Molecule FYI-1000457


Molecule Summary:

ID: FYI-1000457
SMILES: Nc3nc1c(NCN1[C@@H]2O[C@H](COP(=O)([O-])OP(=O)([O-])OC[C@H](O)C(=O)[O-])[C@@H](O)[C@H]2O)c(=O)[nH]3

Received at on: 2021-07-12

Molecule Structure Displayed in 2D:

Molecule Structure SDF File:


 52 54  0  0  1  0  0  0  0  0999 V2000
    2.5369   -3.9206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030   -4.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -3.9206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350   -4.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    5.1350   -5.4206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0812   -5.7253    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.6648   -4.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.0812   -4.1158    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    6.3919   -3.1653    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.7794   -3.2613    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.8055   -2.3553    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.3947   -1.5473    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    5.7825   -1.4492    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.0873   -0.5957    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.7577    0.1463    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.4504    1.0979    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    5.4988    0.7905    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.4020    1.4052    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    6.1430    2.0495    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.8134    2.7914    0.0000 P   0  0  0  0  0  0  0  0  0  0  0  0
    7.5554    2.1210    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    6.0714    3.4619    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    7.4838    3.5334    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.1765    4.4850    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    7.8469    5.2270    0.0000 C   0  0  2  0  0  0  0  0  0  0  0  0
    8.0374    4.6370    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.8247    5.0174    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.5395    6.1786    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    6.5617    6.3882    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    8.2099    6.9206    0.0000 O   0  5  0  0  0  0  0  0  0  0  0  0
    7.3452   -1.8580    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.2493   -1.2454    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1552   -1.2716    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    7.3435   -2.8580    0.0000 C   0  0  1  0  0  0  0  0  0  0  0  0
    7.2454   -3.4702    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.1515   -3.4471    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -5.9206    0.0000 C   0  0  0  0  0  0  0  0  0  0  0  0
    4.2690   -6.9206    0.0000 O   0  0  0  0  0  0  0  0  0  0  0  0
    3.4030   -5.4206    0.0000 N   0  0  0  0  0  0  0  0  0  0  0  0
    2.8660   -5.7306    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.0000   -4.2306    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    2.5369   -3.3006    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.2738   -6.3146    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1257   -5.3353    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    7.1257   -4.5059    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.7065   -0.1065    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    5.5394   -0.8858    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.7956    4.9742    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    6.6285    4.1949    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    9.2403    5.4774    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7212   -1.5247    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
    8.7183   -3.1959    0.0000 H   0  0  0  0  0  0  0  0  0  0  0  0
  1  2  1  0  0  0  0
  2  3  2  0  0  0  0
  3  4  1  0  0  0  0
  4  5  2  0  0  0  0
  5  6  1  0  0  0  0
  6  7  1  0  0  0  0
  7  8  1  0  0  0  0
  4  8  1  0  0  0  0
  9  8  1  6  0  0  0
  9 10  1  0  0  0  0
  9 11  1  0  0  0  0
 11 12  1  0  0  0  0
 12 13  1  0  0  0  0
 12 14  1  6  0  0  0
 14 15  1  0  0  0  0
 15 16  1  0  0  0  0
 16 17  2  0  0  0  0
 16 18  1  0  0  0  0
 16 19  1  0  0  0  0
 19 20  1  0  0  0  0
 20 21  2  0  0  0  0
 20 22  1  0  0  0  0
 20 23  1  0  0  0  0
 23 24  1  0  0  0  0
 24 25  1  0  0  0  0
 25 26  1  0  0  0  0
 25 27  1  1  0  0  0
 25 28  1  0  0  0  0
 28 29  2  0  0  0  0
 28 30  1  0  0  0  0
 12 31  1  0  0  0  0
 31 32  1  0  0  0  0
 31 33  1  1  0  0  0
 31 34  1  0  0  0  0
 34 35  1  0  0  0  0
  9 34  1  0  0  0  0
 34 36  1  1  0  0  0
  5 37  1  0  0  0  0
 37 38  2  0  0  0  0
 37 39  1  0  0  0  0
 39 40  1  0  0  0  0
  2 39  1  0  0  0  0
  1 41  1  0  0  0  0
  1 42  1  0  0  0  0
  6 43  1  0  0  0  0
  7 44  1  0  0  0  0
  7 45  1  0  0  0  0
 14 46  1  0  0  0  0
 14 47  1  0  0  0  0
 24 48  1  0  0  0  0
 24 49  1  0  0  0  0
 27 50  1  0  0  0  0
 33 51  1  0  0  0  0
 36 52  1  0  0  0  0

Molecule Structure SVG File:

<?xml version="1.0" standalone="no"?><!DOCTYPE svg PUBLIC "-//W3C//DTD SVG 1.1//EN" ""><svg width="100%" height="100%" version="1.1" xmlns=""><g id='0' transform='scale(1) translate(0,0) scale(1)'><line x1="179.53387892668" x2="195.04911568361" y1="149.53345519175" y2="140.57650059243" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="195.04911568361" x2="210.56435244054" y1="140.57650059243" y2="131.61954599312" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="210" x2="225.5" y1="134" y2="143" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="225.5" x2="241" y1="143" y2="152" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="212" x2="227.5" y1="130" y2="139" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="227.5" x2="243" y1="139" y2="148" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="241.59124317256" x2="257.10468853857" y1="149.53345519175" y2="140.57650059243" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="257.10468853857" x2="272.61813390457" y1="140.57650059243" y2="131.61954599312" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="275" x2="275" y1="132" y2="114" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="275" x2="275" y1="114" y2="96" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="271" x2="271" y1="132" y2="114" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="271" x2="271" y1="114" y2="96" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="272.61813390457" x2="289.56827478831" y1="95.791727595873" y2="90.333359463052" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="289.56827478831" x2="306.51841567205" y1="90.333359463052" y2="84.874991330231" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="306.51841567205" x2="316.97297308037" y1="84.874991330231" y2="99.290314062365" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="316.97297308037" x2="327.42753048869" y1="99.290314062365" y2="113.7056367945" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="327.42753048869" x2="316.97297308037" y1="113.7056367945" y2="128.12275091755" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="316.97297308037" x2="306.51841567205" y1="128.12275091755" y2="142.5398650406" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="272.61813390457" x2="289.56827478831" y1="131.61954599312" y2="137.07970551686" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="289.56827478831" x2="306.51841567205" y1="137.07970551686" y2="142.5398650406" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<polygon points=" 318,177 312,141 302,145" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="317.65011884808" x2="307.145402494" y1="176.59420642719" y2="191.10447287807" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="307.145402494" x2="296.64068613993" y1="191.10447287807" y2="205.61473932896" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="296.64068613993" x2="307.19556143976" y1="205.61473932896" y2="220.08917796145" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="307.19556143976" x2="317.75043673959" y1="220.08917796145" y2="234.56361659394" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<polygon points=" 318,235 302,268 312,271" fill-opacity="1"  style="fill:none;stroke:#000000;" />
<line x1="306.73696536427" x2="318.74645009103" y1="268.65736858076" y2="281.94948920614" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="318.74645009103" x2="330.75593481779" y1="281.94948920614" y2="295.24160983152" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="330.75593481779" x2="325.25099052105" y1="295.24160983152" y2="312.28848582493" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="325.25099052105" x2="319.74604622432" y1="312.28848582493" y2="329.33536181834" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="321" x2="304" y1="328" y2="322.5" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="304" x2="287" y1="322.5" y2="317" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="320" x2="303" y1="332" y2="326.5" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="303" x2="286" y1="326.5" y2="321" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="319.74604622432" x2="336.79292221773" y1="329.33536181834" y2="334.84030611508" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="336.79292221773" x2="353.83979821114" y1="334.84030611508" y2="340.34525041181" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="319.74604622432" x2="314.23931053666" y1="329.33536181834" y2="346.38223781175" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="314.23931053666" x2="308.732574849" y1="346.38223781175" y2="363.42911380516" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="308.732574849" x2="320.74205957576" y1="363.42911380516" y2="376.71944303962" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="320.74205957576" x2="332.75154430252" y1="376.71944303962" y2="390.00977227408" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="335" x2="348" y1="392" y2="380" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="348" x2="361" y1="380" y2="368" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="332" x2="345.5" y1="389" y2="377" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="345.5" x2="359" y1="377" y2="365" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="332.75154430252" x2="319.45942367714" y1="390.00977227408" y2="402.02104839176" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="319.45942367714" x2="306.16730305176" y1="402.02104839176" y2="414.03232450944" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="332.75154430252" x2="344.76102902927" y1="390.00977227408" y2="403.30189289946" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #c8aa1a" />
<line x1="344.76102902927" x2="356.77051375603" y1="403.30189289946" y2="416.59401352484" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="356.77051375603" x2="351.2655694593" y1="416.59401352484" y2="433.64088951825" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="351.2655694593" x2="345.76062516256" y1="433.64088951825" y2="450.68776551166" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="345.76062516256" x2="357.77010988932" y1="450.68776551166" y2="463.97988613704" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="357.77010988932" x2="369.77959461607" y1="463.97988613704" y2="477.27200676242" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<polygon points=" 370,478 406,476 404,465" fill-opacity="1"  style="fill:#000000" />
<line x1="369.77959461607" x2="364.27285892842" y1="477.27200676242" y2="494.31888275583" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="364.27285892842" x2="358.76612324076" y1="494.31888275583" y2="511.36575874924" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="359" x2="341.5" y1="510" y2="514" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="341.5" x2="324" y1="514" y2="518" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="360" x2="342.5" y1="514" y2="517.5" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="342.5" x2="325" y1="517.5" y2="521" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="358.76612324076" x2="370.77560796752" y1="511.36575874924" y2="524.65787937462" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="370.77560796752" x2="382.78509269428" y1="524.65787937462" y2="537.95" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="317.75043673959" x2="334.77760743288" y1="234.56361659394" y2="228.99776500592" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="334.77760743288" x2="351.80477812617" y1="228.99776500592" y2="223.43191341791" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<polygon points=" 352,224 378,249 384,241" fill-opacity="1"  style="fill:#000000" />
<line x1="351.80477812617" x2="351.77432448054" y1="223.43191341791" y2="205.51800421929" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="351.77432448054" x2="351.7438708349" y1="205.51800421929" y2="187.60409502066" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="317.65011884808" x2="334.69699484149" y1="176.59420642719" y2="182.09915072393" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="334.69699484149" x2="351.7438708349" y1="182.09915072393" y2="187.60409502066" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<polygon points=" 352,188 384,171 378,163" fill-opacity="1"  style="fill:#000000" />
<line x1="272.61813390457" x2="257.10468853857" y1="95.791727595873" y2="86.834772996561" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="257.10468853857" x2="241.59124317256" y1="86.834772996561" y2="77.877818397249" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="244" x2="244" y1="78" y2="60.5" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="244" x2="244" y1="60.5" y2="43" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="240" x2="240" y1="78" y2="60.5" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="240" x2="240" y1="60.5" y2="43" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="241.59124317256" x2="226.07779780655" y1="77.877818397249" y2="86.834772996561" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="226.07779780655" x2="210.56435244054" y1="86.834772996561" y2="95.791727595873" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="210.56435244054" x2="200.94458320088" y1="95.791727595873" y2="90.2384157443" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="200.94458320088" x2="191.32481396122" y1="90.2384157443" y2="84.685103892726" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="210.56435244054" x2="210.56435244054" y1="131.61954599312" y2="113.7056367945" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #000000" />
<line x1="210.56435244054" x2="210.56435244054" y1="113.7056367945" y2="95.791727595873" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="179.53387892668" x2="169.91590107794" y1="149.53345519175" y2="143.98014334017" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="169.91590107794" x2="160.2979232292" y1="143.98014334017" y2="138.4268314886" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="179.53387892668" x2="179.53387892668" y1="149.53345519175" y2="160.64007889489" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="179.53387892668" x2="179.53387892668" y1="160.64007889489" y2="171.74670259804" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="306.51841567205" x2="309.96863458371" y1="84.874991330231" y2="74.318324639482" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #0000ff" />
<line x1="309.96863458371" x2="313.41885349536" y1="74.318324639482" y2="63.761657948733" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="404.8120354449" x2="412.25705610785" y1="469.76249602636" y2="478.00289425772" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="412.25705610785" x2="419.7020767708" y1="478.00289425772" y2="486.24329248909" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="380.82531102795" x2="390.96458363437" y1="244.44134612606" y2="239.90733570789" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="390.96458363437" x2="401.10385624079" y1="239.90733570789" y2="235.37332528971" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<line x1="380.69274809988" x2="390.84635183366" y1="166.49792720284" y2="170.99790119354" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #ff0000" />
<line x1="390.84635183366" x2="400.99995556744" y1="170.99790119354" y2="175.49787518423" style="stroke-opacity:1; stroke-width: 1.5085391825557; stroke: #a4a4a4" />
<ellipse cx="179.53387892668" cy="149.53345519175" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="179.53387892668" y="157.8304206958"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">N</text>
<ellipse cx="241.59124317256" cy="149.53345519175" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="241.59124317256" y="157.8304206958"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">N</text>
<ellipse cx="306.51841567205" cy="84.874991330231" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.51841567205" y="93.171956834288"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">N</text>
<ellipse cx="306.51841567205" cy="142.5398650406" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.51841567205" y="150.83683054466"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">N</text>
<ellipse cx="296.64068613993" cy="205.61473932896" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="296.64068613993" y="213.91170483302"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="330.75593481779" cy="295.24160983152" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="330.75593481779" y="303.53857533557"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="319.74604622432" cy="329.33536181834" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="319.74604622432" y="337.6323273224"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">P</text>
<ellipse cx="285.65229423749" cy="318.32189044303" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="285.65229423749" y="326.61885594708"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="353.83979821114" cy="340.34525041181" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="353.83979821114" y="348.64221591587"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O<tspan baseline-shift='super' font-size='9.4283698909734'>-</tspan></text>
<ellipse cx="308.732574849" cy="363.42911380516" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="308.732574849" y="371.72607930922"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="332.75154430252" cy="390.00977227408" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="332.75154430252" y="398.30673777814"  fill="#c8aa1a" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">P</text>
<ellipse cx="359.33578555328" cy="365.99080282056" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="359.33578555328" y="374.28776832462"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="306.16730305176" cy="414.03232450944" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="306.16730305176" y="422.32929001349"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O<tspan baseline-shift='super' font-size='9.4283698909734'>-</tspan></text>
<ellipse cx="356.77051375603" cy="416.59401352484" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="356.77051375603" y="424.8909790289"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="404.8120354449" cy="469.76249602636" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="404.8120354449" y="478.05946153041"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="323.73368241193" cy="518.8752694853" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="323.73368241193" y="527.17223498936"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="382.78509269428" cy="537.95" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="382.78509269428" y="546.24696550406"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O<tspan baseline-shift='super' font-size='9.4283698909734'>-</tspan></text>
<ellipse cx="380.82531102795" cy="244.44134612606" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="380.82531102795" y="252.73831163012"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="380.69274809988" cy="166.49792720284" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="380.69274809988" y="174.7948927069"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="241.59124317256" cy="42.05" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="241.59124317256" y="50.346965504057"  fill="#ff0000" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">O</text>
<ellipse cx="210.56435244054" cy="95.791727595873" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="210.56435244054" y="104.08869309993"  fill="#0000ff" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">N</text>
<ellipse cx="191.32481396122" cy="84.685103892726" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="191.32481396122" y="92.982069396783"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="160.2979232292" cy="138.4268314886" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="160.2979232292" y="146.72379699266"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="179.53387892668" cy="171.74670259804" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="179.53387892668" y="180.0436681021"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="313.41885349536" cy="63.761657948733" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="313.41885349536" y="72.058623452789"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="419.7020767708" cy="486.24329248909" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="419.7020767708" y="494.54025799315"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="401.10385624079" cy="235.37332528971" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="401.10385624079" y="243.67029079377"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>
<ellipse cx="400.99995556744" cy="175.49787518423" rx="9.8055046866124" ry="9.8055046866124" fill-opacity="1" style="fill:#ffffff"/>
<text fill-opacity="1" id="TextElement" transform="rotate(0)" x="400.99995556744" y="183.79484068829"  fill="#a4a4a4" style="text-anchor:middle;  font-family:sans-serif;font-size:18.856739781947px">H</text>


2021-10-02, 267👍, 0💬