170941785571" y2="95.951177231964" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="346.01779561774" x2="327.34570649327" y1="95.951177231964" y2="106.73141267836" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<polygon points=" 178,150 185,107 172,107" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="105" x2="123.5" y1="239" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="123.5" x2="142" y1="228" y2="217" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="103" x2="121.5" y1="235" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="121.5" x2="140" y1="224" y2="213" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="103.27758051096" x2="103.27758051096" y1="279.22129279793" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="103.27758051096" x2="103.27758051096" y1="257.65929366082" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="142" x2="123.5" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="123.5" x2="105" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140" x2="121.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="121.5" x2="103" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140.62481524854" x2="159.29690437302" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="159.29690437302" x2="177.96899349749" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="140.62481524854" x2="140.62481524854" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="140.62481524854" x2="140.62481524854" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="65.933402262011" x2="84.605491386483" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="84.605491386483" x2="103.27758051096" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="251" x2="251" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="251" x2="251" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="255" x2="255" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="255" x2="255" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="290.00152824432" x2="271.32791087553" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="271.32791087553" x2="252.65429350673" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="329" x2="310.5" y1="235" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="310.5" x2="292" y1="224" y2="213" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="327" x2="308" y1="239" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="308" x2="289" y1="228" y2="217" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="327.34570649327" x2="327.34570649327" y1="236.09729452371" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="327.34570649327" x2="327.34570649327" y1="257.65929366082" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="359.6833563438" x2="343.51453141853" y1="216.53882369256" y2="226.31805910814" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="343.51453141853" x2="327.34570649327" y1="226.31805910814" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="225.51267435052" x2="239.08348392863" y1="214.04778544793" y2="225.07253998582" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="239.08348392863" x2="252.65429350673" y1="225.07253998582" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="402.0371194798" x2="402.0371194798" y1="236.09729452371" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="402.0371194798" x2="402.0371194798" y1="257.65929366082" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="439" x2="420" y1="213" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="420" x2="401" y1="224" y2="235" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="441" x2="422.5" y1="217" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="422.5" x2="404" y1="228" y2="239" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="476.72241948904" x2="458.05033036457" y1="236.09729452371" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="458.05033036457" x2="439.3782412401" y1="225.31705907732" y2="214.53682363093" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="479" x2="479" y1="280" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="479" x2="479" y1="258.5" y2="237" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="475" x2="475" y1="280" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="475" x2="475" y1="258.5" y2="237" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="476.72241948904" x2="458.05033036457" y1="279.22129279793" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="458.05033036457" x2="439.3782412401" y1="290.00152824432" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="514.06659773799" x2="495.39450861352" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="495.39450861352" x2="476.72241948904" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<line x1="374.69988505039" x2="388.36850226509" y1="210.5358799963" y2="223.31658726001" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" />
<line x1="388.36850226509" x2="402.0371194798" y1="223.31658726001" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" />
<ellipse cx="439.3782412401" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="439.3782412401" y="353.88886040386"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="476.72241948904" cy="494.82905821443" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="476.72241948904" y="504.81521314201"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="402.0371194798" cy="537.95" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="402.0371194798" y="547.93615492758"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="327.34570649327" cy="365.46317636907" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.34570649327" y="375.44933129665"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="290.00152824432" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00152824432" y="353.88886040386"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="177.96899349749" cy="494.82905821443" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="504.81521314201"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="252.65429350673" cy="537.95" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.65429350673" y="547.93615492758"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="177.96899349749" cy="365.46317636907" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="375.44933129665"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="209.64644180098" cy="214.81190760886" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.64644180098" y="224.79806253644"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="290.00152824432" cy="42.05" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00152824432" y="52.036154927579"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="364.68988474221" cy="85.170941785571" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.68988474221" y="95.15709671315"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="177.96899349749" cy="106.73141267836" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="116.71756760594"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="140.62481524854" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="140.62481524854" y="353.88886040386"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="65.933402262011" cy="214.53682363093" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="65.933402262011" y="224.52297855851"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="359.6833563438" cy="216.53882369256" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.6833563438" y="226.52497862014"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="225.51267435052" cy="214.04778544793" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.51267435052" y="224.03394037551"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="514.06659773799" cy="214.53682363093" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="514.06659773799" y="224.52297855851"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>
<ellipse cx="374.69988505039" cy="210.5358799963" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="374.69988505039" y="220.52203492388"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:22.695806653588px">O</text>


2021-08-01, 266👍, 0💬