Collections:
Molecule FYI-1000463
Molecule Summary:
ID: FYI-1000463
SMILES: c12c([C@H]([C@@H]([C@H](O1)c1ccc(c(c1)O)O)O)c1c3c([C@@H]([C@@H]([C@H](O3)c3ccc(c(c3)O)O)O)c3c4c(C[C@H]([C@H](O4)c4ccc(c(c4)O)O)O)c(cc3O)O)c(cc1O)O)c(cc(c2)O)O
Received at FYIcenter.com on: 2021-07-16
Molecule Structure Displayed in 2D:
Molecule Structure SDF File:
FYI-1000463 FYIcenter.com 63 71 0 0 1 0 0 0 0 0999 V2000 12.2181 8.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7745 8.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7745 9.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 10.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2181 9.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 11.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7745 12.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.7745 14.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 14.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2181 14.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2181 12.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4399 14.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 16.2245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 10.5812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 8.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8873 8.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8873 9.8758 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 10.5812 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 9.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 11.9920 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 12.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 14.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 14.8137 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8873 14.1083 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8873 12.6974 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 14.8137 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 16.2245 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 10.5812 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4437 5.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4437 4.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 3.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8873 4.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 4.7019 5.6523 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 3.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 4.2325 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 3.5271 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 2.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 1.4108 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 2.1162 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 0.0000 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 9.7745 1.4108 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 3.6655 2.1162 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 1.2218 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 1.2218 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4437 8.4650 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4437 9.8758 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 0.0000 5.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 6.1090 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 7.3309 5.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 8.5527 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 9.6107 5.7088 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 5.2210 5.6273 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.9964 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 12.2181 5.6433 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4399 6.3487 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 13.4399 7.7596 0.0000 C 0 0 0 0 0 0 0 0 0 0 0 0 14.6617 5.6433 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 10.1020 5.5124 0.0000 O 0 0 0 0 0 0 0 0 0 0 0 0 2 1 2 0 0 0 0 3 2 1 0 0 0 0 4 3 1 0 0 0 0 5 4 1 0 0 0 0 6 5 1 0 0 0 0 6 1 1 0 0 0 0 5 7 1 1 0 0 0 8 7 2 0 0 0 0 9 8 1 0 0 0 0 10 9 2 0 0 0 0 11 10 1 0 0 0 0 12 11 2 0 0 0 0 12 7 1 0 0 0 0 13 11 1 0 0 0 0 14 10 1 0 0 0 0 4 15 1 6 0 0 0 3 16 1 1 0 0 0 17 16 2 0 0 0 0 18 17 1 0 0 0 0 19 18 1 0 0 0 0 20 19 1 0 0 0 0 21 20 1 0 0 0 0 22 21 1 0 0 0 0 22 17 1 0 0 0 0 21 23 1 1 0 0 0 24 23 2 0 0 0 0 25 24 1 0 0 0 0 26 25 2 0 0 0 0 27 26 1 0 0 0 0 28 27 2 0 0 0 0 28 23 1 0 0 0 0 29 27 1 0 0 0 0 30 26 1 0 0 0 0 20 31 1 6 0 0 0 19 32 1 6 0 0 0 33 32 2 0 0 0 0 34 33 1 0 0 0 0 35 34 1 0 0 0 0 36 35 1 0 0 0 0 37 36 1 0 0 0 0 38 37 1 0 0 0 0 38 33 1 0 0 0 0 37 39 1 6 0 0 0 40 39 2 0 0 0 0 41 40 1 0 0 0 0 42 41 2 0 0 0 0 43 42 1 0 0 0 0 44 43 2 0 0 0 0 44 39 1 0 0 0 0 45 43 1 0 0 0 0 46 42 1 0 0 0 0 36 47 1 6 0 0 0 48 34 2 0 0 0 0 49 48 1 0 0 0 0 50 49 2 0 0 0 0 50 32 1 0 0 0 0 51 50 1 0 0 0 0 52 48 1 0 0 0 0 53 18 2 0 0 0 0 54 53 1 0 0 0 0 55 54 2 0 0 0 0 55 16 1 0 0 0 0 56 55 1 0 0 0 0 57 53 1 0 0 0 0 58 2 1 0 0 0 0 59 58 2 0 0 0 0 60 59 1 0 0 0 0 61 60 2 0 0 0 0 61 1 1 0 0 0 0 62 60 1 0 0 0 0 63 58 1 0 0 0 0 M END $$$$
Molecule Structure SVG File:
<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" "http://www.w3.org/Graphics/SVG/1.1/DTD/svg11.dtd"><svg width="100%" height="100%" version="1.1" xmlns="http://www.w3.org/2000/svg"><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="401" x2="420" y1="282" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="420" x2="439" y1="292.5" y2="303" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="404" x2="422.5" y1="278" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="422.5" x2="441" y1="288.5" y2="299" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="383.36350211101" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="383.36350211101" x2="402.0371194798" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="364.68988474221" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="364.68988474221" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="402.0371194798" x2="383.36350211101" y1="365.46317636907" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="383.36350211101" x2="364.68988474221" y1="354.68294092268" y2="343.90270547629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="439.3782412401" x2="420.70768035995" y1="343.90270547629" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="420.70768035995" x2="402.0371194798" y1="354.68294092268" y2="365.46317636907" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="439.3782412401" x2="439.3782412401" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="439.3782412401" x2="439.3782412401" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 403,366 396,409 409,409" fill-opacity="1" style="fill:#000000" /> <line x1="366" x2="385" y1="433" y2="422" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="385" x2="404" y1="422" y2="411" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364" x2="382.5" y1="429" y2="418" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="382.5" x2="401" y1="418" y2="407" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="364.68988474221" y1="473.26858732164" y2="451.70658818454" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="364.68988474221" y1="451.70658818454" y2="430.14458904743" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="404" x2="385" y1="493" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="385" x2="366" y1="482.5" y2="472" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="401" x2="382.5" y1="497" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="382.5" x2="364" y1="486.5" y2="476" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="439.3782412401" x2="420.70768035995" y1="473.26858732164" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="420.70768035995" x2="402.0371194798" y1="484.04882276804" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="438" x2="438" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="438" x2="438" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="442" x2="442" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="442" x2="442" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="439.3782412401" x2="420.70768035995" y1="430.14458904743" y2="419.36435360104" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="420.70768035995" x2="402.0371194798" y1="419.36435360104" y2="408.58411815464" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="476.72241948904" x2="458.05033036457" y1="494.82905821443" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="458.05033036457" x2="439.3782412401" y1="484.04882276804" y2="473.26858732164" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="402.0371194798" x2="402.0371194798" y1="537.95" y2="516.38952910721" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="402.0371194798" x2="402.0371194798" y1="516.38952910721" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 365,344 325,360 331,372" fill-opacity="1" style="fill:none;stroke:#000000;" /> <polygon points=" 365,301 331,274 325,285" fill-opacity="1" style="fill:#000000" /> <line x1="292" x2="310.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="310.5" x2="329" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="289" x2="308" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="308" x2="327" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252.65429350673" x2="271.32791087553" y1="279.22129279793" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="271.32791087553" x2="290.00152824432" y1="290.00152824432" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="233.98373262658" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="233.98373262658" x2="252.65429350673" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="215.31317174643" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="215.31317174643" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252.65429350673" x2="233.98373262658" y1="365.46317636907" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="233.98373262658" x2="215.31317174643" y1="354.68294092268" y2="343.90270547629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="271.32791087553" y1="343.90270547629" y2="354.68294092268" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="271.32791087553" x2="252.65429350673" y1="354.68294092268" y2="365.46317636907" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="290.00152824432" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="290.00152824432" x2="290.00152824432" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 253,366 247,409 260,409" fill-opacity="1" style="fill:#000000" /> <line x1="292" x2="273" y1="429" y2="418" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="273" x2="254" y1="418" y2="407" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="289" x2="270.5" y1="433" y2="422" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="270.5" x2="252" y1="422" y2="411" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="290.00152824432" y1="473.26858732164" y2="451.70658818454" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="290.00152824432" y1="451.70658818454" y2="430.14458904743" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="254" x2="273" y1="497" y2="486.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="273" x2="292" y1="486.5" y2="476" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252" x2="270.5" y1="493" y2="482.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="270.5" x2="289" y1="482.5" y2="472" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="233.98373262658" y1="473.26858732164" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="233.98373262658" x2="252.65429350673" y1="484.04882276804" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="214" x2="214" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="214" x2="214" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="218" x2="218" y1="431" y2="452.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="218" x2="218" y1="452.5" y2="474" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="233.98373262658" y1="430.14458904743" y2="419.36435360104" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="233.98373262658" x2="252.65429350673" y1="419.36435360104" y2="408.58411815464" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="177.96899349749" x2="196.64108262196" y1="494.82905821443" y2="484.04882276804" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="196.64108262196" x2="215.31317174643" y1="484.04882276804" y2="473.26858732164" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252.65429350673" x2="252.65429350673" y1="537.95" y2="516.38952910721" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="252.65429350673" x2="252.65429350673" y1="516.38952910721" y2="494.82905821443" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 216,344 175,360 182,372" fill-opacity="1" style="fill:none;stroke:#000000;" /> <polygon points=" 216,301 182,274 175,285" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="176" x2="176" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="176" x2="176" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="181" x2="181" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="181" x2="181" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140.62481524854" x2="159.29690437302" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="159.29690437302" x2="177.96899349749" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140.62481524854" x2="140.62481524854" y1="171.41588184536" y2="192.97635273814" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140.62481524854" x2="140.62481524854" y1="192.97635273814" y2="214.53682363093" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="177.96899349749" x2="159.29690437302" y1="149.85541095257" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="159.29690437302" x2="140.62481524854" y1="160.63564639896" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="215.31317174643" x2="196.64108262196" y1="171.41588184536" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="196.64108262196" x2="177.96899349749" y1="160.63564639896" y2="149.85541095257" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="209.64644180098" x2="212.47980677371" y1="214.81190760886" y2="193.11389472711" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="212.47980677371" x2="215.31317174643" y1="193.11389472711" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="209.64644180098" x2="193.80771764923" y1="214.81190760886" y2="225.45460106629" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="193.80771764923" x2="177.96899349749" y1="225.45460106629" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 216,172 256,156 250,145" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="292" x2="273" y1="170" y2="159" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="273" x2="254" y1="159" y2="148" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="289" x2="270.5" y1="174" y2="163" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="270.5" x2="252" y1="163" y2="152" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="327.34570649327" x2="308.67361736879" y1="149.85541095257" y2="160.63564639896" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="308.67361736879" x2="290.00152824432" y1="160.63564639896" y2="171.41588184536" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="326" x2="326" y1="107" y2="128.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="326" x2="326" y1="128.5" y2="150" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="330" x2="330" y1="107" y2="128.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="330" x2="330" y1="128.5" y2="150" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="308.67361736879" y1="85.170941785571" y2="95.951177231964" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="308.67361736879" x2="327.34570649327" y1="95.951177231964" y2="106.73141267836" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="254" x2="273" y1="109" y2="98.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="273" x2="292" y1="98.5" y2="88" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252" x2="270.5" y1="105" y2="94.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="270.5" x2="289" y1="94.5" y2="84" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252.65429350673" x2="252.65429350673" y1="106.73141267836" y2="128.29341181546" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="252.65429350673" x2="252.65429350673" y1="128.29341181546" y2="149.85541095257" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="290.00152824432" y1="42.05" y2="63.610470892786" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="290.00152824432" x2="290.00152824432" y1="63.610470892786" y2="85.170941785571" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="364.68988474221" x2="346.01779561774" y1="85.170941785571" y2="95.951177231964" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="346.01779561774" x2="327.34570649327" y1="95.951177231964" y2="106.73141267836" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <polygon points=" 178,150 185,107 172,107" fill-opacity="1" style="fill:none;stroke:#000000;" /> <line x1="105" x2="123.5" y1="239" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="123.5" x2="142" y1="228" y2="217" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="103" x2="121.5" y1="235" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="121.5" x2="140" y1="224" y2="213" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="103.27758051096" x2="103.27758051096" y1="279.22129279793" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="103.27758051096" x2="103.27758051096" y1="257.65929366082" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="142" x2="123.5" y1="299" y2="288.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="123.5" x2="105" y1="288.5" y2="278" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140" x2="121.5" y1="303" y2="292.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="121.5" x2="103" y1="292.5" y2="282" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140.62481524854" x2="159.29690437302" y1="300.78176369071" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="159.29690437302" x2="177.96899349749" y1="290.00152824432" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="140.62481524854" x2="140.62481524854" y1="343.90270547629" y2="322.3422345835" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="140.62481524854" x2="140.62481524854" y1="322.3422345835" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="65.933402262011" x2="84.605491386483" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="84.605491386483" x2="103.27758051096" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="251" x2="251" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="251" x2="251" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="255" x2="255" y1="237" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="255" x2="255" y1="258.5" y2="280" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="290.00152824432" x2="271.32791087553" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="271.32791087553" x2="252.65429350673" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="329" x2="310.5" y1="235" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="310.5" x2="292" y1="224" y2="213" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="327" x2="308" y1="239" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="308" x2="289" y1="228" y2="217" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="327.34570649327" x2="327.34570649327" y1="236.09729452371" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="327.34570649327" x2="327.34570649327" y1="257.65929366082" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="359.6833563438" x2="343.51453141853" y1="216.53882369256" y2="226.31805910814" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="343.51453141853" x2="327.34570649327" y1="226.31805910814" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="225.51267435052" x2="239.08348392863" y1="214.04778544793" y2="225.07253998582" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="239.08348392863" x2="252.65429350673" y1="225.07253998582" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="402.0371194798" x2="402.0371194798" y1="236.09729452371" y2="257.65929366082" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="402.0371194798" x2="402.0371194798" y1="257.65929366082" y2="279.22129279793" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="439" x2="420" y1="213" y2="224" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="420" x2="401" y1="224" y2="235" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="441" x2="422.5" y1="217" y2="228" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="422.5" x2="404" y1="228" y2="239" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="476.72241948904" x2="458.05033036457" y1="236.09729452371" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="458.05033036457" x2="439.3782412401" y1="225.31705907732" y2="214.53682363093" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="479" x2="479" y1="280" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="479" x2="479" y1="258.5" y2="237" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="475" x2="475" y1="280" y2="258.5" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="475" x2="475" y1="258.5" y2="237" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="476.72241948904" x2="458.05033036457" y1="279.22129279793" y2="290.00152824432" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="458.05033036457" x2="439.3782412401" y1="290.00152824432" y2="300.78176369071" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="514.06659773799" x2="495.39450861352" y1="214.53682363093" y2="225.31705907732" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="495.39450861352" x2="476.72241948904" y1="225.31705907732" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <line x1="374.69988505039" x2="388.36850226509" y1="210.5358799963" y2="223.31658726001" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #ff0000" /> <line x1="388.36850226509" x2="402.0371194798" y1="223.31658726001" y2="236.09729452371" style="stroke-opacity:1; stroke-width: 1.815664532287; stroke: #000000" /> <ellipse cx="439.3782412401" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="439.3782412401" y="353.88886040386" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="476.72241948904" cy="494.82905821443" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="476.72241948904" y="504.81521314201" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="402.0371194798" cy="537.95" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="402.0371194798" y="547.93615492758" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="327.34570649327" cy="365.46317636907" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="327.34570649327" y="375.44933129665" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="290.00152824432" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00152824432" y="353.88886040386" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="177.96899349749" cy="494.82905821443" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="504.81521314201" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="252.65429350673" cy="537.95" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="252.65429350673" y="547.93615492758" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="177.96899349749" cy="365.46317636907" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="375.44933129665" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="209.64644180098" cy="214.81190760886" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="209.64644180098" y="224.79806253644" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="290.00152824432" cy="42.05" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="290.00152824432" y="52.036154927579" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="364.68988474221" cy="85.170941785571" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="364.68988474221" y="95.15709671315" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="177.96899349749" cy="106.73141267836" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="177.96899349749" y="116.71756760594" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="140.62481524854" cy="343.90270547629" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="140.62481524854" y="353.88886040386" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="65.933402262011" cy="214.53682363093" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="65.933402262011" y="224.52297855851" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="359.6833563438" cy="216.53882369256" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.6833563438" y="226.52497862014" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="225.51267435052" cy="214.04778544793" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="225.51267435052" y="224.03394037551" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="514.06659773799" cy="214.53682363093" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="514.06659773799" y="224.52297855851" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> <ellipse cx="374.69988505039" cy="210.5358799963" rx="11.801819459866" ry="11.801819459866" fill-opacity="1" style="fill:#ffffff"/> <text fill-opacity="1" id="TextElement" transform="rotate(0)" x="374.69988505039" y="220.52203492388" fill="#ff0000" style="text-anchor:middle; font-family:sans-serif;font-size:22.695806653588px">O</text> </g></svg>
✍: FYIcenter.com
2021-08-01, 266👍, 0💬
Popular Posts:
How to use Wildcard Bond in a substructure search using "babel" commands? You can use "~" in a SMART...
What is chem.nlm.nih.gov ChemIDplus Database? chem.nlm.nih.gov ChemIDplus Database contains over 108...
How to download and instal Open Babel from source code on CentOS computers? I want to build the bina...
Collections: Atoms and Elements Molecule FAQ SDF/Mol File FAQ Open Babel Tutorials PyMol Tutorials J...
What IS JSME, Molecule Editor in JavaScript? JSME, Molecule Editor in JavaScript is a free molecule ...